%!PS-Adobe-2.0 %%Creator: dvips(k) 5.86 Copyright 1999 Radical Eye Software %%Title: tensor.dvi %%Pages: 22 %%PageOrder: Ascend %%BoundingBox: 0 0 596 842 %%DocumentFonts: XYATIP10 XYBTIP10 XYDASH10 %%EndComments %DVIPSWebPage: (www.radicaleye.com) %DVIPSCommandLine: dvips tensor.dvi -o tensor.ps %DVIPSParameters: dpi=600, compressed %DVIPSSource: TeX output 2000.05.02:1439 %%BeginProcSet: texc.pro %! /TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72 mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0 0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{ landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[ matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{ statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0] N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin /FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array /BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2 array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get }B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub} B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr 1 add N}if}B/id 0 N/rw 0 N/rc 0 N/gp 0 N/cp 0 N/G 0 N/CharBuilder{save 3 1 roll S A/base get 2 index get S/BitMaps get S get/Cd X pop/ctr 0 N Cdx 0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx sub Cy .1 sub]/id Ci N/rw Cw 7 add 8 idiv string N/rc 0 N/gp 0 N/cp 0 N{ rc 0 ne{rc 1 sub/rc X rw}{G}ifelse}imagemask restore}B/G{{id gp get/gp gp 1 add N A 18 mod S 18 idiv pl S get exec}loop}B/adv{cp add/cp X}B /chg{rw cp id gp 4 index getinterval putinterval A gp add/gp X adv}B/nd{ /cp 0 N rw exit}B/lsh{rw cp 2 copy get A 0 eq{pop 1}{A 255 eq{pop 254}{ A A add 255 and S 1 and or}ifelse}ifelse put 1 adv}B/rsh{rw cp 2 copy get A 0 eq{pop 128}{A 255 eq{pop 127}{A 2 idiv S 128 and or}ifelse} ifelse put 1 adv}B/clr{rw cp 2 index string putinterval adv}B/set{rw cp fillstr 0 4 index getinterval putinterval adv}B/fillstr 18 string 0 1 17 {2 copy 255 put pop}for N/pl[{adv 1 chg}{adv 1 chg nd}{1 add chg}{1 add chg nd}{adv lsh}{adv lsh nd}{adv rsh}{adv rsh nd}{1 add adv}{/rc X nd}{ 1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]A{bind pop} forall N/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn /BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put }if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{ bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{ SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{ userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X 1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4 index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N /p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{ /Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT) (LaserWriter 16/600)]{A length product length le{A length product exch 0 exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot} imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M} B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{ p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end %%EndProcSet %%BeginProcSet: texps.pro %! TeXDict begin/rf{findfont dup length 1 add dict begin{1 index/FID ne 2 index/UniqueID ne and{def}{pop pop}ifelse}forall[1 index 0 6 -1 roll exec 0 exch 5 -1 roll VResolution Resolution div mul neg 0 0]/Metrics exch def dict begin Encoding{exch dup type/integertype ne{pop pop 1 sub dup 0 le{pop}{[}ifelse}{FontMatrix 0 get div Metrics 0 get div def} ifelse}forall Metrics/Metrics currentdict end def[2 index currentdict end definefont 3 -1 roll makefont/setfont cvx]cvx def}def/ObliqueSlant{ dup sin S cos div neg}B/SlantFont{4 index mul add}def/ExtendFont{3 -1 roll mul exch}def/ReEncodeFont{CharStrings rcheck{/Encoding false def dup[exch{dup CharStrings exch known not{pop/.notdef/Encoding true def} if}forall Encoding{]exch pop}{cleartomark}ifelse}if/Encoding exch def} def end %%EndProcSet %%BeginProcSet: special.pro %! TeXDict begin/SDict 200 dict N SDict begin/@SpecialDefaults{/hs 612 N /vs 792 N/ho 0 N/vo 0 N/hsc 1 N/vsc 1 N/ang 0 N/CLIP 0 N/rwiSeen false N /rhiSeen false N/letter{}N/note{}N/a4{}N/legal{}N}B/@scaleunit 100 N /@hscale{@scaleunit div/hsc X}B/@vscale{@scaleunit div/vsc X}B/@hsize{ /hs X/CLIP 1 N}B/@vsize{/vs X/CLIP 1 N}B/@clip{/CLIP 2 N}B/@hoffset{/ho X}B/@voffset{/vo X}B/@angle{/ang X}B/@rwi{10 div/rwi X/rwiSeen true N}B /@rhi{10 div/rhi X/rhiSeen true N}B/@llx{/llx X}B/@lly{/lly X}B/@urx{ /urx X}B/@ury{/ury X}B/magscale true def end/@MacSetUp{userdict/md known {userdict/md get type/dicttype eq{userdict begin md length 10 add md maxlength ge{/md md dup length 20 add dict copy def}if end md begin /letter{}N/note{}N/legal{}N/od{txpose 1 0 mtx defaultmatrix dtransform S atan/pa X newpath clippath mark{transform{itransform moveto}}{transform{ itransform lineto}}{6 -2 roll transform 6 -2 roll transform 6 -2 roll transform{itransform 6 2 roll itransform 6 2 roll itransform 6 2 roll curveto}}{{closepath}}pathforall newpath counttomark array astore/gc xdf pop ct 39 0 put 10 fz 0 fs 2 F/|______Courier fnt invertflag{PaintBlack} if}N/txpose{pxs pys scale ppr aload pop por{noflips{pop S neg S TR pop 1 -1 scale}if xflip yflip and{pop S neg S TR 180 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip yflip not and{pop S neg S TR pop 180 rotate ppr 3 get ppr 1 get neg sub neg 0 TR}if yflip xflip not and{ppr 1 get neg ppr 0 get neg TR}if}{ noflips{TR pop pop 270 rotate 1 -1 scale}if xflip yflip and{TR pop pop 90 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip yflip not and{TR pop pop 90 rotate ppr 3 get ppr 1 get neg sub neg 0 TR}if yflip xflip not and{TR pop pop 270 rotate ppr 2 get ppr 0 get neg sub neg 0 S TR}if}ifelse scaleby96{ppr aload pop 4 -1 roll add 2 div 3 1 roll add 2 div 2 copy TR .96 dup scale neg S neg S TR}if}N/cp{pop pop showpage pm restore}N end}if}if}N/normalscale{ Resolution 72 div VResolution 72 div neg scale magscale{DVImag dup scale }if 0 setgray}N/psfts{S 65781.76 div N}N/startTexFig{/psf$SavedState save N userdict maxlength dict begin/magscale true def normalscale currentpoint TR/psf$ury psfts/psf$urx psfts/psf$lly psfts/psf$llx psfts /psf$y psfts/psf$x psfts currentpoint/psf$cy X/psf$cx X/psf$sx psf$x psf$urx psf$llx sub div N/psf$sy psf$y psf$ury psf$lly sub div N psf$sx psf$sy scale psf$cx psf$sx div psf$llx sub psf$cy psf$sy div psf$ury sub TR/showpage{}N/erasepage{}N/copypage{}N/p 3 def @MacSetUp}N/doclip{ psf$llx psf$lly psf$urx psf$ury currentpoint 6 2 roll newpath 4 copy 4 2 roll moveto 6 -1 roll S lineto S lineto S lineto closepath clip newpath moveto}N/endTexFig{end psf$SavedState restore}N/@beginspecial{SDict begin/SpecialSave save N gsave normalscale currentpoint TR @SpecialDefaults count/ocount X/dcount countdictstack N}N/@setspecial{ CLIP 1 eq{newpath 0 0 moveto hs 0 rlineto 0 vs rlineto hs neg 0 rlineto closepath clip}if ho vo TR hsc vsc scale ang rotate rwiSeen{rwi urx llx sub div rhiSeen{rhi ury lly sub div}{dup}ifelse scale llx neg lly neg TR }{rhiSeen{rhi ury lly sub div dup scale llx neg lly neg TR}if}ifelse CLIP 2 eq{newpath llx lly moveto urx lly lineto urx ury lineto llx ury lineto closepath clip}if/showpage{}N/erasepage{}N/copypage{}N newpath}N /@endspecial{count ocount sub{pop}repeat countdictstack dcount sub{end} repeat grestore SpecialSave restore end}N/@defspecial{SDict begin}N /@fedspecial{end}B/li{lineto}B/rl{rlineto}B/rc{rcurveto}B/np{/SaveX currentpoint/SaveY X N 1 setlinecap newpath}N/st{stroke SaveX SaveY moveto}N/fil{fill SaveX SaveY moveto}N/ellipse{/endangle X/startangle X /yrad X/xrad X/savematrix matrix currentmatrix N TR xrad yrad scale 0 0 1 startangle endangle arc savematrix setmatrix}N end %%EndProcSet %%BeginFont: XYDASH10 %!PS-AdobeFont-1.1: XYDASH10 001.104 %%CreationDate: 1997 Jul 20 21:19:18 %%RevisionDate: 1997 Aug 28 05:34:12 %%RevisionDate: 1997 Sep 18 10:23:31 % % XYDASH10: line segments for Xy-pic at 10 point % % Original Metafont design Copyright (C) 1991-1997 Kristoffer H. Rose. % PostScript adaptation Copyright (C) 1994-1997 Ross Moore. % Hinting and ATM compatibility Copyright (C) 1997 Y&Y, Inc. % % This file is part of the Xy-pic macro package. % Xy-pic Copyright (c) 1991-1997 Kristoffer H. Rose % % The Xy-pic macro package is free software; you can redistribute it % and/or modify it under the terms of the GNU General Public License % as published by the Free Software Foundation; either version 2 % of the License, or (at your option) any later version. % % The Xy-pic macro package is distributed in the hope that it will % be useful, but WITHOUT ANY WARRANTY; without even the implied % warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. % See the GNU General Public License for more details. % % You should have received a copy of the GNU General Public License % along with this macro package; if not, write to the % Free Software Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. 11 dict begin /FontInfo 9 dict dup begin /version (001.104) readonly def /Notice (Copyright (C) 1996, 1997 Ross Moore and Y&Y, Inc.) readonly def /FullName (XYDASH10) readonly def /FamilyName (XYDASH) readonly def /Weight (Medium) readonly def /ItalicAngle 0 def /isFixedPitch false def /UnderlinePosition -300 def /UnderlineThickness 150 def end readonly def /FontName /XYDASH10 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 28 /d28 put dup 34 /d34 put dup 67 /d67 put dup 68 /d68 put dup 73 /d73 put dup 77 /d77 put dup 79 /d79 put dup 80 /d80 put dup 82 /d82 put dup 85 /d85 put dup 105 /d105 put dup 106 /d106 put dup 110 /d110 put dup 111 /d111 put dup 113 /d113 put dup 117 /d117 put dup 123 /d123 put dup 124 /d124 put readonly def /FontBBox{-40 -520 503 520}readonly def /UniqueXX 5092844 def currentdict end currentfile eexec 80347982ab3942d930e069a70d0d48311d743b8793c40476b99911a1be6c93ca a7ffc9533764a6a2a3ebcf0bebc6668e399d80ad8b0e5e21d556d8fa71b95a1e 01e6689c74f977a4bbec6795aec114d8507f237839f414ee4fbf8162c865260f 923a63721852c7bff69703f7e0ab99c3b85e83c62c13ea99442890e370376cce 7133ce8f3de2f4c1dc78fb55dff4eb737c195d266281adef5d56fbbc3b785b1b 59d6efeab3b93e713f4b9105cf1594c83472177c0f2b04c840760c92c094a0b9 2a720e4c7b03708d225531ac69324547d65009965f1c52d2be3112c67b6002b1 3d5f2c82505b7f0136cc926ff2bda0b53691b13e816817e913048ad033e0ff31 9d18776c4be80936c7449f316ff7f9026e5eeb9984867fc558bb18773e9a5390 d4490fb8e63a0ce175f52732043cba9d379d01ef25fc4be056d3206186b53195 63ee3d03fa580efa0ad7d3162f77878d348a841432fabedfebc8559530f6cbc1 59df0a77aacfa9f0974542a736680e064ac101c646442b0ca133c4701c206de9 6b70d341f9558a800520c2d32be3628b6df05a19538ec2596d2334f05d54e742 a1a18ebbc12f04c45b899f667d9e6f3a4eaa1854562506d0da4057c4bbfbbacc c1c208cc47b76226ef6d4d3da7d976b7a21a2cc7aa7cf0602fbd2a46022f7894 c0667e19a31cc10ca33811f882ca5cc140bd49eb62545ffe3f418e8cb9b223e3 b2630b486a3b948c74751c414e84334424a1eee8f20b1bd4eab9a0e0545c9bf2 f8cda548feb88b89e369f29f5318ee43b25672b275b05016b635dc656bca5b14 a28e91c516e3f5e99609f5a37a696fbb39379b8374a044e2fe6d4a193d5360d4 31229d74455ff8645ba7462da11460be68629c6a2b1b4b4f409c806cdaec4d3f 941ec5e5a1a6aaaf2c72de027d73b6d446b29f4a0504dfa9e100f273e0b8f54f 707a5a7e1e5f5f3734783960d641ff957f220cdff18bb2d536a406abc54e557f a1e9728df44ca1a17c233e052e050fcd4d771fc5fa346a7707cd9f99d84d5117 03cc24d00bc9a07facc9d43e8ed8d24492443c69222cc444820fd282106b145d e827cd39334d12ac5ce75341e831caae76283c49935c4fd9dd0326d3abe5afe1 0e8f5279592d753f14ac5d342bd3d6bf32ca10068eda0ca6b4efa56c2aa4681e 6797e2301c9311cf83ff35250362b64b1c39b154b40020a56ee060e7b7740ce7 0a3547ac633756e2968875c226b5c476dd58e66037fca3949219349fa3bd7b03 06010bc612531bc1b732e88fb974a48f0b5193cd09e2adf32e587bfc1c0cfdb9 d9dc516b06dc94649a36152f602bbf3ac10d0a293111339893881f9e864db3d3 7939f8506094e16286fa810f1753921226c9a12a7523c2f189952fe6d920b2d3 bcbc901a5a849b1e15c9735f67169a1e9e382e024b50d2f209b13fb837a6e6e1 5a5e553fe4b462e5120e45b49e1ff99a03f62f350f4942f6f263119d36bcf828 0d17951f18a151e2ceb5091a5b7fef845bc8ee8b6c0cb59ba58cb354eb4b70bb e1aac5c7e333b7ed8e3089160d3054c48abab3ed77a64523f2780c06cba2b32c 1cfc1616b10e05d466a73e4f9d0282ea0998c1a73ba60bea6405030924a89325 4f2c371e95f7c555a96d9fdf038ac12b8319fe6be5fce36176c23dbe6f7c70ea f8195c3425b205b0a52836fd569df967c57015a5e527d49aaee26c0eb365a4da 15ec6c927a62d03431de447bf2c22e250d3bed7d68ea452f31df04330937fe94 69cc064a8d21a2e1fdcce04074577ce791b195559b8a13fafe150ad72f7e7ff2 5b474dcff6711021a476e0c8c2fad2c2ba4eac3709008419893044802ddce7e2 2aa3c69fe7ceb71d43aa3aa90a03414679eac03ca824e08f0d8bb36224c514ea ce3b15ec4881604f8a2ff536109fd896bd852cf92ccfc8b3ee4ba98aa8100a57 5ff41502ffd7ea42673296a9e6efb7521ea0c609877ff9c68b55d76d5325ca2a 57992dc5c35b4f36c54a237dca3ff572abec4b11b8c82e803d4d7d87fe80aba5 009c9742fb1eaebc7540f1f9663f832a2828072a03537c428124595c561d416e 3d500fb2d469583b509a05c63ef231b185ea1d3fd8d6d799b667383c0d4c2d44 2952fabbad72e27d408ec9c4869cde11b72b8f06e0dc732f6802fe2d7f3ca724 1eb3f5568868b6cb4b15b6f168126956393a411cee268050d2a54a7036fd7779 45c6bd96e6e9abe09ee7fef295344226e54f0b0aacd2fbac480d227074a9d2a9 faafe76527d34c5d79c2c2f854cc533cd76de1084d05921d9d8bd2ff7389c638 9e525562625d290be869d9a2e5da4bb88fae5a22c66d8d39c4f28313a052d7e2 b2d4d40bc512e9e6715babe38ea067f3012033f5d5d0d6dd588120a427359638 cea6f9f7ce2ebc82b39ea58d2e955d2f9a6ed7db7f5155949a1c262edaa59aff 25038dfec75f093af2e33f46a0a56fed47179a3824c8514a32cbcea7e9183145 02a80859bc5d5e0f4290ef95514edad5997695e999f7e8919bf474040bd0d879 17532bf89d5982ba7e073e569ecfaff74991e2b5b78f8ebe71790b4f803c6e8b 59cb7e0a03e8f30e961ee414da0e4614dbf6c11ec255e9a716276e1b2fb3d422 123c88c513b1ee248c99cdd48efc2464985fa7ab01dd3717369974d59d7ebc32 29a2124398aebb1bf68d1d7a0ac89aa432c808dcf1e6ab4144aae5a256978be7 f74f09043d699eb65bc7c8e1745db0a0fc7be240120515ef2c097ac0197cf782 922d94ad9f4173a7be421d3aef569a3eff6e724ca5a7c0ece0f6d8a38d3a6d86 ef1acfba6f228cf09cbb1beb2d054eb70bd6848d03cb311a41dcc1bb24c6a052 8ad9fffc9ab458133b488a195483ab46e75672f37d55af3174e3d303cced8801 4cc3763c18a764b5be44b3b28c5b0262a9ee204ac66ddad9388bbee8a4cac3d5 5332ffbec65eb9c6bb3f9dfea5be766b30d1fa5d2ab1bad9840e60606103038b 9befaa2a8823873b981ab33777655d362eb956d55464b6a3e02f69256219c432 02968951f1a7d1014f187c3057b250fd580ecb8ffe11a86614a985b3d9560b97 764621deb7a6ab9c7414134c27737e3cd20c9c4a5ac469f6db595763a2b568c6 ea95e79e5b03e7dc6c4d46d7bac22e0a503d558d72d0b6190756179d141bb4fd 03baa95a77906d32cdf149f643ccf98ab6967f29ba543b674bd19661107281c5 e52bfd2120d96f8e933a861bec284b58b9130a73953734a64580406e10a5a3fc c4661e2c40300def60e01a5324c6d8fb0d7840cc59f78f1db77a1f458c38a99a 9c9df4e4142f5e82567481f4068789819e86087ffd03cf0fe49cfcd5fa21e72b f8b617afa99e91eeb3f6ff64c59bca52985604e5f9f4634a65bc87972fe02d00 20a285ac50e63f5f6baab788d428460ef0639dd16f2cda3ab643a91f38b5b545 ed3521be5a3df7e3a4c96f43ba93b66508ac9a5ae7d01964ac31c52a477b25e1 b39b7913836e2a3dd9c35d62dc0841d6abd837c889ad7bd96c30eae92ceeaa36 78678b4a2542a26283f0cb57274516a23f9de5648d10d915bff016118ab3d1db 8bf4da2151fc1568574b9b18bb82344fc2abd967f0dbda5f75657ebc14fd7bf1 1ac6cf81a8eb952a043b1340a7fc883b28638897d15bb4c394d70df7df3d1312 2629b5a8c236d9e91fe466b264d6e5018581bb79e23dd527875cb97ef7962d44 2fb47682afcf9a3869ef323af9fec2d18e8a3613c10d546970216927e6740be8 0e272580db4cdc1b8fece17f94fc78640294a0 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: XYBTIP10 %!PS-AdobeFont-1.1: XYBTIP10 001.104 %%CreationDate: 1997 Jul 20 21:19:18 %%RevisionDate: 1997 Sep 14 19:58:47 % % XYBTIP10: lower arrow tips for Xy-pic at 10 point "technical style". % % Original Metafont design Copyright (C) 1991-1997 Kristoffer H. Rose. % PostScript adaptation Copyright (C) 1994-1997 Ross Moore. % Hinting and ATM compatibility Copyright (C) 1997 Y&Y, Inc. % % This file is part of the Xy-pic macro package. % Xy-pic Copyright (c) 1991-1997 Kristoffer H. Rose % % The Xy-pic macro package is free software; you can redistribute it % and/or modify it under the terms of the GNU General Public License % as published by the Free Software Foundation; either version 2 % of the License, or (at your option) any later version. % % The Xy-pic macro package is distributed in the hope that it will % be useful, but WITHOUT ANY WARRANTY; without even the implied % warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. % See the GNU General Public License for more details. % % You should have received a copy of the GNU General Public License % along with this macro package; if not, write to the % Free Software Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. 11 dict begin /FontInfo 9 dict dup begin /version (001.104) readonly def /Notice (Copyright (C) 1996, 1997 Ross Moore and Y&Y, Inc.) readonly def /FullName (XYBTIP10) readonly def /FamilyName (XYBTIP) readonly def /Weight (Medium) readonly def /ItalicAngle 0 def /isFixedPitch false def /UnderlinePosition -276 def /UnderlineThickness 138 def end readonly def /FontName /XYBTIP10 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 14 /d14 put dup 15 /d15 put dup 16 /d16 put dup 33 /d33 put dup 34 /d34 put dup 36 /d36 put dup 38 /d38 put dup 39 /d39 put dup 40 /d40 put dup 41 /d41 put dup 42 /d42 put dup 46 /d46 put dup 47 /d47 put dup 52 /d52 put dup 55 /d55 put dup 58 /d58 put dup 61 /d61 put dup 79 /d79 put dup 97 /d97 put dup 110 /d110 put dup 111 /d111 put dup 116 /d116 put dup 118 /d118 put dup 119 /d119 put dup 120 /d120 put dup 125 /d125 put dup 126 /d126 put readonly def /FontBBox{-542 -542 542 542}readonly def /UniqueXX 5092839 def currentdict end currentfile eexec 80347982ab3942d930e069a70d0d48311d725e830d1c76fba12e12486e989c98 74c2b527f0925722787027f44470d484262c360cdfdddf3657533a57bb16f730 48bfbbfcb73a650484015441fdc837add94ac8fbd2022e3ec8f115d4b4bb7b7f 15388f22cc6198efe768bd9fceb3446ee4a8dc27d6cd152485384ef5f59381ff da43f2d20c8fb08aa27ab2015b774db10dacfdcd33e60f178c461553146ab427 bdd7da12534ba078ad3d78041987a409a2d06b6b3057738213cee08cd789eeaa 097caceb2738a78b2f437638f0d63dd9e45ce613ae94486e726c4ed202501d61 51965c5c865a24933f21e0b1c67ff0d74bea0b8003496a2b1c9e3cde218dfa02 7343f1561243c5419412a440b6d4682c4dd92bf310718d73d28f47559a653346 c8fa6a8e3ec0a68d6661b293a71328a0bd0521249f1263070e67d0c20ca4a48d 221bcd864852e33289496155416b7cc05e73dd2b7f9ba0977ab328be862ac7e0 139c8eef1237e57525cbc853d7cbe3c9a8b54c378e8af02257a8daa736c3d9ae fb18fd198a33681c334984d81e2d783d32adf54549f5bea0bf351b1016032908 81685bde8d44703654d97063c8ebfb896e029b2383f5754d467163ec07f3398a d88196c720fd98b9a2260de8d7d3aa6453f831ce18233cfbf6cb098bc3ca2cd1 495386a279ced386537228ec08f3b3e400cc040ab2e763b0cd93c9a2c5ee0436 f0a2f033ba5d3e4231aacc9b0aa820f7ad72a3cec593a1153ee5527693ad3bc8 eaef55ac2f52fdf27146c04dcc825181a275e632e75a94cb9b3d3f7d17c1c08b 83bbf5c681f864e234d10b0f7c64839aa1671931f39a001e4134030b91d9a473 6c7d5e101e04feb20a04907ab46ab24902c1844b018beefd9014c8b629674e57 f1f0d63ad79dfa8ce4d1fffabeb4315386d494a3ab66cc9f291a714ef0ee4f9f 1687f0ecbcd2acea0e98dd5f94dfd700e546599e58d1f25bc54ef6ec0f12b91e 6690287b7c527a51724cea71da655f2b2974633ba5484cc6c2300ba28dff89e2 0c37542986ec1e4613cc8a16521e5c2720d88fa18111a1083dcee82b011400a2 8b4124ab1a5bdde460e2589f2872b0436396df646b0eb176e75de9af54d7c4ab f628a596d7e1ead5815ec6bb58786913f0125dbe4a6328ea358185ce03fdf5b2 8d3e5cee90066a67f548590d69d197b1503ae8f993a1a7aa4248f0be3be623c0 fe29e1772ade5b00f22b228152d197d6b3e1ddf4dece5c7cbadfec3e7bb38696 91becf5079caf4c910b4a25a1b19e3c64eeb79e5223d56f7aae7411259fda2b2 2e2a4652323e63b97e76d22ca5fa800398fb0b4636201037f11794493ce10d4a 80fc85a0a26686c096d560a3a77cb2cf4fdcd105e98e7e88454412c6a107c5dc 7605eef7932c093879753c20b5397cdeba78d0a798f789304d63956f0f471a10 ad93e8ade240e9185f8028420ecc26e436fcff5421bcd39aeb8ac91800241d34 133cc54e557b68947337eb889fb494948d932519e0e19f3dd891220c04935f13 96f8196a907180e760be47484d144c1039ee7934d0f08397e9b640062ffd670c 1c7fc029acbe5f5c7982e68820e9140313eb390f785901879c614f5461f3e0e6 908f053b64f7f0ec48d567b4125934d21158a2ba50e361b6966e857922618b72 06d412a748706d7eac5fff41ee5c52f4142fce1ce9ba67a3c97ec186b187b80c 41b8ee73ba38e3bf2bc6741de19ef652832faba07c55e7bd7ae5fb49d86b1808 8bb5e80ed536552a211ce36d2961583aff648edd54f1de84ae741b98bbd57e37 577e55ca0f97c4ac1fed15732a0a072a176b0c5f14dbcee98f6d60fe3b3df180 2d93213c7eb7a37ff92ff4f97619596aa0771d0cbc82c5cf55b5be4f44fba75e 631ae71cbc9afbc42312cecdd86b7aec3152ddcf7fa1c6f5e051581597864746 2e975089ad928df03a4073bf06bfe1e262a551f24a12bca29408aacf7ed2e43a 3b7f7ff8e40af2ad2b131622058405cdf249568c2653b0be457fed5352e113fc 1107d6ed67a6ffeef5608109c13e5d5bc2432e65b82d3c3fe6d012e7a84e7730 13ae1201e1ad5ac9c2c11163be1d85f342956954f92651fcde7efbd58975fd01 37afbc60f68065b6b4af9856ef3a425a57a25b3ce8e5375aeccfc1146b78fb7e 6aa315ea438e2826d160cb12ae97fbd9c4704114f4269ae8ed6a114882c3fe34 9aa90531189c9e3b9fd1bb8f1772fdd681245ccfcb8b42165e018ad8af8f2440 954f0390129495317eab98a4d43da3e8b81c4269b19e4069c61c0ecb28a57873 610c578517a8e08f9762dce236f12bdb99718602cba86a56166ddcd42497ebf9 5b52ebedd9f09a6109ae30158fbe7d998aff28df96cb38f706e1b05b685c7df4 8410ed3d5558666c7c85dbae18e6e50330f7fd850d55e2c7a2277fa9fc2372b5 5e8102cd124121243810279c8d7773e43cc5233bdab4d5379ae5bf2f2ef82d78 9621ea5c345dba373f989f82a3f1d6edeb69dc7c9abb0de83996d732589a642c b63d80a8dd4420f3593380d56dabe56ffbf30f6d1bc7b8e3d8da03de5eb33aca 4b1dd4b2ae4b385c05b16d65d336149a68d790bfe240b23f6d38c19945037652 4b54fc9e0a60df4b23b9054d0c05b7081ed97195ef3fa26beecf5ea3fe6cae8b ebea88ed339f7e59494275fa923c8e6d1f6d34d82dd65764941e4578de48351c b2bdd01bcb8f95fbd8adc59d14b5212aa0f4243d1284c6c9325eb8331f11a031 c3c72668b913f9dc2b818ffa189229145614d11cc645beb56e006f2eddb395be f40407977ed4c2018231bdb1b3975e3471c917838f156ce50b6b7881cd5a924e f908a4246961874932ef7694a89836e8b2bdccf9d5e37465d72a051b28eacaa9 0c0499a2caf6f048e16a2d538f93db84d5aa1f5ca2bf5f59e688483eb6f7b76b 86fa39f5bb91ac2cb449490d02cacfae6eeda6cc9f81dd1f23f75dfaa147ed8a 8409b1df8fc6ab93b5e0faa71e6ccd142f1d922463b33e72adb48edb72841e71 6e736726f7502bb9acc792946494e722e21bf0fd127e18a5a841c4eb8e5da923 4b33a1ca992a972d9e9be9ab9ac03490a1ac894a14d0d968505d2e85e031c7ba 214a73d474109de5438f3d6c6fcf7d7c3328c23bb891d9a032b826499fef9f6a 6d2f4b931dac8a9e52f0cdc71237f90c0cc8d3ea2b77300e8eaf805a1c96a531 29116f4d980e6b5d2255be1b414827ec5f1c704957686a2a15eb97163c52aa2e 7ff983316875f3254b75360a5eb964fbbe2512639537c9d747ec797438cc6a1f c29c4ece2df509aca9f4432f2802404525ec3ccdd00c16d5e4b1d988e05a32d0 b3109c438bb4d96461ec7a01f31397d05613041ce4e7a058c76db266c85186ea c120fc8ded67831b7b6eaedc2697dbe21aa0be8c23376566c5c2368571454153 c6376da88f348eba5f988877fe62b7173a34031cf1a438f1d0681e252ba36789 ff08228ba054542b40c4d51023bbcc575acd9b5e48212cbdd008e48b5b455ae4 5e8f7abaac5079262c2f68dab05f1a2bfaf0c701cd9f6212786d56080b547abe de0a0c45b69b6735611e712287a2a2dd7c48bd41b61d5a521465d0056ad19950 f3b69224cceb5e44f4434014634678fad7c159c53fe7f1641358a043c397a25d dfcaaa727be1061288fd97407d8ca2e249e551e25cd28a4013136d80e56a9f03 7b1cf2a97c9d3e555c87c7442f038cda997d27c059816266af66e5af51445134 21ba39ffb81e96b689e4b1e8e6a31a64146f292793e8eef0390cb8cb8ef6ee21 95ffc8dc3707c1b5edd3e55958bafd54976526eaa15c355b4ff695b5dea821e4 78100344d5aa80c8968e88f8084a6c3d4f8498773f922ca08b95e293f39a66c0 7cf7a6471e41f1d213e63b2fc4ed95aaaff8523974de592f8781313988ee1fa1 da857e896e84708b791ce58ef30be9ab9d02ced5d8d6a72833dffeb44db429e3 a9c41e2c05da263b966233f2f52870aff1f5814a7460361ebc8146d9addcde2a 44347bd9eaeffcc9761fdc17a89ea5e8f445f95006e017e9276e079f74c8df0e c40a1c57cd36402eca43f744fa2586a1159bebcb5cdfb5cc7d85a50dcfa3a62d 3ee6c5bfb1867e002e8aa07a2acf3e66b535885f1e226169f48a0128d65481cf dcb8c0c147570b40a573595e69a63d1b7ea70ea2512bf2a3ec433d10ccbd63fb 692e642cb7397d926de8e29fa5320505e0023dc37be3ed06cc5d08b0efd62382 92c8a6fafb49304e2bb94b5a9603c34c7f30fe91bc74b9ba972013ac477ccfac 93541acea4d89fd121931f93bedede6bca4bb76959c2bae0655474de2364b0f2 3f0837b0dfb1ffd40fef2cad7cbd9f4e483227ec15a96a23badbf56d9c46a0b6 71771274545d4e81f830000c86c88934f4eda292bd7f13d93f158f446364831a 887ec603d4bb1308fed4f6effe728ed2460280640addf145df15c70d87970054 f86abf37ce50926a7d7f3a8dafb63ed484128a581d72a90c9ead1890f6551444 8fb113f29934bd2da3fc2a33a83bbcb5ea207c71cad63b05f82d1a55fc81280d 548451d254f5df3c97cd3bf42181bb306f365f419cf90ce7778ff5ffea51ea09 4fab9198f70afaac4dd6a703065f723b7d6e53db961c9699bfe7d79280e2f62f 4a05d7a1c0bbe55ae3be7e851f8bdc5206de3f6f1ea55f26248ca6fbdb061417 eb7689dd9d59d4a6d2e42d8a40b606ff7d4ff5fe0b6f6bf498528e0693b398f6 c74708bcec71b15d2cea5140321727a091677ac067f787001ea089276558c727 51a1e8644e499199d2f896154a8275d8b9b01aa32dec10a0f0196e4474e4b188 ab9a89e29a8edf5c449d7c25ea1091646d2c246599e5dcc4f0167f7ee1081ad8 c267205b3b256b96a3b54281236eb39a700fa43acf8517abc72a845bc110e1ec 153fc374710975248e3401bc8d1e66458fa2198d8885374f1feb57e7f77bf4ab 5edec4d089a223380cdd01d9ce39fdaf30ea1e3512db78a713a40159e3f7f578 fc119c61b32b73c6de5dbdf2899d6e9ccfd5c563887bc57122bc0dbac2091844 6b1ab98b5786c8f18477cb06b0df72dddc8c343deea9161c526b7210c5397fe9 faf8d92b0f886b1cda38491d477c1c8d082a8b542e505c6a8bc5bed72b14f1c3 9f 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: XYATIP10 %!PS-AdobeFont-1.1: XYATIP10 001.104 %%CreationDate: 1997 Jul 20 21:19:17 %%RevisionDate: 1997 Sep 14 19:58:47 % % XYATIP10: upper arrow tips for Xy-pic at 10 point "technical style". % % Original Metafont design Copyright (C) 1991-1997 Kristoffer H. Rose. % PostScript adaptation Copyright (C) 1994-1997 Ross Moore. % Hinting and ATM compatibility Copyright (C) 1997 Y&Y, Inc. % % This file is part of the Xy-pic macro package. % Xy-pic Copyright (c) 1991-1997 Kristoffer H. Rose % % The Xy-pic macro package is free software; you can redistribute it % and/or modify it under the terms of the GNU General Public License % as published by the Free Software Foundation; either version 2 % of the License, or (at your option) any later version. % % The Xy-pic macro package is distributed in the hope that it will % be useful, but WITHOUT ANY WARRANTY; without even the implied % warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. % See the GNU General Public License for more details. % % You should have received a copy of the GNU General Public License % along with this macro package; if not, write to the % Free Software Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. 11 dict begin /FontInfo 9 dict dup begin /version (001.104) readonly def /Notice (Copyright (C) 1996, 1997 Ross Moore and Y&Y, Inc.) readonly def /FullName (XYATIP10) readonly def /FamilyName (XYATIP) readonly def /Weight (Medium) readonly def /ItalicAngle 0 def /isFixedPitch false def /UnderlinePosition -276 def /UnderlineThickness 138 def end readonly def /FontName /XYATIP10 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 14 /d14 put dup 15 /d15 put dup 16 /d16 put dup 33 /d33 put dup 34 /d34 put dup 36 /d36 put dup 38 /d38 put dup 39 /d39 put dup 40 /d40 put dup 41 /d41 put dup 42 /d42 put dup 47 /d47 put dup 52 /d52 put dup 55 /d55 put dup 58 /d58 put dup 61 /d61 put dup 79 /d79 put dup 97 /d97 put dup 102 /d102 put dup 111 /d111 put dup 116 /d116 put dup 118 /d118 put dup 119 /d119 put dup 120 /d120 put dup 125 /d125 put dup 126 /d126 put readonly def /FontBBox{-542 -542 542 542}readonly def /UniqueXX 5092838 def currentdict end currentfile eexec 80347982ab3942d930e069a70d0d48311d725e830d1c76fba12e12486e989c98 74c2b527f0925722787027f44470d484262c360cdfdddf3657533a57bb16f730 48bfbbfcb73a650484015441fdc837add94ac8fbd2022e3ec8f115d4b4bb7b7f 15388f22cc6198efe768bd9fceb3446ee4a8dc27d6cd152485384ef5f59381ff da43f2d20c8fb08aa27ab2015b774db10dacfdcd33e60f178c461553146ab427 bdd7da12534ba078ad3d78041987a409a2d06b6b3057738213cee08cd789eeaa 097caceb2738a78b2f437638f0d63dd9e45ce613ae94486e726c4ed202501d61 51965c5c865a24933f21e0b1c67ff0d74bea0b8003496a2b1c9e3cde218dfa02 7343f1561243c5419412a440b6d4682c4dd92bf310718d73d28f47559a653346 c8fa6a8e3ec0a68d6661b293a71328a0bd0521249f1263070e67d0c20ca4a48d 221bcd864852e33289496155416b7cc05e73dd2b7f9ba0977ab328be862ac7e0 139d5cb0db6f50b26bd8ab173859c9c94db82970311d7eb0a02bee1be5f0d126 f9079e67107eda14b460e46b03b0422eb45a4f4afa382841c35b0bc0c8639b73 43c819afc69838ce781c2de7d22bf503ef6eec27c83cfd52a77bbc754b4f2050 55341700991f3ef4b5b5a54c21283034b38c8b6a6e65abccc94c0c26836806ec 4df8d8c64f595841395072f8a2d289b7fe5497bc0e061810b16a1e48653bb092 42ffa3ef0bba4e37a5aa4ddc31f3138aaf10998fd66f3817b77012eac677ed2d 7447908c771fbaba4dfcfeca5374a6b87e5657809a82f0ae068c5384c12f4653 2a82645a512212140d815e80ec76b3370c382e9f6d29ec6afc178a622249fda7 775d4f6a554f04748ed4210257fa6e376188a175db3c00f88421820b063a985c 07ad665eff7e2d32a27015c528227c2805aa8df134f4abad9958b841aa4263ec 9ec6d907308b0a5a51049de002cfe60ef35bf33fc863ba14ff361749554abd65 47426fbf3958ddb506ea3e303c932edec2896d3017a57913cde60cbdafeddbd3 cd5ef6dd49299783a92fe9deafb24e7f74a6ca6c0198b2fcda46b51445a2800f d1dc6a092b3192cfb314892e52753b5c7b94edd34c8213b032f8aab5d08753cb 65bd1a1225ba43194efa625ee5dc6eec6d0353d06ef3bef9c0d7df78fe189482 779c9276e83ccd71b50e87ba92cf092d65498e5b43cdc89436019e306c0d628e c7d1470ab322ca2d6adc3e9ff4196c0f7792ca0b20f741ad7bbd4391b0218511 14f0e97a44fd7d03e7003d1fe2c70d6266740dad7b07b3794dc53871887c8eba 2910d6fa654346318753cc752a7d25c1ef970e7dda8d8bbe249e9edf2c8c2ae6 abb93bab2dd8560466a7d08ce3e200d7cc488c6045871a8033ec1dc3a53e7056 3fe265f58c6ac98754d399b47b817b7aed7ebbbb503268e7324d6c0a0931978b 51a7d37187a99f234ae4c46b585383938e7cf59d2dfd20717031966eaa4317e7 21c03e9363598030c707f2613d977fe82f5967e1781e158d5c9e376a1c79fa5f 9a90ddbcf4bc24f3bcda234fd4058b5012e85de7894c0745a24d91b21a38ebeb d918421472462f7dc83bb4c5dea61690d651eb9fa223871876375aa4974454e6 84fa4ce807a9e8819397c651905a743f356d8c237792bd51845a0a4aa21bf8c3 ed53d949adc90e8a30a8dd8ac9e1df77546c22473a4b7177fa4f23c728b7d114 f75aad3f3d4296c2229e4110a89596c5fa8f15a463aacd6195a0944873982a40 14489e6cdc91ce1bfe9c89d1280eed70d3ffdd76062ae2ac47a11f51bf7aa32a 324f0b190d173b31fb4561fe52d5ca51f2b3af2d669ce118191f3fc73d5d569c 042babcb5f4274b32451f58e9263c81b00fde9f3a04fbc3f92f75e08009c529b 2e208a633412ef2605b86d646f4756e2ad21fac5b6988f5b17eeba3969de4b74 6f39fda9e78fbf6b3d8c1e02696bdbe7c30986bfcf9ee9cdc913bfe7b1636fee ac3cd434f742666830f9b92b9a83c5720a9944d861517362f82bdf1d2af271a3 3f81000f5e326012c6354dac835d75bd06e5c55d53f83b29bc85f3ddc697d598 05ba9ab873f212210abbb05a0281e79a1f915ae212d87a9011eb8b32b2cbc95a a762953ae9ba7c09f4632cd0768fad198e628615bcd0bf68a99b237790e1209f c0a5e893a72026d5100b7a83691438a9ab33c666b435455cd9c93e747b2330cb a0d9509b9152baf9b50ba2e752ace11dbbe3b6c3cbb7ff609d8cbdfc84a84eb3 e414b8f766180fcf56e458907bef3770f3af102e79df71968e50648799555e95 be5f24c7a845994413509437682b0ab41818dd62083ca3807fefe98cabed2900 356bd8a9f0b25e43afbfd13fb318aaacad189f310102e5d1f6bfefadc109f971 a6cae196fb50c2f8a874a293e7bf9c3c096b617f1330e1e4a92ed453cdfac802 9b1057a187107b57ba1e6f8632b1e03f151e60c8706b5e179c5c3f1e1c4bb256 7d273ca9b0c2c54080d788190ae4b996df6f194419ca1ce698ca3d5bc9793af2 2f6ef6d11a3ac289b0354219ff71fd1987cce29aecca00fc99acf05a9c591f6c 354cef5be580f0f0edda224ae7a2ac9920b668f2488c8e7f76f5b0d15b55f029 83067c386c23abc0da400b158b2be1eed2b5fe6ebe12843bf20bdec8b276680d aa9410026d5f55335a1cdcbd722fe08f5e9e8051cd5bf9293f36da2a4bbc00b3 c18b601ae9a39bc5585c61dc74bd70817cbfa302902a4ee33e141556d4bb4a79 5fb7ed6b52d7ebfa65167b6f3baff8eb94cd41094829fc580ed5154802783d8b c05ec49e8133c8cc18f75c767eb5023c3e15993a9c5b6d25f4a5a81eb8a5245b 80a333f189217bd3f17037b658e3a7f329f02d3b5aa3dd8dc22db77510c6c487 41219d20f482ee812155b4fc631786cedad713feff2f5291f5b53f0e12c2809e b9f6358c15371ccba9efd8c799100812dbcd649925fed9f16beeab273fa277e5 16776a191ac0640aa7c7dc1cc06c5e1fa3cd45450f82069ac2bb524476b9a4d1 ac3fe653cced38cd3faa3ab4fdc2e01667cb0bb1353ab5f12505f148eb603fd7 15abadf2cf0fe8a68dc6d5bb39205e589135f4086eeab8ec1cb1724138f0db98 25cb18c59340302c5105af6f9fbeb5ae107cd2e288a4ede1b412f7d5fa4fe7d8 8ac7bf1b5c0d45052f9032106b1ec80c7d0018260650870f7fb016a98267125c a2f65069b152aeaf6a4fd334bda7e7770cc33dcecb5db182d90819f9f563b1e6 1defafeebf3d1a2d7ee3be019b4f879aaf0570ae310851588b8d3e29bff0ad1e 2889e533f404b0987861d7751a496375f10cb9a98015d57c316418be4710410c 3a3125e021e201e2ad01cee609409a06975001b543791c922fe60fca8987344b 14ca7ac266db5c3f0cbe203a89faea3398ee2a07403a50941ea92f972e678b53 1a2631e67d7756adcb8fd9d36f12ef8466cc0158632e987ad0ee3ee4a83f8d9c 5722e43a70fa1b65e1812ece8368924401f6bfc2f7e25ad032666ab364dfc6ce a0214b9423be11c165b6adef90ee172b93b3804d1ebb874c0bea37b6a83e80f2 aacf8dcbd745906dcba2086ac29271c57638d217a003beda81f1319ff8facff3 a4b57bf1d79446f72705058ddab5913dc05bf2139efd682416e5d9112a328211 9c11b306f01f2b211217f8617593e9d1f6a77c657a64ef19df535d2e8cc30b81 ae43cef766ba0808871a541741883573da1273d8897308b560d1b87dc5c0fba7 a265041bbb8028567c5b1674927b9b45bafa4a1241328aa21b99f3b87a39698f 508979202924e76d6e549f4b13f4122242e0519cbd6e6fb98da54921f886dc30 b5cc090b7a77eae8866c57e543a2ceb4537de00c327ef025781c2bfcc654a940 934d2515da059286a0b35c4639791ad74b0376979596a4cdb523655ce94e5e65 55c80ecbbe34eb41738c4637e8cbd5b656520516401788dbc136f3033645792b 7ec54808e8d8fa2a9c044ce9a61573ea1c6eb7b01a39e0933fdced27a52bf6b5 42cb378a770b063219fbd305f63dd006ad3bc406967e51588356ede72c4a4d10 a7c2291e94cbd6adb33647e81e2c0f2892f66a7dfcc5164e1f40ca50fbd72c16 4262ba4a22258f8cbbf315701736a6ff696b9206bb05fd85534b0cc1f91db4b3 9226ce66a9a7e2d3d26584018dadb04d462405dfd34182905c2cafd833f06f57 eed56f4896a452b4d74436497141f13b5e1f742f1d2ae467e28d37467019a29f acc7c54052888e28330147b68951bee8da395c9441de4e0a74a2c60bc8e931b7 130339672f0630adc462642bc9f516859a40c92e7a7298cec345e62fc9d9b79e d34ec4c21d81e1b73df628d6f9429e928db06716730a702a045c1f8d8e224ead 3fc8ebbc2285da9175732bc83d570eb1a2d42b3a05487954006ae813b0998784 8a626dcdaad74eeb9aeca6e5492c720adbe281d4e925559d0f2f1b475846d7ff 628185f28fc84bf1d68d21f63e91126979f32411c4902203a262d43417928205 2ab2430e886609046fd7f876dba3558348200f07246f86654c019d12c926f8bd 7cf2f5883e1fa9a9eef2665c95053a42460e221455520d947be7e1a73ce77f77 506bfe20f08f0ea8af0271115f45985979be39065900b9f15bb5183c5bba02ae e002dae0faea51e7a323db1afa7d2a3b7b7ed93e6cdeb7e5c48f01e29e630b3c 2724eeded01b6fc74423cbea86b4037fe312fced0d5b5ad9e6c0e75d27c9dd3b ff10d470072a99021b9f1132a35aaaae587d92dbd18e8126b15e9b5669f4e696 9745f3af17bb2e0ba7eb1b92c06f97347a958a481e9863d2b436a97f3a166957 bbc24f9adcc2af310593c6d23ca5898ad1d84095d540c8ce0fb9c8a2a328667f 9966fe42c60b9ee51a24266dc013462f31e8556f13895c0449ac34071199d9cc 01d754441769d980cd63bd56d8c143df1506d97d8651652cdd1192459d1a6023 a0c57616184f8235f3889a39927d112118e7e0549b3e1e83df5ac426fbd1984d 61fdfad0 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont TeXDict begin 39158280 55380996 1000 600 600 (tensor.dvi) @start %DVIPSBitmapFont: Fa cmex8 8 6 /Fa 6 113 df2 DI<92380FFF8092B512F8020714FF 021F15C0027F15F0902701FFF8F813FC490180EB0FFE902607FC00EB01FFD91FF0913800 7FC0D93FC0ED1FE049486F7E49C76E7ED801FCEE01FC4916004848177E484883A24848EF 1F8049170F001F19C090C815074819E0003E1803007E19F0007C1801A300FC19F8481800 A2BBFCA500F8C800F8C8FCA36C1801007C19F0A3007E1803003E19E0003F18076C19C06D 170F000F19806D171F6C6CEF3F00A26C6C177E6C6C5F6D16016CB4EE07F86D6C4B5A6D6C 4B5AD91FF0ED7FC0D907FC4A48C7FC902603FF80EB0FFE6D01F8EBFFFC6D6CB612F0021F 15C0020792C8FC020014F8030F138045427C7F4E>76 D80 D<143014FCEB03FF010F13C0013F 13F090387F03F83901FC00FED807E0EB1F80D81F80EB07E0007EC7EA01F800F0EC003C00 C0150C260C80B027>98 D<19031907190F190E191E191C193C19381978197019F019E018 0119C0180319801807190060180E181E181C183C18381878187018F06017016017036017 0795C7FC5F170E171E171C173C5F0140157001E015F000015ED807F01401000F5E001F15 03D871F85D00E11507D840FC92C8FC00005D017E140E161E6D141C163C6D6C1338167816 706D6C13F05E903807E0015E903803F0035E903801F80793C9FC5D903800FC0E151EEC7E 1C153CEC3F3815786E5AA26E5AA25D14075D14034050788247>112 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fb eufm8 8 1 /Fb 1 104 df<903801800C903807F03890381FFEF8EB7FFF90B5FCD803E713F0EA07E0 1403EBC001120F1403ADEBE0079038F01FF8EBF83BEBFCF33807FFC16CEB81FC1401EA01 FCEA00F813709038E000F8D8038013F0486C13E0487E391FF001C0D87FFC138039EFFF07 00000713FE00015B6C6C5AEB1FF0EB00801E2D7F9E23>103 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fc msam6 6 1 /Fc 1 3 df2 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fd msam8 8 1 /Fd 1 3 df2 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fe msbm8 8 6 /Fe 6 124 df<91390FFC018091B5FC903903FC07E390390F7001FF90393CE0007FD9F1 C013392601C380131DD80383C7120D4848140FD80E061407D80C0E1403EA1C0C00381501 EA301C13181270006092C7FC1338EAE03012C0AA12E0EA6038131812701230A2EA381CEA 1C0CD80C0E1570D80E0615F0D80707EC01E026038380EB03C0D801C114072600F1E0EB0F 00D93C70133E90390F3E01FC0103B512F0010014C0DA0FFEC7FC2C307EAE21>67 D78 D82 D<001FB612FCA23A183E00701801F0EB6038D81BC0EBE030001FC7EAC070003E010113E0 003C90380380C01501003801071380EC0603003090380E0700EC1C06EC180EC7EA380CEC 301CEC7038ECE030ECC07001015B4A5AEB03819038070180EB0603D90E07C7FCEB0C06EB 1C0EEB380CEB301CD970381303EBE030EBC070000101601307EB80E0260381C013062607 0180130ED80603141E000E90C7FCD80C07143ED81C0E1476D8380C14E6D8301CEB01CED8 7018EB078CD86038EB3E0CB712FCA2282E7EAD38>90 D<95261FFFF01D70051FB66CF303 F00407B700F01B3F93B800FC973803FFE0030F91C7D80FFF083F130092B50080020001C0 953803FFF0021F01F0C9D81FF0063F90C7FCDAFFFECAD803FC943807FFF0010F01C09426 00FF8093B51280D9FFFCCCD83FF0031F01F0C8FC000F01C0DF0FFF020FB5C9FCD87FFCCD 000390B712F0D8FFC008004CCAFC00FCCF001F158000E00A000280CBFCA40F80BBA5>94 D123 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Ff cmsy6 6 9 /Ff 9 96 df0 D<0060143000E014706C14F00078EB01E06CEB 03C06CEB07806CEB0F003807801E6C6C5A6C6C5A6C6C5AEB79E0EB3FC06D5A6DC7FC497E 497EEB79E0EBF0F03801E07848487E48487E48487E001EEB078048EB03C048EB01E048EB 00F0481470006014301C1D779A30>2 D<136013701360A20040132000E0137038F861F0 387E67E0381FFF803807FE00EA00F0EA07FE381FFF80387E67E038F861F038E060700040 132000001300A21370136014157B9620>I<14301438B1B712FCA3C70038C7FCAFB712FC A326277CA430>6 D 24 D<01FEEC0FE02603FFC0EB3FF8000F01F0EBFE3E3B1F0FF801F0073C3C01FC07C003 803B3000FE0F00010070D93F1EEB00C00060EB1F9C00E0D90FF81460485C14076E7E6E7E 81020315E00060D9073F14C091390F1F80016C90261E0FE01380003890397C07F0073C1C 01F003FE1F003B0F8FE001FFFE3B03FF80007FF8C648C7EA0FE033177C953D>49 D67 D<157CEC03FEEC0FFF5CEC787F4A7EEB01E00103133E903807C03CEC8010010F90C7FC49 C8FCA25B133EA25BA213FCA25BA212015BA212035B1620484814E015033A0FFF8007C002 FC13804890B512004814FCD8700F5B39C0007FC023247DA22B>76 D<00E0140315076C140F0070140E0078141E0038141C003C143C001C1438001E1478000E 1470000F14F06C14E0EB8001000314C0EBC00300011480EBE007000014006D5AEB700EEB 781EEB381CEB3C3CEB1C38EB1E78EB0E70EB0FF06D5AA26D5AA26D5A20207C9E2A>95 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fg cmsy8 8 22 /Fg 22 117 df0 D<123C127E12FFA4127E123C08087A9414>I< EC3FF0903801FFFE903907C00F8090391E0001E00178EB007801E0141C48488048488048 6CEC0F80D80EE0EC1DC0D80C701438D81C38EC70E0D8181CECE060D8380E903801C070D8 300790380380303B700380070038276001C00E13186D6C5A00E0D97038131C486D48130C 6E5AEC0FC06E5A6EC7FC4A7E4A7EEC1CE0EC38706C496C131C0060496C131849487E2770 03800713383B300700038030D8380E903801C070D8181C903800E060D81C38EC70E0D80C 70EC38C0D80EE0141D6C48EC0F806C48EC07006C6C140E6C6C5C01781478011EEB01E090 3907C00F80902601FFFEC7FC9038003FF02E2F7CA737>10 D17 D<91B612C01307131FD97F80C8FC01FCC9 FCEA01F0EA03C0485A48CAFC121E121C123C123812781270A212F05AA97E1270A2127812 38123C121C121E7E6C7E6C7EEA01F0EA00FCEB7F80011FB612C0130713002A2B7AA537> 26 D<170EA3170F8384170384170184717E1878187C84180FF007C0BA12F819FC19F8CB EA07C0F00F00183E601878604D5A60170360170795C7FC5F170EA33E237CA147>33 D67 D<91383FFFF00107B6FC011F15E0017F 812701F83E0313FCD803C09038003FFED80F00EC07FF001E017E6D1380481500007CEE7F C00078163F48EE1FE048137CC7150FA202FC1407A25CA3010116C05CA2EF0F8013034A15 005F171E49485C177C177849485C4C5A4C5A49C7485A040EC7FC163C013E14F0ED03E001 3CEB0F80017C01FEC8FC90387FFFF848B512E04849C9FC4813E0332D7EAC37>I76 D<0378172003F81760020118E01A01A26FEE03C01A071A0F 0203171F1A3F037E167FF2FF80A2DA073EED01EFDA063FED03DFF1079FF10F1FDA0E1F15 1E020C6D023E1300197C19F84A6C6C49485A19E0F003C0DA3007EC078070EB0F00181E02 604B133E6F6C137C02E05D02C04A48137E6F6C485AD901804A5A70485A0103010049C7FC 91C7EAFE3E49EC7EFC0106EC7FF8010E6E5A010C5DD8301C6E5AD83C385DD87FF86EC8EA 7F0849020C16F8484891C913E01BC06C48F03E006C4895C7FC000FCEFC4D317FAD54>I< 0206EB3F8091391E01FFF0DA78077FDAF01F7F903A03C03C1FFE903A0700F003FF90391E 01E0014948486C1380494848137FD9F00F143FD801E090C713C00003011E141FEBC03E38 07803C000F017C140FEB00784813E0001E1380003E90C8FCA2007E1780127CA2171F00FC 1700A2171E173E173C177C6C16785F16016C5E6C4B5A6D4A5A4CC7FC6C6C141E6D5C6C6C 14706D495AD80FFEEB07802707FFC03FC8FC6CEBFFFC6C14F06C6C1380D90FF8C9FC322F 7CAD38>79 D<91383FFFFC0107B612C0011F15F0017F15FC2701F83E007FD803C0EC0FFF D80F001403001E017E0100138048167F007C163F127848017C141F5AC7160014FC171E17 3E4A143C177C177801015D4A495A4C5A4CC7FC0103141E4A137CED03F09138E1FFC0D907 E790C8FCECCFF8ECDF8002C0C9FC495AA349CAFCA3133EA2133C137CA25BA25B485A1380 31307EAC31>I<023FB57E0107B612F8011F15FE017F813A01F83E001FD803C002017FD8 0F00EC007F001E017E143F5A007C161F12784894C7FC48137CC7FC173E02FC143C177C4A 14785F4C5A01014A5A4A010FC8FC167EED1FF80103EB7FE09138E0FF8002E17FECE07F49 486C7E6F7E150F010F80EC80076F7E1400496D7EF00180013E6D6CEB07006093387F801E 49EDC03893383FE0F00178EDFFC001F86E5B01E06E48C7FC4848EC07F0392E7EAC3C>82 DI<181C183C0107B712F8011F16F090B812C0481700270780 007CC8FC48C712FC121E123E007E495A127C12FC12F048495AC7FCA34A5AA44A5AA44A5A A4143F92C9FCA4147EA3147C14FCA25C1301A25C13035CA2495A5C49CAFC130836347DAE 27>I86 D<141F14FFEB03F0EB0FC0 EB1F8014005B133EB3A2137E137C13FC485A485AEA7FC048C7FCEA7FC0EA03F06C7E6C7E 137C137E133EB3A2133F7F1480EB0FC0EB03F0EB00FF141F18437BB123>102 D<12FCB47EEA0FE0EA01F0EA00FC137C137E133EB3A37F1480130FEB07E0EB01FEEB007F EB01FEEB07E0EB0F80131F1400133EB3A3137E137C13FCEA01F0EA0FE0EAFF8000FCC7FC 18437BB123>I<13031307130F130EA2131E131C133C1338A21378137013F013E0A21201 13C01203138012071300A25A120E121E121CA2123C123812781270A212F05A7E1270A212 781238123C121CA2121E120E120F7EA21380120313C0120113E01200A213F01370137813 38A2133C131C131E130EA2130F1307130310437AB11B>I<12E0A27E1270A21278123812 3C121CA2121E120E120F7EA21380120313C0120113E01200A213F0137013781338A2133C 131C131E130EA2130F1307130F130EA2131E131C133C1338A21378137013F013E0A21201 13C01203138012071300A25A120E121E121CA2123C123812781270A212F05AA210437CB1 1B>I<12E0B3B3B3AD034378B114>I<00E0151CB3B3B712FCA27E26287CA72F>116 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fh cmbx8 8 14 /Fh 14 84 df48 DIII<15F814011403A2140714 0F141F143F147FA214F7EB01E7EB03C71307EB0F87EB1F07131E133C137813F01201EA03 E013C0EA0780EA0F00121E123E5A5AB712F0A4C7380FF800A7010FB512F0A4242C7EAB29 >I<00181438391FC003F890B5FC15F015E015C01580ECFE005C14E091C7FC90C8FCA5EB 1FF8EB7FFF90B512C09038F01FE09038C00FF090380007F8001E14FC001CEB03FEC7FCA2 15FFA2120C123FEA7F8012FF13C0A215FE13801407D87E0013FCEC0FF86C131F391FC07F F06CB512C06C14800001EBFC0038003FE0202D7CAB29>II<123C123F90B612E0A44815C0168016005D5D397C0001F80078495A00F8 495A485C140F4A5AC748C7FC147E5CA2495A13035C1307A2495AA2131FA3495AA4137FA9 6D5A6DC8FC232E7CAC29>III< B712E016FE707E17E0000190C77FEE3FF8161F707EA2707EA5160F5FA24C5A4C5AEEFFE0 0307138091B548C7FC707E17E091C7EA1FF8707E707E707E18808218C0A618805EA24C13 00EE1FFEEE7FFCB85A17E0178004FCC7FC322E7DAD3A>66 D 76 D81 D<90391FF8038090B512070003 14CF4814FF381FF00FEBC001393F80007F48C7123F007E141FA200FE140FA215077E7F6D 90C7FC13F06CB4FC14F0ECFF806C14E06C14F86C14FE6C806C1580C615C0131F010114E0 EB000F020013F0153F151F150F12F01507A37E16E06C140F6C15C06C141F01C0EB3F8001 FCEBFF0090B55A00F95CD8F03F13F0D8E003138024307CAE2D>83 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fi cmti8 8 69 /Fi 69 128 df<92397F8007C0913A01FFE01FF0913A07E0787C78DA0F8013F891261F00 F813F8923801F9F1143EA2923900E3F0E04A903803E000A402FC13074A5CA4017FB71280 A2903B01F0000F8000A313034A131F94C7FCA401075C4A133EA4010F147E4A137CA4011F 14FC91C75AA4491301013E5CA3137E017C495AA3003890383807C038FCF8FC5E01F0130F 4BC8FC39F1E0F03E39F3C0707C397F803FF0391E000FC0353D81AE2C>11 DIII<127012F87EA27E127E7E7EEA0F80120713C01203EA01000A0D6CAD24>18 D<1338137C13FC1201EA03F8EA07E0EA0FC0EA1F80EA3E005A5A12E012400E0D69AD24> I<3807803C380FC07E381FE0FFEA3FE1A3EA1FE0000F137F3800C006A20001130EEB800C 0003131CEB0018481338000E13704813E0383801C03870038038E00700EAC006181574AD 25>34 D39 D44 D<387FFFC0A2B5FCA26C13 0012057A901A>I<121C127F12FFA412FE12380808788716>I<14031407140F141E143E14 7E14FEEB03FCEB1F7CEB7CFC1360EB00F8A21301A214F0A21303A214E0A21307A214C0A2 130FA21480A2131FA21400A25BA2133EA2137EA2137CA213FCB512F8A2182C79AB24>49 D<147F903801FFC0903807C1F090380F00F8011E137C13380178133E13F3EBE380D801E1 133F13C1120313810183137F0007EB007E5B1306010E13FE4913FC3903F801F83901E003 F0C7EA07E0EC0FC0EC1F80EC3F0014FC495AEB07E0EB0F80013EC7FC5BEA01F04848131C 4848133C49133848C7FC001E14784814F0383FC001397FFE03E00078B512C0EA703FD8F0 0F130038E003FEEB00F8202D7AAB24>II<13F0EA01F812031207A3EA03F0EA01C0C7FCAD121C127F5AA45A12 380D1D789C16>58 D<16E01501821503A21507150FA2151FA2153B157B157315E382EC01 C114031581EC0701A2140EA2141C143C143802707F15005C13015C49B5FCA249C7FCA213 0E131E131C4980167E5B13F0485AA21203D80FF014FFD8FFFC011F13F0A22C2F7CAE35> 65 D<011FB512FCEEFF80903A00FE000FC0EE03E04AEB01F017F80101140017FC5CA213 0317F84A1301A20107EC03F017E04AEB07C0EE0F80010FEC3F0016FE9138C007F891B512 E04914F89138C0007C4A7F82013F1580A291C7120FA25BA2017E141FA213FEEE3F005B16 7E00015D4B5A49495A4B5A0003EC3F80B600FEC7FC15F82E2D7BAC32>II<011FB512FCEEFF80903A00FE000FC0EE03E04A EB01F0EE00F80101157C173C4A143E171E0103151FA25CA21307A25CA2130FA24A143FA2 131F173E4A147EA2013F157C17FC91C8FC17F849EC01F0A2017EEC03E0A201FEEC07C0EE 0F8049EC1F00163E00015D5E49495AED07C00003023FC7FCB612FC15E0302D7BAC36>I< 011FB612FEA2903900FE0001EE007E4A143EA20101151E171C5CA21303A25C16E0010713 01170002E05B1503130F15074A485A91B5FC5BECC01F4A6CC7FCA2133FA2DA000E13E0A2 491401030013C0017E1403178001FE14071700495C161E12015E49147CED01FC0003EC0F F8B7FC5E2F2D7CAC30>I<011FB612F8A2903900FE000716014A13001778130117705CA2 1303A25C16E001071301170002E05B1503130F15074A485A91B5FC5BECC01F4A6CC7FCA2 133FA2EC000EA25B92C8FC137EA213FEA25BA21201A25BA21203B512F0A22D2D7CAC2E> I<03FF1318020FEBC03891393F00F07802F8EB38F8D903F0131CD907C0EB0FF0EB1F8049 C71207137E49EC03E0485A485AA2484815C0485AA2485A178048CAFCA25A127EA312FE5A A292B512E0A2923801FE006F5A15015EA3007C14035E127E123E001E1407001F5D6C6C13 0F6C6C133F6C6C13793A00F803F1C090383FFF80D907FCC8FC2D2F75AD37>I<903B1FFF F81FFFF8A2D900FEC7EAFE00A24A5CA2010114015F5CA2010314035F5CA2010714075F5C A2010F140F5F5C91B6FC5B9139C0001F805CA2013F143F94C7FC91C7FCA2495C167E137E A201FE14FE5E5BA2000114015E5BA200031403B500C0B512C0A2352D7BAC35>I<90381F FFF8A2903800FE00A25CA21301A25CA21303A25CA21307A25CA2130FA25CA2131FA25CA2 133FA291C7FCA25BA2137EA213FEA25BA21201A25BA21203B512C0A21D2D7CAC1B>I<91 387FFFE0A2913800FE00A25DA214015DA314035DA314075DA3140F5DA3141F5DA3143F92 C7FCA35CA2147EA2003C13FE127E00FE5BA2495AEAFC0300F05B48485A38700FC0D8781F C8FCEA1FFCEA07F0232E7AAC25>I<90261FFFF8EBFFFEA2D900FEC7EA1FE018804AEC3E 005F01015DEE01E04A495AEE0F8001034AC7FC163C4A5B4B5A0107EB03C04B5A4A48C8FC 153E010F137E15FEECC1FF14C790381FCF3F02DE7FECFC1F02F87FEB3FE04A6C7E1480EC 000749801503017E80A201FE6D7EA2491300820001157E167F5B831203B539C007FFF8A2 372D7BAC37>I<90381FFFFEA2D900FEC7FCA25CA21301A25CA21303A25CA21307A25CA2 130FA25CA2131FA25CA2133FA291C7121CA249143C1638017E1478167001FE14F0A249EB 01E0A200011403ED07C049130FED3F80000314FFB7FC1600262D7BAC2D>III<4AB4FC020F13C091383E03F09138F8007CD903E07FD9 07807F011FC77E013E15804914074915C0485AEE03E0485A485AA2485A121F90C8FC5AA2 003E1507127EA348ED0FC0A3EE1F80A217005E163E167E167C16FC4B5A007C5D4B5A6C4A 5A4B5A6C4AC7FC6C6C133E6D13F83903E003F03901F80FC026007FFFC8FCEB0FF02B2F75 AD37>I<011FB512FCEEFF80903A00FE000FE0EE03F04AEB00F8A20101157CA25C177E13 0317FC5CA20107EC01F8A24AEB03F017E0010FEC07C0EE0F804AEB3F00ED01FC91B512F0 4991C7FC0280C8FCA3133F91C9FCA35B137EA313FE5BA312015BA21203B512C0A22F2D7C AC30>I<4AB4FC020F13C091383E03F09138F800FCD903E0133E49487F011FC7FC013EEC 0F804914074915C012014915E04848140312075B120F485AA248C8FC1607123E127EA348 ED0FC0A3EE1F80A21700485D163E167E6C157C16FC4B5A007C01F05B903903FC03E03A3E 070E07C0903906060F80271F0E071FC7FC390F0C033E018C13F8D803EC5B3901FE0FC03A 007FFF0018EB0FF7D90007133816301670ED80F0ED81E015C3EDFFC0A25E93C7FC6E5AEC 00F82B3B75AD37>I<011FB512E016FC903900FE003FEE0FC04AEB07E016030101EC01F0 A24A14F8A21303EE03F05CA20107EC07E017C04AEB0F80EE1F00010F143E16FC9138C007 F091B512805B9138C00FE091388003F06F7E133F6F7E91C7FCA2491301A2017E5CA201FE 1303A2495C17080001163C17384914E0EEF07800031670B5D8C00113E09238007FC0C9EA 1F002E2E7BAC34>I<91380FF00C91383FFC1C9138F80F3C903903C007BC9039078003FC 90390F0001F8131E491300A24914F0A313F816E0A216007F7F6D7EEB7FF8ECFF806D13E0 6D13F801077F01017FEB001FEC01FF6E7E8181A281121CA35D003C141EA25DA2007E5C5D 007F495A6D485A26F1F01FC7FC38E07FFC38C00FF0262F7BAD28>I<000FB712F0A23A1F E00FE00701001401001E02C013E0481500141F12380078EC8001A20070013F14C012F048 1400A25CC791C7FC147EA214FEA25CA21301A25CA21303A25CA21307A25CA2130FA25CA2 131FA25CA2133F003FB57EA22C2D74AC33>I<3B3FFFF007FFF0A2D801FCC7EA7F00163C 5B16380003157816705BA2000715F05E5BA2000F14015E5BA2001F14035E5BA2003F1407 93C7FC90C7FCA2485C150E127EA2151E00FE141C5A153C153815781570007C5C1401007E 495A003E495A6C49C8FC6C133C3807C0F83801FFE06C6CC9FC2C2E72AC35>III89 D<010FB612C0A2903A1FF8003F8002C0 14004A5B49C712FE013E495A013C495A49495A5E0170130F01F0495A49495A4BC7FC15FE 90C75A14014A5A4A5A4A5A4A5A5D143F4AC8FC14FE495A495A5C49481370130F494813F0 49485B49C7FC017E1301495C00011403485A4848495A485A49130F4848131F003F027FC7 FC397F0003FFB7FC5D2A2D7AAC2C>I92 D97 D<13F8121FA21201A25BA21203A25BA21207A25BA2120FEBC7C0EB9FF0EBF878381F F03CEBE03EEBC01EEB801FEA3F00A2123EA2007E133FA2127CA2147F00FC137E5AA214FC A214F8130114F0EB03E0EA780714C0383C0F80381E3E00EA0FF8EA03E0182F78AD21>I< EB01F8EB0FFE90383E0780EBFC03D801F013C03803E0070007130FEA0FC001801380121F 48C8FCA25A127EA312FE5AA5EC0180007CEB03C0EC0780EC0F006C131E001E137C380F83 F03807FFC0C648C7FC1A1F799D21>I<153EEC07FEA2EC007EA2157CA215FCA215F8A214 01A215F0A21403EB07C390381FF3E0EB7C3BEBF81FEA01F03903E00FC0EA07C0120FEA1F 801580EA3F00141F5A007E1400A25C12FE48133EA2EC7E18153848137CA214FCD8780113 78397C03F870A2393C0F78E0381E1E3D390FF81FC03903E00F001F2F79AD24>III<14F8EB03FE90380F873890381F03F8137EEB7C0113F81201EA03F0 15F0EA07E01403120F01C013E0A21407121F018013C0A2140FA21580141F120F143FEC7F 006C6C5AEA03C33801FFBF38007E3E1300147EA2147CA214FC00385BEAFC015C495A4848 5A38F01F80D87FFEC7FCEA1FF01D2C7C9D21>I<131FEA03FFA2EA003FA2133EA2137EA2 137CA213FCA25BA21201147E9038F3FF809038F787C03903FE03E013FC13F8A2EA07F013 E0A213C0000F130715C01380A2001F130F15801300141F481406150E003E133F143E007E 141EEC7E1C007C137CEC3C3812FC157048EB1FE00070EB07801F2F7BAD24>I<130E131F EB3F80A2EB1F00130E90C7FCA9EA03E0EA0FF0EA1E78EA1C7C12381278127013FCEAF0F8 12E012E1EAC1F0120112035B12075BA2120F13831387121F13075BEA3F0E123EEA1E1C13 3C1338EA0FF0EA03C0112E7AAC16>II<131FEA03FFA2EA003FA2133EA2137EA2137CA213 FCA25BA21201EC01E09038F007F0EC1E380003EB3878EC71F8EBE0E1EBE1C13807E381EC 00E049130013CEEA0FFC13F0A213FF381F9FC0EB87E0EB03F01301003F14301570123EA2 007E14F015E0007C13E014E100FC14C0903800F38048EB7F000070131E1D2F7BAD21>I< 137CEA0FFCA21200A213F8A21201A213F0A21203A213E0A21207A213C0A2120FA21380A2 121FA21300A25AA2123EA2127EA2127CA2EAFC30137012F8A213F013E012F012F113C012 FBEA7F80EA1E000E2F7AAD12>I<3B07801FC007F03B1FE07FF01FFC3B3DF1E0F8783E3B 38F3C078F01E3B78FF007DC01FD870FEEB7F80A2D8F1FC1400D8E1F8137EA249137C00C3 02FC5B0003163E495BA200070101147E177C01C05B17FC000F0103ECF83018700180EBE0 0117F0001F010715F0040313E0010001C013E0EFE1C048010F1301EFE380003E91398000 FF00001C6DC7123C341F7A9D3A>I<3907801FC0391FE07FF0393DF1E0F83938F3C07839 78FF007CEA70FEA2EAF1FCEAE1F8A25B00C314FC00035C5BA2000713015D13C01403000F ECE0C015E1EB800715C1001F14C3020F13800100138391380787005A158E003EEB03FC00 1CEB00F0221F7A9D28>II<90383C01 F09038FF07FC3901E79E1E9038C7BC0F000301F81380903887F00702E013C038078FC013 0F1480A2D8061F130F12001400A249131F1680133EA2017EEB3F00A2017C133E157E01FC 137C5DEBFE015D486C485AEC0F80D9F3FEC7FCEBF0F8000390C8FCA25BA21207A25BA212 0FA2EAFFFCA2222B7F9D24>I<903807C06090381FF0E0EB7C39EBF81FEA01F03903E00F C0EA07C0120FEA1F801580EA3F00A248131F007E1400A300FE5B48133EA3147E48137CA2 14FCEA7801387C03F8A2EA3C0FEA1E1F380FF9F0EA03E1EA000113035CA313075CA2130F A23801FFFCA21B2B799D21>I<3807803E391FE0FF80393CF3C1C03938F781E03878FF07 EA70FE13FC12F139E1F8038091C7FC5B12C312035BA21207A25BA2120FA25BA2121FA290 C8FCA25AA2123E121C1B1F7A9D1E>II< 131C133EA2137EA2137CA213FCA25BA21201A2B512E0A23803F000A25BA21207A25BA212 0FA25BA2121FA290C7FCA24813C01301123E130314801307003C1300130E131E6C5AEA0F F0EA07C0132B7AA918>II<3903C001C0390FF003E0391E7807F0EA1C7C123800781303007013 0113FCD8F0F813E012E000E1130038C1F001000114C0120313E014030007148013C0A2EC 0700120F1380140EA25C12076D5A00035B6D5AC6B45A013FC7FC1C1F7A9D21>II<90383E01F090 38FF87F83903C7DE1E380783DC903803F87EEA0E01001E13F0EA1C03003C14380038EBE0 00A2EA300700005BA3130F5CA3011F1318153814001238D87C3F137012FC15E0EB7F0139 F0FF03C03970E78780393FC3FE00381F00F81F1F7C9D21>II<010F13E0EB3F80EBFFC1ECE3C048EBF3803803E0FF 9038C03F00EB801E00075BC7123814785C495A495A495A49C7FC131E5B5B9038F0018038 01E003EA03C038078007390F000F00EA1FE0EBF83E383C7FFE486C5A38701FF838F00FF0 38E007C01B1F7C9D1D>II<381C01C0387F07F0EAFF0FA400FE13E0 3838038014086EAD24>127 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fj cmtt8 7 3 /Fj 3 111 df<1370EA01FCA5EA007090C7FCA5EA7FF8487EA2127FEA007CB1387FFFFC B5FCA27E16257CA41F>105 D<127F487EA2127F1207A7903883FFC0018713E0A2018313 C0903880FC00EB81F8EB83F0EB87E0EB8FC0EB9F8001BFC7FCEBFF80808013F3EBE1F0EB C1F8EB80FC147C80143F397FF87FE039FFFCFFF0A2397FF87FE01C247FA31F>107 D<387F83F838FFCFFC90B5FC7E3907FE1F8013F8EBF00F13E0A213C0AC397FFC3FF839FF FE7FFCA2397FFC3FF81E1980981F>110 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fk eufm7 7 1 /Fk 1 104 df<0107134090381FC1C0EB7FFF48B51280EA03BFEA0F83EB800F381F0007 140FACEB801FEBC07F9038E0EFC0EBF38F380FFF07EA07FCD803F813E0EA01F013C03903 8003C0D807001380D81F801300383FC006387FF00438FFFC18380FFFF06C5B00015B6C6C 5A1B277D9A23>103 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fl cmbxti10 10 6 /Fl 6 116 df101 D<143C147F495A15805B1500A25C6D5AEB007091C7FCAB133FEBFFC000037F3807C7F038 0F87F8EA1F07A2EA3E0FA2127C131F5C12FCEAF83F00005B137F5CA213FF5CA25A91C7FC 5A5BEC0F801207EBFC1F1500120F495A143E5C13F000075BEBF1F06CB45AC65B013EC7FC 193C79BA1E>105 D 108 DI<90390F C003FC903A3FF00FFF8090267FFC3F13E0903A7DFEFE0FF0903AF8FFF807F800019138F0 03FC4913C001F115FED803E113801500A2EA07E313C35CEA000301071407A25CA2010F14 0F17FC5CA2011F141F17F85CEE3FF0133F17E04AEB7FC0A2017FECFF806E4813004B5A6E 485A9039FFFC0FF091B512C0029F90C7FCEC87F8480180C8FCA291C9FCA25AA25BA21207 A25B387FFFE0B57EA25C2F367EA531>112 D115 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fm cmmi8 8 49 /Fm 49 127 df11 D<131FD9FFC013304801F0137000076D13604815 E0D9807C13C0391E003C0148011E13800038EB0E03480107130000605CEC030612E0C713 8EEC018C159C159815B815B0A215F05DA35DA25DA21403A44AC7FCA4140EA45CA3141824 2C7F9D24>13 DI<1460A5EC7FF0EC3FF814FF903803CF E0903807800049C7FC131E5B5B5BA2485A485AA2485A48C8FCA25A121E123E123CA3127C 1278A412F8A4127CA2127E127F6C7E13E0EA1FFC6CB47E6C13F000017F38003FFCEB07FE 1300143F80A280141EA2EB601CEB7838EB1FF0EB07C01D3C7DAD1F>16 D<147C49B4FC903803C78090380783C090381F03E0EB1E01133E017C13F013F8A2EA01F0 120313E01207A2EA0FC01403A2EA1F80A21407003F14E0130090B5FCA2397F000FC0127E A2141F1580127C00FC14005CA2147EA248137C14FC00785B495AA2387C03E0383C07C049 5A001C90C7FCEA1E3EEA0FF8EA03E01C307DAE21>18 D<13FC13FFEB1FC0130F6D7EA36D 7EA2130180A26D7EA3147EA280A36E7EA2140F81A24A7E143F147FECF3F0EB01E3EB03C1 90380781F8130F49C67E133E5B49137E485A48487F1207485A4848EB1F8048C7FC127E48 EC0FC048EC07E000701403232F7DAD29>21 D<90B612F812035A4815F03A1E0380C00000 3C130000701301130700E05CEAC00638000E03A3131CA2133C140713381378A201F07FA2 1201A2D803E07FA20007130313C0A26C486C5A251E7E9C29>25 DI<0103B512F0 131F137F90B612E03A01FC1F80003903F00FC03807C00748486C7E121F1300123EA25AA2 140700FC5C5AA2140F5D141F92C7FC143E0078133C147C007C5B383C01E0381F07C0D807 FFC8FCEA01F8241E7D9C28>I<90B6128012035A481500261E00E0C7FC5A00705B130112 E012C0EA0003A25CA21307A349C8FCA35BA2131E133EA45BA21338211E7E9C1F>I34 D<123C127E12FFA4127E123C08087A8714>58 D<123C127EB4FCA21380A2127F123D1201A312031300A25A1206120E5A5A5A126009157A 8714>I<15C0140114031580A214071500A25C140EA2141E141CA2143C143814781470A2 14F05CA213015CA213035C130791C7FCA25B130EA2131E131CA2133C1338A21378137013 F05BA212015BA212035BA2120790C8FC5A120EA2121E121CA2123C1238A212781270A212 F05AA21A437CB123>61 D<1670A216F01501A24B7EA21507150DA2151915391531ED61FC 156015C0EC0180A2EC03005C14064A7F167E5C5CA25C14E05C4948137F91B6FC5B0106C7 123FA25B131C1318491580161F5B5B120112031207000FED3FC0D8FFF8903807FFFEA22F 2F7DAE35>65 D<013FB6FC17C0903A00FE0007F0EE01F84AEB00FC177E1301177F5CA213 03177E4A14FEA20107EC01FC17F84AEB03F0EE07E0010FEC1FC0EE7F009138C003FC91B5 5A4914FE9139C0003F804AEB0FC017E0013F140717F091C7FC16035BA2017E1407A201FE 15E0160F4915C0161F0001ED3F80EE7F004914FEED03F80003EC0FF0B712C003FCC7FC30 2D7CAC35>I<92387FC003913903FFF80791391FC03E0F91397E00071FD901F8EB03BF49 48EB01FED90FC013004948147E49C8FC017E157C49153C485A120348481538485AA2485A 173048481500A2127F90CAFCA35A5AA5EE018016031700A2007E5D1606160E6C5D5E6C6C 5C000F5D6C6C495A6C6CEB0780D801F8011EC7FCD8007E13F890381FFFE0010390C8FC30 2F7CAD32>I<013FB512FEEEFFC0903A00FE0007F0EE01F84AEB007E8301018118804A14 0F18C00103150718E05CA21307A25CA2130FA24A140FA2131F18C04A141FA2013F168017 3F91C81300A249157EA2017E5D5F01FE14014C5A494A5A4C5A00014BC7FC163E4914FCED 03F00003EC1FC0B7C8FC15F8332D7CAC3A>I<013FB71280A2D900FEC7127F170F4A1407 A20101150318005CA21303A25C16300107147094C7FC4A136016E0130F15019138C007C0 91B5FC5BECC0074A6C5AA2133FA20200EB000CA249151C92C71218017E1538173001FE15 705F5B4C5A000115034C5A49140F161F00034AB4C7FCB8FC5E312D7DAC34>I<92387FC0 03913903FFF80791391FC03E0F91397E00071FD901F8EB03BF4948EB01FED90FC0130049 48147E49C8FC017E157C49153C485A120348481538485AA2485A173048481500A2127F90 CAFCA35A5AA292381FFFFCA29238003FC0EE1F80163F1700A2127E5E167E7EA26C6C14FE 000F4A5A6C7E6C6C1307D801F8EB1E3CD8007EEBFC3890391FFFE018010390C8FC302F7C AD37>71 D<90273FFFFC0FB5FCA2D900FEC7EA3F80A24A1500A201015D177E5CA2010315 FE5F5CA2010714015F5CA2010F14035F5C91B6FC5B9139C00007E05CA2013F140F5F91C7 FCA249141F5F137EA201FE143F94C7FC5BA200015D167E5BA2000315FEB539E03FFFF8A2 382D7CAC3A>I<90263FFFFC90381FFF80A2D900FEC73803F80018E04AEC07804DC7FC01 01151C5F4A14E04C5A01034A5A040EC8FC4A5B5E010714E04B5A9138E00780030EC9FC01 0F131F157F4A487E14C190391FC71FC014CEEC9C0F02F07F90383FE00702C07FEC000382 5B6F7E137E6F7E13FE167F5B707E1201161F4981831203B539E001FFFEA2392D7CAC3C> 75 D77 DI<013FB6FC17E0903A00FE0007F0EE01FC4AEB007EA2010181A25C1880 010316005F5CA2010715FEA24A5C4C5A010F4A5A4C5A4AEB1F8004FFC7FC91B512F84914 C00280C9FCA3133F91CAFCA35B137EA313FE5BA312015BA21203B512E0A2312D7DAC2D> 80 D<013FB512F816FF903A00FE001FC0EE07E04A6D7E707E01016E7EA24A80A213034C 5A5CA201074A5A5F4A495A4C5A010F4A5A047EC7FC9138C003F891B512E04991C8FC9138 C007C04A6C7E6F7E013F80150091C77EA2491301A2017E5CA201FE1303A25BA20001EE03 8018005B5F0003913801FC0EB5D8E000133CEE7FF0C9EA0FC0312E7CAC35>82 D<913807F00691383FFE0E9138F80F9E903903E001FE903807800049C7127C131E49143C A2491438A313F81630A26D1400A27FEB7F8014F86DB47E15F06D13FC01077F01007F141F 02011380EC003F151F150FA215071218A3150F00381500A2151EA2007C5C007E5C007F5C 397B8003E039F1F00F8026E07FFEC7FC38C00FF0272F7CAD2B>I<000FB8FCA23B1FC003 F8003F0100151F001C4A130E123C003801071406123000704A130EA20060010F140C12E0 485CA2141FC715005DA2143FA292C8FCA25CA2147EA214FEA25CA21301A25CA21303A25C A21307A25C130F131F001FB512F0A2302D7FAC29>I<3B7FFFF801FFFEA2D801FCC7EA0F C0178049EC070016060003150E160C5BA20007151C16185BA2000F153816305BA2001F15 7016605BA2003F15E05E90C8FCA24814015E127EA2150300FE92C7FC5A5D1506150E007C 5C151815386C5C5D6CEB03C0260F800FC8FC3803E03C3801FFF038003FC02F2E7BAC30> III<0107B612F8A2903A0FFC0007F002E0EB0FE00280EB1FC049C71380011E143F 011CEC7F004914FE4B5A0130495A0170495A0160495A4B5A4B5A90C748C7FCA215FE4A5A 4A5A4A5A4A5A4A5A4A5A4AC8FC14FE5C130149481306495A4948130E4948130C495A49C7 121C01FE141848481438485A5E484814F048481301484813034848495A48C7127FB7FC5E 2D2D7CAC30>90 D 97 D99 D<151FEC03FFA2EC003FA2153EA2157EA215 7CA215FCA215F8A21401EB07E190381FF9F0EB7C1DEBF80FEA01F03903E007E0EA07C012 0FEA1F8015C0EA3F00140F5A007E1480A2141F12FE481400A2EC3F021506143E5AEC7E0E 007CEBFE0C14FC0101131C393E07BE18391F0E1E38390FFC0FF03903F003C0202F7DAD24 >II<157C4AB4FC91 3807C380EC0F87150FEC1F1FA391383E0E0092C7FCA3147E147CA414FC90383FFFF8A2D9 00F8C7FCA313015CA413035CA413075CA5130F5CA4131F91C8FCA4133EA3EA383C12FC5B A25B12F0EAE1E0EA7FC0001FC9FC213D7CAE22>I<14FCEB03FF90380F839C90381F01BC 013E13FCEB7C005B1201485A15F8485A1401120F01C013F0A21403121F018013E0A21407 A215C0A2000F130F141F0007EB3F80EBC07F3803E1FF3800FF9F90383E1F0013005CA214 3EA2147E0038137C00FC13FC5C495A38F807E038F00F80D87FFEC7FCEA1FF81E2C7E9D22 >I<131FEA03FFA2EA003FA2133EA2137EA2137CA213FCA25BA21201143F9038F1FFC090 38F3C1F03803FF0001FC7F5BA2485A5BA25B000F13015D1380A2001F13035D1300140748 ECC04016C0003E130F1580007E148191381F0180007C1403ED070000FCEB0F06151E48EB 07F80070EB01E0222F7DAD29>I<1307EB0F80EB1FC0A2EB0F80EB070090C7FCA9EA01E0 EA07F8EA0E3CEA1C3E123812301270EA607EEAE07C12C013FC485A120012015B12035BA2 1207EBC04014C0120F13801381381F01801303EB0700EA0F06131EEA07F8EA01F0122E7E AC18>I<131FEA03FFA2EA003FA2133EA2137EA2137CA213FCA25BA2120115F89038F003 FCEC0F0E0003EB1C1EEC387EEBE07014E03807E1C09038E3803849C7FC13CEEA0FDC13F8 A2EBFF80381F9FE0EB83F0EB01F81300481404150C123EA2007E141C1518007CEBF038EC F83000FC1470EC78E048EB3FC00070EB0F801F2F7DAD25>107 D<27078007F0137E3C1F E01FFC03FF803C18F0781F0783E03B3878E00F1E01263079C001B87F26707F8013B00060 010013F001FE14E000E015C0485A4914800081021F130300015F491400A200034A130760 49133E170F0007027EEC8080188149017C131F1801000F02FCEB3F03053E130049495C18 0E001F0101EC1E0C183C010049EB0FF0000E6D48EB03E0391F7E9D3E>109 D<3907C007E0391FE03FF83918F8783E393879E01E39307B801F38707F00126013FEEAE0 FC12C05B00815C0001143E5BA20003147E157C5B15FC0007ECF8081618EBC00115F0000F 1538913803E0300180147016E0001F010113C015E390C7EAFF00000E143E251F7E9D2B> I<90387C01F89038FE07FE3901CF8E0F3A03879C0780D907B813C0000713F000069038E0 03E0EB0FC0000E1380120CA2D8081F130712001400A249130F16C0133EA2017EEB1F80A2 017C14005D01FC133E5D15FC6D485A3901FF03E09038FB87C0D9F1FFC7FCEBF0FC000390 C8FCA25BA21207A25BA2120FA2EAFFFCA2232B829D24>112 D<903807E03090381FF870 90387C1CF0EBF80D3801F00F3903E007E0EA07C0000F1303381F800715C0EA3F00A24813 0F007E1480A300FE131F481400A35C143E5A147E007C13FE5C1301EA3E07EA1F0E380FFC F8EA03F0C7FC13015CA313035CA21307A2EBFFFEA21C2B7D9D20>I<3807C01F390FF07F C0391CF8E0E0383879C138307B8738707F07EA607E13FC00E0EB03804848C7FCA2128112 015BA21203A25BA21207A25BA2120FA25BA2121FA290C8FC120E1B1F7E9D20>II<130E131FA25BA2133EA2137EA2137CA2 13FCA2B512F8A23801F800A25BA21203A25BA21207A25BA2120FA25BA2001F1310143013 001470146014E0381E01C0EB0380381F0700EA0F0EEA07FCEA01F0152B7EA919>I<15C0 EC01E0140015F01570007FB512FCB6FC7EC7EA01F0EC03E0EC0780150014061E0D74AE23 >126 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fn cmmi6 6 18 /Fn 18 114 df21 D<127812FCA212FEA2127E1206 A3120CA2121C121812301260124007107A8513>59 D<140C141C143C1438A21478147014 F014E0130114C0A21303148013071400A25B130E131E131CA2133C13381378137013F05B A212015B12035BA2120790C7FC5A120EA2121E121C123C123812781270A212F05AA21631 7CA420>61 D<151815381578157C15FC1401A2EC037C14071406EC0C7EEC1C3E14181430 A21460ECC03FA249487EEB0300A213065B010FB512805B903838000F13305B13E05B4848 14C00003140790C7FCD80F80130FD8FFE0EBFFFE16FC27247DA32E>65 D<90B6FC16E0903907C003F8ED00FC4948133E161E161FEE0F8049C7FCA317C0133EA449 1580161FA21700495CA2163E5E485A5E4B5A4B5A4848495A4B5A033EC7FC0007EB01F8B6 12E092C8FC2A227CA132>68 D83 D85 DI<3CFF FC01FFF007FF5C270FC0003FC712F849166018C07F00074AEB018003DF13031800DA019F 13061403031F5B0206141CEE80189026E00C0F5B0003131C02185C023014E05F0260EB81 8014E002C00183C7FCD9E18013C601F11307D9F30013CCEA01F701F614D801FC14F0A249 5C5B5E495C15036C4891C8FC38237CA139>I<131FEBFF8C3801E0DE3803807E3807007C 48133C121E123E003C5B127CA3485BA215401560903801E0C012781303393807E180391C 1CF300380FF87F3807E03C1B177E9522>97 D101 D<140FEC3FC0EC71E014E3A2010113C0EC E180ECE000495AA5495AA2EBFFFEA2EB0780A249C7FCA5131EA65BA55BA31370A2EA38F0 EA78E012F8EAF9C0EA7180007FC8FC121E1B2F7CA31E>II<1338137CA2137813701300A7EA0780EA1FC0EA38E01230EA60F0EAC1E0A3 EA03C0A3EA0780A2EA0F0013041306EA1E0CA21318121CEA1E70EA0FE0EA07800F237DA1 16>105 D<1418143C147CA214381400A7EB0780EB1FE01338EB60F013C0A2EA0180A238 0001E0A4EB03C0A4EB0780A4EB0F00A4131EA21238EA783CEAF8381378EA70F0EA7FC000 1FC7FC162D81A119>I<13F8EA0FF0A21200A2485AA4485AA43807801E147FEB81C3EB83 87380F060F495A1318EB700E4848C7FCA213FCEA1E7EEA3C0F80EB0781158039780F0300 A21402EB070600F0138CEB03F8386000F019247CA221>I<000F13FC381FC3FF3931C707 803861EC0301F813C0EAC1F0A213E03903C00780A3EC0F00EA0780A2EC1E041506D80F00 130C143C15181538001EEB1C70EC1FE0000CEB07801F177D9526>110 D113 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fo cmr8 8 91 /Fo 91 128 df0 D<156015F0A24A7E4A7EA24A7E1406EC0E7F14 0C91381C3F8014184A6C7E150F02607F150702C07F1503D901807F1501D903007F496D7E 1306010E147F130C011C6E7E131801386E7E1330496E7E160749811603484881160148C8 7F486F7E1206000E167F120C001CEE3F801218003FB812C0A24817E0A2B912F0342F7DAE 3B>II10 D<9138FF807E01079038E1 FF80903A1F807FC3C0D93E00EB87E049EBFF074913FE485A00039138FC018049017CC7FC AAB712FCA22703E0007CC7FCB3A6486C13FE3A7FFF0FFFF0A22B2F7FAE29>I<14FF0107 13E090381F80F090383E003849137C4913FC485A1203491378153092C7FCA7157CB612FC A23803E000157CB3A5486C13FE3A7FFF0FFFE0A2232F7FAE27>II<91397F800FF0903A03FFE07FFE903A1FC079F80F903B3E001F E003804990393FC007C04990387F800F48481400A24848017EEB0780033EEB030094C7FC A7EF07C0B9FCA23B03E0003E000F1707B3A5486C017FEB0FE03C7FFF07FFF0FFFEA2372F 7FAE3B>I<13E0EA01F01203A2EA07E0EA0FC0EA1F00121E5A5A12E012400C0C72AD23> 19 D<123C127E12FFA7127EA9123CAA1218A41200A7123C127E12FFA4127E123C082F7A AE14>33 D<003C13F0387E01F838FF03FCA2EB83FEA2EA7F81383D80F600011306A30003 130EEB000CA248131C00061318000E13384813704813E0387001C00060138017157EAD23 >I38 D<123C127EB4FCA21380A2127F123D1201A312031300A25A1206120E5A5A5A126009157A AD14>I<13031307130E131C1338137013F0EA01E013C01203EA0780A2EA0F00A2121EA3 5AA45AA512F8A25AAB7EA21278A57EA47EA37EA2EA0780A2EA03C0120113E0EA00F01370 1338131C130E1307130310437AB11B>I<12C07E12707E7E7E120FEA0780120313C0EA01 E0A2EA00F0A21378A3133CA4131EA5131FA2130FAB131FA2131EA5133CA41378A313F0A2 EA01E0A2EA03C013801207EA0F00120E5A5A5A5A5A10437CB11B>I43 D<123C127EB4FCA21380A2127F123D1201A31203 1300A25A1206120E5A5A5A126009157A8714>II<123C127E12FF A4127E123C08087A8714>I<15C0140114031580A214071500A25C140EA2141E141CA214 3C143814781470A214F05CA213015CA213035C130791C7FCA25B130EA2131E131CA2133C 1338A21378137013F05BA212015BA212035BA2120790C8FC5A120EA2121E121CA2123C12 38A212781270A212F05AA21A437CB123>II<130C133C137C EA03FC12FFEAFC7C1200B3B113FE387FFFFEA2172C7AAB23>III<140EA2141E143EA2147E14FEA2EB01BE1303143E1306130E130C1318 13381330136013E013C0EA0180120313001206120E120C5A123812305A12E0B612FCA2C7 EA3E00A9147F90381FFFFCA21E2D7EAC23>I<000CEB0180380FC01F90B512005C5C14F0 14C0D80C7EC7FC90C8FCA8EB1FC0EB7FF8380DE07C380F801F01001380000E130F000CEB 07C0C713E0A2140315F0A4127812FCA448EB07E012E0006014C00070130F6C14806CEB1F 006C133E380780F83801FFE038007F801C2D7DAB23>II<1230123C003FB512F8A215F05A15E039700001C000601480140348EB07 00140E140CC7121C5C143014705C495AA2495AA249C7FCA25B130E131EA2133EA3133C13 7CA413FCA913781D2E7CAC23>III<123C127E 12FFA4127E123C1200AD123C127E12FE12FFA3127F123F1203A312071206A2120E120C12 1C1218123812701260082A7A9C14>59 D61 D<4A7E4A7EA34A7EA24A7EA3EC1BF81419A2EC30FCA2EC70FEEC607EA24A7EA349486C7E A2010380EC000FA201066D7EA3496D7EA2011FB57EA29038180001496D7EA349147EA201 E0147F4980A20001ED1F801203000716C0D80FF0EC3FE0D8FFFC0103B5FCA2302F7EAE35 >65 DIIIIIIII<90387FFFF0A201001300147EB3AD123812FEA314FE5C1278 387001F86C485A381E07E03807FF80D801FCC7FC1C2E7DAC24>IIIIIIIII<90383F80303901FFF0703807C07C390F000E F0001E13074813034813011400127000F01470A315307EA26C1400127E127FEA3FE013FE 381FFFE06C13FC6C13FF00011480D8003F13E013039038003FF0EC07F81401140015FC15 7C12C0153CA37EA215787E6C14706C14F06CEB01E039F78003C039E3F00F0038E07FFE38 C00FF01E2F7CAD27>I<007FB712F8A29039000FC003007C150000701638A200601618A2 00E0161CA248160CA5C71500B3A94A7E011FB512E0A22E2D7EAC33>II< B500C090380FFFC0A2D807FCC73803FE006C48EC00F800015E5F6C7E5F6D1401017E5DA2 6D4AC7FCA26E5B011F140680010F5CA26D6C5BA26E133801031430A26D6C5BA26E13E001 005C8091387E0180A26E48C8FCA21583EC1F86A2EC0FCCA215FC6E5AA26E5AA36E5AA26E 5A322E7FAC35>II<3B7FFFE003FFF8A2000390C713806C48EC7E 000000157C017F14786D14706E5B6D6C5B6D6C485A15036D6C48C7FC903803F80601015B ECFC1C6D6C5AEC7F305DEC3FE06E5A140F816E7E81140DEC1DFCEC38FEEC307F14609138 E03F8049486C7EEC800FD903007F496D7E010E6D7E130C011C6D7E496D7E49147E167F01 F0EC3F80000316C0D80FF8EC7FE0D8FFFE0103B5FCA2302D7EAC35>II<003FB612C0A29038F000 1F0180EB3F80003EC7EA7F00123C003814FE4A5A5A4A5A4A5A12604A5A4A5AA2C7485A4A C7FCA214FE495AA2495A5C1307495AA2495A495A166049C7FC13FEA2485A484814E0A248 5A484814C01501485A48481303150748C7121F00FE14FFB7FCA2232D7CAC2B>II<0003130C48131C000E13384813704813E0 003013C0EA700100601380A2EAE00300C01300A300DE137800FF13FCEB83FEA2EA7F81A2 383F00FC001E1378171577AD23>II<13FF 000713C0380F01F0381C00F8003F137C80A2143F001E7FC7FCA4EB07FF137F3801FE1FEA 07F0EA1FC0EA3F80EA7F00127E00FE14065AA3143F7E007E137F007FEBEF8C391F83C7FC 390FFF03F83901FC01E01F207D9E23>97 DII<15F8141FA214011400ACEB0FE0EB7FF83801F81E3803E007 3807C003380F8001EA1F00481300123E127EA25AA9127C127EA2003E13017EEB8003000F 13073903E00EFC3A01F03CFFC038007FF090391FC0F800222F7EAD27>III<013F13F89038FFC3FE3903E1 FF1E3807807C000F140C391F003E00A2003E7FA76C133EA26C6C5A00071378380FE1F038 0CFFC0D81C3FC7FC90C8FCA3121E121F380FFFF814FF6C14C04814F0391E0007F8481300 48147C12F848143CA46C147C007C14F86CEB01F06CEB03E03907E01F803901FFFE003800 3FF01F2D7E9D23>III<130FEB1F80EB3FC0A4EB1F80EB0F0090C7FCA8EB07C013FFA2130F1307B3AD123012 7838FC0F80A21400485AEA783EEA3FF8EA07E0123C83AD16>II< EA07C012FFA2120F1207B3B3A3EA0FE0EAFFFEA20F2E7EAD14>I<2607C07FEB07F03BFF C3FFC03FFC903AC783F0783F3C0FCE01F8E01F803B07DC00F9C00F01F8D9FF8013C04990 387F000749137EA249137CB2486C01FEEB0FE03CFFFE0FFFE0FFFEA2371E7E9D3C>I<38 07C0FE39FFC3FF809038C703E0390FDE01F0EA07F8496C7EA25BA25BB2486C487E3AFFFE 1FFFC0A2221E7E9D27>II<3807C0FE39FFC7FF8090 38CF03E0390FDC01F03907F800FC49137E49133E49133FED1F80A3ED0FC0A8151F1680A2 ED3F00A26D137E6D137C5D9038FC01F09038CE07E09038C7FF80D9C1FCC7FC01C0C8FCA9 487EEAFFFEA2222B7E9D27>I<90380FE01890387FF8383801F81C3903E00E783807C007 390F8003F8001F1301EA3F00A2007E1300A212FE5AA8127EA36C13017EEB8003380FC007 3803E00E3801F03C38007FF0EB1FC090C7FCA94A7E91381FFFC0A2222B7E9D25>I<3807 81F838FF87FEEB8E3FEA0F9CEA07B813B0EBF01EEBE000A45BB0487EB5FCA2181E7E9D1C >I<3801FE183807FFB8381E01F8EA3C00481378481338A21418A27E7EB41300EA7FF06C B4FC6C13C06C13F0000113F838001FFC130138C0007E143EA26C131EA27EA26C133CA26C 137838FF01F038E3FFC000C0130017207E9E1C>I<1360A413E0A312011203A21207121F B512F0A23803E000AF1418A714383801F03014703800F860EB3FE0EB0F80152A7FA81B> II<3AFFFC01FFC0A23A0FE0007E000007147C 15380003143015706C6C1360A26C6C5BA390387C0180A26D48C7FCA2EB3F07EB1F06A2EB 0F8CA214DCEB07D8A2EB03F0A36D5AA26D5A221E7F9C25>I<3BFFFC3FFE07FFA23B0FE0 03F001F801C09038E000F00007010114E0812603E00314C0A2913807F8012701F0067813 80A29039F80E7C030000D90C3C1300A290397C181E06A2151F6D486C5AA2168C90391F60 0798A216D890390FC003F0A36D486C5AA36DC75A301E7F9C33>I<3AFFFC07FF80A23A0F F003FC000003EB01F0000114C06D485A000091C7FCEB7C06EB3E0E6D5A14B8EB0FB0EB07 E013036D7E497E1307EB067C497EEB1C1F01387FEB700F496C7E6E7ED803C07F00076D7E 391FE003FC3AFFF007FFC0A2221D7F9C25>I<3AFFFC01FFC0A23A0FE0007E000007147C 1538000314306D137000011460A26C6C5BA2EBFC01017C5BEB7E03013E90C7FCA2EB1F06 A2148EEB0F8CA2EB07D8A2EB03F0A36D5AA26D5AA2495AA2130391C8FC1278EAFC06A25B 131CEA7838EA7070EA3FE0EA0F80222B7F9C25>I<003FB51280A2EB003F003C14000038 137E00305BEA700100605B495A495A130F00005B495A49C7FC5B137E9038FC0180EA01F8 120313F03807E003EA0FC0001F1400138048485A007E5B00FE133FB6FCA2191D7E9C1F> III<38078008380FE01C381FF838383F FFF038707FE038E01FC03840078016077AAC23>126 D<001C13E0387F03F8A200FF13FC A2007F13F8A2381C00E016087AAD23>I E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fp cmr6 6 16 /Fp 16 117 df<130C1338137013E0EA01C0EA038013005A120EA25AA25AA312781270A3 12F0AB1270A312781238A37EA27EA27E7E1380EA01C0EA00E013701338130C0E317AA418 >40 D<12C012707E7E7E7E7E1380EA01C0A2EA00E0A21370A313781338A3133CAB1338A3 13781370A313E0A2EA01C0A2EA038013005A120E5A5A5A12C00E317CA418>I<1438B2B7 12FEA3C70038C7FCB227277C9F2F>43 D<13FF000313C0380781E0380F00F0001E137848 133CA248131EA400F8131FAD0078131EA2007C133E003C133CA26C13786C13F0380781E0 3803FFC0C6130018227DA01E>48 D<13E01201120712FF12F91201B3A7487EB512C0A212 217AA01E>II<13FF000313C0380F03E0381C 00F014F8003E13FC147CA2001E13FC120CC712F8A2EB01F0EB03E0EB0FC03801FF00A238 0003E0EB00F01478147C143E143F1230127812FCA2143E48137E0060137C003813F8381E 03F0380FFFC00001130018227DA01E>I<14E01301A213031307A2130D131D1339133113 6113E113C1EA01811203EA07011206120C121C12181230127012E0B6FCA2380001E0A6EB 03F0EB3FFFA218227DA11E>I54 D<137F3803FFC0380781E0380E00704813380018131C1238A3123C003F133838 1FC078EBE0F0380FF9E03807FF80120114C0000713F0380F0FF8381C03FC383801FE3870 007E141F48130F1407A314060070130E0078130C6C1338001F13F03807FFC0C613001822 7DA01E>56 D61 D<120C123FA4120CC7FCA712 0FB4FCA2121F7EB0EAFFE0A20B237DA212>105 D<380F07F038FF1FFCEB703E381FC01E 6C487EA21300AE39FFF0FFF0A21C167D9522>110 D<137E3803FFC0380781E0380F00F0 001E137848133CA248131EA200F8131FA70078131E007C133E003C133C003E137C6C13F8 380F81F03803FFC0C6130018187D961E>I<380F07F038FF3FFCEB703F391FC00F80390F 8007C01300EC03E0A2EC01F0A7EC03E0A2EC07C0018013809038C01F00EB703EEB3FFCEB 07E090C8FCA7EAFFF0A21C207D9522>I<487EA41203A21207A2120F123FB51280A23807 8000AA14C0A63803C180EBE300EA01FEEA007C12207E9E18>116 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fq cmbx12 17.28 2 /Fq 2 64 df33 D<91380FFFF849B612C0010F15F8013F15FE496F7E2701FFF80080480180011F13F0D807 FCC700077FD80FF080484882003F8301F880486C827FB5178080A76C90C7FC4C14006C5A 6C5AD807F04A5BC95C5E4C5B604C5B4C138093B5C7FC4B13FC5F4B13E05F4B5B4B90C8FC 5E5E4B5A5E4B5AA25E4B5AA293C9FCA215FEA35DAE5D92CAFCABEC01FCEC07FF4A7F023F 13E0A24A7FA291B57EA76E5BA26E5BA2020F13806E90C9FCEC01FC396577E44C>63 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fr cmbx5 5 1 /Fr 1 50 df<131C137CEA0FFC12FFA212F01200B3387FFFF8A3151C7B9B1F>49 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fs cmbx7 7 1 /Fs 1 50 df49 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Ft msbm5 5 1 /Ft 1 124 df<1506D803F0133FD80FF813FF001FEB03FE9038F00FFC3900303FF0ECFF C001631300EB6FFEEBFFF614CC0003130C380FFC18393FF01FF8D8FFC013F0010013E000 FC1480006090C7FC20127B9127>123 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fu cmex7 7 2 /Fu 2 99 df80 D<1440EB01F0EB07FCEB1FFF90387F BFC03901FE0FF03907F001FC391F80003F007EC7EA0FC000F0EC01E000C0EC0060230B7F AA26>98 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fv msam7 7 1 /Fv 1 3 df2 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fw msam10 10 3 /Fw 3 33 df<007FB812F8B912FCA348C912016C16036D15076D150FD8F7E0ED1FBCD8F3 F0ED3F3CD8F1F8157ED8F0FC15FC017EEC01F86DEC03F06D6CEB07E06D6CEB0FC06D6CEB 1F806D6CEB3F006D6C137E6D6C5B91387E01F86E485A91381F87E091380FCFC06EB45A6E 90C7FC6E5A6E5AA24A7E4A7E4A7F91380FCFC091381F87E091383F03F091387E01F84A6C 7E4948137E49487F4948EB1F804948EB0FC04948EB07E049C7EA03F0017EEC01F849EC00 FCD8F1F8157ED8F3F0153FD8F7E0ED1FBCB448ED0FFC49150790C91203481601B9FCA36C 17F836387BB741>2 D<05381370A2717FA2717F191E71130E716C7E9538C00380DD01E0 13C0943900F001E095387800F0007FBA12FCBB12FEA26C19FCCB387800F09538F001E094 3901E003C0DD03C013809538800700943807000E050E131E191C4D5BA24D5BA2471C7BA2 53>16 D<1938A285A28501E0DA01C0130F486C4A6C7F486C4A6CEB0380486C4A6CEB01C0 486C4A6C14E0261FBF80D97F7EEB00F0263F1FC0D9FE3F1478297E07E001F81FB512FE48 6C6C48486C14FF486C6C48487E296000FC0FC00114FEC7267E1F80C812786E48C912F0DA 1FFEED01E06E4816C06E48ED03806E48ED0700DA00C05D92C9120E61A261A2481C7CA253 >32 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fx cmsy5 5 6 /Fx 6 96 df0 D<13E0A438F0E1E0EAF843387E4FC0380F5E00 EA01F0A2EA0F5E387E4FC038F843E0EAF0E13800E000A413127B921F>3 D10 D48 D<14C01301B3A7007FB61280B7FC7E211D7B9C2D>63 D<00E0146015E06C1301007014C00078130300381480003C1307001C1400001E5B000E13 0E000F131E6C131CEB803C00031338EBC07800011370EBE0F000005B13F1EB71C0137BEB 3B80133F6DC7FCA2130EA21B1B7B9927>95 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fy cmex10 10 39 /Fy 39 126 df<1430147014E0EB01C01303EB0780EB0F00A2131E5BA25B13F85B12015B 1203A2485AA3485AA3121F90C7FCA25AA3123EA2127EA6127C12FCB3A2127C127EA6123E A2123FA37EA27F120FA36C7EA36C7EA212017F12007F13787FA27F7FA2EB0780EB03C013 01EB00E0147014301462738226>0 D<12C07E12707E123C7E7EA26C7E6C7EA26C7E7F12 007F1378137CA27FA37FA31480130FA214C0A31307A214E0A6130314F0B3A214E01307A6 14C0A2130FA31480A2131F1400A3133EA35BA2137813F85B12015B485AA2485A48C7FCA2 121E5A12385A5A5A14627C8226>I<151E153E157C15F8EC01F0EC03E01407EC0FC0EC1F 8015005C147E5CA2495A495AA2495AA2495AA2495AA249C7FCA2137EA213FE5B12015BA2 12035BA21207A25B120FA35B121FA45B123FA548C8FCA912FEB3A8127FA96C7EA5121F7F A4120F7FA312077FA21203A27F1201A27F12007F137EA27FA26D7EA26D7EA26D7EA26D7E A26D7E6D7EA2147E80801580EC0FC0EC07E01403EC01F0EC00F8157C153E151E1F947182 32>16 D<12F07E127C7E7E6C7E7F6C7E6C7E12017F6C7E137EA27F6D7EA26D7EA26D7EA2 6D7EA26D7EA26D7EA280147E147F80A21580141FA215C0A2140F15E0A3140715F0A41403 15F8A5EC01FCA9EC00FEB3A8EC01FCA9EC03F8A515F01407A415E0140FA315C0141FA215 80A2143F1500A25C147E14FE5CA2495AA2495AA2495AA2495AA2495AA249C7FC137EA25B 485A5B1203485A485A5B48C8FC123E5A5A5A1F947D8232>I<160F161F163E167C16F8ED 01F0ED03E0ED07C0150FED1F801600153E157E5D4A5A5D14034A5A5D140F4A5AA24AC7FC 143E147E5CA2495AA2495AA2495AA2130F5CA2495AA2133F91C8FCA25B137E13FEA25B12 01A25B1203A35B1207A35B120FA35BA2121FA45B123FA690C9FC5AAA12FEB3AC127FAA7E 7FA6121F7FA4120FA27FA312077FA312037FA312017FA212007FA2137E137F7FA280131F A26D7EA2801307A26D7EA26D7EA26D7EA2147E143E143F6E7EA26E7E1407816E7E140181 6E7E157E153E811680ED0FC01507ED03E0ED01F0ED00F8167C163E161F160F28C66E823D >I<12F07E127C7E7E6C7E6C7E6C7E7F6C7E1200137C137E7F6D7E130F806D7E1303806D 7EA26D7E147C147E80A26E7EA26E7EA26E7EA2811403A26E7EA2811400A281157E157FA2 811680A2151F16C0A3150F16E0A3150716F0A31503A216F8A4150116FCA6150016FEAA16 7FB3AC16FEAA16FC1501A616F81503A416F0A21507A316E0150FA316C0151FA31680153F A216005DA2157E15FE5DA214015DA24A5AA214075DA24A5AA24A5AA24AC7FCA2147E147C 14FC495AA2495A5C1307495A5C131F49C8FC137E137C5B1201485A5B485A485A48C9FC12 3E5A5A5A28C67E823D>III40 D<177C17FCEE01F8A2EE03F0EE07E0EE0FC0A2EE1F80 EE3F005E167E5E15015E15034B5A5E150F5E151F4B5AA24BC7FCA215FEA24A5AA24A5AA2 4A5AA2140F5D141F5D143F5DA2147F92C8FC5CA25C13015C1303A25C1307A3495AA3495A A3133F5CA3137F5CA313FF91C9FCA35A5BA31203A25BA31207A35BA3120FA45BA2121FA6 5BA2123FA85BA2127FAE5B12FFB3A62E95688149>48 D<12F87E127EA27E6C7E6C7EA26C 7E6C7E7F12016C7E7F137E137F6D7E131F80130F806D7EA26D7EA26D7EA26D7EA2147FA2 6E7EA281141F81140F811407A281140381A2140181140081A28182A36F7EA36F7EA38215 0FA3821507A3821503A3821501A382A281A31780A3167FA317C0A4163FA217E0A6161FA2 17F0A8160FA217F8AE160717FCB3A62E957E8149>I<12F0B3B3B00434678037>63 DII76 D<95387FFF80050FB512FC94B712C0040316F0041F16FE04 7F707E4BB912E00307DAC3F814F8031FD9F803010713FE4B01C002007F9226FFFE00031F 13C04A01F804077F4A01E004017F020F01809338007FFC4A48C7EE1FFE4A48727EDA7FF0 06037F4A48727F4949727F4990C8EF3FF04948747E4A1A0F4948747E4948747E4948747E 4A86017F894A1B7F49C9727E488A491C1F4848767EA24848767EA24848767EA2491C0100 1F8AA2491C00003F8AA24989007F1F80A290CA193FA4481FC0A2481E1FA2C1FCA748CAD8 03F8CA121FA36C1E3FA26C1F80A46D1D7FA2003F1F006D65A2001F666D1C01A2000F666D 1C03A26C6C525AA26C6C525AA26C6C525A6D1C3F6C666D6C515A6E1BFF013F9AC7FC6E62 6D6C505A6D6C505A6D6C505A6E1A1F6D6C505A6D01C0F1FFE06D6D4E5B6E6C4E5BDA3FFC 060F90C8FC6E6C4E5A6E6C6CEF7FFC020301E0933801FFF06E01F804075B6E01FE041F5B 92263FFFC092B5C9FC6F01F802075B0307D9FFC390B512F8030191B712E06F6C1780041F 4CCAFC040316F0040016C0050F02FCCBFCDD007F138072747B7F7D>II<95387FFF80050FB512FC94B712C0040316F0041F16FE047F707E 4BB912E00307DAC00014F8031F01F8C7000713FE4B01C002007FDBFFFEC9001F13C04A01 F804077F4A01E004017F020F01809338007FFC4A48CBEA1FFE4A48727EDA7FF006037F4A 48727F4949727F4990CDEA3FF0496D4F7E6F19FF496D4E7F496D4E7F496D4E7FDACFFCF0 0FFC90267FC7FE4E487FDA83FF95383FF07FD9FF016D4D486C7E486D6DDDFFC07F496D6C 4CEB801F48486D6C4C496C7E6F6C4C5A48486D6C4C486D7E6F6C4C5A48486D6C4C486D7E 6F6D4B5A496D6D4B481301001F6F6C4A4980706C4A90C7FC496E6C4A481400003F6F6C4A 4881706C4A5A496E6C4A4881007F6F6D49481680706D495A90C96C6C4849153F716C4890 C9FC716C485A716C485A48706C484817C0716C485A4870D9FFE0161F715C725B7290CAFC 725A725AA24E7E4E7E4E7F95B57E4D806C4CD93FF0163F4D486C7E6C4C486C6C17804D48 6C7E4D486C7E4D486C7F6D4B486C6D157F4C496D7E003F4B90C76C6C16006D4A486E6C5D 4C486E7E001F4B486E6C5D6D4A486E6C14014C486E7F000F4B486E6D5C6D49496F6C1303 4B90C96C7E6C6C4948706C495A4B48707E6C6C4948706C495A4B48707E6C6C4948706D48 5A6D494870EBC03F6C4949DD7FE05BD97F8390CB6C6C485ADAC7FE95381FF8FF90263FCF FC726C90C7FCDAFFF872B5FC6D49725B6D49725B6D49725B4B197F6D90CD6C5A6D01C0F1 FFE06D6D4E5B6E6C4E5BDA3FFC060F90C8FC6E6C4E5A6E6C6CEF7FFC020301E0933801FF F06E01F804075B6E01FE041F5B92263FFFC092B5C9FC6F01F802075B0307D9FFC090B512 F8030191B712E06F6C1780041F4CCAFC040316F0040016C0050F02FCCBFCDD007F138072 747B7F7D>III<0078EF0780 00FCEF0FC0B3B3B3A46C171F007E1880A2007F173F6C1800A26D5E001F177E6D16FE6C6C 4B5A6D15036C6C4B5A6C6C4B5A6C6C4B5A6C6C6CEC7FC06D6C4A5AD93FF8010790C7FC6D B4EB3FFE6D90B55A010315F06D5D6D6C1480020F01FCC8FC020113E03A537B7F45>83 D88 DI<007C1A1FA200FEF23F80B3B3B3B3A76C1A7FA26C1B00A26D61A2 003F626D1801A2001F626D1803A26C6C4E5A6D180F0007626C6C4E5A6D183F6C6C4E5A6C 6D4D5A6E5E6D6C4C90C7FCD93FF8EE0FFE6D6C4C5A6DB4EE7FF86D01C04A485A6D01F002 075B6D01FC021F5B9028007FFFE003B5C8FC6E90B65A020F16F8020316E002001680033F 4AC9FC030714F09226003FFECAFC51747B7F5C>91 D<1402EC0F80EC3FE0ECFFF8497F90 3807F8FF90391FE03FC090393F800FE09039FE0003F8D803F8EB00FED80FE0EC3F8048C8 EA07C0007CED01F000F0ED007800C016182D0F80BD2E>98 D<17C0EE07F8EE3FFF4BB512 E0030F14FC923A7FFE1FFF80912703FFF00313F0021F90C7EA3FFEDAFFF0913803FFC001 0301809138007FF0D91FF8C9EA07FED9FF809338007FC0D807FCCBEA0FF8D83FC0F000FF 00FCCDEA0FC000E01A01521080BF53>I<197C953807FFC0067F13FC0507B612C0057F15 FC040FB50083EBFFE093B526F0001F13FE030F01FCC8387FFFE092B50080030313FE020F 01F0CA381FFFE0DAFFFCCCEA7FFE011F0180963803FFF02601FFF0CEEA1FFFD81FFED013 F0D8FF80F503FE00F0D2121E771080BF78>I104 DI< 1B301B781BF8A2F201F0A2F203E0A2F207C0A2F20F80A2F21F00A21A3EA262A262A24F5A A24F5AA24F5AA262190FA24FC7FCA2193EA261A261A24E5AA24E5AA24E5AA24E5AA24EC8 FCA2183EA260131001305E13F800014C5A1203D80FFC4B5A121DD838FE4B5A12F0D8407F 4B5A12004DC9FC6D7E173E6D7E5F6D7E5FA26D6C495AA26D6C495AA26D6C5C1607A26D6C 495AA2027F49CAFCA291383F803EA25EEC1FC05EEC0FE0EDE1F0EC07F1EDF3E0A26EB45A A26E5BA26E90CBFCA25D157E157C15384D64788353>112 D<1B301B78A21BF8A21BF01A 01A21BE01A03A21BC01A07A21B801A0FA21B0062A21A1E1A3EA21A3C1A7CA21A781AF8A2 62A21901A2621903A2621907A262190FA297C7FC61A2191E193EA2193C197CA2197819F8 A2611801A2611803A261A21807A261180FA296C8FC60A2181E183EA2183C187C13100130 1678017016F813F860000116011203486C5E000F1603121DD838FE5E00701607126000C0 5FEA407F0000160FA26D6C92C9FC5FA2171E6D6C143EA2173C6D6C147CA2177817F86D7E 5F16016D7E5F1603A26D6C5C1607A26D6C5C160FA294CAFC027F5BA2161EEC3F80163EA2 163C91381FC07CA2167891380FE0F8A25E15E1EC07F15E15F3EC03FB5E15FFA26E5BA36E 90CBFCA35D157EA2157C153C15384D96788353>I<1B301B78A21BF8A21BF0A21A01A21B E0A21A03A21BC0A31A07A21B80A21A0FA21B00A262A21A1EA21A3EA21A3CA21A7CA21A78 A21AF8A262A31901A262A21903A262A21907A262A2190FA297C7FCA261A2191EA2193EA2 193CA3197CA21978A219F8A261A21801A261A21803A261A21807A261A2180FA296C8FCA3 60A2181EA2183EA2183CA2187C131018781330017016F8A201F85E120117011203486C5E A2120D001D16031219D830FE5E12700060160712C000405FEA007F170FA295C9FC6D7E5F A2171EA26D6C143EA2173CA2177C6D7E1778A36D6C14F8A25FA216016D7E5FA21603A26D 6C5CA21607A26D6C5CA2160FA294CAFC147F5EA2161EEC3F80A2163EA2163CEC1FC0167C A21678A291380FE0F8A25EA2EC07F1A25EA215F3EC03FB5EA215FFA26E5BA48093CBFCA4 157EA4157C153C15384DC8788353>I<1B301B78A31BF8A21BF0A31A01A21BE0A31A03A2 1BC0A31A07A21B80A41A0FA21B00A362A21A1EA31A3EA21A3CA31A7CA21A78A31AF8A262 A41901A262A31903A262A31907A262A3190FA297C7FCA461A2191EA3193EA2193CA3197C A21978A319F8A261A41801A261A31803A261A31807A261A3180FA296C8FCA460A2181EA3 183EA2183CA3187C131018781330A2017016F8A201F85EA212011701120360487EA2120D 001D16031219D838FE5E123012700060160712E000C05FEA407F1200170FA295C9FCA26D 7E5FA2171EA36D7E173EA2173CA36D6C147CA21778A317F86D7E5FA316016D7E5FA41603 6D7E5FA31607A26D6C5CA3160FA294CAFC147FA25EA2161EA2EC3F80A2163EA2163CEC1F C0A2167CA21678A2EC0FE016F8A25EA3EC07F1A25EA315F3EC03FB5EA415FF805EA48093 CBFCA5157EA5157C153CA215384DFA788353>I<146014F0A2497E497E497E497E497F90 383EF7C09038FCF3F03901F8F1F83907F0F0FED81FC0EB3F80D87F80EB1FE0D8FE00EB07 F000F8140100E0EC007000801510C71400B3AD2431777E37>120 D<14F0B3AD6C151000E0157000F8EC01F000FE1407D87F80EB1FE0D81FC0EB3F80D807F0 EBFE003901F8F1F83900FCF3F090383EF7C06DB45A6D90C7FC6D5A6D5A6D5A6D5AA21460 2431777F37>II I<12F87E7E7EA26C7E6C7E7F6C7EEA0FFC6C7E6C6C7E14E06C13F86C13FF013F13E06D13 FF6DECFF807F13016D7E80140F14016E7E150FED007F291B839A25>II E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fz msbm7 7 7 /Fz 7 124 df67 D80 DII<003FB612 C0A23A33E0038180D83F001303003C903807070048EB06060070EB0E0EEC1C0C0060EB18 1CEC3838C7EA7030EC6070ECE0E049485A148190380383800203C7FC495AEB0E06EB0C0E EB1C1CEB3818EB3038EB7070EBE060EBC0E03801C1C0D981801360EA0383D80703C7FCD8 060714E0EA0E0ED81C0C1301D8181C1303D83838EB07C0D87030130ED86070131CD8E0E0 13F8B7FCA223287EA737>90 D<942601FFFE1C3894B600E0F203F8043F03FC1A1F0307B8 963801FFF0037F9026F8000101C0061F130091260FFFFCC8D81FF0943803FFF891B5C9D8 03FC053F1380010F01E0706C932607FFF8C7FCD9FFFECBD87FC04AB51280000701C0DE1F FC91B500F0C8FCD87FFCCC0007B8C9FCD8FFC0070116E048CE003F02F8CAFC00E0090301 FCCBFC950E7FB398>94 D<013FEC03E0D9FF80EB07F048ED1FE048ED7FC048913801FF80 0101903803FE000006EC0FF8D80003EB3FE04AB45A5CD907075B9026061FF3C7FC90380E 3FE790380CFF8690381FFE06ECFC0E90383FF00CEB7FC03A01FF001C07D807FEEB180ED8 0FF8EB1FFED83FE05CD87F805C48C75B007CEC0FC02C197D982D>123 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: FA eufm10 10 6 /FA 6 116 df<497E903807C00E90380FF87C90383FFFFC90B5FC5A1207EA1F83383F80 3F397F0003F8A4127E12FEAF4A7E6C131F9039807FFE109039C0F3FF70D9E3E313C0267F FFC313806C01031300496C5AD81FF85B6C486C5A6C481370D8038013606CC9FC242A7BA6 2A>97 D<02101310027C1370903901FF80E04913F3010F13FF133F5BD801FC14C03803F8 0FEC003F150F5B1207A2151FAF6D133F6DEBFFE06D5A9038FF079FEC8F0F6C13FC6C01F8 13F014F06C13E0EB7F8090383F0007131E4914E0017014C0485A486C1480486C1400486C 130648B45B007FEBC01800E7EBF0300003EBFFE0C6FC6D5B011F5BD903FEC7FCEB003824 387FA62A>103 D<1304EAC01CEA403813F01261EA63E0EA6FC0127F5BA390C8FCA61418 143C147E903801FF804913F04913F8011F13FCEB3C3FEB700FEBE007EBC0031300A31401 AC5AA5138015F813C013E0127F1403EA3FC01380EA1E00000C14F01208C7FCEC07E015C0 1580A2EC0F00140E5C5C5C5C495AEB078091C7FC13021E4A7AB82B>I<1470380401E038 0603C0495A011FC7FCEA073E5B13FC5B14079038F01F80EC3FC0ECFFE013F39038F71FF0 EBFE0FEBFC0713F8140315E001F013C01580EC070014065C5C14703803F1E0003FB512C0 481480B6FCD807F0C7FCB07F6D13206D13E09038FF83C0ECCF806CEBFE006C5B6C5BEB7F E0EB1FC06DC7FC13061C3B7EB820>107 D<1302EA400EEAC01C1378EAE0F0EA63E0EA67 C0127F1380A21300A4127EB3A5127FAA5A138013C613EE13FC13F0EA7FE0EA3FC01380EA 1E00120C12080F3B79B817>I<1430147CD901FE1340903903FF80C0010FEBC38049EBFF 00017F5B01FC5B3903F81FF8EC01F091C8FCA5153015FC9038FC03FEEC0FFFEBFE3F90B6 FC14C16C1380495AD800F87F13E0134090C7FCA4EA01F8D807FE137E380FFF8048EBE0FE 4813F039707FFCF839C01FFFE0D880071380260003FCC7FC6D5AEB00E0222A81A725> 115 D E %EndDVIPSBitmapFont /FB 131[42 42 5[42 3[42 1[42 42 3[42 42 19[42 2[42 1[42 42 1[42 3[42 4[42 42 32[4 5[4 28[{}18 83.022 /XYDASH10 rf /FC 129[0 0 4[0 0 0 1[0 4[0 0 12[0 17[0 17[0 2[0 2[0 2[0 4[0 0 3[0 0 0 0 0 1[0 1[0 0 16[0 0 0 14[{}27 83.022 /XYBTIP10 rf /FD 129[0 0 4[0 0 0 1[0 4[0 8[0 4[0 17[0 17[0 2[0 2[0 2[0 4[0 4[0 0 0 0 0 1[0 1[0 0 16[0 0 0 14[{}26 83.022 /XYATIP10 rf %DVIPSBitmapFont: FE cmsy7 7 38 /FE 38 117 df0 D<1238127C12FEA3127C123807077A9114>I< 0060140600F0140E0078141E6C143C6C14786C14F039078001E03903C003C03901E00780 3900F00F00EB781E6D5A6D5A6D5A6D5A6D5A497E497EEB1E78497E497E497E3901E00780 3903C003C039078001E048C712F0001E147848143C48141E48140E006014061F1F769D34 >I<1338A50060130C00F8133E00FC137E00FE13FE383FBBF83807FFC000011300EA007C 48B4FC000713C0383FBBF838FE38FE00FC137E00F8133E0060130C00001300A517197B9A 22>I<1406140EB3B812E0A3C7000EC8FCB1B812E0A32B2B7CA834>6 D8 D10 D<913801FFC0021F13FC91B67E499038 007FC0D907F0EB07F0D91F80EB00FC49C8127E017C151F01F0ED078048486F7E48486F7E 48486F7E90CA1270481778001E83001C171C003C171E0038170E0078170F007083A200F0 1880481703A96C170700701800A200785F0038170E003C171E001C171C001E173C6C5F6C 17706D16F06C6C4B5A6C6C4B5A6C6C4B5A017C031FC7FC013F157E6D6C5CD907F0EB07F0 D901FFEB7FC06D90B55A021F01FCC8FC020113C039357CA842>13 D<137F3801FFC0000713F0380FC1F8381F007C003C131E0038130E0078130F00707F00F0 1480481303A56C13070070140000785B0038130E003C131E001F137C380FC1F86CB45A00 0113C06C6CC7FC19197C9A22>I<137F3801FFC0000713F0487F487F487FA2487FA2B612 80A76C1400A26C5BA26C5B6C5B6C5B000113C06C6CC7FC19197C9A22>I<160E163E16FE ED03F8ED0FE0ED3F80EDFE00EC03F8EC0FE0EC3F8002FEC7FCEB03F8EB0FE0EB3F8001FE C8FCEA03F8EA0FE0EA3F8000FEC9FC12F812FEEA3F80EA0FE0EA03F8EA00FEEB3F80EB0F E0EB03F8EB00FEEC3F80EC0FE0EC03F8EC00FEED3F80ED0FE0ED03F8ED00FE163E160E16 00AB007FB612FCB712FEA227357AA734>20 D<12E012F812FEEA3F80EA0FE0EA03F8EA00 FEEB3F80EB0FE0EB03F8EB00FEEC3F80EC0FE0EC03F8EC00FEED3F80ED0FE0ED03F8ED00 FE163E16FEED03F8ED0FE0ED3F80EDFE00EC03F8EC0FE0EC3F8002FEC7FCEB03F8EB0FE0 EB3F8001FEC8FCEA03F8EA0FE0EA3F80007EC9FC12F812E0CAFCAB007FB612FCB712FEA2 27357AA734>I24 D<49B512FE130F133F01FFC8FCEA01F8EA03E0EA078048C9FC12 1E121C123C123812781270A212F05AA77E1270A212781238123C121C121E7E6C7EEA03E0 EA01F86CB4FC013FB512FE130F130127277AA134>26 D<176017F01770A217781738173C 171C171E83717E717E717EEF00F8BAFC19801900CB12F8EF01E04D5A4D5A4DC7FC171E17 1C173C173817781770A217F01760391F7C9D42>33 D39 D<13E0EA01F0EA03F8A3EA07F0A313E0A2120F13C0A3EA1F80A21300A25A123EA35AA312 7812F8A25A12100D1E7D9F13>48 D<017F157F2601FFE0903803FFC0000701F890380FF1 F0260F83FC90381F0038261E00FF013C7F001890263F8078130C4890261FC0E07F007090 260FE1C07F0060EB07E3913803F780486DB4C7EA01806E5A157E157F81824B7E0060DAF7 E0EB0300913801E3F0DBC3F85B6C90260381FC13066C90260F00FE5B001C011E90387F80 3C6C017C90381FE0F82607C7F86DB45A2601FFE0010313C06C6CC86CC7FC391B7C9942> I<49B5FC130F133F01FFC7FCEA01F8EA03E0EA078048C8FC121E121C123C123812781270 A212F05AA2B7FCA300E0C8FCA27E1270A212781238123C121C121E7E6C7EEA03E0EA01F8 6CB4FC013FB5FC130F130120277AA12D>I<150EA2151E151C153C1578157015F015E014 0115C0140315801407EC0F00140E141E141C143C14381478147014F0495A5C13035C1307 91C7FC5B131E131C133C13381378137013F05B1201485A5B120790C8FC5A120E121E121C 123C5A127012F05A12601F3576A800>54 D<140C141CA2143CEB3FB8EBFFF8EA03E03807 807C380F007E001E13FF001C13E7003C1480A2D87C0113C0007813C3A2130300F8EB83E0 A213071403A2130F130EA3131E131CA2133C1338A21378D8787013C0A2387CF00713E000 3C1480A2001FEB0F0013C0000F131E00075B3803E0F8EBFFF03807BF8090C8FCA31B317D AC22>59 D<1406140EB3B2007FB712E0B8FC7E2B287CA734>63 D<161E163EA2167E16FE A2150116BE1503163E15071506150E151CA215381530ED703F156015E04A487EA2EC0380 EC0700A2140E5C835C027FB5FCA291B6FC903901C0000F13034A80D84007C7FCEA600ED8 F01E1407D8FC7C81B45A49EDF78049913803FE006C485D6C48EC01F0000ECBFC312D7DA9 35>65 D67 D<0103B512C0013F14FC90B712802703F0780713E03B0F 80F8007FF0D81E00EC0FF848ED03FC007C15010078ED00FE00F8167E00E0167FC748143F 1301171FA35C1303A2171E173E5C0107153C177C4A1478010F15F0160191C713E049EC03 C0EE0780011EEC0F00013E141C1678013C495A017CEB07C00178013FC7FC9038F803FC48 B512E04891C8FC4813F030287EA734>I76 D<91383807F89138F03FFFD903E0B5 128090260781E013C0903A0E07801FE090393C0F000FD9781EEB07F0494813033801E07C 2603C078EB01F800075B1381D80F011400001F5B381E03C0003EC9FC123C127CA217F000 78150112F8A217E0160317C0160717806CED0F005E161E007E5D5E007F5D6C6C495A6DEB 03806C6C010FC7FCD80FF8133E3907FF01F86CEBFFE0C691C8FCEB1FF82D2A7BA835>79 D<0103B512E0013F14FC90B7FC2703F0780313C03B0F80F8007FE0D81E00EC1FF0481507 007CED03F80078150112F800E01500C75A130117F0160117E04A1303010315C0EE0780EE 0F00161E4A5B010714F0ED03E09138801F8090260F8FFEC7FCEC9FF0ECBF8091C9FC5BA2 131E133EA2133C137C137813F8A25B120113C090CAFC2D2B7EA72F>I83 D<18C01703010FB71280017FEDFE0048B75A4816E0270F0001F0C8FC001E495A5A127C14 07485C5A12C0C7120F5DA3141F92C9FCA35C143EA3147E147CA314FC5CA313015CA3495A A25C1307A2495A91CAFC130C322E7CA926>I<00E0153016706C15F0007015E000781401 003815C0003C1403001C1580001E1407000E1500000F5C6C140E6D131E0003141C6D133C 000114386D1378000014706D13F001705BEB780101385BEB3C03011C5BEB1E07010E90C7 FCEB0F0FEB070E149EEB039C14FC6D5AA26D5AA2146024247CA22D>95 D<147EEB03FEEB0FE0EB1F00133E5BB35BA2485AEA07E0EAFF8000FCC7FCB47EEA07E0EA 01F06C7EA2137CB37F7FEB0FE0EB03FEEB007E173B7BAB22>102 D<12FCB47EEA0FE0EA01F06C7E137CB37FA27FEB0FC0EB03FEEB007EEB03FEEB0FC0EB1F 00133EA25BB35B485AEA0FE0EAFF8000FCC7FC173B7BAB22>I<1306130E131E131CA213 3C13381378137013F013E0120113C0A212031380120713005A120EA2121E121C123C1238 12781270A212F05A7E1270A212781238123C121C121E120EA2120F7E1380120313C01201 A213E0120013F0137013781338133C131CA2131E130E13060F3B79AB1B>I<12E0A27E12 70A212781238123C121C121E120EA27EA21380120313C0120113E01200A213F013701378 1338133C131CA2131E130E131E131CA2133C13381378137013F013E0A2120113C0120313 80120713005AA2120E121E121C123C123812781270A212F05AA20F3B7CAB1B>I<12E0B3 B3B3A5033B78AB14>I<12E0A27E1270A212781238123C121CA2121E120E120F7EA27F12 03A27F12017F1200A27F137013781338A2133C131C131E130EA2130F7F801303A2801301 801300A2801470A214781438143C141CA2141E140E140F80A2158014031401193B7CAB22 >110 D<00E0EC01C0B3AEB7FCA27E22237BA22D>116 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: FF cmr5 5 17 /FF 17 117 df6 D<13301360EA01C0EA038013001206120E5AA25AA3 5AA312F0AB1270A37EA37EA27E12067E1380EA01C0EA006013300C297B9E16>40 D<12C0126012387E120C7E1207EA0380A2EA01C0A3EA00E0A313F0AB13E0A3EA01C0A3EA 0380A2EA070012065A121C5A12605A0C297C9E16>I<14E0B0B712C0A3C700E0C7FCB022 237C9B2B>43 D48 D<1360EA01E0120F12FF12F11201B3A3387FFF80A2111C7B9B1C>IIII<001C13E0EA1FFF14C0140013FC0018C7FCA513FCEA1BFF381F07 C0381C01E01218EB00F0C7FC14F8A2127012F8A214F01301006013E0387003C0383C0F80 380FFF00EA03F8151D7D9B1C>II<12FEA2121EA9EB1F C0EBFFF0381FC0F8EB003C001E131EA2140FA6141EA2001F133C381DC0F8381CFFE03818 1F80181D7D9C1F>98 D<121C123EA3121CC7FCA612FEA2121EAEEAFFC0A20A1D7D9C11> 105 D<38FE1FC0EB7FE0381EC0F0381F0078A2121EAB38FFC3FFA218127D911F>110 D<13FE3807FFC0380F01E0383C0078003813380078133C48131EA60078133C0038133800 3C1378380F01E03807FFC03800FE0017127E911C>I<38FE1FC0EBFFF0381FC0F8EB003C 001E131EA2140FA6141E143E001F137CEBC0F8381EFFE0EB1F8090C7FCA6EAFFC0A2181A 7D911F>I<1203A35AA25AA2123FEAFFFCA2EA0F00A81306A5EA078CEA03F8EA01F00F1A 7E9916>116 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: FG cmmi5 5 31 /FG 31 118 df<137F3801FFC0390781E060380E00F048EB78C0123C48EB7D80143D48EB 3F00143EA2143CA20070137C387801FC393C0F9E30391FFE0FE03907F007C01C127C9126 >11 D<14FCEB03FF90380F038090381C01C01338016013E0A201C013C038018003A21580 390307F700EB0FFEA2EB07E7380600071580A35AA31500001C5B141E001E131C001F1378 3833F7F03830FFC090C8FCA25AA45AA21B257E9C21>I<3903F00180EA0FFC391FFE0300 123F387E3F0638E0078638C0018C008013CCC7FC14D814F81470A31460A314E0A3495AA4 495AA26DC7FC191B7E911F>I21 D<0003B512C0000F14E05A4814C0397030600038C070E0 EA0060A213E0A2EA01C0A21203497E120780EB0078000613701B127D9123>25 D<127012F812FCA2127C120CA31218A2123012601240060D7A8413>59 D<146014E0130114C0A213031480130714005B130EA2131E131C133C133813781370A213 F05B12015BA212035B120790C7FC5A120EA2121E121C123C123812781270A212F05AA213 297B9E1F>61 D65 D<0003B512F815FE3A003E001F80ED0FC0150715035B1507A2ED0F8049EB 1F00157E90B512F85D3901F001F8EC007E153E81485AA3151E4848133E5D5DEC07F0B612 C04AC7FC221C7C9B2B>I<91387F8040903907FFE0C090381FC07190393E001B8001F813 0FEA01E0484813074848140048C7FC5A123E15064891C7FCA35AA41518A212785D6C5C15 E06C495A260F8007C7FC3807E01E3801FFF838003FC0221E7C9C29>I<0003B512F815FE 3A003E001F80ED07C0ED03E0150149EB00F0A216F8A25BA4484814F01501A216E0484813 0316C0ED0780ED0F004848131E5D15F8EC07E0B6128002FCC7FC251C7C9B2E>I<903807 F02090381FFC609038780EE09038E003C03801C001EA0380A2D807001380A26DC7FCA27F EA03FC3801FFC06C13F0EB3FF8EB01FCEB003E141E140EA21230A200705BA25C00785B38 FE01E038C7FF80D881FEC7FC1B1E7B9C24>83 D<3AFFFC01FFC0A23A0F80001C001518A3 48C75AA4003E5CA4485CA448495AA34AC7FC14061278141C6C5B381F01E03807FF80D801 FEC8FC221D7B9B27>85 DI<3CFFF81FFF01FF8001F0495A3C1F0003F000780001801530 5F000F13075F020D495AA2021949C7FC913831F80701C0140602605B000701E0131C02C0 1318D9C1805B13C302005B01C66D5A13E6D803ECEB7D8001F8137F93C8FC49137EA24913 7C49137815386C481330311D7B9B35>I<1330A31260A5133813F81267127FEAFFF01330 12F812E01260AA133813F81267127FEAFFF0133012F812E01260A21300A30D277B9D19> 93 D97 DI<137F3801FFC0EA07C3380F03E0381C07C0EA3C0348C7FC A25AA500701340007813E0383C03C0381FFF00EA07F813127C911B>I103 D<137013F8A213F013E01300A6EA0F80EA1FC0EA31E01261A2EAC3C01203EA0780A3EA0F 001308EA1E18A213301370EA0FE0EA07800D1D7D9C16>105 DIII<3A0F01F807E03A3F87FE1FF83A33 CE1F387C3A63D80F603CD8C3F013C001E01380D803C01300A22607801E5BA3EEF0404848 4814C0ED01E0EEE18016E3001E90397800FF00000C0130137C2A127D9133>I<380F03F0 383F87FC3833DC1EEA63F8EAC3F013E0EA03C0A248485AA3EC7820D80F00136014F015C0 14F1001EEB7F80000CEB3E001B127D9125>I<3803C0F8380FE3FE380CFF0F3918FC0780 3830F80313F01200A23801E007A3EC0F00EA03C0141E6D5A6D5A3807BFE0EB8F800180C7 FCA248C8FCA4EA7FE012FF191A7F911F>112 DI<137E3801FF80EA0381380703C0380E0780EB0300EA0F80EA 07F86CB4FC6C1380EA000FEA3003127812F8EB0700EAF00EEA7FFCEA1FF012127C911C> 115 D<13C0EA01E0A3EA03C0A4EAFFFCA2EA0780A2EA0F00A4121EA31304EA3C0CA21318 1370EA1FE0EA0F800E1A7D9917>I<380F800C381FC01EEA39E012615C12C1EA03C0A25C EA0780A21540ECF0C0A21381903883F1803903FE7F003800F81E1A127D9123>I E %EndDVIPSBitmapFont %DVIPSBitmapFont: FH msbm10 10 11 /FH 11 124 df67 D78 D<007FB612C0B712FC6C15 FF2703C01E071380000190393C01C7E00238EBE1F0923800E0F81738EEF03CEE701C171E 170EA7171E171CEEF03CEEE03817F8923801E1F0EEC7E0923803FF80023FB5120016FC16 E00238C8FCB3A60003133C007FB512F0B6FC7E2F397EB834>80 D<913801FFF0021F13FF 027F14C0903A01FFC07FF001079038001FFCD91FFCEB07FFD93F78903803DF80D97C7090 3801C7C0D9F0F0ECE1E0484848903800E0F0D803C1EDF078260781C0EC703C0103ED781C 000F49EC381E000E170ED81E07ED3C0F001C90C8EA1C07003C188000381703007818C000 70170149151E010E150EA200F018E000E01700AB00F01701007018C0A2010F151E6D151C 0078170300381880003C1707001C1800001E6DEC3C0FD80E03ED380E000F171E00076DEC 781C0181ED703C2603C1E0ECF078D801E04B5A6C6C6C903801E1E0D97C70ECC7C0D93F78 903803DF80D91FFC49B4C7FCD907FFEB1FFC01019038C07FF06D6CB512C0021F91C8FC6E 13FC913807001E6F7E6E6C6C7E0201EB03E09238E001F8913B00F000FF01C0037CEB3FFF 6F130F92261F80011380923A07E0007E00923903FC03FC0300B512F0043F13C0DC07FEC7 FC3B4B7DBA35>I<007FB612E0B712FE6C6F7E2703C01E0313E0000190393C00F3F00238 EB70F8EE783CEE381E83EE3C07161C18801703A617071800EE3C0FEE380E173EEE78FCEE F7F892380FFFE0023FB5128004FCC7FC16B8913838F03CED701CED781EED380EED3C0FED 1C07031E7FED0E03030F7FED0701EE81E0ED0380707E030113701778EEE0380300133C70 7EEE700EEE780F9338380780EE3C03041C13C093381E01E00003013C90380E00F0007FB5 39F00FFFFEB67F6C8137397DB836>I<0007B712FC5AA23B0E1FF003C038903A3F000780 7801FC4A5AD80FF0495B49EB0E01D81F80011E5BED3C0390C738380780001E027890C7FC ED700FEDF00E001C903801E01E4B5A02031338C7EB80780207137091380F00F091380E01 E0021E5BEC1C03023C5BEC3807027890C8FC4A5AECE01E0101131CECC03C010313389038 0780784A5A495BEB0E01011E49EB0180D93C0314039038380780017890C7FCD9700F1407 EBF00E3801E01E4948EC0F0000031338D980785C00071370D900F05C48495CD81E0115F7 261C03C0EB01E7003C49495AD83807EC0F8E007890C7EA3F0E4848EB01FEB812FEA33139 7DB83E>90 DI<97B56CF60380077F02FC1E1F061FB76C1DFF0503B800E00A 0F1300057F49C701F8F47FF8932607FFFEC8D807FC983807FF80047F0180DB01FFE17FFC C7FC922607FFF0CAD83F80963803FFE0037F90CBD81FE0DF3FFEC8FC912607FFE0DE07F0 953803FFF0DA3FFECCD803FC067F90C9FC902603FFE0DF00FE943807FFF0011F90CED87F C093B5CAFCD9FFF0E11FF0033F13F0000F90CF6CB46C013FB5CBFCD87FF80A0390B712E0 D8FF800A0004FCCCFC00FCD1001F92CDFC00E00C001480C11380CAC2>94 D<0060150600F8150F6C151F6C153F6C157E6D14FC6DEB01F8D8F7E0EB03F0D8F3F0EB07 E0D8F1F8EB0FC0D8F0FCEB1F80017EEB3F006D137E6D6C5A90380FC1F8903807E3F09038 03F7E06DB45A6D5B6EC7FCA24A7E497F903803F7E0903807E3F090380FC1F890381F80FC 90383F007E017E7F49EB1F80D8F1F8EB0FC0D8F3F0EB07E0D8F7E0EB03F0B448EB01F849 EB00FC90C8127E48153F48151F48150F00601506282874A841>110 D<0060150600F8150F6C151F007E153F6C157F6C6C14FF6C6C5B6C6C5B6C6CEB07EF6C6C EB0FCF6C6CEB1F8F017EEB3F0F6D137E90381F80FC90380FC1F8903807E3F0903803F7E0 903801FFC06D1380EC7F00A2ECFF804913C0903803F7E0903807E3F090380FC1F890381F 80FC90383F007E017E133F49EB1F8F4848EB0FCF4848EB07EF4848EB03FF48487F48487F 48C8127F007E153F48151F48150F00601506282874A841>I<02F815FCD907FCEC01FE01 1F1507013F150F017FED3FF801FFED7FF0D9F81C903801FFC0D801C04A1380D980189038 0FFE004C5AC7EC7FF00238495ADA30035B5DDA701F5B9126603FFBC7FCEDFFE702E113C6 02C7130E903901CFFE0CECBFF8903903FFF01C49EBC018158090390FFE003849481330D9 7FF01403495A00030180EB70074890C7133ED81FFCEC7FFE48485DD8FFE05D495D90C813 C0007E033EC7FC37247CA337>123 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: FI cmmi7 7 73 /FI 73 127 df11 DI<137E48B4EB0180000713C0489038E0030048 1406383E01F0393800700C4813380060EB181848131CEC0C305AC75B14065DA3EC0780A2 92C7FCA31406A3140EA2140C141CA45CA31430A2142021267E9923>II18 D21 D<137001F81338157CA248485BA44848485AA44848485A A44848485AEDC180A3001F90380F8300A2141F9038C03786393FE0E7CC9038FFC3FC393E 7F00F090C9FC5AA45AA45A5A21267D9928>II<48B61280000715C04815 80481500263C0C06C7FC127012C0EB1C0EEA0018A21338A2EB701EA313F013E01201141F 120313C0000780A2380F800FA26C486CC7FC221A7D9827>25 D<14FCEB03FF9038078780 90381E03C0EB3C01017813E0A213F0000114F013E01203A23907C003E0A4390F8007C0A2 1580EC0F00EA1F00141E6D5A6D5A383EE1F0EB7FC0011FC7FC90C8FC5AA45AA45A5A1C26 7D9922>I<010FB5FC013F148049140048B6FC2603F07EC7FC3807C01FEA0F80497E5A12 3EA2003C5B127CA30078133E12F8143C0078137C14785C6C485A495A381E0F80D80FFEC8 FCEA03F8211A7D9826>I<48B512F8000714FC4814F84814F0D83C07C7FC1270EAC00613 0E1200A3131E131CA2133CA35BA313F8A3485AA26C5A1E1A7D981F>I<1403A21406A45C A45CA4903807FF80011F13E090387C30F0D801F0133C3803C060D80780131ED80F00131F 48140F003E13C0A25AA239F801801FA3151E903803003E153C157C1578D8780613F0EC01 E0003CEB03C0001EEB0F80390F0C3E003807FFF8000113E0D8000CC7FC5BA45BA45BA220 347CA728>30 D<15185DA45DA45DA44A5AD803E01438D807F01478D80C7814FC39187C03 000030157C163C1260D9F806131C00C01518A2EA01F05C1630EA03E0A24A1360EA07C016 C0ED0180EC30030003EC070001E0130E00015C9038F8607039007E61E090383FFF80D907 FEC7FCEB00C0A4495AA449C8FCA326347DA72C>32 D34 D<157E000349B4FC0006491380484913C048EB0F0391381C01E048EB18005C4A13605A5C A248484813C0A291C7FC49EB018000E01403ED0700D87006130E5D003C143CD83F0E13F8 391FEE07E06CB55A00035CC649C7FCEB1FF0013CC8FCA35BA313F8A35B5B23267C992C> 39 D<1238127C12FEA3127C123807077A8614>58 D<1238127C12FE12FFA2127F123B12 03A31206A3120C121812381270122008127A8614>I<160E163E16FEED03F8ED0FE0ED3F 80EDFE00EC03F8EC0FE0EC3F8002FEC7FCEB03F8EB0FE0EB3F8001FEC8FCEA03F8EA0FE0 EA3F8000FEC9FC12F812FEEA3F80EA0FE0EA03F8EA00FEEB3F80EB0FE0EB03F8EB00FEEC 3F80EC0FE0EC03F8EC00FEED3F80ED0FE0ED03F8ED00FE163E160E27277AA134>II<12E012F812 FEEA3F80EA0FE0EA03F8EA00FEEB3F80EB0FE0EB03F8EB00FEEC3F80EC0FE0EC03F8EC00 FEED3F80ED0FE0ED03F8ED00FE163E16FEED03F8ED0FE0ED3F80EDFE00EC03F8EC0FE0EC 3F8002FEC7FCEB03F8EB0FE0EB3F8001FEC8FCEA03F8EA0FE0EA3F8000FEC9FC12F812E0 27277AA134>I64 D<4B7E1503150782150F151FA2153FA2156F15CF82EC0187140315071406140E140C0218 7FA2EC30031460A214C013011480D903007F91B5FC5B90380C0001A25B13380130805B01 E013005B12011203000F4A7ED8FFF890381FFFE0A22B2A7DA932>I<013FB512F816FF90 3A01FC001FC04AEB07E0EE03F001031401A24A14F8A2130717F04A130317E0010F1407EE 0FC04AEB1F80EE7E00011F495A91B512F0A291388001FC013FEB007E8291C7EA1F80160F 4915C0A2137EA213FEEE1F805BEE3F000001153E16FE49EB01F84B5A0003EC1FC0B7C7FC 15F82D287DA732>I<4AB41308020FEBE01891397F80F038903A01F8001870D903E0EB0C F0D90F80130749C71203013E15E05B491401485A484815C0485A120F5B001F168090C8FC 4892C7FCA2127EA4127C12FCA21606007C5DA35E007E5D123E5E6C5D6C6C495A00074AC7 FCD803E0130E6C6C13383900FE01F090383FFFC0D907FCC8FC2D2A7DA830>I<013FB512 FC16FF903A01FC001FC04AEB03E0EE01F801031400177C4A80A2010781A25CA2130F1880 5CA2011F1600A24A5CA2133F173E91C8127E177C4915FC5F017E14015F01FE4A5AA2494A 5A4C5A00014BC7FC167C495CED03E00003EC1FC0B600FEC8FC15F031287DA736>I<013F B612FCA2903901FC00014AEB007C173C0103153817185CA21307A24A13C0A2010F010113 005E14C01503011F130F91B5C7FCA2EC800F013F7F15061400A249010E13E0030C13C001 7E90C7FC160101FEEC0380A249EC0700A20001150E161E495C16FC0003EC07F8B7FC5E2E 287DA731>I<013FB612F0A2903901FC00074A1301160001031560A25CA21307A25CED01 80010F0103130093C7FC14C05D131F151EECFFFEA290383F801E150C1400A249131C1518 137E92C8FC13FEA25BA21201A25BA21203B512F0A22C287DA72A>I<4AB41308020FEBE0 1891397F80F038903A01F8001870D903E0EB0CF0D90F80130749C71203013E15E05B4914 01485A484815C0485A120F5B001F168090C8FC4892C7FCA2127EA4127C00FC91387FFFE0 A2923800FE00127C5EA21501007E5D123EA27E6C6C495A6C6C13076C6C130FD801F8131C D800FEEBF06090393FFFC020D907FEC8FC2D2A7DA834>I<903B3FFFF01FFFF8A2D901FC C7EAFE004A5CA2010314015F5CA2010714035F5CA2010F14075F5CA2011F140F91B65AA2 913880000F013F141F5F91C7FCA249143F94C7FC137EA201FE5C167E5BA2000115FE5E5B A200031401B539C07FFFE0A235287DA736>I<90383FFFF0A2903801FC005CA21303A25C A21307A25CA2130FA25CA2131FA25CA2133FA291C7FCA25BA2137EA213FEA25BA21201A2 5BA21203B512C0A21C287DA71D>I<90263FFFF0EB7FF8A2D901FCC7EA1FC04AEC1E005F 010315704C5A4AEB03804CC7FC0107141C5E4A13E04B5A010FEB0780030EC8FC4A5A157C 011F13FE14C3EC877F149E90393FB83F8014F09138C01FC0148049486C7EA2017E6D7EA2 01FE6D7EA2496D7EA200016E7EA249147FA2000382B539C007FFF8A235287DA738>75 D<90383FFFF8A2D901FCC7FC5CA21303A25CA21307A25CA2130FA25CA2131FA25CA2133F A291C8FCA249141C1618137E163801FE1430167049146016E000011401ED03C0491307ED 0F800003147FB7FC160026287DA72E>III<013FB512F816FF903A01FC001FC04AEB07 E0EE01F0010315F816005CA2130716015CA2010FEC03F0A24AEB07E0EE0FC0011FEC1F80 EE3E0091388001FC91B512E093C7FCD93F80C8FC91C9FCA35B137EA313FE5BA312015BA2 1203B512C0A22D287DA72A>80 D<4AB4FC021F13E091387E01F8903901F8007ED907E013 1FD90F80EB0F8049C7EA07C0137E49EC03E0485A4915F0484814011207485A4915F8121F 90C8FC5A17F0007E1503A4007CED07E012FC17C0160F1780161F007C1600163E007E157E 003E017C5BD901FE5B3A1F038701F09039070387C03A0F86018F80D807C6019FC7FCD803 F613FC3900FF03F090393FFFC006EB07FDD90001130E6F5A163C6F5AEDFFF85E6E5B5E6F 5A033EC7FC2D347DA834>I<91381FE0089138FFFC18903903E01E389039078007709039 0E0003F0491301491300017814E0137013F0A2000115C0A216007F7F6CB47E14F86DB47E 6D13F06D7F01077F01007F1407EC00FF153F81A3001880A20038141E12300038141C153C 00781438007C5C007E5C0077EB03C026E3E00FC7FC38C0FFFE38801FF0252A7CA829>83 D<000FB712E05A9039800FE007D81E009038C001C05A0038011F1300123000705C006015 01023F148012E0481400A2C74890C7FCA2147EA214FEA25CA21301A25CA21303A25CA213 07A25CA2130FA25CA2131F001FB57EA22B287DA727>I<3B7FFFE003FFF0A2D803F8C7EA 3E0049143C16180007153816305BA2000F157016605BA2001F15E05E5BA2003F14015E90 C7FCA248140393C7FC127EA200FE5C15065AA2150E150C151C5D007C5C5D6C495A003F49 5A261F800FC8FC3807C07C3801FFF038007F802C297BA72D>III<903B3FFF E00FFFC0A2010190390001FC006D4814F017C0027F495A4CC7FC6E130E6F5A021F5B6F5A 5E91380FE1C0EDE380DA07F7C8FC15FE6E5A5D6E7EA2811403EC077F140E4A7E02187FEC 301F02607F14C049486C7EEB030001066D7E5B01386D7E5B01F06D7E485AD80FF0497ED8 FFFC90381FFFE0A232287DA736>II<010FB612C05B9139E0003F800280EB7F00013EC712FE013C495A0138495A 49495A4B5A0160495A01E0495A4949C7FC5D90C75A4A5A4A5A4A5A4A5A4A5A4A5A4AC8FC 14FE495A495A494813304948137049481360133F4A13E049C75A01FE1301485A4848495A 485A484813074848130F4848013FC7FC484848B4FCB7FC5D2A287CA72D>I<12C0AC1303 131F13FF12C7B5FCA213E3130312F812C0B1131F13FF12C7B5FCA213E3130312F812C012 00A710367BA91B>92 D<1306A31218A8EB07C0130F137FEA1BFF121F38FFFE0013F61386 EAFC0612F81218AFEB07C0130F137FEA1BFF121F38FFFE0013F61386EAFC0612F81218A4 90C7FCA312357CA81B>I97 DII<15F8141FA2 EC01F0A21403A215E0A21407A215C0A2140FEB1F8F90387FCF80EBF0EF3803C03FEA0780 390F001F00A2001E5B123E003C133E127C147E5A147CA214FC5AECF830A3903801F060A2 EA7803010E13C0393C1CF980381FF07F3907C01E001D297CA723>I III<133EEA07FEA2EA007CA213FCA25BA21201A25BA2120314FCEB E3FF9038EF0780D807FC13C0EBF00313E0A2EA0FC014071380A2121FEC0F801300A248EB 1F00A2003E1406143E127EEC7C0C127C151800FCEB3C30157048EB1FE00070EB0F801F29 7CA727>I<130E131F5BA2133E131C90C7FCA7EA03E0487EEA0C78EA187C1230A212605B 12C0A2EA01F0A3485AA2485AA2EBC180EA0F81A2381F0300A213066C5A131CEA07F06C5A 11287DA617>I<1407EC0F80141FA21500140E91C7FCA7EB03E0EB07F8EB0C3C1318EB30 3E136013C0A248485AA2C7FCA25CA4495AA4495AA4495AA4495AA21238D87C1FC7FC12FC 133E485AEA70F8EA7FE0EA1F80193380A61B>I<133EEA07FEA2EA007CA213FCA25BA212 01A25BA21203EC07809038E01FC0EC38600007EB61E014C3EBC187EBC307D80FC613C090 38CC038001B8C7FC13E0487E13FEEB3F80EB0FC0486C7E1303003E1460A2127EECC0C012 7CECC18012FC903801E30038F800FE0070137C1B297CA723>I<137CEA0FFCA2EA00F8A2 1201A213F0A21203A213E0A21207A213C0A2120FA21380A2121FA21300A25AA2123EA212 7EA2EA7C18A3EAF830A21320EA786013C0EA3F80EA0F000E297EA715>I<3B07801FC007 E03B0FE07FF01FF83B18F0E0F8783C3B30F1807CE03E903AFB007D801ED860FEEB3F005B 49133E00C14A133E5B1201A24848495BA35F4848485A1830EE01F0A23C0F8003E003E060 A218C0933801E180271F0007C013E3933800FF00000E6D48137C341B7D993B>I<390780 1FC0390FE07FF03918F0E0F83930F1807CEBFB00D860FE133C5B5B00C1147C5B1201A248 485BA34A5AEA07C01660EC03E0A23A0F8007C0C0A2EDC180913803C300D81F0013C7EC01 FE000EEB00F8231B7D9929>I<9038F007C03901FC1FF039031E78780006EBE03C90381F C01C000CEB801E14005B0018141F133E1200137E153E137CA213FC157C5B1578000114F0 A2EC01E0EC03C03903FC07809038FE1F00EBE7FCEBE1F0D807E0C7FCA25BA2120FA25B12 1FEAFFF8A22025809922>112 DI<3807 803E390FE0FF803818F3C13930F703C0EBFE073860FC0F13F8158039C1F0070091C7FC12 01A2485AA4485AA4485AA448C8FCA2120E1A1B7D991F>II<131C133EA25BA45BA4485AB512E0A23801F000485AA4485AA4485AA448C7FC1460A2 14C0123EEB0180EB0300EA1E06EA1F1CEA0FF8EA03E013267EA419>II<3903E001C03907F003E0380C7807EA187C0030130314011260EBF80000C014C0A2 EA01F0A2EC0180EA03E0A2EC0300EA07C0A21406A25CA200035B6D5A3801F0E06CB45A01 3FC7FC1B1B7D9921>II<90387C03C03901FF0FF03907079C30390E03B078000CEBF0F800 1813E1123015F0396007C0E015001200A2495AA449C7FC15301238007C1460EAFC3E15C0 EAF87E39F06F03803970C70700383F83FE381F01F81D1B7D9926>II<013E13C0137F9038FF81 8048EBC3004813FF380701FE3806000C00045BC75A5C5CEB03800106C7FC5B5B5B5B9038 C00180EA038039060003005C380FF81E381FFFFE38383FFC38601FF86D5A38C007C01A1B 7D9920>I<1404140EA2140FEC0780B612C015E015C0C7EA0F80EC1E005C143814101B0D 74A922>126 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: FJ cmmi10 10 82 /FJ 82 127 df11 DII<1403EC3F F891387FFF80D901E313C014800103133F9138001F80ED070092C7FC80A280A280801301 8080130080147F81143F8149B47E130790380F8FF0EB3E0F496C7E13F83801F003D803E0 7F1207380FC0011380121FEA3F0014005A127EA212FE5D481301A35DA24813035D6C1307 5D127C4A5A6C91C7FC5C6C133E6C6C5A3807C0F03801FFE0D8003FC8FC223D7DBB25>I< EC3FF0EB01FF010F13E090383FC00049C7FC13FCEA03F8485A5B120F485AA2485AA2387F FFFE80A290C8FC5A5AA5127EA4123E123F7E6C6C13606D13E03903E003C03901F01F0038 007FFCEB0FE01C257DA322>I<1406A6ED7FC0913807FFE0ED806091381FFFE091383C7F 8002F0C7FC495A495A495A49C8FC130E131E5B5B5BA2485AA2485A485AA248C9FCA3121E A2123E123CA3127C1278A412F8A57EA2127C127E127F7F6C7E13F0EA1FFE380FFFC06C13 F86C13FEC66D7E013F7F01077F1300EC1FF0140714031401A35DA290381803C0131C9038 0F0780D903FEC7FCEB00F8234B7CB924>III<133F14C0EB07F06D7E801301A26D7EA3147FA36E7EA36E7EA3 6E7EA36E7EA36E7EA36E7EA26E7EA214014A7E5C4A7E91381E3F80143C14784A6C7E1301 EB03E049486C7EEB0F80EB1F00496D7E137E5B48486D7E485A485A000F6E7E485A485A48 C87E12FE167F4816800070151F293B7CB930>21 DI<017E1438D83FFE147E16FEA2 D801FC14FC12000001140116F85BED03F0120315074914E0150F000715C0ED1F805BED3F 00000F147EA2495B4A5A001F495A5D49485A4A5A003F49C7FC143EEB00F8495A48485AEB 0F80D87E3EC8FC13F8EAFFE0138000F8C9FC27257CA429>I<1406A6913807FFC04A13E0 91383F80609138FDFFE0903903F87F804948C7FC495A495A495A137F91C8FC5B5B1201A2 5BA512007F137E90383F3FF090381FFFFC90380FC01C90381FFFF890383C7FE001F0C8FC 485A485A485AA248C9FC121EA25AA2127C1278A312F87EA2127E127F7FEA3FE013FC6CB4 FC6C13E06C13F8000113FF6C6C13C0010F13F001037FEB007F140F14031400A4010C5BEB 0E0190380783E0903801FF80D9007EC7FC234B7EB924>I<013FB612E090B712F05A1207 17E0270F807006C7FC391E00600E48140C003813E04813C048141CEAC001120014800103 5BA213071400A25B1578011E137CA3133E133C137C157E13FC5B1201157F1203497FA3D8 01C0131C2C257EA32F>I<15FE913803FF8091380F83E091383E01F091387C00F85C4948 13FC0103147C4948137E5C130F495AA249C7FC16FE5B137EA2150113FE4914FCA2000114 0316F85BED07F01203ED0FE04914C0151F000715806DEB3F00157E6D5B390FEE01F09038 E707E09038C3FF80D9C0FCC7FC001F90C8FCA25BA2123FA290C9FCA25AA2127EA212FEA2 5AA2127027377EA42B>I<027FB512C00103B612E0130F5B017F15C09026FF81FEC7FC39 01FC007E48487F485A497F484880485AA248C7FCA2127EA2153F00FE92C7FC5AA25D157E 5A5DA24A5AA24A5A007C495A5D003C495A003E013FC8FC6C137C380F81F83803FFE0C66C C9FC2B257DA32F>I<013FB512FE90B7FC5A5A4815FE260F801CC7FCEA1E005A00385B5A 5A481378C7FC147014F0A4495AA31303A3495AA3130FA25C131FA3133FA291C8FC131E28 257EA324>I<1503A35DA21506A2150EA2150CA2151CA21518A21538A21530A21570A2EC 07FE91383FFFC0903901FCE3F0903907E0E0F890391F80C03ED93E007FEB7C01D801F8EC 0F80D803F0018013C0D807E014071403D80FC015E0D81F801300A248485AA2007E1306A2 020E130F12FE48010C14C0A2021CEB1F80A20218EB3F00A20238137E007C5D1430007E4A 5A003E90387003F06CEC07C09138600F80D80F80013FC7FC3903E0E0FC3901F8E7F03900 7FFF80D90FFCC8FCEB01C0A25CA21303A291C9FCA25BA21306A2130EA2130CA22B4B7CB9 31>30 DI<160C161C1618A316 381630A316701660A316E05EA315015EA301F80103130FD803FE9138001F80D8070F153F 000E018015C0001C5C001814060038161F0030160FD8701F010E13070060140C1703D8E0 3F168000C0EB001C491318EA007E180001FE13384913305F000116064913700360130E5F 000316184901E013384B133017705F0201495AD801F849485A4CC7FC160E2600FC035B01 7EEB0078013FEB01E090390FE30F80902603FFFEC8FC9038003FF00206C9FCA2140E140C A3141C1418A314381430A314701460324B7EB936>I 34 D39 D<13F8EA03FC120FEA1FF8EA3F80EA7E00127C5AA25AA47EA2127C 127EEA3F80EA1FF8EA0FFC1203EA00F80E167CA817>44 D<121C127FEAFF80A5EA7F0012 1C0909798817>58 D<121C127FEAFF80A213C0A3127F121C1200A412011380A212031300 5A1206120E5A5A5A12600A19798817>II<150C151E153EA2153C157CA2157815F8A215F01401A215E01403A2 15C01407A21580140FA215005CA2141E143EA2143C147CA2147814F8A25C1301A25C1303 A2495AA25C130FA291C7FC5BA2131E133EA2133C137CA2137813F8A25B1201A25B1203A2 5B1207A25B120FA290C8FC5AA2121E123EA2123C127CA2127812F8A25A12601F537BBD2A >I<126012FCB4FCEA7FC0EA1FF0EA07FCEA01FF38007FC0EB1FF0EB07FCEB01FF903800 7FC0EC1FF0EC07FCEC01FF9138007FC0ED1FF0ED07FCED01FF9238007FC0EE1FF0EE07FC EE01FF9338007F80EF1FC0A2EF7F80933801FF00EE07FCEE1FF0EE7FC04B48C7FCED07FC ED1FF0ED7FC04A48C8FCEC07FCEC1FF0EC7FC04948C9FCEB07FCEB1FF0EB7FC04848CAFC EA07FCEA3FF0EA7FC048CBFC12FC1270323279AD41>I64 D<1760177017F01601A21603A21607160FA24C7EA216331673166316C3A2ED0183A2ED03 03150683150C160115181530A21560A215C014011580DA03007FA202061300140E140C5C 021FB5FC5CA20260C7FC5C83495A8349C8FC1306A25BA25B13385B01F01680487E000716 FFB56C013F13FF5EA2383C7DBB3E>I<0103B77E4916F018FC903B0007F80003FE4BEB00 FFF07F80020FED3FC0181F4B15E0A2141FA25DA2143F19C04B143F1980027F157F190092 C812FE4D5A4A4A5AEF0FF04AEC1FC005FFC7FC49B612FC5F02FCC7B4FCEF3FC00103ED0F E0717E5C717E1307844A1401A2130F17035CA2131F4D5A5C4D5A133F4D5A4A4A5A4D5A01 7F4BC7FC4C5A91C7EA07FC49EC3FF0B812C094C8FC16F83B397DB83F>I<9339FF8001C0 030F13E0037F9038F80380913A01FF807E07913A07F8000F0FDA1FE0EB079FDA3F809038 03BF0002FFC76CB4FCD901FC80495A4948157E495A495A4948153E017F163C49C9FC5B12 01484816385B1207485A1830121F4993C7FCA2485AA3127F5BA312FF90CCFCA41703A25F 1706A26C160E170C171C5F6C7E5F001F5E6D4A5A6C6C4A5A16076C6C020EC8FC6C6C143C 6C6C5C6CB4495A90393FE00FC0010FB5C9FC010313FC9038007FC03A3D7CBA3B>I<0103 B7FC4916E018F8903B0007F80007FE4BEB00FFF03F80020FED1FC0180F4B15E0F007F002 1F1503A24B15F81801143F19FC5DA2147FA292C8FCA25C18035CA2130119F84A1507A213 0319F04A150FA2010717E0181F4A16C0A2010FEE3F80A24AED7F00187E011F16FE4D5A4A 5D4D5A013F4B5A4D5A4A4A5A057FC7FC017F15FEEE03FC91C7EA0FF049EC7FC0B8C8FC16 FC16C03E397DB845>I<0103B812F05BA290260007F8C7123F4B1407F003E0020F150118 005DA2141FA25D19C0143FA24B1330A2027F1470190092C7126017E05C16014A495A160F 49B6FCA25F9138FC000F01031407A24A6DC8FCA201075C18034A130660010F160693C7FC 4A150E180C011F161C18184A1538A2013F5E18F04A4A5AA2017F15074D5A91C8123F4991 3803FF80B9FCA295C7FC3C397DB83D>I<0103B812E05BA290260007F8C7123F4B140FF0 03C0140F18015DA2141FA25D1980143FA25D1760027F14E095C7FC92C75AA24A1301A24A 495A16070101141F91B6FC94C8FCA2903903FC001F824A130EA21307A24A130CA2010F14 1CA24A90C9FCA2131FA25CA2133FA25CA2137FA291CBFC497EB612C0A33B397DB835>I< DCFF8013E0030F13F0037F9038FC01C0913A01FF803E03913A07FC000F07DA0FE0EB038F DA3FC0903801DF804AC812FFEB01FED903F8157F4948ED3F00495A495A494881017F161E 49C9FC5B12014848161C5B1207485A1818121F4993C7FCA2485AA3127F5BA312FF90CCFC 93387FFFFE93B5FCA29338007FC0715A177F95C7FCA27E5F5F7F123F16016C7E5F6C6C14 036D14071207D803FCEC1EF86C6C143C26007F80EBF07890393FF007E0010FB5EA803001 0349C9FC9038003FE03B3D7DBA41>I<0103B5D8F803B512F8495DA290260007F8C73807 F8004B5DA2020F150F615DA2021F151F615DA2023F153F615DA2027F157F96C7FC92C8FC A24A5D605CA249B7FC60A202FCC7120101031503605CA201071507605CA2010F150F605C A2011F151F605CA2013F153F605CA2017F157F95C8FC91C8FC496C4A7EB690B6FCA34539 7DB845>I<0107B512FCA216F890390007F8005DA2140FA25DA2141FA25DA2143FA25DA2 147FA292C7FCA25CA25CA21301A25CA21303A25CA21307A25CA2130FA25CA2131FA25CA2 133FA25CA2137FA291C8FC497EB6FCA326397DB824>I<0203B512FCA3DA000113006F5A A215015EA315035EA315075EA3150F5EA3151F5EA3153F5EA3157F93C7FCA35D5DA31401 A25DA21403120FD83F805B127FEBC007D8FF805BA24A5AEB001F00FC5C00E0495A006049 C8FC007013FE383801F8381E07F03807FFC0D801FEC9FC2E3B7AB82E>I<0103B500F890 3807FFFC5BA290260007F8C813804BEDFC0019F0020F4B5AF003804B4AC7FC180E021F15 38604B5CEF0380023F4AC8FC170E4B133C1770027F5C4C5ADB0007C9FC160E4A5B167E4A 13FE4B7E01015B92380E7F80ECFC1CED383F010301E07FECFDC04A486C7EECFF00D907FC 6D7E5C4A130783130F707E5C1601011F81A24A6D7EA2013F6F7EA24A143F84137F717E91 C8123F496C81B60107B512C0A26146397DB847>I<0103B6FC5B5E90260007FCC8FC5D5D 140FA25DA2141FA25DA2143FA25DA2147FA292C9FCA25CA25CA21301A25CA21303A25CA2 130718404A15C0A2010F150118804A1403A2011F16005F4A1406170E013F151E171C4A14 3C177C017F5D160391C7120F49EC7FF0B8FCA25F32397DB839>I<902603FFF893383FFF 80496081D900079438FF80000206DC01BFC7FCA2020E4C5A1A7E020C1606190CDA1C7E16 FE4F5A02181630A20238166162023016C1F00181DA703F158395380303F002601506A202 E0ED0C076202C01518183001016D6C140F06605B028015C0A20103923801801FDD03005B 140092380FC00649173F4D91C8FC01065DA2010E4B5B4D137E130C6F6C5A011C17FEDCE1 805B011802E3C7FCA2013802E6130104EC5C1330ED03F8017016034C5C01F05CD807FC4C 7EB500E0D9C007B512F01680150151397CB851>I<902603FFF891381FFFF8496D5CA2D9 0007030113006FEC007C02061678DA0EFF157081020C6D1460A2DA1C3F15E0705CEC181F 82023815016F6C5C1430150702706D1303030392C7FC02607FA2DAE0015C701306ECC000 8201016E130EEF800C5C163F0103EDC01C041F131891C713E0160F49EDF0381830010614 0717F8010E02031370EFFC60130CEE01FE011C16E004005B011815FF177F133860013015 3FA20170151F95C8FC01F081EA07FCB512E01706A245397DB843>I<4BB4FC031F13F092 38FE01FC913903F0007EDA07C0EB1F80DA1F80EB0FC0023EC7EA07E002FCEC03F0495A49 48EC01F8495A4948EC00FC495A49C912FE49167E13FE49167F1201485AA2485AA2120F5B 001F17FFA2485AA34848ED01FEA400FFEE03FC90C9FCA2EF07F8A2EF0FF0A218E0171F18 C0EF3F806C167F180017FE4C5A6C6C5D1603001F4B5A6D4A5A000FED1F806C6C4AC7FC6D 147E0003EC01F8D801FC495AD8007EEB0FC090263F807FC8FC903807FFF801001380383D 7CBA3F>I<0103B7FC4916E018F8903B0007F80007FC4BEB00FE187F020FED3F80F01FC0 5DA2021F16E0A25DA2143FF03FC05DA2027FED7F80A292C8130018FE4A4A5A604AEC07F0 4D5A0101ED3FC04CB4C7FC91B612FC17E0D903FCCAFCA25CA21307A25CA2130FA25CA213 1FA25CA2133FA25CA2137FA291CBFC497EB6FCA33B397DB835>I<4BB4FC031F13F09238 FE01FC913903F0007EDA07C0EB1F80DA1F80EB0FC0023EC7EA07E002FCEC03F0495A4948 EC01F8495A4948EC00FC495A013F16FE49C9FC13FE187F485A12035B12075B120F4916FF 121FA2485AA34848ED01FEA448C9EA03FCA3EF07F8A218F0170F18E0171F18C0EF3F807E EF7F0017FEDA07C05B6C90391FF001F8903980383803001F496C485A9139E00C0FE0260F C0C0EB1F80D807E1D90E3FC7FC0280137ED803F1EB07F8D801F95C3A007FC00FC0903A3F E07F0003903807FFFE0100018F5BDA000F1306170E171E705A177CEEC1F816FF5FA25F5F 6F5B6F48C7FCED00F8384B7CBA42>I<0103B612F849EDFF8018E0903B0007F8001FF84B EB03FCEF00FE020F157FA24BEC3F80A2021F16C0A25DA2143FF07F805DA2027FEDFF0060 92C7485A4D5A4A4A5A4D5A4AEC1F80057FC7FC0101EC07F891B612E094C8FC9139FC000F C00103EC03F0707E4A6D7E831307177E5C177F010F5D5F5CA2011F1401A25CA2133F1603 4A4A1360A2017F17E019C091C71401496C01011480B61503933900FE0700EF7E0ECAEA1F FCEF07F03B3B7DB83F>I<92391FE00380DBFFFC130002036D5A91390FE01F8F91393F00 07DF027EEB01FE02F81300495A4948147E177C4948143C495AA2011F153891C8FCA34915 30A28094C7FC80806D7E14FEECFFE06D13FE6DEBFFC06D14F06D806D80021F7F02037FEC 003F03037F1500167F163F161FA3120C160FA2001C151F94C7FCA3003C153EA25E003E5D 127E007F4A5A6D495A6DEB0FC0D8F9F0495AD8F0FE01FEC8FC39E03FFFF8010F13E0D8C0 0190C9FC313D7CBA33>I<0003B812FEA25A903AF8003FC00101C0913880007E4848163C 90C7007F141C121E001C92C7FCA2485CA200305C007017180060130112E0485CA21403C7 16005DA21407A25DA2140FA25DA2141FA25DA2143FA25DA2147FA292C9FCA25CA25CA213 01A25CA21303A25CEB0FFC003FB6FC5AA237397EB831>I<003FB56C48B51280485DA226 007F80C7381FF00091C8EA07C0604993C7FCA2491506A20001160E170C5BA20003161C17 185BA20007163817305BA2000F167017605BA2001F16E05F5BA2003F15015F5BA2007F15 0394C8FC90C8FCA25E4815065A160E160C161C161816385E127E5E4B5A6C4A5A4BC9FC6C 6C131E6C6C5B6C6C13F83903F807E06CB55A6C6C48CAFCEB0FF0393B7BB839>I<267FFF FC91383FFFC0B55DA2000390C83807FC006C48ED03E06060000094C7FC5F17065FA25F6D 5DA26D5D17E05F4C5AA24CC8FC6E1306A2013F5C161C16185EA25E6E5BA2011F495A1503 93C9FC1506A25D6E5AA2010F5B157015605DA2ECE18002E3CAFC14F3EB07F614FE5C5CA2 5C5CA26D5AA25C91CBFC3A3B7CB830>I<277FFFFC01B500F890B51280B5FC60000390C7 D807FCC7380FF80001FC4BEC03E000016204035E98C7FC621A0604075DA2040F5DA2041B 5D6216336D02735D1663000003C34A5A83DB01834AC8FC04815CDB0301140603075D1506 030C5DA203185D1970033015606115606D01E04A5A15C090267F01804AC9FC17FEDA0300 14060400130E0206150C020E5D140C4A5DA24A5D18E04A5D715A5C4A92CAFCA26DC85AA2 013E157C1778133C1770133801301560513B7CB84E>I<49B500F890387FFFF095B5FC1A E0D90003018090380FFC004BC713E00201ED07804EC7FC6E6C140E606F5C705B606F6C48 5A4D5A031F91C8FCEEE0065F6F6C5A5F03075B705A16F96FB45A94C9FC6F5AA36F7EA34B 7FED037F9238063FC0150E4B6C7E1538ED700F03E07F15C04A486C7EEC0300020613034A 805C4A6D7E14704A1300494880495A49C86C7E130E011E153F017E4B7ED803FF4B7E007F 01E0011FEBFFC0B5FC6144397EB845>II<91B7 12FCA25B9239E00007F84AC7EA0FF0D903F8EC1FE04AEC3FC04AEC7F804A150049485C91 C7485A4C5A010E4A5A4C5A010C4A5A011C4A5A01185D167F4CC7FC90C7485A4B5A4B5A4B 5A5E151F4B5A4B5A4BC8FC4A5A4A5A4A5A5D140F4A5A4A5A4A48130C4AC7FC495A4A141C 01031518495A494814384948143049481470495A49C812F0495D00011501484814034848 4A5A4848140F4848141F4848EC7F804848EB07FF90B7FCB8FC94C7FC36397BB839>I<12 C0B21460EB03E0130F137FEAC1FF12C7B5FCA2EBFC6013F013C0EAFE0012F812C0B3A6EB 03E0130F137FEAC1FF12C7B5FCA2EBFC6013F013C0EAFE0012F812C0C7FCAB134F7ABC20 >92 D<147E903803FF8090390FC1C38090391F00EFC0017E137F49133F485A4848EB1F80 12075B000F143F48481400A2485A5D007F147E90C7FCA215FE485C5AA214015D48150CA2 1403EDF01C16181407007C1538007E010F1330003E131F027B13706C01E113E03A0F83C0 F9C03A03FF007F80D800FCEB1F0026267DA42C>97 D<133FEA1FFFA3C67E137EA313FE5B A312015BA312035BA31207EBE0FCEBE3FF9038E707C0390FFE03E09038F801F001F013F8 EBE000485A15FC5BA2123F90C7FCA214015A127EA2140312FE4814F8A2140715F05AEC0F E0A215C0EC1F80143F00781400007C137E5C383C01F86C485A380F07C06CB4C7FCEA01FC 1E3B7CB924>II<163FED1FFFA3ED007F167EA216FEA216FCA21501A216F8A21503A216 F0A21507A2027E13E0903803FF8790380FC1CF90381F00EF017EEB7FC049133F485A4848 131F000715805B000F143F485A1600485A5D127F90C7127EA215FE5A485CA21401A248EC F80CA21403161CEDF0181407007C1538007E010F1330003E131F027B13706C01E113E03A 0F83C0F9C03A03FF007F80D800FCEB1F00283B7DB92B>II<16F8ED03FEED0F87 92381F0F80ED3E3F167F157CA215FC1700161C4A48C7FCA414035DA414075DA20107B512 F0A39026000FE0C7FC5DA4141F5DA4143F92C8FCA45C147EA514FE5CA413015CA4495AA4 5C1307A25C121E123F387F8F80A200FF90C9FC131E12FEEA7C3CEA7878EA1FF0EA07C029 4C7CBA29>III<14E0EB03F8A21307A314F0EB01C0 90C7FCAB13F8EA03FEEA070F000E1380121C121812381230EA701F1260133F00E0130012 C05BEA007EA213FE5B1201A25B12035BA20007131813E01438000F133013C01470EB8060 14E014C01381EB838038078700EA03FEEA00F815397EB71D>I<150FED3F80A2157FA316 00151C92C7FCABEC0F80EC3FE0ECF0F0903801C0F849487E14005B130E130C131CEB1801 133801305BA2EB0003A25DA21407A25DA2140FA25DA2141FA25DA2143FA292C7FCA25CA2 147EA214FEA25CA21301001E5B123F387F83F0A238FF87E0495A00FE5BD87C1FC8FCEA70 7EEA3FF8EA0FC0214981B722>IIIIII<90390F8003F090391FE00FFC 903939F03C1F903A70F8700F80903AE0FDE007C09038C0FF80030013E000014913030180 15F05CEA038113015CA2D800031407A25CA20107140FA24A14E0A2010F141F17C05CEE3F 80131FEE7F004A137E16FE013F5C6E485A4B5A6E485A90397F700F80DA383FC7FC90387E 1FFCEC07E001FEC9FCA25BA21201A25BA21203A25B1207B512C0A32C3583A42A>I<02FC 13C0903803FF0190380F838390383F01C790397E00EF8049137F485A4848133F00071500 5B485A001F5C157E485AA2007F14FE90C75AA3481301485CA31403485CA314075D140F12 7C141F007E495A003E137F381F01EF380F839F3903FF1F80EA00FC1300143F92C7FCA35C 147EA314FE5C130190387FFFF0A322357DA425>I<3903E001F83907F807FE390E3C1E07 391C3E381F3A183F703F800038EBE07F0030EBC0FF00705B00601500EC007E153CD8E07F 90C7FCEAC07EA2120013FE5BA312015BA312035BA312075BA3120F5BA3121F5B0007C9FC 21267EA425>I<14FF010313C090380F80F090383E00380178131C153C4913FC00011301 13E0A33903F000F06D13007F3801FFE014FC14FF6C14806D13C0011F13E013039038003F F014071403001E1301127FA24814E0A348EB03C012F800E0EB07800070EB0F006C133E00 1E13F83807FFE0000190C7FC1E267CA427>II<13F8D803FE1438D8070F147C000E6D13FC121C1218003814011230 D8701F5C12601503EAE03F00C001005B5BD8007E1307A201FE5C5B150F1201495CA2151F 120349EC80C0A2153F1681EE0180A2ED7F0303FF130012014A5B3A00F8079F0E90397C0E 0F1C90393FFC07F8903907F001F02A267EA430>I<01F8EB03C0D803FEEB07E0D8070F13 0F000E018013F0121C12180038140700301403D8701F130112601500D8E03F14E000C090 C7FC5BEA007E16C013FE5B1501000115805B150316001203495B1506150E150C151C1518 15385D00015C6D485A6C6C485AD97E0FC7FCEB1FFEEB07F024267EA428>I<01F816F0D8 03FE9138E001F8D8070F903801F003000ED9800314FC121C12180038020713010030EDE0 00D8701F167C1260030F143CD8E03F163800C001005B5BD8007E131F183001FE5C5B033F 1470000117604991C7FCA218E000034A14C049137E17011880170318005F03FE1306170E 000101015C01F801BF5B3B00FC039F8070903A7E0F0FC0E0903A1FFC03FFC0902703F000 7FC7FC36267EA43B>I<903907E001F090391FF807FC9039783E0E0F9039E01F1C1FD801 C09038383F803A03800FF07F0100EBE0FF5A000E4A1300000C157E021F133C001C4AC7FC 1218A2C7123FA292C8FCA25CA2147EA214FEA24A130CA20101141C001E1518003F5BD87F 81143801835C00FF1560010714E03AFE0E7C01C0D87C1C495A2778383E0FC7FC391FF00F FC3907C003F029267EA42F>I<13F8D803FE1470D8070F14F8000EEB8001121C12180038 1403003015F0EA701F1260013F130700E0010013E012C05BD8007E130F16C013FE5B151F 000115805BA2153F000315005BA25D157EA315FE5D1401000113033800F80790387C1FF8 EB3FF9EB0FE1EB00035DA2000E1307D83F805B007F495AA24A5A92C7FCEB003E007C5B00 705B6C485A381E07C06CB4C8FCEA01FC25367EA429>II<1504151E151FA2ED0F8016C0ED07E0007FB612F0B712F8A26C 15F0C8EA1FC0ED3F00157E5D5D5D1560251271BB2A>126 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: FK cmbx10 10 72 /FK 72 128 df<913803FFC0027F13F00103B512FC010FEB00FED93FF8133FD97FE0EBFF 8049485A5A1480484A13C04A6C1380A36F1300167E93C7FCA592383FFFC0B8FCA4000390 C7FCB3ABB5D8FC3F13FFA4303A7EB935>12 D<912603FFC0EB7FF8027F9039F00FFFFE49 B5D8FC7F6D7E010F903B007FFFE01FC0D91FF8011F90380007E0D97FE0D97FFCEB1FF049 484948133F485C02805C484E7E02004A6D5AA281735A047F6E5A96C8FCA5953807FFF8BB FCA4000390C7397FE0001FB3ABB5D8FC1FB50087B512E0A44B3A7EB950>14 D33 D39 D<141C143C14F8EB01F0EB03E01307EB0FC0EB1F8014005B137E13FE5B12015B1203A248 5AA2120F5B121FA25B123FA4485AA512FFB1127FA56C7EA4121F7FA2120F7F1207A26C7E A212017F12007F137E7F7F1480EB0FC0EB07E01303EB01F0EB00F8143C141C165377BD25 >I<12E07E127C7E7E7F6C7E6C7E12037F6C7E7F12007F137E137FA2EB3F80A214C0131F 14E0A2130F14F0A4EB07F8A514FCB114F8A5EB0FF0A414E0131FA214C0133F1480A2EB7F 00A2137E13FE5B12015B485A5B1207485A485A90C7FC123E5A12F05A16537BBD25>I43 DIII<141E 143E14FE1307133FB5FCA313CFEA000FB3B3A6007FB61280A4213779B630>49 DIII<001C15C0D81F80 130701F8137F90B61280A216005D5D15F05D15804AC7FC14F090C9FCA8EB07FE90383FFF E090B512F89038FC07FC9038E003FFD98001138090C713C0120EC813E0157F16F0A216F8 A21206EA3F80EA7FE012FF7FA44914F0A26C4813FF90C713E0007C15C06C5B6C491380D9 C0071300390FF01FFE6CB512F8000114E06C6C1380D90FF8C7FC25387BB630>II<123C123EEA3FE090B71280A41700485D5E5E 5EA25E007CC7EA0FC000784A5A4BC7FC00F8147E48147C15FC4A5A4A5AC7485A5D140F4A 5A143F92C8FC5C147E14FE1301A2495AA31307A2130F5CA2131FA5133FA96D5A6D5A6D5A 293A7BB830>I<49B47E010F13F0013F13FC9038FE01FF3A01F8007F804848EB3FC04848 EB1FE0150F485AED07F0121FA27FA27F7F01FEEB0FE0EBFF809138E01FC06CEBF03F02FC 13809138FF7F006C14FC6C5C7E6C14FE6D7F6D14C04914E048B612F0EA07F848486C13F8 261FE01F13FC383FC007EB8001007F6D13FE90C7123F48140F48140715031501A21500A2 16FC7E6C14016D14F86C6CEB03F06D13076C6CEB0FE0D80FFEEB7FC00003B61200C614FC 013F13F00103138027387CB630>III65 DII< B87E17F817FF18C028007FF8000713F09338007FF8EF1FFE717E050313807113C0A27113 E0F07FF0A2F03FF8A219FC181FA219FEA419FFAC19FEA419FC183FA219F8187F19F0F0FF E0A24D13C04D13804D1300EF1FFEEF7FFC933807FFF0B912C095C7FC17FC178040397DB8 49>IIIIII<010FB612C0A4D90001EBE000B3B3EA0F80 EA3FE0EA7FF0A2EAFFF8A35E5C13F0007F495BD83FE091C7FC391F800FFE390FF03FFC6C B512F0000114C026003FFCC8FC2A3A7FB831>IIIIIIIIII<003FB91280A4D9F800EBF003D87FC09238007F C049161F007EC7150FA2007C1707A200781703A400F818E0481701A4C892C7FCB3AE010F B7FCA43B387DB742>IIII89 D<003FB712FEA4913980007FFC01FCC7EA FFF801F05B01C015F0494913E090C75A4816C0007E4A13805D007C16004B5A157F00785D 4B5A5C5EC7485B5C5E5C4A5B93C7FC5C4A5A5D14FF495B5D5B495B4B131E5B5D4990C7FC 5B5C4948143E13FF5C485B48167E4A147C484914FC5A4A13014890C7120348150F49143F 4848EB01FFB8FCA42F397BB83A>I97 D<13FFB5FCA412077EAF4AB47E020F 13F0023F13FC9138FE03FFDAF00013804AEB7FC00280EB3FE091C713F0EE1FF8A217FC16 0FA217FEAA17FCA3EE1FF8A217F06E133F6EEB7FE06E14C0903AFDF001FF80903AF8FC07 FE009039F03FFFF8D9E00F13E0D9C00390C7FC2F3A7EB935>I<903801FFC0010F13FC01 7F13FFD9FF8013802603FE0013C048485AEA0FF8121F13F0123F6E13804848EB7F00151C 92C7FC12FFA9127FA27F123FED01E06C7E15036C6CEB07C06C6C14806C6C131FC69038C0 7E006DB45A010F13F00101138023257DA42A>II<903803FF80011F13F0017F13FC3901FF83FE3A03FE 007F804848133F484814C0001FEC1FE05B003FEC0FF0A2485A16F8150712FFA290B6FCA3 01E0C8FCA4127FA36C7E1678121F6C6C14F86D14F000071403D801FFEB0FE06C9038C07F C06DB51200010F13FC010113E025257DA42C>II<161FD907FEEBFFC090387FFFE348B6EAEFE02607 FE07138F260FF801131F48486C138F003F15CF4990387FC7C0EEC000007F81A6003F5DA2 6D13FF001F5D6C6C4890C7FC3907FE07FE48B512F86D13E0261E07FEC8FC90CAFCA2123E 123F7F6C7E90B512F8EDFF8016E06C15F86C816C815A001F81393FC0000F48C813804815 7F5A163FA36C157F6C16006D5C6C6C495AD81FF0EB07FCD807FEEB3FF00001B612C06C6C 91C7FC010713F02B377DA530>I<13FFB5FCA412077EAFED7FC0913803FFF8020F13FE91 381F03FFDA3C01138014784A7E4A14C05CA25CA291C7FCB3A3B5D8FC3F13FFA4303A7DB9 35>II<141FEC7FC0ECFFE0A24913F0A56D13E0A2EC7FC0EC1F0091C7 FCA9EC0FF0EB0FFFA4EB007F143FB3B0121FEA3F80EA7FC0EAFFE0EC7FE0A215C014FF6C 481380903883FE006CB45A000F13F0000113801C4B86BA1D>I<13FFB5FCA412077EAF92 380FFFE0A4923803FC0016F0ED0FE0ED1F804BC7FC157E5DEC03F8EC07E04A5A141FEC7F E04A7E8181A2ECCFFEEC0FFF496C7F806E7F6E7F82157F6F7E6F7E82150F82B5D8F83F13 F8A42D3A7EB932>I<13FFB5FCA412077EB3B3ACB512FCA4163A7DB91B>I<01FED97FE0EB 0FFC00FF902601FFFC90383FFF80020701FF90B512E0DA1F81903983F03FF0DA3C009038 87801F000749DACF007F00034914DE6D48D97FFC6D7E4A5CA24A5CA291C75BB3A3B5D8FC 1FB50083B512F0A44C257DA451>I<01FEEB7FC000FF903803FFF8020F13FE91381F03FF DA3C011380000713780003497E6D4814C05CA25CA291C7FCB3A3B5D8FC3F13FFA430257D A435>I<903801FFC0010F13F8017F13FFD9FF807F3A03FE003FE048486D7E48486D7E48 486D7EA2003F81491303007F81A300FF1680A9007F1600A3003F5D6D1307001F5DA26C6C 495A6C6C495A6C6C495A6C6C6CB45A6C6CB5C7FC011F13FC010113C029257DA430>I<90 39FF01FF80B5000F13F0023F13FC9138FE07FFDAF00113800007496C13C06C0180EB7FE0 91C713F0EE3FF8A2EE1FFCA3EE0FFEAA17FC161FA217F8163F17F06E137F6E14E06EEBFF C0DAF00313809139FC07FE0091383FFFF8020F13E0020390C7FC91C9FCACB512FCA42F35 7EA435>I<49B4EB0780010FEBE00F013FEBF81F9039FFC07C3F0003EB803E3A07FE000F 7F4848EB07FF121F497F123F497F127FA25B12FFAA6C7EA36C7E5D6C7E000F5C6C6C5B6C 6C133F6CEBC0FD39007FFFF1011F13C10101130190C7FCAC037F13FEA42F357DA432>I< 9038FE03F000FFEB0FFEEC3FFF91387C7F809138F8FFC000075B6C6C5A5CA29138807F80 ED3F00150C92C7FC91C8FCB3A2B512FEA422257EA427>I<90383FF0383903FFFEF8000F 13FF381FC00F383F0003007E1301007C130012FC15787E7E6D130013FCEBFFE06C13FCEC FF806C14C06C14F06C14F81203C614FC131F9038007FFE140700F0130114007E157E7E15 7C6C14FC6C14F8EB80019038F007F090B512C000F8140038E01FF81F257DA426>I<130F A55BA45BA25B5BA25A1207001FEBFFE0B6FCA3000390C7FCB21578A815F86CEB80F01481 6CEBC3E090383FFFC06D1380903803FE001D357EB425>I<01FFEC3FC0B5EB3FFFA40007 14016C80B3A35DA25DA26C5C6E4813E06CD9C03E13FF90387FFFFC011F13F00103138030 257DA435>IIIII<003FB612 C0A3D9F0031380EB800749481300003E5C003C495A007C133F5D0078495A14FF5D495B5B C6485B92C7FC495A131F5C495A017FEB03C0EBFFF014E04813C05AEC80074813005A49EB 0F80485A003F141F4848133F9038F001FFB7FCA322257DA42A>I<390F8003E0393FC007 F8EBE00F397FF01FFC00FF14FEA4007F14FC393FE00FF8EBC007390F8003E01F0C78BA30 >127 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: FL cmsy10 10 59 /FL 59 117 df<007FB81280B912C0A26C17803204799641>0 D<121C127FEAFF80A5EA 7F00121C0909799917>I<0060150600F8150F6C151F007E153F6C157E6C6C14FC6C6CEB 01F86C6CEB03F06C6CEB07E06C6CEB0FC06C6CEB1F80017EEB3F006D137E6D6C5A90380F C1F8903807E3F0903803F7E06DB45A6D5B6EC7FCA24A7E497F903803F7E0903807E3F090 380FC1F890381F80FC90383F007E017E7F49EB1F804848EB0FC04848EB07E04848EB03F0 4848EB01F84848EB00FC48C8127E007E153F48151F48150F00601506282874A841>II<15301578 B3A6007FB812F8B912FCA26C17F8C80078C8FCB3A3007FB812F8B912FCA26C17F836367B B641>6 D8 D10 D<923803FFC0033F13FC4AB67E020715E0913A1FFE007FF8DA7FE0EB07 FE4AC87ED903FCED3FC0D907F0ED0FE0D90FC0ED03F049486F7E49CA7E017E177E498349 834848EF0F80000319C04917074848EF03E0000F19F049170148CC12F8A2001E1978003E 197CA2003C193C007C193EA20078191EA300F8191FA248190FAA6C191FA20078191EA300 7C193EA2003C193C003E197CA2001E1978001F19F8A26C6CEF01F06D1703000719E06C6C EF07C06D170F000119806C6CEF1F006D5F017E177E6D5F6D6C4B5A6D6C4B5AD907F0ED0F E0D903FCED3FC0D900FF03FFC7FCDA7FE0EB07FEDA1FFEEB7FF80207B612E002011580DA 003F01FCC8FC030313C0484E7BBB53>13 DII<00 7FB812F8B912FCA26C17F8CCFCAE007FB812F8B912FCA26C17F8CCFCAE007FB812F8B912 FCA26C17F836287BA841>17 D20 D<126012F812FEEA7F80EA3FE0EA0FF8EA03FEC6 6C7EEB3FE0EB0FF8EB03FE903800FF80EC3FE0EC0FF8EC03FE913800FF80ED3FE0ED0FF8 ED03FE923800FF80EE3FE0EE0FF8EE03FE933800FF80EF3FC0171FEF7F80933801FF00EE 07FCEE1FF0EE7FC04B48C7FCED07FCED1FF0ED7FC04A48C8FCEC07FCEC1FF0EC7FC04948 C9FCEB07FCEB1FF0EB7FC04848CAFCEA07FCEA1FF0EA7FC048CBFC12FC1270CCFCAE007F B81280B912C0A26C1780324479B441>I24 D<020FB6128091B712C01303010F1680D91FF8C9FCEB7F8001FECAFCEA01F8 485A485A485A5B48CBFCA2123EA25AA2127812F8A25AA87EA21278127CA27EA27EA26C7E 7F6C7E6C7E6C7EEA00FEEB7F80EB1FF86DB71280010316C01300020F1580323279AD41> 26 D<007FB512FCB712C016F06C15FCC8EA07FE9238007F80EE1FC0EE07E0707E707E70 7E177C83A283A2EF0F80A2170718C0A21703A81707A21880170FA2EF1F00A2173EA25F17 FC4C5A4C5A4C5AEE1FC0EE7F80DB07FEC7FC007FB65AB712F016C06C02FCC8FC323279AD 41>I<05041402051E140F057E143FDC01FE14FF4C48EB01FEDC0FF0EB07F8DC3FC0EB1F E04CC7EA3F80DB01FEECFF00DB07F8EB03FCDB0FE0EB07F0DB3FC0EB1FE003FFC7EA7F80 DA01FC02FEC7FCDA07F8EB03FCDA1FE0EB0FF0DA3F80EB1FC002FFC7EA7F80D903FCD901 FEC8FCD90FF0EB07F84948495AD97F80EB3FC0D801FEC7B4C9FCD803F8EB01FCD80FF0EB 07F8D83FC0EB1FE048C7EA3F8000FE4ACAFCA2007F6E7ED83FC0EB1FE0D80FF0EB07F8D8 03F8EB01FCD801FE6DB4FC26007F80EB3FC0D91FE0EB0FF06D6C6D7ED903FCEB01FED900 FF9038007F80DA3F80EB1FC0DA1FE0EB0FF0DA07F8EB03FCDA01FCEB00FE6EB4EC7F80DB 3FC0EB1FE0DB0FE0EB07F0DB07F8EB03FCDB01FEEB00FFDB007FEC3F80DC3FC0EB1FE0DC 0FF0EB07F8DC03FCEB01FE706CEB00FFDC007E143F051E140F48377BB053>I<00401420 00F0147800FC147EB4EC7F806C6C6D7ED81FE0EB0FF0D807F8EB03FCD801FCEB00FE6CB4 EC7F80D93FC0EB1FE0D90FE0EB07F0D907F8EB03FCD901FEEB00FFD9007FEC3F80DA3FC0 EB1FE0DA0FF0EB07F8DA03F8EB01FCDA01FE6DB4FC9126007F80EB3FC0DB1FE0EB0FF06F 6C6D7EDB03FCEB01FEDB00FF9038007F80DC3F80EB1FC0DC1FE0EB0FF0DC07F8EB03FCDC 01FCEB00FE706C147FA24C4814FEDC07F8EB03FCDC1FE0EB0FF0DC3F80EB1FC004FFC7EA 7F80DB03FC903801FE00DB0FF0EB07F84B48495ADB7F80EB3FC0DA01FEC7B4C7FCDA03F8 EB01FCDA0FF0EB07F8DA3FC0EB1FE04AC7EA3F80D901FE02FFC8FCD907F8EB03FCD90FE0 EB07F0D93FC0EB1FE001FFC7EA7F80D801FC02FEC9FCD807F8EB03FCD81FE0EB0FF0D87F 80EB3FC048C7485A00FC027ECAFC00F0147848377BB053>I<181EA4181F84A285180785 727EA2727E727E85197E85F11F80F10FC0F107F0007FBA12FCBCFCA26C19FCCCEA07F0F1 0FC0F11F80F13F00197E61614E5A4E5AA24E5A61180F96C7FCA260181EA4482C7BAA53> 33 D<1430A31478A314FCA2497EA2497E497FA2497F90381F7BE090383E79F09038FC78 FCD801F8137ED807F0EB3F80D83FE0EB1FF0D8FF80EB07FCD8FE00130100F8EC007C00C0 150CC71400B3B3AD1430264A7EB92A>I<14301478B3B3AD00C0150C00F8157C00FEEC01 FCD8FF801307D83FE0EB1FF0D807F0EB3F80D801F8EB7E00D800FC5B90383E79F090381F 7BE06DB45A6D5BA26D90C7FC6D5AA26D5AA21478A31430A3264A7EB92A>I<0278151EA4 02F8151F4A81A20101834A150701038349486F7EA249486F7E49CA7E4983017E177E4983 4848EF1F804848EF0FC0D80FE0EF07F0003FBA12FCBCFCA2003F19FCD80FE0CAEA07F0D8 03F0EF0FC06C6CEF1F806C6CEF3F00017E177E6D5F6D5F6D6C4B5A6D6C4B5AA26D6C4B5A 01015F6E150F010094C7FCA26E5D0278151EA4482C7BAA53>I39 D49 D<91381FFFFE91B6FC1303010F14 FED91FF0C7FCEB7F8001FEC8FCEA01F8485A485A485A5B48C9FCA2123EA25AA2127812F8 A25AA2B712FE16FFA216FE00F0C9FCA27EA21278127CA27EA27EA26C7E7F6C7E6C7E6C7E EA00FEEB7F80EB1FF06DB512FE010314FF1300021F13FE283279AD37>I54 D<126012F0AD12FCA412F0AD126006207BA400>I<00601618 00F0163C6C167CA200781678007C16F8A2003C16F0003E1501A26CED03E0A26C16C06D14 07A2000716806D140FA26C6CEC1F00A26CB612FEA36C5D01F8C7127CA2017C5CA2013C5C 013E1301A2011E5C011F1303A26D6C485AA201075CECC00FA2010391C7FC6E5AA2903801 F03EA20100133CECF87CA2EC7878EC7CF8A2EC3FF0A26E5AA36E5AA36E5A6EC8FC2E3C80 B92F>I<156015F0A21401EB07F190383FFFE0EB7C1FEBF00748486C5AD803C07F484848 7ED80F007FA248497E001E14BC153C003E143E141FA248EB1E1F143EA2143CA2147C00FC 1580147814F8A214F0A21301A214E01303A214C0A21307A21480A2130FA214005B007C15 00131EA2D87E3E5BA2D83E3C133E137CA21378001F5C13F8000F14784913F800075C0003 495AEBE0033901F007802603FC1FC7FCEBFFFEEBC7F0D807C0C8FCA25BA26CC9FC21477C BF2A>59 D<18F017011707A3170FA2171F60173F1737177F176F17EF17CF04017F178F16 03170FEE0707160EA2161C161816381630167016E0A2ED01C016801503ED0700A2150E5D A25D157815705D02018103CFB5FCEC03BF4AB6FCA2020EC71203141E5C14380278810020 5B386001E0EAF0036C4848140126FE1F8081B5C8FC190C49EEFF3C496F13F06C4817E06C 4817806C48EE7E00D8078093C7FC3E407DBB42>65 D67 D<0203B512F0027F14FF49B7 12E0010F16F890273FC3F00713FED978039038007FFF2601E007020F1380D803C0030313 C0D80780030013E0000F177FD81F00EE3FF048EF1FF8003E4A140F5A0078EF07FC00C001 0F1503C7FCA24B1401A3141F5DA3023F16F8A292C8FCF003F0A25C027EED07E0A219C04A 150F1980F01F00495A183E6049481578604D5A49484A5A4D5A050EC7FC4948143C5FEE01 E04948EB07C0043FC8FC91380001FC49EB3FF049B5128048B500FCC9FC4814E04801FCCA FC3E397FB840>II<0307B6 12FE033FEDFF804AB812C0140791260F807EC7FC91263C00FEEC3F004A161E4A49141801 0194C7FC495A01071301A2D90FC05B148014000118130390C75BA34B5AA3150F5EA34B5A A293B512FC4B5C604B14C0037ECAFCA25DA25D1401A24A5AA25D14075D140F5D141F92CB FC5C0006133E003E137E007E137CB413FC6D5AEBC1F0EBF1E06CB45A6C90CCFC6C5AEA07 F0423C7EB83C>III<92B6 12FC021F15F891B712F0010316C090270FF0003CC7FC013EC7127C01785C49130100015D 0003140348485C49130790C7FCC8485AA34B5AA34BC8FCA35D157EA315FE5DA314015DA3 4A5AA314075DA34A5AA25D141F92C9FC4A1406023E141C027E147C027C5C4A495A4A5C49 48495A000FB7C7FC003F5D4815F0B712C0363982B82D>I76 DI<0370EBFF80912601E00713E0912603C0 1F13F891260F007F7F021E9038F03FFE913A7803C00FFF9139F0078003494848486C1380 902603C01E7F902607803EEC7FC049485A011E49143F013E17E0494848141FEBF8035D26 01F007150F00035CEBE00F00075CD9C01EC8FC000F131C49C9FC121FA248CA13C0A34817 1F1980127EA2183F00FE1800A2183E187E187C18FC6017016C5F4D5A6017076C6C4B5A4D C7FC171E6D5D6C6C5D5F6D4A5A6C6CEC03806C6C020FC8FC01FF143E6C01C013F86C9038 F807E06C90B512806C6C49C9FC011F13F0010313803B3D7BBA42>79 D<0203B512F8027FECFF8049B712F0010F8290273FC3F00313FED978039038003FFF2601 E00702071380D803C06F13C0D807801500000F177FD81F00EE3FE0484A141F123E5A0078 010F150F12C0C7FC4B15C0A3021FED1F80A24B1500183EA2023F5D6092C85A4D5A4D5A4A 4A5A027E020EC7FC173C17F84AEB03E0EE3F80DB1FFEC8FC0101EB7FF89138F8FFC0DAF9 FCC9FC02F8CAFC495AA3495AA3495AA3495AA291CBFC5BA2137EA35B13F013C03B3D7FB8 3A>I<0203B512FE027FECFFF049B712FC010F16FF90273FC3F00080D9780302077F2601 E0071401D803C06F6C7ED80780163F000F171FEA1F00484A140F123E5A0078010F5E12C0 C7FC4B4A5AA296C7FC021F5D183E4B5C187860023F4A5A4D5A92C7000FC8FC173EEE03F8 4AEBFFE0DA7E0313804B48C9FC4B7EECFC036F7F6F7F0101147F4A80163F707E495A707E A249481307830403151049486E14F0F101E04A6D6CEB03C0011F933880078070EC0F0049 C8EBC01E716C5A013E92383FF0F0017EEEFFE0017C6F1380496F48C7FC01E0ED07F0443B 7FB846>82 DI<1A801907F10F00023FB712FE49B8 5A010F17F0013F17C0494CC7FC2801E00003F0C9FC48481307485A120F48C7485A5A5AA2 00FE4A5A5A12F01280C8485AA44BCAFCA415FEA44A5AA44A5AA44A5AA4140F5DA35D141F A25D143FA292CBFC5CA2147E14FE5CA2495A5C495A5C0102CCFC41427DBB2D>IIII<0060161800F0163CB3B26C167CA2007C16F8A26CED01F0003F 15036C6CEC07E06C6CEC0FC0D807F0EC3F80D803FE903801FF003A00FFC00FFC6DB55A01 1F14E0010391C7FC9038007FF82E347CB137>91 DI102 D<12FCEAFFC0EA07F0EA01FCEA007E7F80131F80130FB3A7801307 806D7E6D7EEB007EEC1FF0EC07F8EC1FF0EC7E00495A495A495A5C130F5CB3A7131F5C13 3F91C7FC137E485AEA07F0EAFFC000FCC8FC1D537ABD2A>I<14C0EB01E01303A214C013 07A21480130FA2EB1F00A2131E133EA25BA2137813F8A2485AA25B1203A25B1207A2485A A290C7FC5AA2123EA2123C127CA2127812F8A41278127CA2123C123EA27EA27E7FA26C7E A212037FA212017FA26C7EA21378137CA27FA2131E131FA2EB0F80A2130714C0A2130314 E0A21301EB00C0135278BD20>I<126012F07EA21278127CA2123C123EA27EA27E7FA26C 7EA212037FA26C7EA212007FA21378137CA27FA2131E131FA2EB0F80A2130714C0A21303 14E0A414C01307A21480130FA2EB1F00A2131E133EA25BA2137813F8A25B1201A2485AA2 5B1207A2485AA290C7FC5AA2123EA2123C127CA2127812F8A25A126013527CBD20>I<12 6012F0B3B3B3B3A91260045377BD17>I<0070131C00F0131EB3B3B3B3A80070131C1752 77BD2A>I<126012F07EA21278127CA2123C123EA2121E121FA27E7FA212077FA212037F A212017FA212007FA21378137CA2133C133EA2131E131FA27F80A2130780A26D7EA21301 80A2130080A21478147CA2143C143EA2141E141FA2801580A2140715C0A2140315E0A214 0115F0A2140015F8A21578157CA2153C153EA2151E150C1F537BBD2A>110 D112 D114 D<0060166000F016F0B3B3A9B8FCA36C16E02C327BB1 37>116 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: FM cmr7 7 73 /FM 73 128 df0 DI<1438A3147CA314FEA2497E14BFA2 01037F141FA201067F140FA2010C7F1407A201187F1403A201307F1401A201607F140001 E07F49137EA20001147F497FA248C71380151FA24815C05AD81FC0EB3FE03AFFF001FFFE A2272A7EA92D>3 D6 D<90383FFFFCA2010090C7FC147EA5903803FF80013F13F89038FC7E 7ED803E0EB0F80D80FC0EB07E0D81F00EB01F04815F8007EEC00FCA248157EA6007E15FC A26CEC01F86C15F0D80FC0EB07E0D803E0EB0F80D800FCEB7E0090383FFFF801031380D9 007EC7FCA514FF013F13FCA227287DA72F>8 D<010FB5FCA29038003FC06E5AA400FEED 0FE06C151FD83F80EC3F80001F160001C05C000F157EA813E000075DA3D803F0EB81F8EA 01F8ED83F0D800FCEB87E0013FEB8FC090261FDFBFC7FC903807FFFC9038007FE0EC1F80 A54A7E010FB5FCA22B287DA733>I<903803FF80011F13F090387E00FCD801F8133FD807 E0EB0FC04848EB07E04848EB03F048C7EA01F8A2007EEC00FCA248157EA7007E15FCA36C EC01F8A26C6CEB03F0000F15E0A26C6CEB07C0000315806C6CEB0F00A26C6C131ED8C070 EB1C060178133CD86038EB380C01181330011C13700070151CD87FFCEB7FFC003F15F8A3 27297DA82F>I<1238127C12FE12FFA2127F123B1203A31206A3120C1218123812701220 08127BA713>39 D<1306130C13181330136013E0EA01C0EA0380A2EA07005A120E121EA2 121C123CA35AA512F85AAB7E1278A57EA3121C121EA2120E120F7EEA0380A2EA01C0EA00 E0136013301318130C13060F3B7AAB1A>I<12C012607E7E7E120E7EEA0380A2EA01C013 E0120013F0A213701378A3133CA5133E131EAB133E133CA51378A3137013F0A213E01201 13C0EA0380A2EA0700120E120C5A5A5A5A0F3B7DAB1A>I<140EB3A2B812E0A3C7000EC8 FCB3A22B2B7DA333>43 D45 D<1238127C12FEA3127C123807077B 8613>I48 D<13381378EA01F8121F12FE12E01200B3AB487EB512F8A21526 7BA521>I<13FF000313E0380E03F0381800F848137C48137E00787F12FC6CEB1F80A412 7CC7FC15005C143E147E147C5C495A495A5C495A010EC7FC5B5B903870018013E0EA0180 390300030012065A001FB5FC5A485BB5FCA219267DA521>I<13FF000313E0380F01F838 1C007C0030137E003C133E007E133FA4123CC7123E147E147C5C495AEB07E03801FF8091 C7FC380001E06D7E147C80143F801580A21238127C12FEA21500485B0078133E00705B6C 5B381F01F03807FFC0C690C7FC19277DA521>I<1438A2147814F81301A2130313071306 130C131C131813301370136013C012011380EA03005A120E120C121C5A12305A12E0B612 E0A2C7EAF800A7497E90383FFFE0A21B277EA621>I<0018130C001F137CEBFFF85C5C14 80D819FCC7FC0018C8FCA7137F3819FFE0381F81F0381E0078001C7F0018133EC7FC80A2 1580A21230127C12FCA3150012F00060133E127000305B001C5B380F03E03803FFC0C648 C7FC19277DA521>II<1230123C003FB512E0A215C0481480A239700007000060130E140C48131C5C 5CC75A5C1301495AA249C7FC5B130E131EA3133E133CA2137CA413FCA813781B287DA621 >I<137F3803FFE0380781F8380E007C48131E5A801278A3127C007E131EEA3F80EBE03C 6C6C5A380FFCF03807FFC06C5BC613E0487F38079FFC380F07FEEA1E0348C67E48133FEC 1F8048130FA21407A315001278140E6C5B6C5B380F80F03803FFE0C66CC7FC19277DA521 >I<137F3801FFC03807C1E0380F0070001E1378003E7F003C133E007C131EA200FC131F A41580A4007C133FA2123C003E137F001E135F380F01DF3807FF9F3801FE1FD800101300 1300A2143E123C007E133CA25C5C007C5B383003C0381C0780D80FFFC7FCEA03F819277D A521>I<1238127C12FEA3127C12381200AB1238127C12FEA3127C123807197B9813>I61 D<140EA2141FA34A7EA3EC6FC0A2ECEFE014C7 A290380183F0A390380301F8A201067F1400A249137EA2011C137F01187FA24980013FB5 FCA2903960000FC0A201E080491307A248486D7EA200038115011207D81FC0497ED8FFF8 90383FFFE0A22B2A7EA931>65 D I<91387FC002903903FFF80690390FE01E0E90383F0007017CEB019ED801F0EB00FE4848 147E4848143E5B000F151E48C8FC48150E123EA2007E1506A2127C00FC1500A8127C007E 1506A2123EA2003F150C7E6C7E000715186D14386C6C14306C6C1460D8007CEB01C0013F EB038090390FE01E00903803FFF89038007FC0272A7DA82F>IIII<9138 7FC002903903FFF80690390FE01E0E90383F0007017CEB019ED801F0EB00FE4848147E48 48143E5B000F151E48C8FC48150E123EA2007E1506A2127C00FC92C7FCA792387FFFE012 7C007E02001300167E123EA2123F7E6C7E6C7EA26C7ED801F814FEEA007C013FEB039E90 390FE00F0E903903FFFC029026007FE0C7FC2B2A7DA833>II< B512C0A23807F8006C5AB3B0487EB512C0A212287EA718>I75 DIIIIIII<9038 7F80203903FFF06039078078E0380E000E481307481303007813010070130012F0A21560 A27E1500127C127FEA3FE013FF6C13F06C13FC000313FFC61480010F13C0010013E0EC0F F014031401EC00F8A200C01478A46C1470A26C14F06C14E06CEB01C000EFEB078039E3E0 1F0038C0FFFC38801FF01D2A7DA825>I<007FB7FCA23A7E003F003F0078150F00708100 6081A200E01680481501A5C791C7FCB3A64A7E013FB5FCA229287EA72F>II II<3B7FFF801FFF80A23B07FE0007F8006C48EB03E0000115806C 6C91C7FC017F1306150E6D6C5A90381FC0186D6C5A1570903807F0606D6C5AEB01F9ECFF 806D90C8FC80A26E7E6E7E143F4A7EECE7F0ECC3F8EB018390380381FC49C67E0106137E 49137F011C6D7E496D7E1330496D7E01E06D7E00016E7E1203D80FF0EB07FED8FFFC9038 1FFFE0A22B287EA731>II< 003FB6FCA2EBC00090C712FE003CEB01FC0038EB03F8A248EB07F0EC0FE0A20060EB1FC0 EC3F80A2C7EA7F0014FEA2495A495AA2495A495A495AA2495A90387F0003A213FE485AA2 48481307485AA24848130E485A151E4848133E48C7127E48EB03FE90B5FCA220287DA728 >II93 D<5AEA0380EA07C0EA0FE0EA1EF0EA3C78EA701CEAE00EEAC0060F0978A721 >I98 D100 D<133F3801FFE03803E1F0380F80F8381F007C143E123E007E131E141F127C12FCA2B6FC A200FCC7FCA4127C127E1403123E6C1307380F800E3807C01C3803E0783800FFE0EB3F80 181C7E9A1E>I<90387E03E03901FF9FF03807C3FC380F00F048EBF800001E1378003E13 7CA6001E1378001F13F86C5BEBC3E0380DFF80D81C7EC7FC90C8FCA3121E380FFFF014FC 6C13FF001F1480393E001FC000781307EC03E0481301A40078EB03C0007C13076CEB0F80 390FC07E003803FFF838007FC01C277E9921>103 DI<120EEA3F80A5EA0E00C7FCA7EA078012FFA2121F120FB3121FEAFFF8A20D 287EA713>I<260F81FC137F3BFF8FFF03FFC0903A9C0F8703E03B1FB007CC01F0D80FE0 13D8903AC003F000F8A301805BAF486C486C487E3CFFF83FFE0FFF80A2311A7E9937> 109 D<380F81FC38FF8FFF90389C0F80391FB007C0EA0FE09038C003E0A31380AF391FC0 07F039FFF83FFEA21F1A7E9925>II<380F81FC38FF8FFF9038BC0FC0391FF0 07E0390FC003F0EB800115F8EC00FCA2157C157EA7157C15FCA2EC01F801C013F0EC03E0 9038F007C09038BC1F8090388FFF00EB83F80180C7FCA7487EEAFFF8A21F257E9925>I< 380F07C038FF1FF0EB38F8EA1F71EA0F6113C1EBC0F014005BAF487EEAFFFCA2151A7E99 1A>114 D<3803F840380FFEC0EA3C07EA7803EA7001EAF000A37E6C1300EA7FC013FC6C B4FC6C1380000713C0C613E0130738C003F0130113007EA26C13E0130100F813C038EE07 8038C7FF00EA81FC141C7E9A1A>I<13C0A41201A312031207120F121FB512E0A23807C0 00AC1430A73803E060A23801F0C03800FF80EB3F0014257FA31A>I<39FFF807FEA2390F E001F001C013E0000714C013E000031480EBF00300011400A23800F806A2EB7C0CA2EB7E 1CEB3E18A26D5AA2EB0FE0A36D5AA26D5AA21F1A7F9823>118 D<3BFFF8FFF07FE0A23B 1FC01FC01F80000F90390F800E00A20007150CEC1FC02603E01B5B15E0143B2601F0315B 15F0D9F86013700000156015F89039FCC078E0017CEB7CC0137D90393F803D80153FEC00 1F6D91C7FCA2011E7F010E130EA22B1A7F982F>I<39FFF81FFCA2390FF00FE0D807E013 80D803F013003801F80E00005BEB7C386D5AEB3FE06D5A130F130780497EEB1DF8EB38FC EB707EEBE03E48487E0003EB0F80000714C0001F14E039FFE01FFEA21F197F9823>I<38 3FFFFEA2383E00FCEA3801003013F8387003F0EB07E0EA600F14C0EB1F8038003F00137E 13FE5B3801F806EA03F0EA07E0120FEBC00E381F800C383F001C5A007E137CB512FCA217 197E981E>122 DI<380F8010381FF038383FFFF04813E038E07F C038400F8015067BA621>126 D<3838038038FC07E0EAFE0FA3EAFC073838038013077A A721>I E %EndDVIPSBitmapFont %DVIPSBitmapFont: FN cmtt10 10 21 /FN 21 122 df<121FEA3F80EA7FC0EAFFE0A5EA7FC0EA3F80EA1F000B0B708A2C>46 D64 D79 D86 D<3801FFF0000713FE001F6D7E15E0488090 38C01FF81407EC01FC381F80000006C77EC8127EA3ECFFFE131F90B5FC1203120F48EB80 7E383FF800EA7FC090C7FC12FE5AA47E007F14FEEB8003383FE01F6CB612FC6C15FE6C14 BF0001EBFE1F3A003FF007FC27247CA32C>97 DI100 DI104 D<1307EB1FC0A2497EA36D5AA20107C7FC90C8FCA7387FFFC080B5FC7EA2EA0007B3A800 7FB512FCB612FEA36C14FC1F3479B32C>I107 D<387FFFE0B57EA37EEA0003B3B3A500 7FB61280B712C0A36C158022337BB22C>I<3A7F83F007E09039CFFC1FF83AFFDFFE3FFC D87FFF13FF91B57E3A07FE1FFC3E01FCEBF83F496C487E01F013E001E013C0A301C01380 B33B7FFC3FF87FF0027F13FFD8FFFE6D13F8D87FFC4913F0023F137F2D2481A32C>I<39 7FF01FE039FFF87FFC9038F9FFFE01FB7F6CB6FC00019038F03F80ECC01F02807FEC000F 5B5BA25BB3267FFFE0B5FCB500F11480A36C01E0140029247FA32C>II114 D<90387FF8700003B512F8120F5A5A387FC00F387E00034813015AA36CEB00F0007F1400 13F0383FFFC06C13FE6CEBFF80000314E0C66C13F8010113FCEB0007EC00FE0078147F00 FC143F151F7EA26C143F6D133E6D13FE9038F007FC90B5FC15F815E000F8148039701FFC 0020247AA32C>I<131E133FA9007FB6FCB71280A36C1500D8003FC8FCB1ED03C0ED07E0 A5EC800F011FEB1FC0ECE07F6DB51280160001035B6D13F89038003FE0232E7EAD2C>I< 3A7FF003FF80486C487FA3007F7F0001EB000FB3A3151FA2153F6D137F3900FE03FF90B7 FC6D15807F6D13CF902603FE07130029247FA32C>I<3A7FFF01FFFCB514FE148314016C 15FC3A03E0000F80A26D131F00011500A26D5B0000143EA26D137E017C137CA2017E13FC 013E5BA2EB3F01011F5BA21483010F5BA214C701075BA214EF01035BA214FF6D90C7FCA2 6D5A147C27247EA32C>I<3A7FFF01FFFCB5008113FE148314816C010113FC3A03E0000F 806C7E151F6D140012005D6D133E137C017E137E013E137CA2013F13FC6D5BA2EB0F815D A2EB07C1ECC3E0A2EB03E3ECE7C0130114F75DEB00FFA292C7FC80A2143EA2147E147CA2 14FC5CA2EA0C01003F5BEA7F83EB87E0EA7E0F495A387FFF806C90C8FC6C5A6C5AEA07E0 27367EA32C>121 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: FO cmti10 10 72 /FO 72 128 df<04FFEB03F003039038E00FFC923A0FC0F01F1E923A3F00783E0F923A7E 01F87C3FDB7C03EBFC7F03FC14F8DA01F813F905F1137EDC01E1133C913B03F00003F000 A314074B130760A3140F4B130F60A3010FB812C0A3903C001F80001F8000A3023F143F92 C790C7FCA44A5C027E147EA402FE14FE4A5CA413014A13015FA313034A13035FA313074A 495AA44948495AA44948495AA3001CD9038090C8FC007E90380FC03F013E143E00FE011F 5B133C017C5C3AF8780F01E0D878F0EB07C0273FE003FFC9FC390F8000FC404C82BA33> 11 DI< EE7FE0923903FFFC7E92380FC03E92381F000F033EEB3FFE4B137F03FC14FC5D1401173D 4A48EB01F8A21703A24A4814F0A21707A2020F15E05D170FA218C0010FB7FCA3903B001F 80001F80A2173F143F92C71300A25FA24A147E147E17FEA25F14FE4A1301A25FA2010114 035CEFF070A21607010316F04AECE0E0A3EFE1C013074A14C3933803E380EE01E7933800 FF004948143C94C7FCA3495AA3001C90CAFC127E133E12FE133C137CEAF878EA78F0EA3F E0EA0F80374C82BA31>II<130FEB1F80133F 137FEBFF00485A5BEA03F0485A485A485A003EC7FC5A5A12E05A111064B92A>19 D<3901E003C03907F00FE0000F131F01F813F0001F133FA3000F131F3907B00F60380030 00A2017013E0016013C0EBE00101C01380000113030180130000035B3807000E000E5B48 5B485B485B48485A00C05B1C1971B92B>34 D39 D<150C151C153815F0EC01E0EC03C0EC0780EC0F00141E5C147C5C5C495A1303495A5C13 0F49C7FCA2133EA25BA25BA2485AA212035B12075BA2120F5BA2121FA290C8FCA25AA212 3EA2127EA2127CA412FC5AAD1278A57EA3121C121EA2120E7EA26C7E6C7EA212001E5274 BD22>I<140C140E80EC0380A2EC01C015E0A2140015F0A21578A4157C153CAB157CA715 FCA215F8A21401A215F0A21403A215E0A21407A215C0140F1580A2141F1500A2143EA25C A25CA2495AA2495A5C1307495A91C7FC5B133E133C5B5B485A12035B48C8FC120E5A1278 5A12C01E527FBD22>I<4B7E4B7EA21507A25EA2150FA293C8FCA25DA2151EA2153EA215 3CA2157CA21578A2007FB812E0B9FCA27EC7D801F0C8FCA25DA21403A25DA21407A25DA2 140FA292C9FCA25CA2141EA2143EA2141C333275AD40>43 DI<387FFFF8A2B5FCA214F0150579941E>I<120EEA3F80127F12FFA31300127E12 3C0909778819>I<15181538157815F0140114031407EC0FE0141F147FEB03FF90383FEF C0148FEB1C1F13001580A2143FA21500A25CA2147EA214FEA25CA21301A25CA21303A25C A21307A25CA2130FA25CA2131FA25CA2133FA291C7FC497EB61280A31D3877B72A>49 DII<133C137E13FF5AA313FE13FCEA00701300B2120E EA3F80127F12FFA31300127E123C102477A319>58 DI65 D<0107B612FCEFFF8018C0903B000FF0001FF04BEB07F81703021F15FC17014B14 FEA2023F1400A24B1301A2147F18FC92C7120318F84A140718F04AEC0FE0EF1FC00101ED 3F80EF7F004AEB01FEEE07F849B612E05F9139F80007F0EE01FC01076E7E177F4AEC3F80 A2010F16C0171F5CA2131F173F5CA2133FEF7F805C1800017F5D4C5A91C7485A5F49140F EE1FE0494A5A00014AB45AB748C7FC16F816C037397BB83A>II<0103B612FEEFFFC018F0903B 0007F8000FF84BEB03FCEF00FE020F157FF03F804B141F19C0021F150F19E05D1807143F 19F05DA2147FA292C8FCA25C180F5CA2130119E04A151FA2130319C04A153FA201071780 187F4A1600A2010F16FEA24A4A5A60011F15034D5A4A5D4D5A013F4B5A173F4A4AC7FC17 FC017FEC03F84C5A91C7EA1FC04949B45A007F90B548C8FCB712F016803C397CB83F>I< 0107B8FCA3903A000FF000034BEB007F183E141F181E5DA2143FA25D181C147FA2923800 0380A24A130718004A91C7FC5E13015E4A133E167E49B512FEA25EECF8000107147C163C 4A1338A2010F147818E04A13701701011F16C016004A14031880013F150718004A5CA201 7F151E173E91C8123C177C4915FC4C5A4914070001ED7FF0B8FCA25F38397BB838>I<01 07B712FEA3903A000FF000074B1300187C021F153CA25DA2143FA25D1838147FA292C8FC EE03804A130718004A91C7FCA201015CA24A131E163E010314FE91B5FC5EA2903807F800 167C4A1378A2130FA24A1370A2011F14F0A24A90C8FCA2133FA25CA2137FA291CAFCA25B A25B487EB6FCA337397BB836>II<0103B5D8F80FB512E0A390260007F8C7381FE0 004B5DA2020F153F615DA2021F157F96C7FC5DA2023F5D605DA2027F14016092C7FCA24A 1403605CA249B7FC60A202FCC712070103150F605CA20107151F605CA2010F153F605CA2 011F157F95C8FC5CA2013F5D5F5CA2017F14015F91C7FC491403007FD9FE01B512F8B55B A243397CB83E>I<0103B512F8A390390007F8005DA2140FA25DA2141FA25DA2143FA25D A2147FA292C7FCA25CA25CA21301A25CA21303A25CA21307A25CA2130FA25CA2131FA25C A2133FA25CA2137FA291C8FC497EB6FCA25C25397CB820>I<0103B500F890387FFFE0A2 1AC090260007F8C7380FFC004B15E061020F4BC7FC183E4B5C18F0021F4A5A4D5A4BEB0F 804DC8FC023F143C5F4B5B4C5A027FEB07C04CC9FCED001E5E4A5BED01FCECFE03150701 01497E151FECFC7C4B7E903903FDE07FDAFFC07F1580ED003F49488014F84A131F83130F 160F4A801607011F81A24A130383133F16014A80A2017F6E7EA291C8FC494A7F007F01FE 011F13FCB55CA243397CB840>75 D<0107B512FCA25E9026000FF8C7FC5D5D141FA25DA2 143FA25DA2147FA292C8FCA25CA25CA21301A25CA21303A25CA21307A25CA2130F170C4A 141CA2011F153C17384A1478A2013F157017F04A14E01601017F140317C091C71207160F 49EC1F80163F4914FF000102071300B8FCA25E2E397BB834>I<902607FFF8923807FFF0 614F13E0D9000FEFF0004F5AA2021F167FF1EFC0141DDA1CFCEC01CF023C16DF9538039F 800238ED071FA20278ED0E3F97C7FC0270151CA202F04B5AF0707E14E0037E14E0010117 FE4D485A02C0EC0380A20103ED0701610280140EA20107ED1C0305385B14006F13704916 0705E05B010EEC01C0A2011E913803800F61011CEC0700A2013C020E131F4C5C1338ED1F B80178163F04F091C8FC01705CA201F04A5B187E00015DD807F816FEB500C09039007FFF FC151E150E4C397AB84A>I<902603FFF891B512E0A281D90007923807F8006F6E5A6102 0F5E81DA0E7F5DA2021E6D1307033F92C7FC141C82DA3C1F5C70130EEC380FA202786D13 1E0307141C147082DAF003143C70133814E0150101016E1378030014705C8201036E13F0 604A1480163F010715C1041F5B91C7FC17E149EC0FE360010E15F31607011E15FF95C8FC 011C80A2013C805F1338160013785F01F8157CEA03FC267FFFE0143CB51538A243397CB8 3E>I I<0107B612F817FF1880903B000FF0003FE04BEB0FF0EF03F8141FEF01FC5DA2023F15FE A25DA2147FEF03FC92C7FCA24A15F817074A15F0EF0FE01301EF1FC04AEC3F80EFFE0001 034A5AEE0FF091B612C04CC7FCD907F8C9FCA25CA2130FA25CA2131FA25CA2133FA25CA2 137FA291CAFCA25BA25B1201B512FCA337397BB838>II<0103B612F017FEEFFF80903B0007F8003FC04BEB0FF01707020FEC03F8EF01 FC5DA2021F15FEA25DA2143FEF03FC5DA2027FEC07F818F092C7120F18E04AEC1FC0EF3F 004A14FEEE01F80101EC0FE091B6128004FCC7FC9138FC003F0103EC0F80834A6D7E8301 071403A25C83010F14075F5CA2011F140FA25CA2133F161F4AECE007A2017F160F180E91 C7FC49020F131C007F01FE153CB5913807F078040313F0CAEAFFE0EF3F80383B7CB83D> I<92383FC00E913901FFF01C020713FC91391FC07E3C91393F001F7C027CEB0FF84A1307 49481303495A4948EB01F0A2495AA2011F15E091C7FCA34915C0A36E90C7FCA2806D7E14 FCECFF806D13F015FE6D6D7E6D14E0010080023F7F14079138007FFC150F15031501A215 00A2167C120EA3001E15FC5EA3003E4A5AA24B5AA2007F4A5A4B5A6D49C7FC6D133ED8F9 F013FC39F8FC03F839F07FFFE0D8E01F138026C003FCC8FC2F3D7ABA2F>I<0007B812E0 A25AD9F800EB001F01C049EB07C0485AD900011403121E001C5C003C1780140312380078 5C00701607140700F01700485CA2140FC792C7FC5DA2141FA25DA2143FA25DA2147FA292 C9FCA25CA25CA21301A25CA21303A25CA21307A25CA2130FA25CEB3FF0007FB512F8B6FC A2333971B83B>I<003FB539800FFFFEA326007F80C7EA7F8091C8EA3F00173E49153CA2 491538A20001167817705BA2000316F05F5BA2000715015F5BA2000F15035F5BA2001F15 0794C7FC5BA2003F5D160E5BA2007F151E161C90C8FCA2163C4815385A16781670A216F0 4B5A5E1503007E4A5A4BC8FC150E6C143E6C6C5B15F0390FC003E03907F01FC00001B5C9 FC38007FFCEB1FE0373B70B83E>III89 D<91B712F0A25B9239E0001FE092C7EA3FC0D903FCEC7F8002F015004A14FE 16014948495A4A495A4C5A49C75B4C5A010E143F011E4A5A011C4AC7FC4B5A5E90C7485A 15074B5A4B5A4B5A5E157F4BC8FC4A5A4A5A4A5A5D140F4A5A4A5A4A5A4AC712E05C1301 4948130149485C495A494813034A5C013F1407495A49C7FC48484AC7FC48485C5B000715 3E4848147E4848EB01FE4848EB07FC4848133F90B6FCB7FC5E34397AB833>I<01181330 013813709038F001E03901C003800180130000035B3807000E000E5B000C1318001C1338 485B00301360A2007013E000605BA238EF01DE38FF81FFA66CC65A003C13781C196AB92B >92 D<14F8EB07FE90381F871C90383E03FE137CEBF801120148486C5A485A120FEBC001 001F5CA2EA3F801403007F5C1300A21407485C5AA2140F5D48ECC1C0A2141F1583168014 3F1587007C017F1300ECFF076C485B9038038F8E391F0F079E3907FE03FC3901F000F022 2677A42A>97 D<133FEA1FFFA3C67E137EA313FE5BA312015BA312035BA31207EBE0F8EB E7FE9038EF0F80390FFC07C013F89038F003E013E0D81FC013F0A21380A2123F1300A214 075A127EA2140F12FE4814E0A2141F15C05AEC3F80A215005C147E5C387801F8007C5B38 3C03E0383E07C0381E1F80D80FFEC7FCEA01F01C3B77B926>I<147F903803FFC090380F C1E090381F0070017E13784913383901F801F83803F003120713E0120FD81FC013F091C7 FC485AA2127F90C8FCA35A5AA45AA3153015381578007C14F0007EEB01E0003EEB03C0EC 0F806CEB3E00380F81F83803FFE0C690C7FC1D2677A426>II<147F903803FFC090 380FC1E090383F00F0017E13785B485A485A485A120F4913F8001F14F0383F8001EC07E0 EC1F80397F81FF00EBFFF891C7FC90C8FC5A5AA55AA21530007C14381578007E14F0003E EB01E0EC03C06CEB0F806CEB3E00380781F83803FFE0C690C7FC1D2677A426>IIIII<150E153F157FA3157E151C1500ABEC1F80EC7FC0ECF1F0 EB01C090380380F813071401130F130E131EEB1C03133C013813F0A2EB0007A215E0A214 0FA215C0A2141FA21580A2143FA21500A25CA2147EA214FEA25CA21301A25CA213035C12 1C387E07E0A238FE0FC05C49C7FCEAF83EEA787CEA3FF0EA0FC0204883B619>IIIII<147F903803FFC090380FC1 F090381F00F8017E137C5B4848137E4848133E0007143F5B120F485AA2485A157F127F90 C7FCA215FF5A4814FEA2140115FC5AEC03F8A2EC07F015E0140F007C14C0007EEB1F8000 3EEB3F00147E6C13F8380F83F03803FFC0C648C7FC202677A42A>I<9039078007C09039 1FE03FF090393CF0787C903938F8E03E9038787FC00170497EECFF00D9F0FE148013E05C EA01E113C15CA2D80003143FA25CA20107147FA24A1400A2010F5C5E5C4B5A131F5EEC80 035E013F495A6E485A5E6E48C7FC017F133EEC70FC90387E3FF0EC0F8001FEC9FCA25BA2 1201A25BA21203A25B1207B512C0A3293580A42A>II<3903C003F0390FF01FFC391E783C0F381C7C703A3C3EE03F8038383FC0EB7F 800078150000701300151CD8F07E90C7FCEAE0FE5BA2120012015BA312035BA312075BA3 120F5BA3121F5BA3123F90C9FC120E212679A423>I<14FE903807FF8090380F83C09038 3E00E04913F00178137001F813F00001130313F0A215E00003EB01C06DC7FC7FEBFFC06C 13F814FE6C7F6D13807F010F13C01300143F141F140F123E127E00FE1480A348EB1F0012 E06C133E00705B6C5B381E03E06CB45AD801FEC7FC1C267AA422>II<13F8D803FEEB01C0D8078FEB03E0390E0F80 07121E121C0038140F131F007815C01270013F131F00F0130000E015805BD8007E133FA2 01FE14005B5D120149137EA215FE120349EBFC0EA20201131E161C15F813E0163CD9F003 133814070001ECF07091381EF8F03A00F83C78E090393FF03FC090390FC00F00272679A4 2D>I<01F0130ED803FC133FD8071EEB7F80EA0E1F121C123C0038143F49131F0070140F A25BD8F07E140000E08013FEC6485B150E12015B151E0003141C5BA2153C000714385B5D A35DA24A5A140300035C6D48C7FC0001130E3800F83CEB7FF8EB0FC0212679A426>I<01 F01507D803FC903903801F80D8071E903907C03FC0D80E1F130F121C123C0038021F131F 49EC800F00701607A249133FD8F07E168000E0ED000313FEC64849130718000001147E5B 03FE5B0003160E495BA2171E00070101141C01E05B173C1738A217781770020314F05F00 03010713016D486C485A000190391E7C07802800FC3C3E0FC7FC90393FF81FFE90390FE0 03F0322679A437>I<903907E007C090391FF81FF89039787C383C9038F03E703A01E01E E0FE3803C01F018013C0D8070014FC481480000E1570023F1300001E91C7FC121CA2C75A A2147EA214FEA25CA21301A24A1370A2010314F016E0001C5B007E1401010714C000FEEC 0380010F1307010EEB0F0039781CF81E9038387C3C393FF03FF03907C00FC027267CA427 >I<13F0D803FCEB01C0D8071EEB03E0D80E1F1307121C123C0038140F4914C01270A249 131FD8F07E148012E013FEC648133F160012015B5D0003147E5BA215FE00075C5BA21401 5DA314035D14070003130FEBF01F3901F87FE038007FF7EB1FC7EB000F5DA2141F003F5C 48133F92C7FC147E147C007E13FC387001F8EB03E06C485A383C1F80D80FFEC8FCEA03F0 233679A428>I<903903C0038090380FF007D91FF81300496C5A017F130E9038FFFE1E90 38F83FFC3901F007F849C65A495B1401C7485A4A5A4AC7FC141E5C5C5C495A495A495A49 C8FC131E5B49131C5B4848133C48481338491378000714F8390FF801F0391FFF07E0383E 1FFFD83C0F5B00785CD8700790C7FC38F003FC38E000F021267BA422>III<001E1338007F13FEEAFF811383A3EB03FC00FE13F8 383800F017096AB72A>127 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: FP cmcsc10 10 50 /FP 50 122 df<121C127FEAFF80A213C0A3127F121C1200A412011380A2120313005A12 06120E5A5A5A12600A1977881B>44 D<121C127FEAFF80A5EA7F00121C090977881B>46 D48 DIII<151C153CA2157C15FCA214011403A21407140F141D141914311471 146114C11301EB038114011307130E130C131813381330136013E0EA01C01380EA03005A 12065A121C5A123012705AB712FEA3C73801FC00AB4A7E49B512FCA327397DB82E>I<00 061406D80780131E9038F801FC90B5FC5D5D15C05D4AC7FC38067FF090C9FCABEB03FC90 381FFF8090387C07E09038E001F03907C000F8497F90C7127E0006147FC8EA3F80A216C0 151FA216E0A4123E127F487EA490C713C048143F126016800070147F6C150015FE6C5C00 0F495A39078007F03903F01FE06CB512806C6C48C7FCEB0FF0233A7BB72E>II<12301238123E003FB612F8A316F05A16E016C00070C7EA0180 00601403ED0700150E00E0140C48141C5D5DC8126015E04A5A4A5A92C7FC5C140EA25C14 3C14381478147014F0A213015C1303A21307A3130F5CA2131FA5133FA96D5A6DC8FC253B 7AB82E>III<150EA315 1FA24B7EA34B7EA3EDDFE0A202017F158FA29138030FF81507A202067F1503020E7FEC0C 01A2021C7FEC1800A24A80167FA24A6D7EA202E0804A131FA2494880160FA249B67EA249 810106C71203A249811601A2498182A2496F7EA20170820160153F13E06D821203D80FFC ED7FF8B56C010FB512E0A33B3C7CBB44>65 DIIIII73 D76 DII<913801FFC0020F13F891387F80FF903A01FC001FC0D903F0EB07E0D90FC0EB01F849 486D7E49C8127E017E81496F7E00018348486F7EA248486F7E000F83491503001F83A248 486F7EA3007F834981A300FF1880AB007F18006D5DA3003F5FA26D1503001F5FA26C6C4B 5AA200075F6D150F6C6C4B5A00015F6C6C4B5A017F4BC7FC6D6C14FE6D6C495A6D6C495A D903F0EB07E0D901FCEB1FC09027007F80FFC8FC91380FFFF8020113C0393D7ABA46>I< B712F816FF17E0C69039C0003FF86D48EB07FCEE01FE707EEF7F80EF3FC0A2EF1FE0A218 F0A718E0A2EF3FC0A2EF7F80EFFF004C5AEE07F8EE3FF091B612C04CC7FC0280C9FCB3A5 497EB612C0A334397DB83E>I82 DI<003FB812FCA3D9C001EB800390C790C7FC007C173E0078171E0070170EA30060 1706A400E01707481703A4C81500B3B0020313C0010FB612F0A338397CB841>II89 D<1407A24A7EA34A7EA3EC37E0A2EC77F01463A2ECC1F8A201017F1480A290380300 7EA301067FA2010E80010C131FA2496D7EA2013FB57EA29038300007496D7EA3496D7EA2 00018149130012036D801207D81FE0903801FF80D8FFF8010F13F8A22D2C7DAB33>97 DI< 91383FC006903901FFF80E90390FE03E1E90381F0007017EEB03BE01F8EB01FE48481300 4848147E0007153E485A001F151E5B003F150E90C8FC5A1606A212FE1600AA007F1506A3 7E6D140E001F150C7F000F151C6C6C1418000315386C6C14706C6C14E0017EEB01C0011F EB078090390FE03E00903801FFF89038003FC0272D7BAB31>IIII< 91383FE003903901FFF807903907E01E0F90391F00078F017EEB01DF496DB4FC48488048 4880484880485A001F815B003F8190C8FC5A82A212FE93C7FCA892383FFFF8A2007F0200 1380EE3F00A27E7F121F7F120F6C7E6C7E6C6C5C6C7E017E5C011FEB01CF903907E00F87 903901FFFE039026003FF0C7FC2D2D7BAB35>III107 DIIIII114 D<017F13603901FFE0E0380780F9380E001F48130748130312780070130100F01300A315 607EA26C14007E127F13C0EA3FFEEBFFE06C13F8000713FE6C7FC61480010F13C01300EC 0FE01407EC03F01401A212C01400A37E15E06C1301A26CEB03C06CEB0780B4EB0F0038F3 E01E38E0FFF838C01FE01C2D7BAB26>I<007FB712C0A23A7E003FC00F007890381F8003 007015011600126000E016E0A2481660A5C71500B3A8EC7FE0011FB57EA22B2B7DAA31> II< 3B7FFF800FFFC0A2000790390003FE006C48EB01F800015D000015C0017F13036D5C6E48 C7FC90381FC0066D6C5A151C6D6C5A903803F83001015BECFCE06D6C5AEC7F80A2143F6E 7E140F4A7E4A7E1433EC63F8ECE1FCECC0FE903801807E0103137F49486C7E0106131F49 80011C6D7E496D7E0130130301708001F06D7E000181000781D81FF8491380B46C4913F8 A22D2B7DAA33>120 DI E %EndDVIPSBitmapFont %DVIPSBitmapFont: FQ cmr10 10 98 /FQ 98 128 df0 D<1506150FA24B7EA24B7EA24B 7EA2EDDFF0A29138018FF8A291380307FCA291380603FEA291380E01FF140CDA1C007F14 1802386D7E143002706D7E146002E06D7E5C01016E7E5C01036E7E91C7FC496E7E130601 0E6E7E130C011C6E7F131801386F7E133001706F7E136001E06F7E5B170F484882170748 C97F17030006831701488383481880001FB9FC4818C0A24818E0A2BA12F0A23C3C7CBB45 >II<15E0A34A7EA34A7EA34A7EA34A7EA2 140DEC1DFF14191418A24A7F157FA202607F153FA202C07F151FA2D901807F150FA2D903 007F1507A20106801503A2010E80130C1501011C80131881A24981167FA24981163FA249 81161FA20001821203486C81D81FF84A7EB50107B512E0A3333C7DBB3A>I5 DI<011FB512FE A39026001FFEC8FCEC07F8A8EC3FFE0103B512E0D91FF713FC90397F07F87F01FCEC1F80 D803F8EC0FE0D807F06E7ED80FE06E7E001F82D83FC06E7EA2007F8201808000FF1780A7 007F170001C05C003F5EA2D81FE04A5A000F5ED807F04A5AD803F84A5AD800FCEC1F8001 7F027FC7FC90391FF7FFFC0103B512E09026003FFEC8FCEC07F8A8EC1FFE011FB512FEA3 31397BB83C>8 D<010FB612C0A3D900070180C7FCDA01FEC8FCA7D8FF80ED07FC01E015 1F001F17E001F0153F000F17C001F8157F00071780ACD803FCEDFF00A4D801FE4A5AA200 005E017F4A5A02811307013F5DD91FC1495AD90FE1495AD903F9017FC7FC0100B512FC02 3F13F0020390C8FC6E5AA8913807FF80010FB612C0A336397BB841>III III<133C137EA213FE1201EA03FC13F0EA07E0EA0FC0EA1F80EA1E005A5A5A12C00F0F 6FB92A>19 D<121C127FEAFF80A8EA7F00AB123EAB121CABC7FCA8121C127FEAFF80A5EA 7F00121C093C79BB17>33 D<001C131C007F137F39FF80FF80A26D13C0A3007F137F001C 131C00001300A40001130101801380A20003130301001300485B00061306000E130E485B 485B485B006013601A197DB92A>I<030C1303031E497EA2033E130FA2033C91C7FCA203 7C5BA20378131EA303F8133EA24B133CA20201147CA24B1378A2020314F8A24B5BA30207 1301007FB91280BA12C0A26C1880C7271F0007C0C7FC021E5CA3023E130FA2023C91C8FC A2027C5BA20278131EA302F8133E007FB91280BA12C0A26C1880280003E000F8C8FC4A5B A301071301A202805BA2010F1303A202005BA2491307A2011E5CA3013E130FA2013C91C9 FCA2017C5BA20178131EA20130130C3A4A7BB945>I<121C127FEAFF80A213C0A3127F12 1C1200A412011380A2120313005A1206120E5A5A5A12600A1979B917>39 D<146014E0EB01C0EB0380EB0700130E131E5B5BA25B485AA2485AA212075B120F90C7FC A25A121EA2123EA35AA65AB2127CA67EA3121EA2121F7EA27F12077F1203A26C7EA26C7E 1378A27F7F130E7FEB0380EB01C0EB00E01460135278BD20>I<12C07E12707E7E7E120F 6C7E6C7EA26C7E6C7EA21378A2137C133C133E131EA2131F7FA21480A3EB07C0A6EB03E0 B2EB07C0A6EB0F80A31400A25B131EA2133E133C137C1378A25BA2485A485AA2485A48C7 FC120E5A5A5A5A5A13527CBD20>I<15301578B3A6007FB812F8B912FCA26C17F8C80078 C8FCB3A6153036367BAF41>43 D<121C127FEAFF80A213C0A3127F121C1200A412011380 A2120313005A1206120E5A5A5A12600A19798817>II<121C127F EAFF80A5EA7F00121C0909798817>I48 DIII<1538A2157815F8A2140114031407A2140F141F141B1433147314 6314C313011483EB030313071306130C131C131813301370136013C01201EA038013005A 120E120C5A123812305A12E0B712F8A3C73803F800AB4A7E0103B512F8A325397EB82A> I<0006140CD80780133C9038F003F890B5FC5D5D158092C7FC14FC38067FE090C9FCABEB 07F8EB3FFE9038780F803907E007E090388003F0496C7E12066E7EC87EA28181A21680A4 123E127F487EA490C71300485C12E000605C12700030495A00385C6C1303001E495A6C6C 485A3907E03F800001B5C7FC38007FFCEB1FE0213A7CB72A>II<12301238123E003FB612E0A316C05A168016000070C712060060140E5D1518 00E01438485C5D5DC712014A5A92C7FC5C140E140C141C5CA25CA214F0495AA21303A25C 1307A2130FA3495AA3133FA5137FA96DC8FC131E233B7BB82A>III<121C127FEAFF80A5EA7F00121CC7FCB2121C127FEAFF 80A5EA7F00121C092479A317>I<121C127FEAFF80A5EA7F00121CC7FCB2121C127F5A13 80A4127F121D1201A412031300A25A1206A2120E5A121812385A1260093479A317>I<00 7FB812F8B912FCA26C17F8CCFCAE007FB812F8B912FCA26C17F836167B9F41>61 D63 D<1538A3157CA315FEA34A7EA34A6C7EA202077FEC063FA2020E7FEC0C1FA2021C7FEC18 0FA202387FEC3007A202707FEC6003A202C07F1501A2D901807F81A249C77F167FA20106 810107B6FCA24981010CC7121FA2496E7EA3496E7EA3496E7EA213E0707E1201486C81D8 0FFC02071380B56C90B512FEA3373C7DBB3E>65 DI<913A01FF8001 80020FEBE003027F13F8903A01FF807E07903A03FC000F0FD90FF0EB039F4948EB01DFD9 3F80EB00FF49C8127F01FE153F12014848151F4848150FA248481507A2485A1703123F5B 007F1601A35B00FF93C7FCAD127F6DED0180A3123F7F001F160318006C7E5F6C7E17066C 6C150E6C6C5D00001618017F15386D6C5CD91FE05C6D6CEB03C0D903FCEB0F80902701FF 803FC7FC9039007FFFFC020F13F002011380313D7BBA3C>IIIIIII75 DIIIIIIII<003FB812E0A3D9C003EB001F273E0001FE130348EE01F000781600007017 70A300601730A400E01738481718A4C71600B3B0913807FF80011FB612E0A335397DB83C >IIII<007FB590383FFFFCA3C601F801071380D97FE0D903FCC7FC013FEC 01F06D6C5C5F6D6C5C6D6C13034CC8FC6D6C1306160E6D6C5B6DEB8018163891387FC030 6E6C5A16E06E6C5A91380FF18015FB6EB4C9FC5D14036E7EA26E7F6F7EA24B7E15DF9138 019FF09138038FF8150F91380607FC91380E03FE140C4A6C7EEC38000230804A6D7E14E0 4A6D7E49486D7E130391C76C7E01066E7E130E010C6E7E011C1401013C8101FE822607FF 80010713E0B500E0013FEBFF80A339397EB83E>II<003FB7FCA39039FC0001FE01C0130349495A003EC7FC003C4A5A5E003814 1F00784A5A12704B5A5E006014FF4A90C7FCA24A5A5DC712074A5AA24A5A5D143F4A5AA2 4A5A92C8FC5B495AA2495A5C130F4948EB0180A2495A5C137F495A16034890C7FC5B1203 485AEE0700485A495C001F5D48485C5E4848495A49130FB8FCA329397BB833>II<3901800180000313033907000700000E 130E485B0018131800381338003013300070137000601360A200E013E0485BA400CE13CE 39FF80FF806D13C0A3007F137FA2393F803F80390E000E001A1974B92A>II<13101338137C13FE487E3803C780380783C0 380F01E0381E00F04813780070131C48130E00401304170D77B92A>I96 DIIIII<147E903803FF8090380F C1E0EB1F8790383F0FF0137EA213FCA23901F803C091C7FCADB512FCA3D801F8C7FCB3AB 487E387FFFF8A31C3B7FBA19>III< EA0380EA0FE0487EA56C5AEA0380C8FCAAEA03F012FFA312071203B3AA487EB512C0A312 387EB717>IIII<2703F00FF0EB1FE000FFD93FFCEB7FF8 913AF03F01E07E903BF1C01F83803F3D0FF3800FC7001F802603F70013CE01FE14DC49D9 07F8EB0FC0A2495CA3495CB3A3486C496CEB1FE0B500C1B50083B5FCA340257EA445>I< 3903F00FF000FFEB3FFCECF03F9039F1C01F803A0FF3800FC03803F70013FE496D7EA25B A35BB3A3486C497EB500C1B51280A329257EA42E>II<3903F01FE000 FFEB7FF89038F1E07E9039F3801F803A0FF7000FC0D803FEEB07E049EB03F04914F84913 0116FC150016FEA3167FAA16FEA3ED01FCA26DEB03F816F06D13076DEB0FE001F614C090 39F7803F009038F1E07E9038F0FFF8EC1FC091C8FCAB487EB512C0A328357EA42E>I I<3807E01F00FFEB7FC09038E1E3E09038E387F0380FE707EA03E613EE9038EC03E09038 FC0080491300A45BB3A2487EB512F0A31C257EA421>II<1318A51338A31378A313F8120112031207 001FB5FCB6FCA2D801F8C7FCB215C0A93800FC011580EB7C03017E13006D5AEB0FFEEB01 F81A347FB220>IIIIII<003FB512FCA2EB8003D83E0013F8003CEB07F00038EB0FE012 300070EB1FC0EC3F800060137F150014FE495AA2C6485A495AA2495A495A495AA290387F 000613FEA2485A485A0007140E5B4848130C4848131CA24848133C48C7127C48EB03FC90 B5FCA21F247EA325>III126 D<001C131C007F137F39FF80FF80A5397F007F00001C131C190978B72A>I E %EndDVIPSBitmapFont %DVIPSBitmapFont: FR cmr10 10.95 18 /FR 18 121 df<121EEA7F8012FF13C0A213E0A3127FEA1E601200A413E013C0A3120113 80120313005A120E5A1218123812300B1C798919>44 D<121EEA7F80A2EAFFC0A4EA7F80 A2EA1E000A0A798919>46 D<15074B7EA34B7EA34B7EA34B7EA34B7E15E7A2913801C7FC 15C3A291380381FEA34AC67EA3020E6D7EA34A6D7EA34A6D7EA34A6D7EA34A6D7EA34948 6D7E91B6FCA249819138800001A249C87EA24982010E157FA2011E82011C153FA2013C82 0138151FA2017882170F13FC00034C7ED80FFF4B7EB500F0010FB512F8A33D417DC044> 65 DI<011FB512FCA3D9000713006E5A1401B3B3A6123FEA7F 80EAFFC0A44A5A1380D87F005B007C130700385C003C495A6C495A6C495A2603E07EC7FC 3800FFF8EB3FC026407CBD2F>74 DI97 D100 DI105 D<1478EB01FEA2EB03FFA4EB01 FEA2EB00781400AC147FEB7FFFA313017F147FB3B3A5123E127F38FF807E14FEA214FCEB 81F8EA7F01387C03F0381E07C0380FFF803801FC00185185BD1C>III<3901F801FE00FF903807FFC091381E07E09138 7803F000079038E001F82603F9C07F0001138001FB6D7E91C7FC13FF5BA25BB3A6486C49 7EB5D8F87F13FCA32E287DA733>110 D<14FF010713E090381F81F890387E007E01F813 1F4848EB0F804848EB07C04848EB03E0000F15F04848EB01F8A2003F15FCA248C812FEA4 4815FFA96C15FEA36C6CEB01FCA3001F15F86C6CEB03F0A26C6CEB07E06C6CEB0FC06C6C EB1F80D8007EEB7E0090383F81FC90380FFFF0010090C7FC282A7EA82D>I<3901F807E0 00FFEB1FF8EC787CECE1FE3807F9C100031381EA01FB1401EC00FC01FF1330491300A35B B3A5487EB512FEA31F287EA724>114 D118 D120 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: FS cmbx10 10.95 28 /FS 28 122 df40 D<127012F8127C7EEA3F806C7E6C7E12076C7E7F6C7E6C 7EA2137F80133F806D7EA280130FA280130780A36D7EA4807FA51580B01500A55B5CA449 5AA35C130F5CA2131F5CA2495A5C137F91C7FC13FEA2485A485A5B485A120F485A485A00 3EC8FC5A5A1270195A7AC329>I44 D46 D48 D<903803FF80013F13F890B512FE00036E7E4881260FF80F7F261FC0037F4848C67F486C 6D7E6D6D7E487E6D6D7EA26F1380A46C5A6C5A6C5A0007C7FCC8FC4B1300A25E153F5E4B 5AA24B5A5E4A5B4A5B4A48C7FC5D4A5AEC1FE04A5A4A5A9139FF000F80EB01FC495A4948 EB1F00495AEB1F8049C7FC017E5C5B48B7FC485D5A5A5A5A5AB7FC5EA4293C7BBB34>50 D59 D77 D85 DII<903807FFC0013F13F848B6FC48812607FE037F26 0FF8007F6DEB3FF0486C806F7EA36F7EA26C5A6C5AEA01E0C8FC153F91B5FC130F137F39 01FFFE0F4813E0000F1380381FFE00485A5B485A12FF5BA4151F7F007F143F6D90387BFF 806C6C01FB13FE391FFF07F36CEBFFE100031480C6EC003FD91FF890C7FC2F2B7DA933> 97 D99 D101 DI<903A03FF8007F0013F9038F83FF8499038FCFFFC48B712FE 48018313F93A07FC007FC34848EB3FE1001FEDF1FC4990381FF0F81700003F81A7001F5D A26D133F000F5D6C6C495A3A03FF83FF8091B5C7FC4814FC01BF5BD80F03138090CAFCA2 487EA27F13F06CB6FC16F016FC6C15FF17806C16C06C16E01207001F16F0393FE0000348 48EB003F49EC1FF800FF150F90C81207A56C6CEC0FF06D141F003F16E001F0147FD81FFC 903801FFC02707FF800F13006C90B55AC615F8013F14E0010101FCC7FC2F3D7DA834>I< EA01F8487E487E487E481380A66C13006C5A6C5A6C5AC8FCA913FFB5FCA512077EB3ABB5 12F8A515407CBF1D>105 D<13FFB5FCA512077EB092380FFFFEA5DB01FEC7FC4B5AED07 F0ED1FE04B5A4B5A4BC8FCEC03FC4A5A4A5A141F4A7EECFFFCA2818102E77F02C37F1481 02007F826F7E6F7E151F6F7E826F7F6F7F816F7FB5D8FC07EBFFC0A5323F7DBE37>107 D<01FFD91FF8ECFFC0B590B5010713F80203DAC01F13FE4A6E487FDA0FE09026F07F077F 91261F003FEBF8010007013EDAF9F0806C0178ECFBC04A6DB4486C7FA24A92C7FC4A5CA3 4A5CB3A4B5D8FE07B5D8F03FEBFF80A551297CA858>109 D<01FFEB1FF8B5EBFFFE0203 6D7E4A80DA0FE07F91381F007F0007013C806C5B4A6D7E5CA25CA35CB3A4B5D8FE0FB512 E0A533297CA83A>II<01FFEBFFE0 B5000713FC021FEBFF80027F80DAFF8113F09139FC007FF8000701F06D7E6C496D7E4A13 0F4A6D7E1880A27013C0A38218E0AA4C13C0A318805E18005E6E5C6E495A6E495A02FCEB FFF0DAFF035B92B55A029F91C7FC028713FC028113C00280C9FCACB512FEA5333B7DA83A >I<3901FE01FE00FF903807FF804A13E04A13F0EC3F1F91387C3FF8000713F8000313F0 EBFFE0A29138C01FF0ED0FE091388007C092C7FCA391C8FCB3A2B6FCA525297DA82B> 114 D<90383FFC1E48B512BE000714FE5A381FF00F383F800148C7FC007E147EA200FE14 3EA27E7F6D90C7FC13F8EBFFE06C13FF15C06C14F06C806C806C806C80C61580131F1300 020713C014000078147F00F8143F151F7EA27E16806C143F6D140001E013FF9038F803FE 90B55A15F0D8F87F13C026E00FFEC7FC222B7DA929>III119 D121 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: FT cmbx12 14.4 36 /FT 36 124 df45 D<91380FFFC091B512FC0107ECFF80011F15 E090263FF8077F9026FF800113FC4848C76C7ED803F86E7E491680D807FC8048B416C080 486D15E0A4805CA36C17C06C5B6C90C75AD801FC1680C9FC4C13005FA24C5A4B5B4B5B4B 13C04B5BDBFFFEC7FC91B512F816E016FCEEFF80DA000713E0030113F89238007FFE707E 7013807013C018E07013F0A218F8A27013FCA218FEA2EA03E0EA0FF8487E487E487EB57E A318FCA25E18F891C7FC6C17F0495C6C4816E001F04A13C06C484A1380D80FF84A13006C B44A5A6CD9F0075BC690B612F06D5D011F1580010302FCC7FCD9001F1380374F7ACD43> 51 D66 D<932601FFFCEC01C0047FD9FFC013030307B600F81307033F03FE131F92B8EA803F0203 DAE003EBC07F020F01FCC7383FF0FF023F01E0EC0FF94A01800203B5FC494848C9FC4901 F8824949824949824949824949824990CA7E494883A2484983485B1B7F485B481A3FA248 49181FA3485B1B0FA25AA298C7FC5CA2B5FCAE7EA280A2F307C07EA36C7FA21B0F6C6D19 80A26C1A1F6C7F1C006C6D606C6D187EA26D6C606D6D4C5A6D6D16036D6D4C5A6D6D4C5A 6D01FC4C5A6D6DEE7F806D6C6C6C4BC7FC6E01E0EC07FE020F01FEEC1FF80203903AFFE0 01FFF0020091B612C0033F93C8FC030715FCDB007F14E0040101FCC9FC525479D261>I< BB12FEA5D8000701F8C700077FF0007F191F190785858586861B80A21A1FA31A0FA41BC0 06F81307A497C7FCA31701A317031707170F177F92B6FCA59238F8007F170F1707170317 01A31700A795C9FCB3B812F8A54A517CD055>70 D73 D76 DII<93380FFFC00303B6FC031F15E092B712 FC0203D9FC0013FF020F01C0010F13C0023F90C7000313F0DA7FFC02007F902601FFF0ED 3FFE49496F7E49496F7F49496F7F4990C96C7F4948707F4948707F01FF854A177F488648 49717EA24849711380A2481BC04A83481BE0A24A83481BF0A3481BF8A291CB7EA3B51AFC AF6C1BF8A26E5FA36C1BF0A36C6D4D13E0A36C1BC06E5F6C1B806E5F6CDB01FE16006C6D 902607FF80495A4C13E06C6D013F6D495A017F91267F03F85C6D6C90277C00FC015B6D6C 49D97E035B6D01806E485B6D6D48D91F8F5B6D01E0039F90C7FC6D01F06EB45A6DD9FCF8 5DDA3FFF6E13F0020F6D4913C0020301FF90B5C8FC020091B512FC031F180C0303181EDB 001FEBE3FE93C7EA01FF74133E74137E7413FEF2F8077290B5FC1CFCA285A21CF8A2851C F07314E0A27314C0731480731400735B9638007FF8F21FE0576A79D265>81 DI<91260FFF80130791B500 F85B010702FF5B011FEDC03F49EDF07F9026FFFC006D5A4801E0EB0FFD4801800101B5FC 4848C87E48488149150F001F824981123F4981007F82A28412FF84A27FA26D82A27F7F6D 93C7FC14C06C13F014FF15F86CECFF8016FC6CEDFFC017F06C16FC6C16FF6C17C06C836C 836D826D82010F821303010082021F16801400030F15C0ED007F040714E01600173F050F 13F08383A200788200F882A3187FA27EA219E07EA26CEFFFC0A27F6D4B13806D17006D5D 01FC4B5A01FF4B5A02C04A5A02F8EC7FF0903B1FFFC003FFE0486C90B65AD8FC0393C7FC 48C66C14FC48010F14F048D9007F90C8FC3C5479D24B>I<003FBC1280A59126C0003F90 38C0007F49C71607D87FF8060113C001E08449197F49193F90C8171FA2007E1A0FA3007C 1A07A500FC1BE0481A03A6C994C7FCB3B3AC91B912F0A553517BD05E>I87 D<001FBA12C01AE0A40380C714C002 F8C75A02C0178091C8481400495D495F494B5B495D495F48484B5B5F495F94B55A5E90C8 5D4C91C7FC5E60003E4B5B5E604C5B5EC95C93B55A5D604B91C8FC5D5F4B5B5D5F4B5B5D 5F92B55A5C5F4A91C9FC5C5E4A5B5C4CEC03E04A5B5C5E91B55A5B4C14074991C8FC4918 C05D495B5B4B150F495B5B4B151F90B55A48183F5D4891C9127F4818FF4A5D48495D485F 4A5D4849033F1380484CB5FC4A143FBBFCA47E435279D152>90 D97 DI<913801FFF8021FEBFF80 91B612F0010315FC010F9038C00FFE903A1FFE0001FFD97FFC491380D9FFF05B4817C048 495B5C5A485BA2486F138091C7FC486F1300705A4892C8FC5BA312FFAD127F7FA27EA2EF 03E06C7F17076C6D15C07E6E140F6CEE1F806C6DEC3F006C6D147ED97FFE5C6D6CEB03F8 010F9038E01FF0010390B55A01001580023F49C7FC020113E033387CB63C>I<4DB47E04 07B5FCA5EE001F1707B3A4913801FFE0021F13FC91B6FC010315C7010F9038E03FE74990 380007F7D97FFC0101B5FC49487F4849143F484980485B83485B5A91C8FC5AA3485AA412 FFAC127FA36C7EA37EA26C7F5F6C6D5C7E6C6D5C6C6D49B5FC6D6C4914E0D93FFED90FEF EBFF80903A0FFFC07FCF6D90B5128F0101ECFE0FD9003F13F8020301C049C7FC41547CD2 4B>I<913803FFC0023F13FC49B6FC010715C04901817F903A3FFC007FF849486D7E4948 6D7E4849130F48496D7E48178048497F18C0488191C7FC4817E0A248815B18F0A212FFA4 90B8FCA318E049CAFCA6127FA27F7EA218E06CEE01F06E14037E6C6DEC07E0A26C6DEC0F C06C6D141F6C6DEC3F806D6CECFF00D91FFEEB03FE903A0FFFC03FF8010390B55A010015 C0021F49C7FC020113F034387CB63D>IIII<137F497E000313E0487FA2487FA76C5BA26C5B C613806DC7FC90C8FCADEB3FF0B5FCA512017EB3B3A6B612E0A51B547BD325>I108 DII<913801FFE0021F13FE91B612C0010315F0010F9038807FFC90 3A1FFC000FFED97FF86D6C7E49486D7F48496D7F48496D7F4A147F48834890C86C7EA248 83A248486F7EA3007F1880A400FF18C0AC007F1880A3003F18006D5DA26C5FA26C5F6E14 7F6C5F6C6D4A5A6C6D495B6C6D495B6D6C495BD93FFE011F90C7FC903A0FFF807FFC6D90 B55A010015C0023F91C8FC020113E03A387CB643>I<903A3FF001FFE0B5010F13FE033F EBFFC092B612F002F301017F913AF7F8007FFE0003D9FFE0EB1FFFC602806D7F92C76C7F 4A824A6E7F4A6E7FA2717FA285187F85A4721380AC1A0060A36118FFA2615F616E4A5BA2 6E4A5B6E4A5B6F495B6F4990C7FC03F0EBFFFC9126FBFE075B02F8B612E06F1480031F01 FCC8FC030313C092CBFCB1B612F8A5414D7BB54B>I<90397FE003FEB590380FFF80033F 13E04B13F09238FE1FF89139E1F83FFC0003D9E3E013FEC6ECC07FECE78014EF150014EE 02FEEB3FFC5CEE1FF8EE0FF04A90C7FCA55CB3AAB612FCA52F367CB537>114 D<903903FFF00F013FEBFE1F90B7FC120348EB003FD80FF81307D81FE0130148487F4980 127F90C87EA24881A27FA27F01F091C7FC13FCEBFFC06C13FF15F86C14FF16C06C15F06C 816C816C81C681013F1580010F15C01300020714E0EC003F030713F015010078EC007F00 F8153F161F7E160FA27E17E07E6D141F17C07F6DEC3F8001F8EC7F0001FEEB01FE9039FF C00FFC6DB55AD8FC1F14E0D8F807148048C601F8C7FC2C387CB635>I<143EA6147EA414 FEA21301A313031307A2130F131F133F13FF5A000F90B6FCB8FCA426003FFEC8FCB3A9EE 07C0AB011FEC0F8080A26DEC1F0015806DEBC03E6DEBF0FC6DEBFFF86D6C5B021F5B0203 13802A4D7ECB34>II<007FB500F090387FFFFEA5C66C 48C7000F90C7FC6D6CEC07F86D6D5C6D6D495A6D4B5A6F495A6D6D91C8FC6D6D137E6D6D 5B91387FFE014C5A6E6C485A6EEB8FE06EEBCFC06EEBFF806E91C9FCA26E5B6E5B6F7E6F 7EA26F7F834B7F4B7F92B5FCDA01FD7F03F87F4A486C7E4A486C7E020F7FDA1FC0804A48 6C7F4A486C7F02FE6D7F4A6D7F495A49486D7F01076F7E49486E7E49486E7FEBFFF0B500 FE49B612C0A542357EB447>120 DI 123 D E %EndDVIPSBitmapFont end %%EndProlog %%BeginSetup %%Feature: *Resolution 600dpi TeXDict begin %%PaperSize: A4 %%EndSetup %%Page: 71 1 71 74 bop 1699 790 a FQ(CHAPTER)41 b(4)488 1089 y FT(3-dimensional)47 b(T)-11 b(op)t(ological)46 b(Quan)l(tum)f(Field)g(Theory)605 1372 y FQ(In)35 b(this)g(c)n(hapter,)g(follo)n(wing)f(the)g(ideas)g(of) h([)p FK(R)-8 b(T2)p FQ(])34 b(and)h([)p FK(T)p FQ(],)i(w)n(e)d(will)h (sho)n(w)e(that)i(the)456 1471 y(algebraic)18 b(formalism)i(of)h(mo)r (dular)f(tensor)f(categories)g(is)h(closely)g(related)g(with)h(the)g (top)r(ology)456 1571 y(of)f(3-manifolds.)33 b(In)21 b(particular,)f(w)n(e)g(will)h(sho)n(w)e(that)i(ev)n(ery)e(MTC)i(giv)n (es)e(rise)g(to)i(an)f(in)n(v)-5 b(arian)n(t)456 1671 y(of)28 b(compact)g(3-manifolds.)39 b(Historically)-7 b(,)28 b(this)g(w)n(as)g(one)g(of)h(the)f(main)h(motiv)-5 b(ations)28 b(for)g(the)456 1770 y(theory)18 b(of)h(mo)r(dular)g (tensor)f(categories.)32 b(W)-7 b(e)20 b(will)f(quote)g(without)h(pro)r (ofs)e(sev)n(eral)g(imp)r(ortan)n(t)456 1870 y(results)i(ab)r(out)g (3-manifolds)g(whic)n(h)g(are)g(used)h(in)g(this)g(construction.)33 b(The)21 b(reader)e(is)i(referred)456 1969 y(to)h(an)f(excellen)n(t)h (in)n(tro)r(ductory)f(text)i([)p FK(PS)p FQ(])f(and)g(references)f (therein)i(for)e(pro)r(ofs)g(and)h(detailed)456 2069 y(discussion.)605 2169 y(In)27 b(this)g(c)n(hapter,)g(b)n(y)f (\\manifold")g(w)n(e)h(mean)f(an)h(orien)n(ted)f(compact)h(top)r (ological)e(man-)456 2268 y(ifold,)40 b(p)r(ossibly)e(with)g(b)r (oundary;)43 b(b)n(y)38 b(a)f(\\closed)g(manifold")g(w)n(e)h(will)g (mean)g(a)f(manifold)456 2368 y(without)29 b(b)r(oundary)-7 b(.)39 b(All)29 b(maps)f(b)r(et)n(w)n(een)g(manifolds)h(will)f(b)r(e)h (con)n(tin)n(uous)f(and)g(preserving)456 2468 y(orien)n(tation,)21 b(unless)g(stated)h(otherwise.)34 b(By)21 b FL(')g FQ(w)n(e)g(denote)h (homeomorphism)e(of)i(manifolds,)456 2567 y(and)j(b)n(y)p 727 2500 90 4 v 24 w FJ(M)34 b FQ(w)n(e)25 b(denote)g(the)h(manifold)f FJ(M)34 b FQ(with)25 b(rev)n(ersed)f(orien)n(tation.)34 b(Finally)-7 b(,)26 b(for)f(an)g(ori-)456 2667 y(en)n(ted)h(manifold)h FJ(M)35 b FQ(w)n(e)26 b(endo)n(w)g(its)g(b)r(oundary)g FJ(@)5 b(M)35 b FQ(with)27 b(an)f(orien)n(tation)f(in)i(the)f(standard) 456 2766 y(w)n(a)n(y:)37 b(\()p FJ(v)730 2778 y FM(1)768 2766 y FJ(;)14 b(:)g(:)g(:)f(;)h(v)992 2778 y FI(k)1033 2766 y FQ(\))29 b(is)f(a)g(p)r(ositiv)n(e)g(rep)r(er)g(for)g FJ(@)5 b(M)37 b FQ(if)29 b(\()p FJ(v)2216 2778 y FM(1)2254 2766 y FJ(;)14 b(:)g(:)g(:)f(;)h(v)2478 2778 y FI(k)2519 2766 y FJ(;)g(n)p FQ(\))29 b(is)f(a)g(p)r(ositiv)n(e)g(rep)r(er)g(for) 456 2866 y FJ(M)9 b FQ(,)27 b(where)g FJ(n)h FQ(is)f(the)h(out)n(w)n (ard)e(normal)h(v)n(ector)f(to)h FJ(@)5 b(M)k FQ(.)1334 3099 y FK(4.1.)46 b(In)m(v)-5 b(arian)m(ts)34 b(of)e(3-manifolds)605 3249 y FQ(In)25 b(this)g(section)f(w)n(e)h(construct)f(in)n(v)-5 b(arian)n(ts)23 b(of)i(closed)f(3-manifolds.)35 b(This)24 b(construction)456 3349 y(is)30 b(based)f(on)h(the)g(notion)g(of)g (surgery)-7 b(,)29 b(whic)n(h)h(itself)h(is)f(a)f(sp)r(ecial)h(case)f (of)h(the)h(op)r(eration)e(of)456 3448 y(gluing,)e(describ)r(ed)g(in)h (the)g(lemma)f(b)r(elo)n(w.)605 3610 y FP(Lemma)k FQ(4.1.1)p FP(.)40 b FO(L)l(et)34 b FJ(M)1382 3622 y FM(1)1454 3610 y FO(and)h FJ(M)1701 3622 y FM(2)1772 3610 y FO(b)l(e)g(two)g (manifolds)h(of)g(the)e(same)h(dimension.)55 b(L)l(et)456 3710 y FJ(N)523 3722 y FM(1)601 3710 y FO(b)l(e)41 b(a)h(c)l(onne)l (cte)l(d)f(c)l(omp)l(onent)g(of)h FJ(@)5 b(M)1849 3722 y FM(1)1886 3710 y FO(,)44 b FJ(N)2022 3722 y FM(2)2100 3710 y FO(a)e(c)l(onne)l(cte)l(d)f(c)l(omp)l(onent)g(of)h FJ(@)5 b(M)3235 3722 y FM(2)3313 3710 y FO(and)456 3812 y FJ(f)17 b FQ(:)28 b FJ(N)632 3824 y FM(1)721 3765 y FE(\030)692 3812 y FL(\000)-39 b(!)23 b FJ(N)891 3824 y FM(2)957 3812 y FO(b)l(e)30 b(an)g(orientation)h(r)l(eversing)f(home) l(omorphism.)605 3912 y FQ(\(i\))g FO(De\014ne)f FJ(M)1065 3924 y FM(1)1121 3912 y FL([)1176 3924 y FI(f)1238 3912 y FJ(M)1319 3924 y FM(2)1385 3912 y FO(by)994 4069 y FJ(M)1075 4081 y FM(1)1130 4069 y FL([)1185 4081 y FI(f)1247 4069 y FJ(M)1328 4081 y FM(2)1388 4069 y FQ(:=)23 b(\()p FJ(M)1612 4081 y FM(1)1667 4069 y FL(t)c FJ(M)1822 4081 y FM(2)1859 4069 y FQ(\))p FJ(=)p FL(f)p FQ(\()p FJ(x;)14 b(y)s FQ(\))23 b FL(j)g FJ(y)i FQ(=)e FJ(f)9 b FQ(\()p FJ(x)p FQ(\))p FJ(;)14 b(x)24 b FL(2)g FJ(N)2805 4081 y FM(1)2842 4069 y FL(g)p FJ(:)456 4226 y FO(Then)35 b FJ(M)758 4238 y FI(f)833 4226 y FL(\021)c FJ(M)1010 4238 y FM(1)1069 4226 y FL([)1124 4238 y FI(f)1190 4226 y FJ(M)1271 4238 y FM(2)1342 4226 y FO(is)k(again)h(a)f(manifold.)56 b(We)35 b(wil)t(l)h(say)f(that)g FJ(M)2861 4238 y FI(f)2938 4226 y FO(is)g(obtaine)l(d)h(by)456 4326 y(gluing)30 b FJ(M)781 4338 y FM(1)847 4326 y FO(and)g FJ(M)1089 4338 y FM(2)1156 4326 y FO(using)f(the)h(identi\014c)l(ation)h FJ(f)38 b FO(of)31 b(their)f(b)l(oundary)h(c)l(omp)l(onents.)605 4428 y FQ(\(ii\))36 b FO(If)g FJ(f)894 4398 y FE(0)951 4428 y FQ(=)e FJ(f)d FL(\016)22 b FJ(')36 b FO(for)h(some)f FJ(')9 b FQ(:)30 b FJ(N)1816 4440 y FM(1)1915 4381 y FE(\030)1887 4428 y FL(\000)-39 b(!)33 b FJ(N)2096 4440 y FM(1)2169 4428 y FO(which)k(extends)e(to)h FJ(M)2896 4440 y FM(1)2995 4381 y FE(\030)2967 4428 y FL(\000)-40 b(!)34 b FJ(M)3190 4440 y FM(1)3227 4428 y FO(,)k(then)456 4527 y FJ(M)537 4539 y FI(f)576 4523 y Fx(0)625 4527 y FL(')22 b FJ(M)793 4539 y FI(f)836 4527 y FO(.)605 4627 y FQ(\(iii\))34 b FJ(M)853 4639 y FI(f)928 4627 y FO(dep)l(ends)g(only)g(on)f(the)g(isotopy)i(class)e(of)h FJ(f)9 b FO(,)34 b(i.e.,)i(it)d(do)l(es)g(not)g(change)h(when)456 4727 y(we)c(c)l(ontinuously)f(deform)i FJ(f)9 b FO(.)605 4889 y FP(Pr)n(oof.)41 b FQ(Only)27 b(\(iii\))i(is)f(not)g(immediately) g(ob)n(vious.)36 b(It)28 b(follo)n(ws)f(from)g(the)i(next)f(claim:)456 4996 y(If)i FJ(f)591 4965 y FE(0)642 4996 y FL(\030)e FJ(f)39 b FQ(then)31 b(one)f(can)g(write)g FJ(f)1582 4965 y FE(0)1633 4996 y FQ(=)d FJ(f)i FL(\016)20 b FJ(')31 b FQ(for)f(some)f FJ(')9 b FQ(:)30 b FJ(M)2479 5008 y FM(1)2572 4948 y FE(\030)2543 4996 y FL(\000)-39 b(!)28 b FJ(M)2761 5008 y FM(1)2828 4996 y FQ(suc)n(h)i(that)h FJ(')d FL(6)p FQ(=)f(id)456 5095 y(only)32 b(in)h(a)f(neigh)n(b)r(orho) r(o)r(d)f(of)i FJ(N)1512 5107 y FM(1)1549 5095 y FQ(.)52 b(Indeed,)34 b(it)f(su\016ces)g(to)f(pro)n(v)n(e)f(this)i(in)g(the)g (case)f(where)456 5195 y FJ(M)537 5207 y FM(1)601 5195 y FQ(is)c(the)g(cylinder)f([0)p FJ(;)14 b FQ(1])j FL(\002)h FJ(N)1478 5207 y FM(1)1515 5195 y FQ(,)28 b(in)g(whic)n(h)f(case)g(it)h (is)g(ob)n(vious.)p 3384 5195 4 57 v 3388 5142 50 4 v 3388 5195 V 3437 5195 4 57 v 1917 5365 a FM(71)p eop %%Page: 72 2 72 75 bop 456 226 a FM(72)404 b(4.)29 b(3-DIMENSIONAL)g(TOPOLOGICAL)h (QUANTUM)f(FIELD)g(THEOR)-5 b(Y)605 425 y FP(Examples)31 b FQ(4.1.2)p FP(.)40 b FQ(Let)35 b FJ(T)1479 437 y FM(1)1551 425 y FQ(and)g FJ(T)1769 437 y FM(2)1841 425 y FQ(b)r(e)g(t)n(w)n(o)g (solid)g(tori.)59 b(The)35 b(b)r(oundary)f(of)h(a)g(solid)456 525 y(torus)21 b(is)h(a)g(2-dimensional)f(torus)h(whic)n(h)g(can)g(b)r (e)g(though)n(t)g(of)h(as)e(a)h(rectangle)f(with)i(iden)n(ti\014ed)456 624 y(opp)r(osite)30 b(sides.)47 b(The)31 b(sides)f(of)h(the)h (rectangle)d(giv)n(e)h(t)n(w)n(o)g(1-cycles)g(whic)n(h)h(form)f(a)h (basis)f(in)456 724 y(homology)c(\(see)h(Figure)g(4.1\).)1008 1520 y @beginspecial 0 @llx 0 @lly 226 @urx 74 @ury 2260 @rwi @setspecial %%BeginDocument: figures/torus.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: torus.eps %%Creator: fig2dev Version 3.2 Patchlevel 1 %%CreationDate: Mon Mar 27 16:30:42 2000 %%For: kirillov@copiague (Alexander Kirillov) %%Orientation: Portrait %%BoundingBox: 0 0 226 74 %%Pages: 0 %%BeginSetup %%EndSetup %%Magnification: 0.2300 %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -30.0 102.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n -1000 8350 m -1000 -1000 l 19519 -1000 l 19519 8350 l cp clip 0.01380 0.01380 sc 30.000 slw % Ellipse n 5849 4796 3600 2400 0 360 DrawEllipse gs col-1 s gr % Polyline 15.000 slw gs clippath 7752 4458 m 7997 4297 l 7837 4543 l 8088 4292 l 8003 4207 l cp clip n 7874 4421 m 8024 4271 l gs col-1 s gr gr % arrowhead n 7752 4458 m 7997 4297 l 7837 4543 l 7828 4467 l 7752 4458 l cp gs 0.00 setgray ef gr col-1 s % Polyline 30.000 slw gs clippath 6106 3378 m 5817 3318 l 6106 3258 l 5736 3258 l 5736 3378 l cp clip n 5856 3318 m 5781 3318 l gs col-1 s gr gr % arrowhead 15.000 slw n 6106 3378 m 5817 3318 l 6106 3258 l 6058 3318 l 6106 3378 l cp gs 0.00 setgray ef gr col-1 s % Polyline 30.000 slw n 3974 4721 m 3976 4723 l 3980 4727 l 3988 4734 l 3999 4745 l 4015 4761 l 4035 4780 l 4059 4802 l 4086 4828 l 4115 4855 l 4145 4884 l 4176 4913 l 4207 4941 l 4237 4969 l 4267 4995 l 4295 5020 l 4322 5044 l 4348 5066 l 4372 5086 l 4395 5105 l 4418 5122 l 4440 5139 l 4461 5154 l 4482 5169 l 4503 5183 l 4524 5196 l 4545 5209 l 4567 5222 l 4589 5234 l 4612 5246 l 4635 5259 l 4658 5270 l 4683 5282 l 4708 5293 l 4733 5305 l 4760 5316 l 4786 5326 l 4813 5336 l 4840 5346 l 4867 5356 l 4894 5365 l 4921 5374 l 4948 5382 l 4975 5389 l 5001 5396 l 5027 5403 l 5052 5409 l 5077 5415 l 5102 5420 l 5126 5425 l 5150 5429 l 5174 5434 l 5200 5438 l 5226 5441 l 5252 5445 l 5279 5448 l 5306 5451 l 5334 5454 l 5362 5457 l 5391 5459 l 5420 5461 l 5449 5463 l 5479 5464 l 5508 5466 l 5537 5467 l 5566 5468 l 5595 5469 l 5623 5469 l 5651 5470 l 5677 5470 l 5703 5471 l 5729 5471 l 5753 5471 l 5777 5471 l 5801 5471 l 5824 5471 l 5849 5471 l 5874 5471 l 5899 5471 l 5924 5471 l 5949 5471 l 5975 5470 l 6002 5470 l 6028 5470 l 6055 5469 l 6081 5468 l 6108 5468 l 6135 5467 l 6161 5465 l 6187 5464 l 6212 5462 l 6237 5461 l 6261 5459 l 6284 5457 l 6307 5454 l 6330 5452 l 6352 5449 l 6374 5446 l 6396 5443 l 6418 5439 l 6440 5435 l 6463 5431 l 6487 5426 l 6510 5422 l 6535 5416 l 6559 5411 l 6584 5405 l 6610 5399 l 6635 5393 l 6660 5386 l 6685 5379 l 6709 5373 l 6734 5366 l 6757 5360 l 6780 5353 l 6802 5346 l 6824 5340 l 6845 5334 l 6866 5327 l 6887 5321 l 6909 5314 l 6931 5307 l 6954 5300 l 6977 5292 l 7000 5285 l 7023 5276 l 7047 5268 l 7071 5259 l 7095 5249 l 7119 5239 l 7142 5229 l 7165 5218 l 7188 5207 l 7210 5196 l 7231 5184 l 7251 5172 l 7270 5160 l 7289 5147 l 7307 5134 l 7324 5121 l 7340 5108 l 7355 5095 l 7370 5080 l 7386 5065 l 7402 5048 l 7418 5029 l 7435 5009 l 7454 4986 l 7473 4962 l 7493 4936 l 7514 4908 l 7535 4880 l 7557 4851 l 7577 4822 l 7596 4796 l 7613 4773 l 7626 4753 l 7637 4739 l 7643 4729 l 7647 4724 l 7649 4721 l gs col-1 s gr % Polyline n 4124 4871 m 4126 4868 l 4130 4862 l 4136 4852 l 4146 4836 l 4159 4816 l 4174 4792 l 4191 4766 l 4208 4739 l 4226 4712 l 4244 4686 l 4261 4661 l 4277 4639 l 4292 4618 l 4306 4599 l 4320 4581 l 4334 4565 l 4347 4549 l 4360 4535 l 4374 4521 l 4388 4507 l 4402 4494 l 4417 4481 l 4433 4467 l 4449 4454 l 4466 4441 l 4484 4428 l 4502 4415 l 4521 4403 l 4540 4390 l 4559 4379 l 4578 4367 l 4598 4356 l 4617 4346 l 4635 4336 l 4654 4327 l 4672 4319 l 4689 4311 l 4707 4303 l 4724 4296 l 4741 4289 l 4759 4283 l 4776 4277 l 4795 4270 l 4813 4264 l 4833 4259 l 4853 4253 l 4873 4247 l 4894 4242 l 4915 4237 l 4936 4232 l 4958 4227 l 4979 4223 l 5000 4218 l 5021 4214 l 5042 4210 l 5063 4207 l 5083 4203 l 5104 4199 l 5124 4196 l 5143 4193 l 5162 4190 l 5182 4187 l 5203 4183 l 5224 4180 l 5247 4177 l 5270 4173 l 5293 4170 l 5318 4167 l 5343 4163 l 5368 4160 l 5394 4157 l 5420 4154 l 5446 4151 l 5472 4148 l 5498 4146 l 5524 4143 l 5549 4141 l 5574 4139 l 5599 4137 l 5624 4135 l 5649 4134 l 5672 4132 l 5696 4131 l 5719 4130 l 5744 4129 l 5769 4128 l 5795 4127 l 5821 4126 l 5848 4126 l 5875 4125 l 5903 4125 l 5930 4125 l 5958 4124 l 5986 4125 l 6013 4125 l 6040 4125 l 6066 4126 l 6092 4126 l 6116 4127 l 6141 4128 l 6164 4129 l 6186 4130 l 6208 4131 l 6229 4132 l 6249 4134 l 6273 4135 l 6296 4137 l 6319 4140 l 6343 4142 l 6366 4145 l 6389 4148 l 6412 4151 l 6435 4154 l 6458 4158 l 6481 4162 l 6504 4166 l 6526 4170 l 6548 4175 l 6569 4179 l 6590 4184 l 6610 4189 l 6629 4194 l 6649 4198 l 6668 4203 l 6687 4209 l 6706 4214 l 6725 4219 l 6745 4225 l 6765 4231 l 6786 4237 l 6808 4244 l 6830 4251 l 6852 4258 l 6875 4265 l 6897 4273 l 6920 4280 l 6942 4288 l 6964 4296 l 6985 4303 l 7006 4311 l 7026 4318 l 7045 4325 l 7064 4332 l 7082 4339 l 7099 4346 l 7118 4354 l 7137 4361 l 7155 4370 l 7174 4378 l 7193 4387 l 7212 4396 l 7230 4406 l 7249 4416 l 7267 4426 l 7285 4437 l 7302 4448 l 7318 4460 l 7334 4471 l 7348 4483 l 7362 4495 l 7375 4508 l 7387 4520 l 7399 4534 l 7410 4547 l 7421 4562 l 7432 4578 l 7443 4595 l 7454 4614 l 7466 4636 l 7478 4660 l 7491 4686 l 7504 4714 l 7518 4744 l 7531 4773 l 7544 4801 l 7555 4826 l 7563 4845 l 7569 4859 l 7572 4867 l 7574 4870 l 7574 4871 l gs col-1 s gr % Polyline 15.000 slw n 2924 4796 m 2924 4795 l 2925 4792 l 2927 4784 l 2930 4770 l 2934 4750 l 2940 4725 l 2946 4696 l 2954 4665 l 2961 4635 l 2968 4605 l 2976 4578 l 2983 4552 l 2989 4529 l 2996 4507 l 3003 4487 l 3009 4469 l 3017 4451 l 3024 4434 l 3032 4416 l 3040 4399 l 3049 4382 l 3059 4364 l 3069 4347 l 3081 4329 l 3093 4311 l 3105 4292 l 3118 4274 l 3132 4257 l 3146 4239 l 3160 4222 l 3175 4206 l 3190 4190 l 3204 4175 l 3219 4161 l 3234 4147 l 3249 4134 l 3263 4122 l 3277 4110 l 3292 4098 l 3308 4086 l 3324 4073 l 3341 4061 l 3358 4049 l 3376 4036 l 3395 4024 l 3413 4012 l 3432 4000 l 3450 3988 l 3469 3977 l 3487 3966 l 3505 3955 l 3522 3945 l 3539 3935 l 3555 3926 l 3571 3917 l 3587 3909 l 3604 3899 l 3621 3890 l 3638 3880 l 3656 3871 l 3674 3861 l 3692 3852 l 3711 3842 l 3730 3832 l 3749 3823 l 3768 3813 l 3787 3804 l 3806 3795 l 3824 3786 l 3842 3778 l 3860 3769 l 3877 3761 l 3894 3754 l 3912 3746 l 3927 3739 l 3943 3732 l 3959 3725 l 3976 3718 l 3994 3710 l 4012 3703 l 4031 3695 l 4050 3687 l 4070 3679 l 4090 3671 l 4110 3663 l 4131 3655 l 4151 3647 l 4171 3639 l 4191 3632 l 4210 3624 l 4230 3617 l 4249 3610 l 4268 3603 l 4287 3596 l 4306 3589 l 4325 3582 l 4345 3575 l 4365 3568 l 4387 3561 l 4409 3553 l 4431 3546 l 4455 3538 l 4478 3530 l 4502 3523 l 4527 3515 l 4551 3508 l 4575 3501 l 4599 3494 l 4623 3487 l 4646 3481 l 4669 3475 l 4692 3469 l 4714 3464 l 4737 3459 l 4757 3454 l 4778 3449 l 4799 3445 l 4821 3440 l 4843 3436 l 4866 3432 l 4890 3427 l 4915 3423 l 4940 3419 l 4966 3414 l 4992 3410 l 5018 3406 l 5044 3402 l 5071 3398 l 5097 3394 l 5123 3391 l 5149 3387 l 5174 3384 l 5199 3381 l 5224 3377 l 5249 3374 l 5274 3371 l 5297 3368 l 5321 3365 l 5345 3362 l 5369 3359 l 5395 3357 l 5421 3354 l 5448 3351 l 5475 3348 l 5504 3345 l 5533 3342 l 5562 3340 l 5592 3337 l 5622 3335 l 5652 3332 l 5682 3330 l 5711 3328 l 5741 3327 l 5770 3325 l 5798 3324 l 5827 3323 l 5855 3322 l 5882 3321 l 5909 3321 l 5937 3321 l 5962 3321 l 5987 3321 l 6013 3322 l 6039 3323 l 6066 3324 l 6093 3325 l 6121 3326 l 6149 3328 l 6178 3329 l 6207 3331 l 6237 3334 l 6266 3336 l 6296 3339 l 6325 3341 l 6354 3344 l 6383 3348 l 6411 3351 l 6439 3354 l 6466 3358 l 6492 3361 l 6518 3365 l 6543 3368 l 6567 3372 l 6591 3376 l 6614 3380 l 6637 3384 l 6661 3388 l 6685 3392 l 6709 3397 l 6733 3402 l 6757 3407 l 6782 3412 l 6807 3418 l 6832 3424 l 6858 3430 l 6883 3436 l 6909 3443 l 6935 3449 l 6960 3456 l 6986 3463 l 7011 3470 l 7036 3477 l 7061 3484 l 7085 3491 l 7109 3498 l 7132 3505 l 7155 3512 l 7178 3519 l 7201 3526 l 7224 3534 l 7247 3541 l 7271 3548 l 7294 3556 l 7319 3564 l 7344 3572 l 7370 3580 l 7396 3589 l 7423 3598 l 7451 3608 l 7479 3617 l 7507 3627 l 7535 3637 l 7563 3647 l 7591 3657 l 7618 3668 l 7645 3678 l 7671 3688 l 7697 3698 l 7722 3709 l 7746 3719 l 7770 3729 l 7793 3739 l 7815 3749 l 7837 3759 l 7860 3770 l 7883 3781 l 7906 3792 l 7929 3804 l 7952 3817 l 7975 3829 l 7998 3842 l 8022 3856 l 8045 3870 l 8068 3884 l 8090 3898 l 8113 3912 l 8134 3926 l 8155 3940 l 8176 3954 l 8196 3968 l 8215 3982 l 8233 3995 l 8250 4008 l 8267 4021 l 8283 4033 l 8299 4046 l 8316 4060 l 8333 4074 l 8350 4088 l 8367 4102 l 8384 4117 l 8400 4132 l 8417 4147 l 8434 4163 l 8451 4179 l 8467 4194 l 8483 4210 l 8498 4225 l 8513 4240 l 8527 4255 l 8541 4269 l 8554 4283 l 8566 4296 l 8578 4309 l 8588 4321 l 8599 4334 l 8612 4348 l 8624 4363 l 8636 4378 l 8648 4394 l 8660 4409 l 8671 4425 l 8682 4441 l 8692 4457 l 8702 4472 l 8711 4488 l 8719 4503 l 8727 4517 l 8733 4531 l 8739 4545 l 8744 4558 l 8749 4571 l 8754 4586 l 8757 4601 l 8761 4617 l 8764 4634 l 8766 4654 l 8768 4675 l 8770 4698 l 8771 4722 l 8772 4745 l 8773 4766 l 8774 4782 l 8774 4791 l 8774 4795 l 8774 4796 l gs col-1 s gr % Polyline [90] 0 sd n 7574 4871 m 7576 4874 l 7581 4881 l 7589 4892 l 7600 4908 l 7613 4927 l 7628 4948 l 7644 4969 l 7659 4989 l 7673 5008 l 7687 5026 l 7700 5042 l 7712 5056 l 7724 5070 l 7736 5083 l 7749 5096 l 7761 5107 l 7773 5119 l 7786 5131 l 7800 5143 l 7814 5155 l 7829 5168 l 7845 5181 l 7862 5194 l 7879 5207 l 7897 5220 l 7914 5232 l 7932 5244 l 7950 5256 l 7968 5268 l 7985 5278 l 8002 5289 l 8019 5299 l 8037 5309 l 8054 5318 l 8072 5327 l 8090 5337 l 8109 5346 l 8129 5355 l 8150 5364 l 8171 5373 l 8193 5382 l 8215 5391 l 8237 5399 l 8260 5407 l 8283 5414 l 8305 5421 l 8327 5427 l 8348 5432 l 8370 5437 l 8391 5442 l 8412 5446 l 8431 5449 l 8450 5452 l 8470 5455 l 8490 5457 l 8511 5459 l 8533 5461 l 8555 5462 l 8577 5463 l 8600 5464 l 8622 5464 l 8645 5464 l 8667 5463 l 8689 5462 l 8710 5461 l 8731 5459 l 8751 5457 l 8770 5455 l 8789 5452 l 8807 5449 l 8824 5446 l 8843 5442 l 8862 5437 l 8880 5432 l 8899 5427 l 8918 5421 l 8937 5414 l 8956 5407 l 8975 5399 l 8994 5391 l 9012 5382 l 9030 5373 l 9047 5364 l 9064 5355 l 9080 5346 l 9095 5337 l 9109 5327 l 9123 5318 l 9137 5309 l 9151 5298 l 9166 5286 l 9181 5274 l 9196 5262 l 9212 5248 l 9227 5234 l 9242 5220 l 9256 5205 l 9271 5190 l 9284 5174 l 9297 5159 l 9309 5144 l 9320 5128 l 9331 5113 l 9340 5098 l 9349 5084 l 9357 5068 l 9365 5052 l 9373 5036 l 9380 5018 l 9388 4997 l 9396 4975 l 9404 4951 l 9412 4925 l 9420 4897 l 9428 4870 l 9435 4845 l 9441 4824 l 9445 4809 l 9448 4800 l 9449 4797 l 9449 4796 l gs col-1 s gr [] 0 sd % Polyline n 7574 4796 m 7576 4793 l 7581 4786 l 7590 4775 l 7602 4759 l 7617 4739 l 7635 4716 l 7653 4692 l 7672 4667 l 7690 4644 l 7707 4622 l 7723 4602 l 7738 4583 l 7751 4566 l 7764 4551 l 7776 4536 l 7788 4522 l 7799 4509 l 7812 4494 l 7825 4479 l 7839 4464 l 7852 4449 l 7867 4433 l 7881 4418 l 7896 4403 l 7912 4389 l 7927 4374 l 7942 4361 l 7956 4348 l 7971 4336 l 7984 4325 l 7998 4314 l 8011 4305 l 8024 4296 l 8037 4288 l 8050 4280 l 8064 4272 l 8078 4264 l 8092 4257 l 8107 4250 l 8123 4243 l 8138 4237 l 8154 4231 l 8170 4225 l 8186 4219 l 8201 4214 l 8217 4209 l 8232 4205 l 8247 4200 l 8262 4196 l 8277 4192 l 8292 4187 l 8309 4183 l 8326 4178 l 8344 4174 l 8362 4169 l 8381 4165 l 8401 4160 l 8420 4156 l 8440 4152 l 8459 4148 l 8478 4144 l 8496 4141 l 8514 4138 l 8532 4136 l 8549 4134 l 8566 4131 l 8584 4130 l 8602 4128 l 8620 4127 l 8640 4127 l 8660 4127 l 8680 4127 l 8701 4128 l 8722 4130 l 8742 4132 l 8763 4135 l 8783 4138 l 8803 4142 l 8823 4147 l 8842 4152 l 8862 4159 l 8879 4165 l 8897 4171 l 8915 4179 l 8934 4187 l 8953 4196 l 8973 4205 l 8993 4215 l 9013 4226 l 9033 4237 l 9053 4248 l 9072 4260 l 9091 4271 l 9109 4282 l 9127 4293 l 9143 4304 l 9158 4314 l 9173 4324 l 9187 4334 l 9203 4346 l 9219 4358 l 9235 4370 l 9250 4382 l 9265 4395 l 9279 4408 l 9292 4421 l 9305 4434 l 9316 4447 l 9327 4460 l 9337 4472 l 9346 4484 l 9354 4496 l 9362 4509 l 9369 4521 l 9376 4534 l 9383 4549 l 9390 4565 l 9397 4583 l 9406 4603 l 9414 4625 l 9423 4648 l 9431 4671 l 9439 4692 l 9444 4707 l 9447 4716 l 9449 4720 l 9449 4721 l gs col-1 s gr % Polyline n 2924 4796 m 2924 4797 l 2925 4800 l 2927 4809 l 2931 4825 l 2937 4846 l 2944 4871 l 2951 4899 l 2959 4927 l 2966 4954 l 2974 4979 l 2980 5002 l 2987 5023 l 2993 5043 l 2999 5061 l 3005 5079 l 3012 5096 l 3017 5111 l 3024 5127 l 3030 5143 l 3037 5159 l 3045 5176 l 3053 5193 l 3062 5210 l 3071 5228 l 3081 5246 l 3091 5264 l 3102 5282 l 3113 5299 l 3125 5316 l 3136 5333 l 3148 5349 l 3161 5365 l 3173 5381 l 3187 5396 l 3199 5410 l 3212 5424 l 3225 5438 l 3240 5452 l 3255 5467 l 3272 5482 l 3289 5497 l 3307 5513 l 3326 5529 l 3345 5544 l 3365 5560 l 3385 5575 l 3406 5590 l 3426 5605 l 3447 5619 l 3467 5633 l 3488 5646 l 3508 5659 l 3529 5671 l 3549 5684 l 3568 5694 l 3587 5705 l 3607 5716 l 3628 5727 l 3649 5738 l 3671 5749 l 3694 5760 l 3717 5772 l 3741 5783 l 3765 5794 l 3790 5805 l 3815 5816 l 3840 5827 l 3864 5837 l 3889 5847 l 3913 5857 l 3937 5866 l 3960 5875 l 3983 5884 l 4005 5892 l 4027 5901 l 4049 5909 l 4071 5916 l 4093 5924 l 4115 5932 l 4138 5939 l 4162 5947 l 4185 5955 l 4210 5962 l 4234 5970 l 4259 5978 l 4285 5985 l 4310 5993 l 4335 6000 l 4360 6007 l 4384 6014 l 4409 6020 l 4432 6026 l 4455 6032 l 4477 6038 l 4499 6044 l 4520 6049 l 4541 6054 l 4562 6059 l 4584 6064 l 4606 6069 l 4629 6073 l 4652 6078 l 4675 6083 l 4699 6088 l 4723 6093 l 4748 6097 l 4773 6102 l 4797 6107 l 4822 6111 l 4846 6116 l 4870 6120 l 4894 6124 l 4917 6128 l 4939 6132 l 4961 6135 l 4982 6139 l 5003 6143 l 5024 6146 l 5045 6149 l 5066 6153 l 5087 6156 l 5108 6160 l 5131 6164 l 5153 6167 l 5176 6171 l 5200 6175 l 5224 6178 l 5247 6182 l 5271 6185 l 5294 6189 l 5317 6192 l 5340 6195 l 5361 6198 l 5383 6200 l 5403 6203 l 5423 6205 l 5442 6207 l 5462 6209 l 5480 6210 l 5499 6212 l 5518 6213 l 5538 6214 l 5558 6215 l 5578 6216 l 5598 6217 l 5619 6218 l 5640 6219 l 5662 6219 l 5683 6220 l 5704 6220 l 5725 6220 l 5745 6221 l 5765 6221 l 5785 6221 l 5805 6221 l 5824 6221 l 5843 6221 l 5862 6221 l 5881 6221 l 5900 6221 l 5920 6221 l 5940 6221 l 5962 6221 l 5983 6221 l 6006 6220 l 6029 6220 l 6052 6220 l 6076 6219 l 6099 6219 l 6123 6218 l 6147 6217 l 6170 6216 l 6192 6215 l 6215 6214 l 6236 6213 l 6257 6212 l 6278 6210 l 6299 6209 l 6320 6207 l 6341 6205 l 6362 6203 l 6384 6200 l 6406 6198 l 6429 6195 l 6452 6192 l 6476 6189 l 6500 6185 l 6524 6182 l 6548 6178 l 6572 6175 l 6596 6171 l 6619 6167 l 6642 6164 l 6664 6160 l 6686 6156 l 6707 6153 l 6728 6149 l 6749 6146 l 6770 6143 l 6791 6139 l 6812 6135 l 6834 6132 l 6856 6128 l 6879 6124 l 6902 6120 l 6926 6116 l 6950 6111 l 6974 6107 l 6998 6102 l 7022 6097 l 7046 6093 l 7069 6088 l 7092 6083 l 7114 6078 l 7136 6073 l 7157 6069 l 7178 6064 l 7199 6059 l 7218 6054 l 7237 6049 l 7256 6044 l 7276 6038 l 7296 6032 l 7316 6026 l 7338 6020 l 7359 6014 l 7381 6007 l 7403 6000 l 7426 5993 l 7448 5985 l 7471 5978 l 7493 5970 l 7515 5962 l 7537 5955 l 7558 5947 l 7580 5939 l 7600 5932 l 7621 5924 l 7641 5916 l 7662 5909 l 7682 5901 l 7703 5893 l 7724 5884 l 7745 5875 l 7767 5867 l 7790 5857 l 7813 5848 l 7836 5838 l 7859 5828 l 7883 5817 l 7906 5807 l 7929 5796 l 7952 5786 l 7974 5775 l 7996 5765 l 8017 5754 l 8037 5744 l 8056 5734 l 8074 5724 l 8091 5715 l 8108 5705 l 8124 5696 l 8143 5685 l 8161 5673 l 8179 5661 l 8196 5649 l 8214 5636 l 8231 5623 l 8248 5609 l 8265 5596 l 8281 5582 l 8297 5568 l 8313 5554 l 8328 5540 l 8343 5526 l 8357 5512 l 8371 5498 l 8385 5485 l 8398 5472 l 8412 5459 l 8425 5445 l 8439 5431 l 8453 5417 l 8468 5402 l 8483 5386 l 8498 5370 l 8514 5354 l 8530 5337 l 8546 5319 l 8561 5302 l 8576 5285 l 8591 5267 l 8604 5250 l 8617 5234 l 8630 5218 l 8641 5202 l 8652 5186 l 8662 5171 l 8672 5154 l 8682 5136 l 8691 5119 l 8700 5100 l 8708 5082 l 8716 5063 l 8723 5045 l 8730 5026 l 8736 5008 l 8741 4991 l 8746 4975 l 8750 4959 l 8753 4945 l 8757 4932 l 8759 4920 l 8762 4909 l 8765 4892 l 8767 4878 l 8769 4864 l 8771 4850 l 8772 4835 l 8773 4821 l 8773 4809 l 8774 4800 l 8774 4797 l 8774 4796 l gs col-1 s gr /Symbol ff 450.00 scf sf 4814 3236 m gs 1 -1 sc (b) col-1 sh gr /Symbol ff 450.00 scf sf 7829 4871 m gs 1 -1 sc (a) col-1 sh gr % Polyline gs clippath 17119 2610 m 17551 2700 l 17119 2790 l 17655 2790 l 17655 2610 l cp clip n 17400 2700 m 17625 2700 l gs col-1 s gr gr % arrowhead 30.000 slw n 17119 2610 m 17551 2700 l 17119 2790 l 17191 2700 l 17119 2610 l cp gs 0.00 setgray ef gr col-1 s % Polyline 15.000 slw gs clippath 17119 6810 m 17551 6900 l 17119 6990 l 17655 6990 l 17655 6810 l cp clip n 17400 6900 m 17625 6900 l gs col-1 s gr gr % arrowhead 30.000 slw n 17119 6810 m 17551 6900 l 17119 6990 l 17191 6900 l 17119 6810 l cp gs 0.00 setgray ef gr col-1 s % Polyline n 13200 4425 m 13125 4575 l gs col-1 s gr % Polyline n 18330 4425 m 18255 4575 l gs col-1 s gr % Polyline n 18486 4425 m 18411 4575 l gs col-1 s gr % Polyline n 15861 6978 m 15786 7128 l gs col-1 s gr % Polyline n 15861 2103 m 15786 2253 l gs col-1 s gr % Polyline n 16011 2103 m 15936 2253 l gs col-1 s gr % Polyline 15.000 slw gs clippath 17610 3271 m 17700 2838 l 17790 3271 l 17790 2735 l 17610 2735 l cp clip n 17700 2990 m 17700 2765 l gs col-1 s gr gr % arrowhead 30.000 slw n 17610 3271 m 17700 2838 l 17790 3271 l 17700 3199 l 17610 3271 l cp gs 0.00 setgray ef gr col-1 s % Polyline 15.000 slw gs clippath 13410 3276 m 13500 2843 l 13590 3276 l 13590 2740 l 13410 2740 l cp clip n 13500 2995 m 13500 2770 l gs col-1 s gr gr % arrowhead 30.000 slw n 13410 3276 m 13500 2843 l 13590 3276 l 13500 3204 l 13410 3276 l cp gs 0.00 setgray ef gr col-1 s % Polyline n 13500 6900 m 17700 6900 l 17700 2700 l 13500 2700 l cp gs col-1 s gr /Times-Italic ff 600.00 scf sf 15450 2475 m gs 1 -1 sc (a) col-1 sh gr /Times-Italic ff 600.00 scf sf 17925 4950 m gs 1 -1 sc (b) col-1 sh gr /Times-Italic ff 600.00 scf sf 12825 4950 m gs 1 -1 sc (b) col-1 sh gr /Times-Italic ff 600.00 scf sf 15450 7350 m gs 1 -1 sc (a) col-1 sh gr $F2psEnd rs %%EndDocument @endspecial 673 1721 a FP(Figure)32 b(4.1.)40 b FQ(A)28 b(torus)f(obtained)g(b)n(y)g(gluing)g(opp)r(osite)h(sides)f(of)g(a)h (rectangle.)605 1939 y(Belo)n(w)h(w)n(e)g(will)h(consider)e(orien)n (tation)h(rev)n(ersing)e(homeomorphisms)h FJ(f)18 b FQ(:)28 b FJ(T)3056 1951 y FM(1)3148 1892 y FE(\030)3120 1939 y FL(\000)-40 b(!)27 b FJ(T)3304 1951 y FM(2)3370 1939 y FQ(as)456 2038 y(acting)g(on)g(the)h(corresp)r(onding)e(rectangles.) 35 b(W)-7 b(e)28 b(will)g(consider)e(t)n(w)n(o)h(examples.)605 2138 y(\(i\))33 b FJ(f)40 b FQ(iden)n(ti\014es)33 b FJ(a)1204 2108 y FE(0)1204 2158 y FM(1)1273 2138 y FQ(with)f FJ(a)1510 2108 y FE(0)1510 2158 y FM(2)1547 2138 y FQ(,)i FJ(a)1648 2108 y FE(00)1648 2158 y FM(1)1722 2138 y FQ(with)e FJ(a)1959 2108 y FE(0)q(0)1959 2158 y FM(2)2002 2138 y FQ(,)h FJ(b)2094 2108 y FE(0)2094 2158 y FM(1)2163 2138 y FQ(with)g FJ(b)2393 2108 y FE(0)o(0)2393 2158 y FM(2)2467 2138 y FQ(and)e FJ(b)2668 2108 y FE(00)2668 2158 y FM(1)2743 2138 y FQ(with)h FJ(b)2972 2108 y FE(0)2972 2158 y FM(2)3009 2138 y FQ(,)h(i.e.,)h(it)e (is)g(a)456 2238 y(re\015ection)27 b(in)g(the)h(v)n(ertical)f(line:)996 3359 y @beginspecial 0 @llx 0 @lly 229 @urx 128 @ury 2290 @rwi @setspecial %%BeginDocument: figures/tori1.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: tori1.eps %%Creator: fig2dev Version 3.2 Patchlevel 0-beta3 %%CreationDate: Mon Dec 14 12:19:41 1998 %%For: shurik@localhost.localdomain (Alexander Kirillov,,,) %%Orientation: Portrait %%BoundingBox: 0 0 229 128 %%Pages: 0 %%BeginSetup %%EndSetup %%Magnification: 0.2500 %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -192.0 136.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n -1000 10022 m -1000 -1000 l 29008 -1000 l 29008 10022 l cp clip 0.01500 0.01500 sc % Arc 15.000 slw gs clippath 23756 2453 m 23956 2668 l 23687 2550 l 23990 2766 l 24059 2669 l cp clip [90] 0 sd n 20400.0 7500.0 6000.0 -126.9 -53.1 arc gs col-1 s gr gr [] 0 sd % arrowhead n 23756 2453 m 23956 2668 l 23687 2550 l 23761 2529 l 23756 2453 l cp gs 0.00 setgray ef gr col-1 s % Arc gs clippath 26964 3512 m 27246 3595 l 26954 3631 l 27325 3662 l 27335 3543 l cp clip [90] 0 sd n 20400.0 82800.0 79500.0 -95.0 -85.0 arc gs col-1 s gr gr [] 0 sd % arrowhead n 26964 3512 m 27246 3595 l 26954 3631 l 27007 3576 l 26964 3512 l cp gs 0.00 setgray ef gr col-1 s % Arc gs clippath 22756 5448 m 23048 5416 l 22793 5562 l 23147 5448 l 23110 5334 l cp clip [90] 0 sd n 20400.0 -2475.0 8325.0 108.9 71.1 arcn gs col-1 s gr gr [] 0 sd % arrowhead n 22756 5448 m 23048 5416 l 22793 5562 l 22820 5490 l 22756 5448 l cp gs 0.00 setgray ef gr col-1 s % Arc gs clippath 23687 7050 m 23956 6931 l 23756 7147 l 24059 6931 l 23990 6834 l cp clip [90] 0 sd n 20400.0 2100.0 6000.0 126.9 53.1 arcn gs col-1 s gr gr [] 0 sd % arrowhead n 23687 7050 m 23956 6931 l 23756 7147 l 23761 7071 l 23687 7050 l cp gs 0.00 setgray ef gr col-1 s % Polyline gs clippath 17112 2610 m 17544 2700 l 17112 2790 l 17655 2790 l 17655 2610 l cp clip n 17400 2700 m 17625 2700 l gs col-1 s gr gr % arrowhead 30.000 slw n 17112 2610 m 17544 2700 l 17112 2790 l 17184 2700 l 17112 2610 l cp gs 0.00 setgray ef gr col-1 s % Polyline 15.000 slw gs clippath 17112 6810 m 17544 6900 l 17112 6990 l 17655 6990 l 17655 6810 l cp clip n 17400 6900 m 17625 6900 l gs col-1 s gr gr % arrowhead 30.000 slw n 17112 6810 m 17544 6900 l 17112 6990 l 17184 6900 l 17112 6810 l cp gs 0.00 setgray ef gr col-1 s % Polyline n 13200 4425 m 13125 4575 l gs col-1 s gr % Polyline n 18330 4425 m 18255 4575 l gs col-1 s gr % Polyline n 18486 4425 m 18411 4575 l gs col-1 s gr % Polyline n 15861 6978 m 15786 7128 l gs col-1 s gr % Polyline n 15861 2103 m 15786 2253 l gs col-1 s gr % Polyline n 16011 2103 m 15936 2253 l gs col-1 s gr % Polyline 15.000 slw gs clippath 26712 6810 m 27144 6900 l 26712 6990 l 27255 6990 l 27255 6810 l cp clip n 27000 6900 m 27225 6900 l gs col-1 s gr gr % arrowhead 30.000 slw n 26712 6810 m 27144 6900 l 26712 6990 l 26784 6900 l 26712 6810 l cp gs 0.00 setgray ef gr col-1 s % Polyline 15.000 slw gs clippath 26712 2610 m 27144 2700 l 26712 2790 l 27255 2790 l 27255 2610 l cp clip n 27000 2700 m 27225 2700 l gs col-1 s gr gr % arrowhead 30.000 slw n 26712 2610 m 27144 2700 l 26712 2790 l 26784 2700 l 26712 2610 l cp gs 0.00 setgray ef gr col-1 s % Polyline n 25500 6975 m 25425 7125 l gs col-1 s gr % Polyline n 25386 2103 m 25311 2253 l gs col-1 s gr % Polyline n 25500 2103 m 25425 2253 l gs col-1 s gr % Polyline n 27862 4425 m 27787 4575 l gs col-1 s gr % Polyline n 27975 4425 m 27900 4575 l gs col-1 s gr % Polyline n 22875 4425 m 22800 4575 l gs col-1 s gr % Polyline 15.000 slw n 20400 600 m 20400 9000 l gs col-1 s gr % Polyline gs clippath 13410 3288 m 13500 2856 l 13590 3288 l 13590 2745 l 13410 2745 l cp clip n 13500 3000 m 13500 2775 l gs col-1 s gr gr % arrowhead 30.000 slw n 13410 3288 m 13500 2856 l 13590 3288 l 13500 3216 l 13410 3288 l cp gs 0.00 setgray ef gr col-1 s % Polyline 15.000 slw gs clippath 17610 3283 m 17700 2851 l 17790 3283 l 17790 2740 l 17610 2740 l cp clip n 17700 2995 m 17700 2770 l gs col-1 s gr gr % arrowhead 30.000 slw n 17610 3283 m 17700 2851 l 17790 3283 l 17700 3211 l 17610 3283 l cp gs 0.00 setgray ef gr col-1 s % Polyline n 13500 6900 m 17700 6900 l 17700 2700 l 13500 2700 l cp gs col-1 s gr % Polyline 15.000 slw gs clippath 23010 3288 m 23100 2856 l 23190 3288 l 23190 2745 l 23010 2745 l cp clip n 23100 3000 m 23100 2775 l gs col-1 s gr gr % arrowhead 30.000 slw n 23010 3288 m 23100 2856 l 23190 3288 l 23100 3216 l 23010 3288 l cp gs 0.00 setgray ef gr col-1 s % Polyline 15.000 slw gs clippath 27210 3288 m 27300 2856 l 27390 3288 l 27390 2745 l 27210 2745 l cp clip n 27300 3000 m 27300 2775 l gs col-1 s gr gr % arrowhead 30.000 slw n 27210 3288 m 27300 2856 l 27390 3288 l 27300 3216 l 27210 3288 l cp gs 0.00 setgray ef gr col-1 s % Polyline n 23100 6900 m 27300 6900 l 27300 2700 l 23100 2700 l cp gs col-1 s gr /Times-Italic ff 600.00 scf sf 15450 2475 m gs 1 -1 sc (a) col-1 sh gr /Times-Italic ff 600.00 scf sf 17925 4950 m gs 1 -1 sc (b) col-1 sh gr /Times-Italic ff 600.00 scf sf 12825 4950 m gs 1 -1 sc (b) col-1 sh gr /Times-Italic ff 600.00 scf sf 25050 7350 m gs 1 -1 sc (a) col-1 sh gr /Times-Italic ff 600.00 scf sf 27450 4950 m gs 1 -1 sc (b) col-1 sh gr /Times-Italic ff 600.00 scf sf 22500 4950 m gs 1 -1 sc (b) col-1 sh gr /Times-Italic ff 600.00 scf sf 15450 7350 m gs 1 -1 sc (a) col-1 sh gr /Times-Roman ff 300.00 scf sf 15750 7500 m gs 1 -1 sc (1) col-1 sh gr /Times-Roman ff 300.00 scf sf 15750 2625 m gs 1 -1 sc (1) col-1 sh gr /Times-Roman ff 300.00 scf sf 18150 5100 m gs 1 -1 sc (1) col-1 sh gr /Times-Roman ff 300.00 scf sf 13050 5100 m gs 1 -1 sc (1) col-1 sh gr /Times-Roman ff 300.00 scf sf 22725 5100 m gs 1 -1 sc (2) col-1 sh gr /Times-Roman ff 300.00 scf sf 25275 2625 m gs 1 -1 sc (2) col-1 sh gr /Times-Roman ff 300.00 scf sf 25350 7500 m gs 1 -1 sc (2) col-1 sh gr /Times-Roman ff 300.00 scf sf 27675 5100 m gs 1 -1 sc (2) col-1 sh gr /Times-Italic ff 600.00 scf sf 24975 2475 m gs 1 -1 sc (a) col-1 sh gr /Times-Italic ff 600.00 scf sf 21300 3075 m gs 1 -1 sc (f) col-1 sh gr /Times-Italic ff 600.00 scf sf 21300 1275 m gs 1 -1 sc (f) col-1 sh gr /Times-Italic ff 600.00 scf sf 21300 5400 m gs 1 -1 sc (f) col-1 sh gr /Times-Italic ff 600.00 scf sf 21300 7725 m gs 1 -1 sc (f) col-1 sh gr $F2psEnd rs %%EndDocument @endspecial 456 3481 a(Then)36 b FJ(M)762 3493 y FI(f)843 3481 y FQ(=)h FJ(T)994 3493 y FM(1)1056 3481 y FL([)1111 3493 y FI(f)1178 3481 y FJ(T)1227 3493 y FM(2)1302 3481 y FL(')h FJ(S)1461 3450 y FM(2)1522 3481 y FL(\002)24 b FJ(S)1667 3450 y FM(1)1704 3481 y FQ(.)64 b(Indeed,)39 b FJ(M)2176 3493 y FI(f)2255 3481 y FQ(has)d(a)g(w)n(ell-de\014ned)g (pro)5 b(jection)36 b(on)456 3580 y(the)i(circle)g FJ(\014)k FQ(whic)n(h)c(is)g(a)g(common)f(parallel)g(of)h(b)r(oth)g(tori)g(\(on)g (the)g(\014gure)g(ab)r(o)n(v)n(e,)h FJ(\014)k FQ(is)456 3680 y(represen)n(ted)30 b(b)n(y)i(an)n(y)f(of)h(the)g(in)n(terv)-5 b(als)31 b FJ(b)1801 3692 y FM(1)1838 3680 y FJ(;)14 b(:)g(:)g(:)g(;)g(b)2059 3650 y FE(0)o(0)2059 3700 y FM(2)2101 3680 y FQ(\).)50 b(The)32 b(\014b)r(er)g(of)g(this)g(pro)5 b(jection)31 b(is)g FJ(S)3384 3650 y FM(2)3421 3680 y FQ(,)456 3779 y(obtained)21 b(b)n(y)f(gluing)h(t)n(w)n(o)g(copies)f(of) h(a)g(disk)g(along)f(the)i(b)r(oundary)-7 b(.)34 b(Finally)-7 b(,)22 b(it)g(can)f(b)r(e)g(sho)n(wn)456 3879 y(that)27 b(this)h(is)g(indeed)g(a)f(direct)g(pro)r(duct.)605 3979 y(\(ii\))32 b FJ(f)39 b FQ(iden)n(ti\014es)31 b FJ(a)1223 3949 y FE(0)1223 3999 y FM(1)1291 3979 y FQ(with)h FJ(b)1520 3949 y FE(0)1520 3999 y FM(2)1556 3979 y FQ(,)g FJ(a)1655 3949 y FE(00)1655 3999 y FM(1)1728 3979 y FQ(with)g FJ(b)1957 3949 y FE(00)1957 3999 y FM(2)1999 3979 y FQ(,)g FJ(b)2090 3949 y FE(0)2090 3999 y FM(1)2157 3979 y FQ(with)g FJ(a)2394 3949 y FE(0)2394 3999 y FM(2)2462 3979 y FQ(and)f FJ(b)2663 3949 y FE(0)o(0)2663 3999 y FM(1)2736 3979 y FQ(with)g FJ(a)2972 3949 y FE(00)2972 3999 y FM(2)3014 3979 y FQ(,)h(i.e.,)g(it)f (is)g(a)456 4078 y(re\015ection)c(in)g(the)h(diagonal:)975 5216 y @beginspecial 0 @llx 0 @lly 234 @urx 128 @ury 2340 @rwi @setspecial %%BeginDocument: figures/tori2.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: tori2.eps %%Creator: fig2dev Version 3.2 Patchlevel 0-beta3 %%CreationDate: Mon Dec 14 12:26:04 1998 %%For: shurik@localhost.localdomain (Alexander Kirillov,,,) %%Orientation: Portrait %%BoundingBox: 0 0 234 128 %%Pages: 0 %%BeginSetup %%EndSetup %%Magnification: 0.2500 %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -189.0 136.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n -1000 10022 m -1000 -1000 l 29147 -1000 l 29147 10022 l cp clip 0.01500 0.01500 sc % Arc 15.000 slw gs clippath 23839 2520 m 24032 2742 l 23767 2616 l 24063 2841 l 24135 2745 l cp clip [90] 0 sd n 20445.8 7301.8 5802.0 -129.9 -51.3 arc gs col-1 s gr gr [] 0 sd % arrowhead n 23839 2520 m 24032 2742 l 23767 2616 l 23841 2597 l 23839 2520 l cp gs 0.00 setgray ef gr col-1 s % Arc gs clippath 23767 6984 m 24032 6857 l 23839 7080 l 24135 6855 l 24063 6759 l cp clip [90] 0 sd n 20445.8 2298.2 5802.0 129.9 51.3 arcn gs col-1 s gr gr [] 0 sd % arrowhead n 23767 6984 m 24032 6857 l 23839 7080 l 23841 7003 l 23767 6984 l cp gs 0.00 setgray ef gr col-1 s % Arc gs clippath 26513 3440 m 26796 3521 l 26505 3560 l 26876 3587 l 26884 3467 l cp clip [90] 0 sd n 20825.5 83664.4 80365.5 -95.0 -85.7 arc gs col-1 s gr gr [] 0 sd % arrowhead n 26513 3440 m 26796 3521 l 26505 3560 l 26557 3503 l 26513 3440 l cp gs 0.00 setgray ef gr col-1 s % Arc gs clippath 26505 6040 m 26796 6078 l 26513 6160 l 26884 6133 l 26876 6013 l cp clip [90] 0 sd n 20825.5 -74064.4 80365.5 95.0 85.7 arcn gs col-1 s gr gr [] 0 sd % arrowhead n 26505 6040 m 26796 6078 l 26513 6160 l 26557 6097 l 26505 6040 l cp gs 0.00 setgray ef gr col-1 s % Polyline n 22125 4800 m 25125 1800 l 28125 4800 l 25125 7800 l 22125 4800 l cp gs col-1 s gr % Polyline n 20400 600 m 20400 9000 l gs col-1 s gr % Polyline 30.000 slw n 13875 2850 m 13800 3000 l gs col-1 s gr % Polyline n 14025 2850 m 13950 3000 l gs col-1 s gr % Polyline n 17550 6300 m 17475 6450 l gs col-1 s gr % Polyline n 27075 6300 m 27000 6450 l gs col-1 s gr % Polyline n 27180 2700 m 27105 2850 l gs col-1 s gr % Polyline n 27336 2700 m 27261 2850 l gs col-1 s gr % Polyline n 14175 6450 m 14100 6600 l gs col-1 s gr % Polyline n 23595 6450 m 23520 6600 l gs col-1 s gr % Polyline n 17511 2625 m 17436 2775 l gs col-1 s gr % Polyline n 17625 2625 m 17550 2775 l gs col-1 s gr % Polyline n 23475 2700 m 23400 2850 l gs col-1 s gr % Polyline n 23625 2700 m 23550 2850 l gs col-1 s gr % Polyline 15.000 slw gs clippath 18249 5099 m 18617 4857 l 18376 5226 l 18760 4842 l 18633 4715 l cp clip n 18450 5025 m 18675 4800 l gs col-1 s gr gr % arrowhead 30.000 slw n 18249 5099 m 18617 4857 l 18376 5226 l 18363 5112 l 18249 5099 l cp gs 0.00 setgray ef gr col-1 s % Polyline 15.000 slw gs clippath 15249 2099 m 15617 1857 l 15376 2226 l 15760 1842 l 15633 1715 l cp clip n 15450 2025 m 15675 1800 l gs col-1 s gr gr % arrowhead 30.000 slw n 15249 2099 m 15617 1857 l 15376 2226 l 15363 2112 l 15249 2099 l cp gs 0.00 setgray ef gr col-1 s % Polyline 15.000 slw gs clippath 27699 5099 m 28067 4857 l 27826 5226 l 28210 4842 l 28083 4715 l cp clip n 27900 5025 m 28125 4800 l gs col-1 s gr gr % arrowhead 30.000 slw n 27699 5099 m 28067 4857 l 27826 5226 l 27813 5112 l 27699 5099 l cp gs 0.00 setgray ef gr col-1 s % Polyline 15.000 slw gs clippath 24699 2099 m 25067 1857 l 24826 2226 l 25210 1842 l 25083 1715 l cp clip n 24900 2025 m 25125 1800 l gs col-1 s gr gr % arrowhead 30.000 slw n 24699 2099 m 25067 1857 l 24826 2226 l 24813 2112 l 24699 2099 l cp gs 0.00 setgray ef gr col-1 s % Polyline 15.000 slw n 22350 5025 m 22125 4800 l gs col-1 s gr % Polyline n 12675 4800 m 15675 1800 l 18675 4800 l 15675 7800 l 12675 4800 l cp gs col-1 s gr % Polyline gs clippath 16021 2268 m 15779 1899 l 16148 2141 l 15764 1757 l 15637 1884 l cp clip n 15947 2067 m 15722 1842 l gs col-1 s gr gr % arrowhead 30.000 slw n 16021 2268 m 15779 1899 l 16148 2141 l 16034 2154 l 16021 2268 l cp gs 0.00 setgray ef gr col-1 s % Polyline 15.000 slw gs clippath 13029 5276 m 12787 4907 l 13156 5149 l 12772 4765 l 12645 4892 l cp clip n 12955 5075 m 12730 4850 l gs col-1 s gr gr % arrowhead 30.000 slw n 13029 5276 m 12787 4907 l 13156 5149 l 13042 5162 l 13029 5276 l cp gs 0.00 setgray ef gr col-1 s % Polyline 15.000 slw gs clippath 25456 2253 m 25214 1884 l 25583 2126 l 25199 1742 l 25072 1869 l cp clip n 25382 2052 m 25157 1827 l gs col-1 s gr gr % arrowhead 30.000 slw n 25456 2253 m 25214 1884 l 25583 2126 l 25469 2139 l 25456 2253 l cp gs 0.00 setgray ef gr col-1 s % Polyline 15.000 slw gs clippath 22464 5261 m 22222 4892 l 22591 5134 l 22207 4750 l 22080 4877 l cp clip n 22390 5060 m 22165 4835 l gs col-1 s gr gr % arrowhead 30.000 slw n 22464 5261 m 22222 4892 l 22591 5134 l 22477 5147 l 22464 5261 l cp gs 0.00 setgray ef gr col-1 s /Times-Italic ff 600.00 scf sf 21300 3075 m gs 1 -1 sc (f) col-1 sh gr /Times-Italic ff 600.00 scf sf 21300 1275 m gs 1 -1 sc (f) col-1 sh gr /Times-Italic ff 600.00 scf sf 21300 6075 m gs 1 -1 sc (f) col-1 sh gr /Times-Italic ff 600.00 scf sf 21300 7800 m gs 1 -1 sc (f) col-1 sh gr /Times-Italic ff 600.00 scf sf 13425 3225 m gs 1 -1 sc (a) col-1 sh gr /Times-Roman ff 300.00 scf sf 13725 3450 m gs 1 -1 sc (1) col-1 sh gr /Times-Italic ff 600.00 scf sf 17100 6675 m gs 1 -1 sc (a) col-1 sh gr /Times-Roman ff 300.00 scf sf 17400 6825 m gs 1 -1 sc (1) col-1 sh gr /Times-Italic ff 600.00 scf sf 26625 6675 m gs 1 -1 sc (a) col-1 sh gr /Times-Italic ff 600.00 scf sf 26775 3225 m gs 1 -1 sc (b) col-1 sh gr /Times-Italic ff 600.00 scf sf 13800 6975 m gs 1 -1 sc (b) col-1 sh gr /Times-Roman ff 300.00 scf sf 14025 7200 m gs 1 -1 sc (1) col-1 sh gr /Times-Italic ff 600.00 scf sf 23250 6975 m gs 1 -1 sc (b) col-1 sh gr /Times-Roman ff 300.00 scf sf 23475 7125 m gs 1 -1 sc (2) col-1 sh gr /Times-Roman ff 300.00 scf sf 26925 6825 m gs 1 -1 sc (2) col-1 sh gr /Times-Roman ff 300.00 scf sf 27000 3375 m gs 1 -1 sc (2) col-1 sh gr /Times-Italic ff 600.00 scf sf 17175 3150 m gs 1 -1 sc (b) col-1 sh gr /Times-Roman ff 300.00 scf sf 17400 3300 m gs 1 -1 sc (1) col-1 sh gr /Times-Italic ff 600.00 scf sf 23025 3075 m gs 1 -1 sc (a) col-1 sh gr /Times-Roman ff 300.00 scf sf 23325 3225 m gs 1 -1 sc (2) col-1 sh gr $F2psEnd rs %%EndDocument @endspecial eop %%Page: 73 3 73 76 bop 1381 226 a FM(4.1.)29 b(INV)-7 b(ARIANTS)30 b(OF)e(3-MANIF)n(OLDS)837 b(73)456 425 y FQ(Then)25 b(w)n(e)f(claim)h (that)h FJ(T)1235 437 y FM(1)1285 425 y FL([)1340 437 y FI(f)1396 425 y FJ(T)1445 437 y FM(2)1505 425 y FL(')d FJ(S)1649 395 y FM(3)1686 425 y FQ(.)36 b(The)25 b(easiest)f(w)n(a)n(y) g(to)h(visualize)f(this)h(is)g(to)g(note)g(that)456 525 y(the)h(complemen)n(t)g(of)g(a)g(solid)g(torus)f(in)i FJ(S)1776 495 y FM(3)1836 525 y FQ(=)c FH(R)1978 495 y FM(3)2036 525 y FL([)16 b(1)27 b FQ(is)f(again)f(a)h(solid)f(torus.) 36 b(Hence)26 b FJ(S)3325 495 y FM(3)3389 525 y FQ(is)456 624 y(a)h(union)g(of)h(t)n(w)n(o)f(solid)g(tori)g(with)h(b)r(oundaries) f(iden)n(ti\014ed)h(b)n(y)f(the)h(map)g FJ(f)9 b FQ(.)605 785 y(In)26 b(general,)f(the)h(spaces)e FJ(T)1457 797 y FM(1)1508 785 y FL([)1563 797 y FI(f)1621 785 y FJ(T)1670 797 y FM(2)1733 785 y FQ(obtained)h(b)n(y)g(gluing)g(t)n(w)n(o)g(solid) g(tori)h(are)e(called)h FO(lens)456 885 y(sp)l(ac)l(es)p FQ(,)e(see)f(e.g.)f([)p FK(PS)q FQ(].)35 b(Since)22 b(suc)n(h)f(a)h (lens)f(space)h(is)f(de\014ned)h(b)n(y)g(the)g(isotop)n(y)f(class)g(of) h FJ(f)9 b FQ(,)22 b(it)h(is)456 984 y(natural)e(to)g(study)h(the)h (group)d(of)i(isotop)n(y)f(classes)f(of)i(homeomorphisms)f(of)g(a)h (2-dimensional)456 1084 y(torus.)605 1245 y FP(Theorem)32 b FQ(4.1.3)p FP(.)40 b FO(L)l(et)20 b FJ(T)1432 1257 y FM(0)1490 1245 y FO(b)l(e)i(a)f(solid)i(torus.)35 b(Fix)22 b(a)g(standar)l(d)f(b)l(asis)h FJ(\013;)14 b(\014)26 b FO(of)40 b FQ(H)3134 1257 y FM(1)3171 1245 y FQ(\()p FJ(@)5 b(T)3301 1257 y FM(0)3338 1245 y FJ(;)14 b FH(Z)o FQ(\))p FO(,)456 1344 y(as)27 b(shown)i(in)e(Figur)l(e)h FQ(4.1)p FO(.)37 b FQ(\()p FO(Given)29 b(a)e(solid)i(torus)e FJ(T)2130 1356 y FM(0)2167 1344 y FO(,)i FJ(\013)e FO(is)h(de\014ne)l (d)g(uniquely)g(up)f(to)h(a)g(sign,)456 1444 y(but)h FJ(\014)34 b FO(is)c(not.)p FQ(\))38 b FO(Then)6 b FQ(:)605 1543 y(\(i\))26 b FO(F)-6 b(or)26 b(a)g(map)g FJ(f)18 b FQ(:)27 b FJ(@)5 b(T)1322 1555 y FM(0)1382 1543 y FL(!)23 b FJ(@)5 b(T)1586 1555 y FM(0)1622 1543 y FO(,)27 b(denote)f(by)g FJ(f)2080 1555 y FE(\003)2143 1543 y FO(its)g(action)g(in)f FQ(H)2663 1555 y FM(1)2701 1543 y FQ(\()p FJ(@)5 b(T)2831 1555 y FM(0)2868 1543 y FJ(;)14 b FH(Z)o FQ(\))j FL(')23 b FH(Z)3164 1513 y FM(2)3195 1543 y FO(.)38 b(Then)456 1643 y FJ(f)31 b FL(7!)23 b FJ(f)675 1655 y FE(\003)743 1643 y FO(is)30 b(an)f(isomorphism)j(of)e(the)g(gr)l(oup)g FQ(\000)1954 1655 y FM(1)p FI(;)p FM(0)2074 1643 y FO(of)g(isotopy)h (classes)f(of)h(home)l(omorphisms)456 1753 y FJ(@)5 b(T)554 1765 y FM(0)641 1706 y FE(\030)613 1753 y FL(\000)-39 b(!)23 b FJ(@)5 b(T)843 1765 y FM(0)909 1753 y FO(with)37 b FQ(SL)1194 1765 y FM(2)1231 1753 y FQ(\()p FH(Z)p FQ(\))p FO(.)1414 1723 y FM(1)605 1902 y FQ(\(ii\))25 b FO(The)g(home)l (omorphisms)h(of)f FJ(@)5 b(T)1738 1914 y FM(0)1799 1902 y FO(c)l(orr)l(esp)l(onding)25 b(to)f(the)g(matric)l(es)2871 1785 y Fy(\022)2933 1852 y FL(\000)p FQ(1)114 b(0)2965 1951 y(0)h FL(\000)p FQ(1)3228 1785 y Fy(\023)3313 1902 y FO(and)456 1993 y Fy(\022)517 2059 y FQ(1)82 b FJ(k)517 2159 y FQ(0)i(1)687 1993 y Fy(\023)778 2110 y FO(fr)l(om)30 b FQ(SL)1072 2122 y FM(2)1109 2110 y FQ(\()p FH(Z)p FQ(\))24 b(\()p FJ(k)i FL(2)e FH(Z)o FQ(\))g FO(c)l(an)30 b(b)l(e)g(extende)l(d) f(to)h(the)g(whole)h FJ(T)2664 2122 y FM(0)2701 2110 y FO(.)605 2320 y FP(Pr)n(oof.)41 b FQ(\(i\))25 b(F)-7 b(or)24 b(ev)n(ery)g FJ(f)9 b FQ(,)24 b(the)h(induced)h(automorphism)d FJ(f)2539 2332 y FE(\003)2602 2320 y FQ(of)h FJ(H)2762 2332 y FM(1)2800 2320 y FQ(\()p FJ(@)5 b(T)2930 2332 y FM(0)2966 2320 y FJ(;)14 b FH(Z)p FQ(\))19 b(preserv)n(es)456 2420 y(the)29 b(in)n(tersection)f(form.)40 b(Hence)29 b(the)g(matrix)g(of)f FJ(f)2079 2432 y FE(\003)2146 2420 y FQ(in)h(the)h(basis)e FJ(\013;)14 b(\014)33 b FQ(b)r(elongs)28 b(to)h(SL)3264 2432 y FM(2)3301 2420 y FQ(\()p FH(Z)p FQ(\).)456 2520 y(Surjectivit)n(y)f(of)h(this)g(map)g(is)g(ob)n(vious)e (if)j(w)n(e)e(write)h FJ(@)5 b(T)2248 2532 y FM(0)2310 2520 y FQ(=)24 b FH(R)2453 2489 y FM(2)2497 2520 y FJ(=)p FH(Z)2599 2489 y FM(2)2660 2520 y FQ(and)k(note)h(that)g(SL)3287 2532 y FM(2)3324 2520 y FQ(\()p FH(Z)p FQ(\))456 2619 y(acts)22 b(on)h FH(R)787 2589 y FM(2)830 2619 y FQ(;)h(injectivit)n(y) g(can)e(b)r(e)i(pro)n(v)n(ed)d(b)n(y)h(standard)g(top)r(ological)g (argumen)n(ts,)g(see)h(details)456 2719 y(in)k([)p FK(PS)q FQ(].)605 2868 y(\(ii\))g(The)g(homeomorphism)e(of)i FJ(T)1677 2880 y FM(0)1740 2868 y FQ(that)g(extends)g(the)g (transformation)2927 2751 y Fy(\022)2989 2818 y FQ(1)82 b FJ(k)2989 2917 y FQ(0)i(1)3159 2751 y Fy(\023)3247 2868 y FQ(is)26 b(the)456 3013 y(so-called)g FO(Dehn)k(twist)8 b FQ(:)37 b(cut)29 b(the)f(solid)f(torus)h FJ(T)1995 3025 y FM(0)2059 3013 y FQ(along)f(the)h(disk)g(with)h(b)r(oundary)e FJ(\013)p FQ(,)h(t)n(wist)456 3113 y(it)g FJ(k)i FQ(times)e(and)f(glue) h(it)g(bac)n(k)e(\(see)i(Figure)f(4.2)g(for)g FJ(k)f FQ(=)c(1\).)p 3384 3113 4 57 v 3388 3060 50 4 v 3388 3113 V 3437 3113 4 57 v 995 3871 a @beginspecial 0 @llx 0 @lly 101 @urx 68 @ury 1010 @rwi @setspecial %%BeginDocument: figures/torus1.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: torus1.eps %%Creator: fig2dev Version 3.2 Patchlevel 1 %%CreationDate: Mon Mar 27 14:46:21 2000 %%For: kirillov@copiague (Alexander Kirillov) %%Orientation: Portrait %%BoundingBox: 0 0 101 68 %%Pages: 0 %%BeginSetup %%EndSetup %%Magnification: 0.2300 %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -30.0 100.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n -1000 8218 m -1000 -1000 l 10472 -1000 l 10472 8218 l cp clip 0.01380 0.01380 sc 30.000 slw % Ellipse n 5849 4796 3600 2400 0 360 DrawEllipse gs col-1 s gr % Polyline 15.000 slw gs clippath 7752 4458 m 7997 4297 l 7837 4543 l 8088 4292 l 8003 4207 l cp clip n 7874 4421 m 8024 4271 l gs col-1 s gr gr % arrowhead n 7752 4458 m 7997 4297 l 7837 4543 l 7828 4467 l 7752 4458 l cp gs 0.00 setgray ef gr col-1 s % Polyline 30.000 slw gs clippath 6106 3378 m 5817 3318 l 6106 3258 l 5736 3258 l 5736 3378 l cp clip n 5856 3318 m 5781 3318 l gs col-1 s gr gr % arrowhead 15.000 slw n 6106 3378 m 5817 3318 l 6106 3258 l 6058 3318 l 6106 3378 l cp gs 0.00 setgray ef gr col-1 s % Polyline 30.000 slw n 3974 4721 m 3976 4723 l 3980 4727 l 3988 4734 l 3999 4745 l 4015 4761 l 4035 4780 l 4059 4802 l 4086 4828 l 4115 4855 l 4145 4884 l 4176 4913 l 4207 4941 l 4237 4969 l 4267 4995 l 4295 5020 l 4322 5044 l 4348 5066 l 4372 5086 l 4395 5105 l 4418 5122 l 4440 5139 l 4461 5154 l 4482 5169 l 4503 5183 l 4524 5196 l 4545 5209 l 4567 5222 l 4589 5234 l 4612 5246 l 4635 5259 l 4658 5270 l 4683 5282 l 4708 5293 l 4733 5305 l 4760 5316 l 4786 5326 l 4813 5336 l 4840 5346 l 4867 5356 l 4894 5365 l 4921 5374 l 4948 5382 l 4975 5389 l 5001 5396 l 5027 5403 l 5052 5409 l 5077 5415 l 5102 5420 l 5126 5425 l 5150 5429 l 5174 5434 l 5200 5438 l 5226 5441 l 5252 5445 l 5279 5448 l 5306 5451 l 5334 5454 l 5362 5457 l 5391 5459 l 5420 5461 l 5449 5463 l 5479 5464 l 5508 5466 l 5537 5467 l 5566 5468 l 5595 5469 l 5623 5469 l 5651 5470 l 5677 5470 l 5703 5471 l 5729 5471 l 5753 5471 l 5777 5471 l 5801 5471 l 5824 5471 l 5849 5471 l 5874 5471 l 5899 5471 l 5924 5471 l 5949 5471 l 5975 5470 l 6002 5470 l 6028 5470 l 6055 5469 l 6081 5468 l 6108 5468 l 6135 5467 l 6161 5465 l 6187 5464 l 6212 5462 l 6237 5461 l 6261 5459 l 6284 5457 l 6307 5454 l 6330 5452 l 6352 5449 l 6374 5446 l 6396 5443 l 6418 5439 l 6440 5435 l 6463 5431 l 6487 5426 l 6510 5422 l 6535 5416 l 6559 5411 l 6584 5405 l 6610 5399 l 6635 5393 l 6660 5386 l 6685 5379 l 6709 5373 l 6734 5366 l 6757 5360 l 6780 5353 l 6802 5346 l 6824 5340 l 6845 5334 l 6866 5327 l 6887 5321 l 6909 5314 l 6931 5307 l 6954 5300 l 6977 5292 l 7000 5285 l 7023 5276 l 7047 5268 l 7071 5259 l 7095 5249 l 7119 5239 l 7142 5229 l 7165 5218 l 7188 5207 l 7210 5196 l 7231 5184 l 7251 5172 l 7270 5160 l 7289 5147 l 7307 5134 l 7324 5121 l 7340 5108 l 7355 5095 l 7370 5080 l 7386 5065 l 7402 5048 l 7418 5029 l 7435 5009 l 7454 4986 l 7473 4962 l 7493 4936 l 7514 4908 l 7535 4880 l 7557 4851 l 7577 4822 l 7596 4796 l 7613 4773 l 7626 4753 l 7637 4739 l 7643 4729 l 7647 4724 l 7649 4721 l gs col-1 s gr % Polyline n 4124 4871 m 4126 4868 l 4130 4862 l 4136 4852 l 4146 4836 l 4159 4816 l 4174 4792 l 4191 4766 l 4208 4739 l 4226 4712 l 4244 4686 l 4261 4661 l 4277 4639 l 4292 4618 l 4306 4599 l 4320 4581 l 4334 4565 l 4347 4549 l 4360 4535 l 4374 4521 l 4388 4507 l 4402 4494 l 4417 4481 l 4433 4467 l 4449 4454 l 4466 4441 l 4484 4428 l 4502 4415 l 4521 4403 l 4540 4390 l 4559 4379 l 4578 4367 l 4598 4356 l 4617 4346 l 4635 4336 l 4654 4327 l 4672 4319 l 4689 4311 l 4707 4303 l 4724 4296 l 4741 4289 l 4759 4283 l 4776 4277 l 4795 4270 l 4813 4264 l 4833 4259 l 4853 4253 l 4873 4247 l 4894 4242 l 4915 4237 l 4936 4232 l 4958 4227 l 4979 4223 l 5000 4218 l 5021 4214 l 5042 4210 l 5063 4207 l 5083 4203 l 5104 4199 l 5124 4196 l 5143 4193 l 5162 4190 l 5182 4187 l 5203 4183 l 5224 4180 l 5247 4177 l 5270 4173 l 5293 4170 l 5318 4167 l 5343 4163 l 5368 4160 l 5394 4157 l 5420 4154 l 5446 4151 l 5472 4148 l 5498 4146 l 5524 4143 l 5549 4141 l 5574 4139 l 5599 4137 l 5624 4135 l 5649 4134 l 5672 4132 l 5696 4131 l 5719 4130 l 5744 4129 l 5769 4128 l 5795 4127 l 5821 4126 l 5848 4126 l 5875 4125 l 5903 4125 l 5930 4125 l 5958 4124 l 5986 4125 l 6013 4125 l 6040 4125 l 6066 4126 l 6092 4126 l 6116 4127 l 6141 4128 l 6164 4129 l 6186 4130 l 6208 4131 l 6229 4132 l 6249 4134 l 6273 4135 l 6296 4137 l 6319 4140 l 6343 4142 l 6366 4145 l 6389 4148 l 6412 4151 l 6435 4154 l 6458 4158 l 6481 4162 l 6504 4166 l 6526 4170 l 6548 4175 l 6569 4179 l 6590 4184 l 6610 4189 l 6629 4194 l 6649 4198 l 6668 4203 l 6687 4209 l 6706 4214 l 6725 4219 l 6745 4225 l 6765 4231 l 6786 4237 l 6808 4244 l 6830 4251 l 6852 4258 l 6875 4265 l 6897 4273 l 6920 4280 l 6942 4288 l 6964 4296 l 6985 4303 l 7006 4311 l 7026 4318 l 7045 4325 l 7064 4332 l 7082 4339 l 7099 4346 l 7118 4354 l 7137 4361 l 7155 4370 l 7174 4378 l 7193 4387 l 7212 4396 l 7230 4406 l 7249 4416 l 7267 4426 l 7285 4437 l 7302 4448 l 7318 4460 l 7334 4471 l 7348 4483 l 7362 4495 l 7375 4508 l 7387 4520 l 7399 4534 l 7410 4547 l 7421 4562 l 7432 4578 l 7443 4595 l 7454 4614 l 7466 4636 l 7478 4660 l 7491 4686 l 7504 4714 l 7518 4744 l 7531 4773 l 7544 4801 l 7555 4826 l 7563 4845 l 7569 4859 l 7572 4867 l 7574 4870 l 7574 4871 l gs col-1 s gr % Polyline 15.000 slw n 2924 4796 m 2924 4795 l 2925 4792 l 2927 4784 l 2930 4770 l 2934 4750 l 2940 4725 l 2946 4696 l 2954 4665 l 2961 4635 l 2968 4605 l 2976 4578 l 2983 4552 l 2989 4529 l 2996 4507 l 3003 4487 l 3009 4469 l 3017 4451 l 3024 4434 l 3032 4416 l 3040 4399 l 3049 4382 l 3059 4364 l 3069 4347 l 3081 4329 l 3093 4311 l 3105 4292 l 3118 4274 l 3132 4257 l 3146 4239 l 3160 4222 l 3175 4206 l 3190 4190 l 3204 4175 l 3219 4161 l 3234 4147 l 3249 4134 l 3263 4122 l 3277 4110 l 3292 4098 l 3308 4086 l 3324 4073 l 3341 4061 l 3358 4049 l 3376 4036 l 3395 4024 l 3413 4012 l 3432 4000 l 3450 3988 l 3469 3977 l 3487 3966 l 3505 3955 l 3522 3945 l 3539 3935 l 3555 3926 l 3571 3917 l 3587 3909 l 3604 3899 l 3621 3890 l 3638 3880 l 3656 3871 l 3674 3861 l 3692 3852 l 3711 3842 l 3730 3832 l 3749 3823 l 3768 3813 l 3787 3804 l 3806 3795 l 3824 3786 l 3842 3778 l 3860 3769 l 3877 3761 l 3894 3754 l 3912 3746 l 3927 3739 l 3943 3732 l 3959 3725 l 3976 3718 l 3994 3710 l 4012 3703 l 4031 3695 l 4050 3687 l 4070 3679 l 4090 3671 l 4110 3663 l 4131 3655 l 4151 3647 l 4171 3639 l 4191 3632 l 4210 3624 l 4230 3617 l 4249 3610 l 4268 3603 l 4287 3596 l 4306 3589 l 4325 3582 l 4345 3575 l 4365 3568 l 4387 3561 l 4409 3553 l 4431 3546 l 4455 3538 l 4478 3530 l 4502 3523 l 4527 3515 l 4551 3508 l 4575 3501 l 4599 3494 l 4623 3487 l 4646 3481 l 4669 3475 l 4692 3469 l 4714 3464 l 4737 3459 l 4757 3454 l 4778 3449 l 4799 3445 l 4821 3440 l 4843 3436 l 4866 3432 l 4890 3427 l 4915 3423 l 4940 3419 l 4966 3414 l 4992 3410 l 5018 3406 l 5044 3402 l 5071 3398 l 5097 3394 l 5123 3391 l 5149 3387 l 5174 3384 l 5199 3381 l 5224 3377 l 5249 3374 l 5274 3371 l 5297 3368 l 5321 3365 l 5345 3362 l 5369 3359 l 5395 3357 l 5421 3354 l 5448 3351 l 5475 3348 l 5504 3345 l 5533 3342 l 5562 3340 l 5592 3337 l 5622 3335 l 5652 3332 l 5682 3330 l 5711 3328 l 5741 3327 l 5770 3325 l 5798 3324 l 5827 3323 l 5855 3322 l 5882 3321 l 5909 3321 l 5937 3321 l 5962 3321 l 5987 3321 l 6013 3322 l 6039 3323 l 6066 3324 l 6093 3325 l 6121 3326 l 6149 3328 l 6178 3329 l 6207 3331 l 6237 3334 l 6266 3336 l 6296 3339 l 6325 3341 l 6354 3344 l 6383 3348 l 6411 3351 l 6439 3354 l 6466 3358 l 6492 3361 l 6518 3365 l 6543 3368 l 6567 3372 l 6591 3376 l 6614 3380 l 6637 3384 l 6661 3388 l 6685 3392 l 6709 3397 l 6733 3402 l 6757 3407 l 6782 3412 l 6807 3418 l 6832 3424 l 6858 3430 l 6883 3436 l 6909 3443 l 6935 3449 l 6960 3456 l 6986 3463 l 7011 3470 l 7036 3477 l 7061 3484 l 7085 3491 l 7109 3498 l 7132 3505 l 7155 3512 l 7178 3519 l 7201 3526 l 7224 3534 l 7247 3541 l 7271 3548 l 7294 3556 l 7319 3564 l 7344 3572 l 7370 3580 l 7396 3589 l 7423 3598 l 7451 3608 l 7479 3617 l 7507 3627 l 7535 3637 l 7563 3647 l 7591 3657 l 7618 3668 l 7645 3678 l 7671 3688 l 7697 3698 l 7722 3709 l 7746 3719 l 7770 3729 l 7793 3739 l 7815 3749 l 7837 3759 l 7860 3770 l 7883 3781 l 7906 3792 l 7929 3804 l 7952 3817 l 7975 3829 l 7998 3842 l 8022 3856 l 8045 3870 l 8068 3884 l 8090 3898 l 8113 3912 l 8134 3926 l 8155 3940 l 8176 3954 l 8196 3968 l 8215 3982 l 8233 3995 l 8250 4008 l 8267 4021 l 8283 4033 l 8299 4046 l 8316 4060 l 8333 4074 l 8350 4088 l 8367 4102 l 8384 4117 l 8400 4132 l 8417 4147 l 8434 4163 l 8451 4179 l 8467 4194 l 8483 4210 l 8498 4225 l 8513 4240 l 8527 4255 l 8541 4269 l 8554 4283 l 8566 4296 l 8578 4309 l 8588 4321 l 8599 4334 l 8612 4348 l 8624 4363 l 8636 4378 l 8648 4394 l 8660 4409 l 8671 4425 l 8682 4441 l 8692 4457 l 8702 4472 l 8711 4488 l 8719 4503 l 8727 4517 l 8733 4531 l 8739 4545 l 8744 4558 l 8749 4571 l 8754 4586 l 8757 4601 l 8761 4617 l 8764 4634 l 8766 4654 l 8768 4675 l 8770 4698 l 8771 4722 l 8772 4745 l 8773 4766 l 8774 4782 l 8774 4791 l 8774 4795 l 8774 4796 l gs col-1 s gr % Polyline [90] 0 sd n 7574 4871 m 7576 4874 l 7581 4881 l 7589 4892 l 7600 4908 l 7613 4927 l 7628 4948 l 7644 4969 l 7659 4989 l 7673 5008 l 7687 5026 l 7700 5042 l 7712 5056 l 7724 5070 l 7736 5083 l 7749 5096 l 7761 5107 l 7773 5119 l 7786 5131 l 7800 5143 l 7814 5155 l 7829 5168 l 7845 5181 l 7862 5194 l 7879 5207 l 7897 5220 l 7914 5232 l 7932 5244 l 7950 5256 l 7968 5268 l 7985 5278 l 8002 5289 l 8019 5299 l 8037 5309 l 8054 5318 l 8072 5327 l 8090 5337 l 8109 5346 l 8129 5355 l 8150 5364 l 8171 5373 l 8193 5382 l 8215 5391 l 8237 5399 l 8260 5407 l 8283 5414 l 8305 5421 l 8327 5427 l 8348 5432 l 8370 5437 l 8391 5442 l 8412 5446 l 8431 5449 l 8450 5452 l 8470 5455 l 8490 5457 l 8511 5459 l 8533 5461 l 8555 5462 l 8577 5463 l 8600 5464 l 8622 5464 l 8645 5464 l 8667 5463 l 8689 5462 l 8710 5461 l 8731 5459 l 8751 5457 l 8770 5455 l 8789 5452 l 8807 5449 l 8824 5446 l 8843 5442 l 8862 5437 l 8880 5432 l 8899 5427 l 8918 5421 l 8937 5414 l 8956 5407 l 8975 5399 l 8994 5391 l 9012 5382 l 9030 5373 l 9047 5364 l 9064 5355 l 9080 5346 l 9095 5337 l 9109 5327 l 9123 5318 l 9137 5309 l 9151 5298 l 9166 5286 l 9181 5274 l 9196 5262 l 9212 5248 l 9227 5234 l 9242 5220 l 9256 5205 l 9271 5190 l 9284 5174 l 9297 5159 l 9309 5144 l 9320 5128 l 9331 5113 l 9340 5098 l 9349 5084 l 9357 5068 l 9365 5052 l 9373 5036 l 9380 5018 l 9388 4997 l 9396 4975 l 9404 4951 l 9412 4925 l 9420 4897 l 9428 4870 l 9435 4845 l 9441 4824 l 9445 4809 l 9448 4800 l 9449 4797 l 9449 4796 l gs col-1 s gr [] 0 sd % Polyline n 7574 4796 m 7576 4793 l 7581 4786 l 7590 4775 l 7602 4759 l 7617 4739 l 7635 4716 l 7653 4692 l 7672 4667 l 7690 4644 l 7707 4622 l 7723 4602 l 7738 4583 l 7751 4566 l 7764 4551 l 7776 4536 l 7788 4522 l 7799 4509 l 7812 4494 l 7825 4479 l 7839 4464 l 7852 4449 l 7867 4433 l 7881 4418 l 7896 4403 l 7912 4389 l 7927 4374 l 7942 4361 l 7956 4348 l 7971 4336 l 7984 4325 l 7998 4314 l 8011 4305 l 8024 4296 l 8037 4288 l 8050 4280 l 8064 4272 l 8078 4264 l 8092 4257 l 8107 4250 l 8123 4243 l 8138 4237 l 8154 4231 l 8170 4225 l 8186 4219 l 8201 4214 l 8217 4209 l 8232 4205 l 8247 4200 l 8262 4196 l 8277 4192 l 8292 4187 l 8309 4183 l 8326 4178 l 8344 4174 l 8362 4169 l 8381 4165 l 8401 4160 l 8420 4156 l 8440 4152 l 8459 4148 l 8478 4144 l 8496 4141 l 8514 4138 l 8532 4136 l 8549 4134 l 8566 4131 l 8584 4130 l 8602 4128 l 8620 4127 l 8640 4127 l 8660 4127 l 8680 4127 l 8701 4128 l 8722 4130 l 8742 4132 l 8763 4135 l 8783 4138 l 8803 4142 l 8823 4147 l 8842 4152 l 8862 4159 l 8879 4165 l 8897 4171 l 8915 4179 l 8934 4187 l 8953 4196 l 8973 4205 l 8993 4215 l 9013 4226 l 9033 4237 l 9053 4248 l 9072 4260 l 9091 4271 l 9109 4282 l 9127 4293 l 9143 4304 l 9158 4314 l 9173 4324 l 9187 4334 l 9203 4346 l 9219 4358 l 9235 4370 l 9250 4382 l 9265 4395 l 9279 4408 l 9292 4421 l 9305 4434 l 9316 4447 l 9327 4460 l 9337 4472 l 9346 4484 l 9354 4496 l 9362 4509 l 9369 4521 l 9376 4534 l 9383 4549 l 9390 4565 l 9397 4583 l 9406 4603 l 9414 4625 l 9423 4648 l 9431 4671 l 9439 4692 l 9444 4707 l 9447 4716 l 9449 4720 l 9449 4721 l gs col-1 s gr % Polyline n 2924 4796 m 2924 4797 l 2925 4800 l 2927 4809 l 2931 4825 l 2937 4846 l 2944 4871 l 2951 4899 l 2959 4927 l 2966 4954 l 2974 4979 l 2980 5002 l 2987 5023 l 2993 5043 l 2999 5061 l 3005 5079 l 3012 5096 l 3017 5111 l 3024 5127 l 3030 5143 l 3037 5159 l 3045 5176 l 3053 5193 l 3062 5210 l 3071 5228 l 3081 5246 l 3091 5264 l 3102 5282 l 3113 5299 l 3125 5316 l 3136 5333 l 3148 5349 l 3161 5365 l 3173 5381 l 3187 5396 l 3199 5410 l 3212 5424 l 3225 5438 l 3240 5452 l 3255 5467 l 3272 5482 l 3289 5497 l 3307 5513 l 3326 5529 l 3345 5544 l 3365 5560 l 3385 5575 l 3406 5590 l 3426 5605 l 3447 5619 l 3467 5633 l 3488 5646 l 3508 5659 l 3529 5671 l 3549 5684 l 3568 5694 l 3587 5705 l 3607 5716 l 3628 5727 l 3649 5738 l 3671 5749 l 3694 5760 l 3717 5772 l 3741 5783 l 3765 5794 l 3790 5805 l 3815 5816 l 3840 5827 l 3864 5837 l 3889 5847 l 3913 5857 l 3937 5866 l 3960 5875 l 3983 5884 l 4005 5892 l 4027 5901 l 4049 5909 l 4071 5916 l 4093 5924 l 4115 5932 l 4138 5939 l 4162 5947 l 4185 5955 l 4210 5962 l 4234 5970 l 4259 5978 l 4285 5985 l 4310 5993 l 4335 6000 l 4360 6007 l 4384 6014 l 4409 6020 l 4432 6026 l 4455 6032 l 4477 6038 l 4499 6044 l 4520 6049 l 4541 6054 l 4562 6059 l 4584 6064 l 4606 6069 l 4629 6073 l 4652 6078 l 4675 6083 l 4699 6088 l 4723 6093 l 4748 6097 l 4773 6102 l 4797 6107 l 4822 6111 l 4846 6116 l 4870 6120 l 4894 6124 l 4917 6128 l 4939 6132 l 4961 6135 l 4982 6139 l 5003 6143 l 5024 6146 l 5045 6149 l 5066 6153 l 5087 6156 l 5108 6160 l 5131 6164 l 5153 6167 l 5176 6171 l 5200 6175 l 5224 6178 l 5247 6182 l 5271 6185 l 5294 6189 l 5317 6192 l 5340 6195 l 5361 6198 l 5383 6200 l 5403 6203 l 5423 6205 l 5442 6207 l 5462 6209 l 5480 6210 l 5499 6212 l 5518 6213 l 5538 6214 l 5558 6215 l 5578 6216 l 5598 6217 l 5619 6218 l 5640 6219 l 5662 6219 l 5683 6220 l 5704 6220 l 5725 6220 l 5745 6221 l 5765 6221 l 5785 6221 l 5805 6221 l 5824 6221 l 5843 6221 l 5862 6221 l 5881 6221 l 5900 6221 l 5920 6221 l 5940 6221 l 5962 6221 l 5983 6221 l 6006 6220 l 6029 6220 l 6052 6220 l 6076 6219 l 6099 6219 l 6123 6218 l 6147 6217 l 6170 6216 l 6192 6215 l 6215 6214 l 6236 6213 l 6257 6212 l 6278 6210 l 6299 6209 l 6320 6207 l 6341 6205 l 6362 6203 l 6384 6200 l 6406 6198 l 6429 6195 l 6452 6192 l 6476 6189 l 6500 6185 l 6524 6182 l 6548 6178 l 6572 6175 l 6596 6171 l 6619 6167 l 6642 6164 l 6664 6160 l 6686 6156 l 6707 6153 l 6728 6149 l 6749 6146 l 6770 6143 l 6791 6139 l 6812 6135 l 6834 6132 l 6856 6128 l 6879 6124 l 6902 6120 l 6926 6116 l 6950 6111 l 6974 6107 l 6998 6102 l 7022 6097 l 7046 6093 l 7069 6088 l 7092 6083 l 7114 6078 l 7136 6073 l 7157 6069 l 7178 6064 l 7199 6059 l 7218 6054 l 7237 6049 l 7256 6044 l 7276 6038 l 7296 6032 l 7316 6026 l 7338 6020 l 7359 6014 l 7381 6007 l 7403 6000 l 7426 5993 l 7448 5985 l 7471 5978 l 7493 5970 l 7515 5962 l 7537 5955 l 7558 5947 l 7580 5939 l 7600 5932 l 7621 5924 l 7641 5916 l 7662 5909 l 7682 5901 l 7703 5893 l 7724 5884 l 7745 5875 l 7767 5867 l 7790 5857 l 7813 5848 l 7836 5838 l 7859 5828 l 7883 5817 l 7906 5807 l 7929 5796 l 7952 5786 l 7974 5775 l 7996 5765 l 8017 5754 l 8037 5744 l 8056 5734 l 8074 5724 l 8091 5715 l 8108 5705 l 8124 5696 l 8143 5685 l 8161 5673 l 8179 5661 l 8196 5649 l 8214 5636 l 8231 5623 l 8248 5609 l 8265 5596 l 8281 5582 l 8297 5568 l 8313 5554 l 8328 5540 l 8343 5526 l 8357 5512 l 8371 5498 l 8385 5485 l 8398 5472 l 8412 5459 l 8425 5445 l 8439 5431 l 8453 5417 l 8468 5402 l 8483 5386 l 8498 5370 l 8514 5354 l 8530 5337 l 8546 5319 l 8561 5302 l 8576 5285 l 8591 5267 l 8604 5250 l 8617 5234 l 8630 5218 l 8641 5202 l 8652 5186 l 8662 5171 l 8672 5154 l 8682 5136 l 8691 5119 l 8700 5100 l 8708 5082 l 8716 5063 l 8723 5045 l 8730 5026 l 8736 5008 l 8741 4991 l 8746 4975 l 8750 4959 l 8753 4945 l 8757 4932 l 8759 4920 l 8762 4909 l 8765 4892 l 8767 4878 l 8769 4864 l 8771 4850 l 8772 4835 l 8773 4821 l 8773 4809 l 8774 4800 l 8774 4797 l 8774 4796 l gs col-1 s gr /Symbol ff 450.00 scf sf 4814 3236 m gs 1 -1 sc (b) col-1 sh gr /Symbol ff 450.00 scf sf 7829 4871 m gs 1 -1 sc (a) col-1 sh gr $F2psEnd rs %%EndDocument @endspecial 2026 3588 a FL(!)2298 3871 y @beginspecial 0 @llx 0 @lly 101 @urx 68 @ury 1010 @rwi @setspecial %%BeginDocument: figures/dehntw3.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: dehntw3.eps %%Creator: fig2dev Version 3.2 Patchlevel 1 %%CreationDate: Mon Mar 27 14:44:43 2000 %%For: kirillov@copiague (Alexander Kirillov) %%Orientation: Portrait %%BoundingBox: 0 0 101 68 %%Pages: 0 %%BeginSetup %%EndSetup %%Magnification: 0.2300 %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -30.0 100.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n -1000 8218 m -1000 -1000 l 10472 -1000 l 10472 8218 l cp clip 0.01380 0.01380 sc 30.000 slw % Ellipse n 5849 4796 3600 2400 0 360 DrawEllipse gs col-1 s gr % Polyline 15.000 slw gs clippath 7752 4458 m 7997 4297 l 7837 4543 l 8088 4292 l 8003 4207 l cp clip n 7874 4421 m 8024 4271 l gs col-1 s gr gr % arrowhead n 7752 4458 m 7997 4297 l 7837 4543 l 7828 4467 l 7752 4458 l cp gs 0.00 setgray ef gr col-1 s % Polyline 30.000 slw gs clippath 6106 3378 m 5817 3318 l 6106 3258 l 5736 3258 l 5736 3378 l cp clip n 5856 3318 m 5781 3318 l gs col-1 s gr gr % arrowhead 15.000 slw n 6106 3378 m 5817 3318 l 6106 3258 l 6058 3318 l 6106 3378 l cp gs 0.00 setgray ef gr col-1 s % Polyline 30.000 slw n 3974 4721 m 3976 4723 l 3980 4727 l 3988 4734 l 3999 4745 l 4015 4761 l 4035 4780 l 4059 4802 l 4086 4828 l 4115 4855 l 4145 4884 l 4176 4913 l 4207 4941 l 4237 4969 l 4267 4995 l 4295 5020 l 4322 5044 l 4348 5066 l 4372 5086 l 4395 5105 l 4418 5122 l 4440 5139 l 4461 5154 l 4482 5169 l 4503 5183 l 4524 5196 l 4545 5209 l 4567 5222 l 4589 5234 l 4612 5246 l 4635 5259 l 4658 5270 l 4683 5282 l 4708 5293 l 4733 5305 l 4760 5316 l 4786 5326 l 4813 5336 l 4840 5346 l 4867 5356 l 4894 5365 l 4921 5374 l 4948 5382 l 4975 5389 l 5001 5396 l 5027 5403 l 5052 5409 l 5077 5415 l 5102 5420 l 5126 5425 l 5150 5429 l 5174 5434 l 5200 5438 l 5226 5441 l 5252 5445 l 5279 5448 l 5306 5451 l 5334 5454 l 5362 5457 l 5391 5459 l 5420 5461 l 5449 5463 l 5479 5464 l 5508 5466 l 5537 5467 l 5566 5468 l 5595 5469 l 5623 5469 l 5651 5470 l 5677 5470 l 5703 5471 l 5729 5471 l 5753 5471 l 5777 5471 l 5801 5471 l 5824 5471 l 5849 5471 l 5874 5471 l 5899 5471 l 5924 5471 l 5949 5471 l 5975 5470 l 6002 5470 l 6028 5470 l 6055 5469 l 6081 5468 l 6108 5468 l 6135 5467 l 6161 5465 l 6187 5464 l 6212 5462 l 6237 5461 l 6261 5459 l 6284 5457 l 6307 5454 l 6330 5452 l 6352 5449 l 6374 5446 l 6396 5443 l 6418 5439 l 6440 5435 l 6463 5431 l 6487 5426 l 6510 5422 l 6535 5416 l 6559 5411 l 6584 5405 l 6610 5399 l 6635 5393 l 6660 5386 l 6685 5379 l 6709 5373 l 6734 5366 l 6757 5360 l 6780 5353 l 6802 5346 l 6824 5340 l 6845 5334 l 6866 5327 l 6887 5321 l 6909 5314 l 6931 5307 l 6954 5300 l 6977 5292 l 7000 5285 l 7023 5276 l 7047 5268 l 7071 5259 l 7095 5249 l 7119 5239 l 7142 5229 l 7165 5218 l 7188 5207 l 7210 5196 l 7231 5184 l 7251 5172 l 7270 5160 l 7289 5147 l 7307 5134 l 7324 5121 l 7340 5108 l 7355 5095 l 7370 5080 l 7386 5065 l 7402 5048 l 7418 5029 l 7435 5009 l 7454 4986 l 7473 4962 l 7493 4936 l 7514 4908 l 7535 4880 l 7557 4851 l 7577 4822 l 7596 4796 l 7613 4773 l 7626 4753 l 7637 4739 l 7643 4729 l 7647 4724 l 7649 4721 l gs col-1 s gr % Polyline n 4124 4871 m 4126 4868 l 4130 4862 l 4136 4852 l 4146 4836 l 4159 4816 l 4174 4792 l 4191 4766 l 4208 4739 l 4226 4712 l 4244 4686 l 4261 4661 l 4277 4639 l 4292 4618 l 4306 4599 l 4320 4581 l 4334 4565 l 4347 4549 l 4360 4535 l 4374 4521 l 4388 4507 l 4402 4494 l 4417 4481 l 4433 4467 l 4449 4454 l 4466 4441 l 4484 4428 l 4502 4415 l 4521 4403 l 4540 4390 l 4559 4379 l 4578 4367 l 4598 4356 l 4617 4346 l 4635 4336 l 4654 4327 l 4672 4319 l 4689 4311 l 4707 4303 l 4724 4296 l 4741 4289 l 4759 4283 l 4776 4277 l 4795 4270 l 4813 4264 l 4833 4259 l 4853 4253 l 4873 4247 l 4894 4242 l 4915 4237 l 4936 4232 l 4958 4227 l 4979 4223 l 5000 4218 l 5021 4214 l 5042 4210 l 5063 4207 l 5083 4203 l 5104 4199 l 5124 4196 l 5143 4193 l 5162 4190 l 5182 4187 l 5203 4183 l 5224 4180 l 5247 4177 l 5270 4173 l 5293 4170 l 5318 4167 l 5343 4163 l 5368 4160 l 5394 4157 l 5420 4154 l 5446 4151 l 5472 4148 l 5498 4146 l 5524 4143 l 5549 4141 l 5574 4139 l 5599 4137 l 5624 4135 l 5649 4134 l 5672 4132 l 5696 4131 l 5719 4130 l 5744 4129 l 5769 4128 l 5795 4127 l 5821 4126 l 5848 4126 l 5875 4125 l 5903 4125 l 5930 4125 l 5958 4124 l 5986 4125 l 6013 4125 l 6040 4125 l 6066 4126 l 6092 4126 l 6116 4127 l 6141 4128 l 6164 4129 l 6186 4130 l 6208 4131 l 6229 4132 l 6249 4134 l 6273 4135 l 6296 4137 l 6319 4140 l 6343 4142 l 6366 4145 l 6389 4148 l 6412 4151 l 6435 4154 l 6458 4158 l 6481 4162 l 6504 4166 l 6526 4170 l 6548 4175 l 6569 4179 l 6590 4184 l 6610 4189 l 6629 4194 l 6649 4198 l 6668 4203 l 6687 4209 l 6706 4214 l 6725 4219 l 6745 4225 l 6765 4231 l 6786 4237 l 6808 4244 l 6830 4251 l 6852 4258 l 6875 4265 l 6897 4273 l 6920 4280 l 6942 4288 l 6964 4296 l 6985 4303 l 7006 4311 l 7026 4318 l 7045 4325 l 7064 4332 l 7082 4339 l 7099 4346 l 7118 4354 l 7137 4361 l 7155 4370 l 7174 4378 l 7193 4387 l 7212 4396 l 7230 4406 l 7249 4416 l 7267 4426 l 7285 4437 l 7302 4448 l 7318 4460 l 7334 4471 l 7348 4483 l 7362 4495 l 7375 4508 l 7387 4520 l 7399 4534 l 7410 4547 l 7421 4562 l 7432 4578 l 7443 4595 l 7454 4614 l 7466 4636 l 7478 4660 l 7491 4686 l 7504 4714 l 7518 4744 l 7531 4773 l 7544 4801 l 7555 4826 l 7563 4845 l 7569 4859 l 7572 4867 l 7574 4870 l 7574 4871 l gs col-1 s gr % Polyline 15.000 slw [90] 0 sd n 7574 4871 m 7576 4874 l 7581 4881 l 7589 4892 l 7600 4908 l 7613 4927 l 7628 4948 l 7644 4969 l 7659 4989 l 7673 5008 l 7687 5026 l 7700 5042 l 7712 5056 l 7724 5070 l 7736 5083 l 7749 5096 l 7761 5107 l 7773 5119 l 7786 5131 l 7800 5143 l 7814 5155 l 7829 5168 l 7845 5181 l 7862 5194 l 7879 5207 l 7897 5220 l 7914 5232 l 7932 5244 l 7950 5256 l 7968 5268 l 7985 5278 l 8002 5289 l 8019 5299 l 8037 5309 l 8054 5318 l 8072 5327 l 8090 5337 l 8109 5346 l 8129 5355 l 8150 5364 l 8171 5373 l 8193 5382 l 8215 5391 l 8237 5399 l 8260 5407 l 8283 5414 l 8305 5421 l 8327 5427 l 8348 5432 l 8370 5437 l 8391 5442 l 8412 5446 l 8431 5449 l 8450 5452 l 8470 5455 l 8490 5457 l 8511 5459 l 8533 5461 l 8555 5462 l 8577 5463 l 8600 5464 l 8622 5464 l 8645 5464 l 8667 5463 l 8689 5462 l 8710 5461 l 8731 5459 l 8751 5457 l 8770 5455 l 8789 5452 l 8807 5449 l 8824 5446 l 8843 5442 l 8862 5437 l 8880 5432 l 8899 5427 l 8918 5421 l 8937 5414 l 8956 5407 l 8975 5399 l 8994 5391 l 9012 5382 l 9030 5373 l 9047 5364 l 9064 5355 l 9080 5346 l 9095 5337 l 9109 5327 l 9123 5318 l 9137 5309 l 9151 5298 l 9166 5286 l 9181 5274 l 9196 5262 l 9212 5248 l 9227 5234 l 9242 5220 l 9256 5205 l 9271 5190 l 9284 5174 l 9297 5159 l 9309 5144 l 9320 5128 l 9331 5113 l 9340 5098 l 9349 5084 l 9357 5068 l 9365 5052 l 9373 5036 l 9380 5018 l 9388 4997 l 9396 4975 l 9404 4951 l 9412 4925 l 9420 4897 l 9428 4870 l 9435 4845 l 9441 4824 l 9445 4809 l 9448 4800 l 9449 4797 l 9449 4796 l gs col-1 s gr [] 0 sd % Polyline n 7574 4796 m 7576 4793 l 7581 4786 l 7590 4775 l 7602 4759 l 7617 4739 l 7635 4716 l 7653 4692 l 7672 4667 l 7690 4644 l 7707 4622 l 7723 4602 l 7738 4583 l 7751 4566 l 7764 4551 l 7776 4536 l 7788 4522 l 7799 4509 l 7812 4494 l 7825 4479 l 7839 4464 l 7852 4449 l 7867 4433 l 7881 4418 l 7896 4403 l 7912 4389 l 7927 4374 l 7942 4361 l 7956 4348 l 7971 4336 l 7984 4325 l 7998 4314 l 8011 4305 l 8024 4296 l 8037 4288 l 8050 4280 l 8064 4272 l 8078 4264 l 8092 4257 l 8107 4250 l 8123 4243 l 8138 4237 l 8154 4231 l 8170 4225 l 8186 4219 l 8201 4214 l 8217 4209 l 8232 4205 l 8247 4200 l 8262 4196 l 8277 4192 l 8292 4187 l 8309 4183 l 8326 4178 l 8344 4174 l 8362 4169 l 8381 4165 l 8401 4160 l 8420 4156 l 8440 4152 l 8459 4148 l 8478 4144 l 8496 4141 l 8514 4138 l 8532 4136 l 8549 4134 l 8566 4131 l 8584 4130 l 8602 4128 l 8620 4127 l 8640 4127 l 8660 4127 l 8680 4127 l 8701 4128 l 8722 4130 l 8742 4132 l 8763 4135 l 8783 4138 l 8803 4142 l 8823 4147 l 8842 4152 l 8862 4159 l 8879 4165 l 8897 4171 l 8915 4179 l 8934 4187 l 8953 4196 l 8973 4205 l 8993 4215 l 9013 4226 l 9033 4237 l 9053 4248 l 9072 4260 l 9091 4271 l 9109 4282 l 9127 4293 l 9143 4304 l 9158 4314 l 9173 4324 l 9187 4334 l 9203 4346 l 9219 4358 l 9235 4370 l 9250 4382 l 9265 4395 l 9279 4408 l 9292 4421 l 9305 4434 l 9316 4447 l 9327 4460 l 9337 4472 l 9346 4484 l 9354 4496 l 9362 4509 l 9369 4521 l 9376 4534 l 9383 4549 l 9390 4565 l 9397 4583 l 9406 4603 l 9414 4625 l 9423 4648 l 9431 4671 l 9439 4692 l 9444 4707 l 9447 4716 l 9449 4720 l 9449 4721 l gs col-1 s gr % Polyline [90] 0 sd n 5925 5475 m 5926 5475 l 5930 5477 l 5939 5480 l 5954 5485 l 5975 5492 l 5998 5500 l 6021 5508 l 6043 5515 l 6063 5522 l 6081 5529 l 6097 5535 l 6112 5540 l 6125 5545 l 6138 5550 l 6150 5555 l 6162 5560 l 6174 5566 l 6186 5571 l 6198 5578 l 6211 5585 l 6223 5593 l 6235 5601 l 6247 5610 l 6259 5619 l 6270 5629 l 6280 5640 l 6290 5651 l 6300 5663 l 6309 5674 l 6317 5686 l 6326 5699 l 6336 5713 l 6345 5728 l 6355 5744 l 6365 5761 l 6375 5778 l 6385 5796 l 6395 5814 l 6405 5831 l 6414 5849 l 6424 5865 l 6433 5882 l 6441 5897 l 6450 5913 l 6459 5927 l 6467 5942 l 6476 5957 l 6486 5973 l 6495 5988 l 6505 6004 l 6515 6020 l 6525 6036 l 6535 6051 l 6545 6067 l 6555 6082 l 6564 6096 l 6574 6110 l 6583 6124 l 6591 6137 l 6600 6150 l 6609 6163 l 6617 6176 l 6627 6190 l 6636 6203 l 6646 6218 l 6656 6232 l 6667 6247 l 6678 6263 l 6690 6278 l 6702 6293 l 6714 6307 l 6726 6322 l 6738 6335 l 6750 6349 l 6762 6362 l 6775 6375 l 6787 6386 l 6799 6398 l 6812 6410 l 6826 6422 l 6840 6434 l 6855 6447 l 6871 6460 l 6888 6473 l 6905 6486 l 6923 6499 l 6940 6511 l 6958 6523 l 6976 6535 l 6994 6547 l 7011 6557 l 7028 6568 l 7045 6578 l 7063 6588 l 7080 6597 l 7098 6606 l 7116 6616 l 7135 6625 l 7155 6634 l 7176 6643 l 7197 6652 l 7219 6661 l 7241 6670 l 7263 6678 l 7286 6686 l 7309 6693 l 7331 6700 l 7353 6706 l 7374 6711 l 7396 6716 l 7417 6721 l 7438 6725 l 7459 6729 l 7480 6732 l 7502 6735 l 7525 6737 l 7548 6740 l 7572 6741 l 7596 6743 l 7621 6744 l 7645 6745 l 7669 6745 l 7692 6745 l 7714 6745 l 7735 6744 l 7756 6743 l 7775 6742 l 7793 6741 l 7809 6739 l 7825 6738 l 7844 6735 l 7862 6732 l 7879 6728 l 7896 6724 l 7914 6718 l 7932 6712 l 7951 6706 l 7970 6698 l 7988 6691 l 8003 6685 l 8015 6680 l 8022 6677 l 8025 6675 l gs col-1 s gr [] 0 sd % Polyline n 5700 5475 m 5697 5476 l 5689 5479 l 5676 5483 l 5657 5489 l 5632 5497 l 5603 5506 l 5570 5517 l 5536 5528 l 5502 5538 l 5468 5549 l 5437 5558 l 5407 5567 l 5379 5575 l 5353 5583 l 5328 5590 l 5305 5596 l 5282 5602 l 5260 5607 l 5238 5613 l 5217 5617 l 5196 5622 l 5175 5626 l 5153 5630 l 5130 5635 l 5107 5639 l 5083 5643 l 5058 5647 l 5032 5651 l 5006 5655 l 4979 5659 l 4952 5663 l 4924 5666 l 4896 5669 l 4868 5672 l 4841 5675 l 4813 5678 l 4785 5680 l 4758 5682 l 4730 5684 l 4703 5686 l 4675 5688 l 4651 5689 l 4626 5690 l 4601 5691 l 4575 5692 l 4549 5693 l 4521 5694 l 4493 5694 l 4464 5695 l 4435 5695 l 4405 5695 l 4374 5695 l 4343 5695 l 4313 5695 l 4282 5694 l 4251 5694 l 4220 5693 l 4190 5692 l 4161 5691 l 4132 5689 l 4104 5688 l 4076 5686 l 4050 5684 l 4024 5682 l 3999 5680 l 3974 5678 l 3950 5675 l 3922 5672 l 3895 5668 l 3867 5664 l 3840 5660 l 3812 5655 l 3785 5650 l 3757 5644 l 3729 5638 l 3702 5632 l 3675 5625 l 3648 5618 l 3622 5611 l 3596 5603 l 3571 5595 l 3547 5587 l 3523 5578 l 3501 5570 l 3479 5561 l 3458 5552 l 3438 5543 l 3419 5534 l 3400 5525 l 3380 5514 l 3359 5504 l 3339 5492 l 3318 5480 l 3298 5467 l 3278 5454 l 3257 5440 l 3237 5425 l 3217 5410 l 3198 5395 l 3179 5379 l 3161 5363 l 3144 5347 l 3127 5331 l 3112 5315 l 3098 5299 l 3084 5284 l 3072 5268 l 3061 5253 l 3050 5238 l 3039 5220 l 3029 5202 l 3019 5184 l 3010 5165 l 3001 5145 l 2993 5124 l 2986 5103 l 2979 5081 l 2973 5059 l 2968 5036 l 2963 5014 l 2959 4991 l 2956 4969 l 2954 4947 l 2952 4925 l 2951 4904 l 2950 4883 l 2950 4862 l 2950 4843 l 2950 4823 l 2951 4803 l 2953 4783 l 2954 4762 l 2956 4740 l 2959 4718 l 2962 4695 l 2965 4673 l 2969 4650 l 2973 4627 l 2978 4605 l 2983 4582 l 2988 4561 l 2993 4540 l 2999 4520 l 3005 4501 l 3011 4482 l 3017 4464 l 3024 4447 l 3032 4428 l 3040 4409 l 3049 4390 l 3059 4371 l 3070 4352 l 3081 4333 l 3093 4314 l 3105 4295 l 3118 4276 l 3132 4258 l 3146 4240 l 3160 4223 l 3175 4206 l 3190 4191 l 3204 4175 l 3219 4161 l 3234 4147 l 3249 4134 l 3263 4122 l 3277 4110 l 3292 4098 l 3308 4086 l 3324 4073 l 3341 4061 l 3358 4049 l 3376 4036 l 3395 4024 l 3413 4012 l 3432 4000 l 3450 3988 l 3469 3977 l 3487 3966 l 3505 3955 l 3522 3945 l 3539 3935 l 3555 3926 l 3571 3917 l 3587 3909 l 3604 3899 l 3621 3890 l 3638 3880 l 3656 3871 l 3674 3861 l 3692 3852 l 3711 3842 l 3730 3832 l 3749 3823 l 3768 3813 l 3787 3804 l 3806 3795 l 3824 3786 l 3842 3778 l 3860 3769 l 3877 3761 l 3894 3754 l 3912 3746 l 3927 3739 l 3943 3732 l 3959 3725 l 3976 3718 l 3994 3710 l 4012 3703 l 4031 3695 l 4050 3687 l 4070 3679 l 4090 3671 l 4110 3663 l 4131 3655 l 4151 3647 l 4171 3639 l 4191 3632 l 4210 3624 l 4230 3617 l 4249 3610 l 4268 3603 l 4287 3596 l 4306 3589 l 4325 3582 l 4345 3575 l 4365 3568 l 4387 3561 l 4409 3553 l 4431 3546 l 4455 3538 l 4478 3530 l 4502 3523 l 4527 3515 l 4551 3508 l 4575 3501 l 4599 3494 l 4623 3487 l 4646 3481 l 4669 3475 l 4692 3469 l 4714 3464 l 4737 3459 l 4757 3454 l 4778 3449 l 4799 3445 l 4821 3440 l 4843 3436 l 4866 3432 l 4890 3427 l 4915 3423 l 4940 3419 l 4966 3414 l 4992 3410 l 5018 3406 l 5044 3402 l 5071 3398 l 5097 3394 l 5123 3391 l 5149 3387 l 5174 3384 l 5199 3381 l 5224 3377 l 5249 3374 l 5274 3371 l 5297 3368 l 5321 3365 l 5345 3362 l 5369 3359 l 5395 3357 l 5421 3354 l 5448 3351 l 5475 3348 l 5504 3345 l 5533 3342 l 5562 3340 l 5592 3337 l 5622 3335 l 5652 3332 l 5682 3330 l 5711 3328 l 5741 3327 l 5770 3325 l 5798 3324 l 5827 3323 l 5855 3322 l 5882 3321 l 5909 3321 l 5937 3321 l 5962 3321 l 5987 3321 l 6013 3322 l 6039 3323 l 6066 3324 l 6093 3325 l 6121 3326 l 6149 3328 l 6178 3329 l 6207 3331 l 6237 3334 l 6266 3336 l 6296 3339 l 6325 3341 l 6354 3344 l 6383 3348 l 6411 3351 l 6439 3354 l 6466 3358 l 6492 3361 l 6518 3365 l 6543 3368 l 6567 3372 l 6591 3376 l 6614 3380 l 6637 3384 l 6661 3388 l 6685 3392 l 6709 3397 l 6733 3402 l 6757 3407 l 6782 3412 l 6807 3418 l 6832 3424 l 6858 3430 l 6883 3436 l 6909 3443 l 6935 3449 l 6960 3456 l 6986 3463 l 7011 3470 l 7036 3477 l 7061 3484 l 7085 3491 l 7109 3498 l 7132 3505 l 7155 3512 l 7178 3519 l 7201 3526 l 7224 3534 l 7247 3541 l 7271 3548 l 7294 3556 l 7319 3564 l 7344 3572 l 7370 3580 l 7396 3589 l 7423 3598 l 7451 3608 l 7479 3617 l 7507 3627 l 7535 3637 l 7563 3647 l 7591 3657 l 7618 3668 l 7645 3678 l 7671 3688 l 7697 3698 l 7722 3709 l 7746 3719 l 7770 3729 l 7793 3739 l 7815 3749 l 7837 3759 l 7860 3770 l 7883 3781 l 7906 3792 l 7929 3804 l 7952 3817 l 7975 3829 l 7998 3842 l 8022 3856 l 8045 3870 l 8068 3884 l 8090 3898 l 8113 3912 l 8134 3926 l 8155 3940 l 8176 3954 l 8196 3968 l 8215 3982 l 8233 3995 l 8250 4008 l 8267 4021 l 8283 4033 l 8299 4046 l 8316 4060 l 8333 4074 l 8350 4088 l 8367 4102 l 8384 4117 l 8400 4133 l 8417 4149 l 8434 4165 l 8451 4181 l 8467 4198 l 8483 4215 l 8498 4231 l 8513 4248 l 8528 4264 l 8541 4281 l 8554 4297 l 8566 4313 l 8578 4328 l 8589 4344 l 8599 4359 l 8610 4377 l 8621 4394 l 8632 4413 l 8643 4432 l 8653 4452 l 8664 4473 l 8674 4494 l 8683 4515 l 8693 4537 l 8701 4559 l 8710 4581 l 8717 4603 l 8724 4624 l 8730 4645 l 8736 4666 l 8741 4686 l 8746 4705 l 8750 4724 l 8753 4742 l 8756 4759 l 8759 4777 l 8761 4796 l 8763 4815 l 8765 4835 l 8766 4856 l 8767 4877 l 8768 4900 l 8768 4923 l 8768 4946 l 8767 4970 l 8766 4995 l 8765 5020 l 8763 5045 l 8761 5070 l 8759 5096 l 8756 5122 l 8753 5148 l 8750 5175 l 8747 5196 l 8744 5219 l 8741 5242 l 8738 5265 l 8734 5290 l 8730 5316 l 8725 5342 l 8721 5370 l 8716 5398 l 8711 5427 l 8705 5456 l 8699 5486 l 8693 5516 l 8687 5546 l 8680 5576 l 8674 5606 l 8667 5636 l 8660 5665 l 8652 5694 l 8645 5722 l 8638 5749 l 8631 5775 l 8623 5801 l 8616 5826 l 8608 5851 l 8600 5875 l 8591 5901 l 8582 5926 l 8573 5951 l 8563 5976 l 8553 6001 l 8543 6026 l 8532 6051 l 8521 6076 l 8509 6101 l 8497 6126 l 8485 6150 l 8473 6174 l 8461 6197 l 8449 6219 l 8437 6241 l 8425 6262 l 8413 6283 l 8401 6302 l 8390 6320 l 8379 6338 l 8368 6354 l 8358 6370 l 8348 6385 l 8338 6400 l 8324 6419 l 8311 6437 l 8298 6454 l 8284 6472 l 8269 6490 l 8253 6508 l 8237 6528 l 8219 6548 l 8200 6568 l 8181 6589 l 8162 6610 l 8144 6629 l 8128 6645 l 8116 6658 l 8107 6667 l 8102 6673 l 8100 6675 l gs col-1 s gr /Symbol ff 450.00 scf sf 4814 3236 m gs 1 -1 sc (b) col-1 sh gr /Symbol ff 450.00 scf sf 7829 4871 m gs 1 -1 sc (a) col-1 sh gr $F2psEnd rs %%EndDocument @endspecial 1488 4071 a FP(Figure)32 b(4.2.)41 b FQ(Dehn)28 b(t)n(wist.)605 4356 y(Let)g(us)f(also)g(remind)g(the)h(follo)n(wing)f (standard)g(fact:)605 4516 y FP(Theorem)32 b FQ(4.1.4)p FP(.)40 b FO(The)30 b(gr)l(oup)g FQ(SL)1744 4528 y FM(2)1782 4516 y FQ(\()p FH(Z)o FQ(\))24 b FO(is)30 b(gener)l(ate)l(d)h(by)f(the) g(elements)1349 4720 y FJ(s)23 b FQ(=)1498 4603 y Fy(\022)1559 4670 y FQ(0)83 b FL(\000)p FQ(1)1559 4769 y(1)115 b(0)1790 4603 y Fy(\023)1865 4720 y FJ(;)184 b(t)23 b FQ(=)2212 4603 y Fy(\022)2273 4670 y FQ(1)83 b(1)2273 4769 y(0)g(1)2439 4603 y Fy(\023)2514 4720 y FJ(;)456 4929 y FO(with)30 b(the)g(de\014ning)g(r)l(elations)g FJ(s)1465 4899 y FM(4)1525 4929 y FQ(=)23 b(1)p FJ(;)14 b FQ(\()p FJ(st)p FQ(\))1825 4899 y FM(3)1885 4929 y FQ(=)23 b FJ(s)2012 4899 y FM(2)2049 4929 y FO(.)p 456 5039 499 4 v 605 5107 a Fp(1)640 5130 y Fo(The)35 b(notation)i(\000)1134 5139 y Fp(1)p Fn(;)p Fp(0)1253 5130 y Fo(is)d(c)n(hosen)i(b)r(ecause)h (later)e(w)n(e)g(will)f(in)n(tro)r(duce)i(more)e(general)h(groups)g (\000)3331 5138 y Fn(g)r(;n)3425 5130 y Fo(,)456 5216 y(corresp)r(onding)24 b(to)g(surfaces)g(of)f(gen)n(us)h Fm(g)i Fo(with)e Fm(n)f Fo(b)r(oundary)i(comp)r(onen)n(ts.)p eop %%Page: 74 4 74 77 bop 456 226 a FM(74)404 b(4.)29 b(3-DIMENSIONAL)g(TOPOLOGICAL)h (QUANTUM)f(FIELD)g(THEOR)-5 b(Y)605 425 y FQ(Let)24 b(us)f(restrict)g (our)f(atten)n(tion)h(to)h(3-manifolds.)34 b(In)24 b(this)f(case,)h (there)f(are)f(t)n(w)n(o)h(classical)456 525 y(constructions)31 b(allo)n(wing)f(to)i(get)g(an)n(y)f(manifold)h(b)n(y)g(gluing)f(of)h (simpler)g(pieces:)45 b(Heegaard)456 624 y(splitting)24 b(and)f(surgery)g(along)f(links.)36 b(The)24 b(approac)n(h)e(of)h(this) i(c)n(hapter)e(is)g(based)h(on)f(surgery;)456 724 y(the)28 b(Heegaard)d(splitting)j(will)g(b)r(e)g(discussed)f(later.)605 864 y FP(Definition)32 b FQ(4.1.5)p FP(.)40 b FQ(Let)35 b FJ(L)g FQ(b)r(e)g(a)g(link)g(in)g FJ(S)2090 834 y FM(3)2127 864 y FQ(.)60 b(Denote)35 b(b)n(y)g FJ(T)2674 876 y FI(i)2736 864 y FQ(some)g(small)g(tubular)456 964 y(neigh)n(b)r(orho)r(o)r(d)d (of)h(the)h FJ(i)p FQ(-th)f(comp)r(onen)n(t)g(of)g FJ(L)p FQ(.)53 b(Eac)n(h)32 b FJ(T)2324 976 y FI(i)2385 964 y FQ(is)h(a)g(solid)g(torus.)53 b(Let)33 b FJ(T)3214 976 y FM(0)3284 964 y FQ(b)r(e)h(a)456 1064 y(\014xed)d(standard)g (solid)g(torus.)49 b(Supp)r(ose)32 b(w)n(e)f(are)g(giv)n(en)g(\(orien)n (tation)f(preserving\))g(homeo-)456 1170 y(morphisms)e FJ(f)919 1182 y FI(i)956 1170 y FQ(:)g FJ(@)5 b(T)1105 1182 y FI(i)1186 1123 y FE(\030)1158 1170 y FL(\000)-40 b(!)26 b FJ(@)5 b(T)1390 1182 y FM(0)1427 1170 y FQ(.)42 b(De\014ne)29 b(a)g(new)h(3-manifold)e FJ(M)2489 1182 y FI(L;f)2597 1170 y FQ(,)i(called)f(a)g FO(sur)l(gery)36 b FQ(of)29 b FJ(S)3407 1140 y FM(3)456 1270 y FQ(along)d(the)i(link)g FJ(L)p FQ(,)f(b)n(y)g(the)h(form)n(ula)1317 1404 y FJ(M)1398 1416 y FI(L;f)1529 1404 y FQ(:=)1639 1337 y Fy(\000)1677 1404 y FJ(S)1733 1370 y FM(3)1789 1404 y FL(n)18 b FQ(\()p FL([)1936 1416 y FI(i)1964 1404 y FJ(T)2025 1370 y FM(in)n(t)2013 1425 y FI(i)2108 1404 y FQ(\))2140 1337 y Fy(\001)2197 1404 y FL([)2252 1416 y FI(f)2284 1424 y FG(i)2333 1404 y FQ(\()p FJ(T)2414 1416 y FM(0)2451 1404 y FQ(\))2483 1370 y FI(N)2546 1404 y FJ(;)-2113 b FQ(\(4.1.1\))456 1539 y(where)27 b FJ(N)36 b FQ(is)28 b(the)g(n)n(um)n(b)r(er)f(of)g (comp)r(onen)n(ts)h(of)f FJ(L)g FQ(and)h(\\in)n(t)o(")g(denotes)f(in)n (terior.)605 1639 y(In)f(other)f(w)n(ords,)g(w)n(e)h(are)f(cutting)h (from)f FJ(S)1974 1609 y FM(3)2037 1639 y FQ(a)h(n)n(um)n(b)r(er)f(of)h (solid)f(tori)h(\(p)r(ossibly)f(link)n(ed\))456 1739 y(and)i(pasting)g(instead)h(new)f(solid)g(tori,)g(but)i(p)r(ossibly)e (in)h(some)f(t)n(wisted)g(w)n(a)n(y)-7 b(.)605 1879 y FP(Theorem)32 b FQ(4.1.6)p FP(.)40 b FO(A)n(ny)25 b(c)l(onne)l(cte)l(d) g(close)l(d)i(3-manifold)h(c)l(an)e(b)l(e)f(obtaine)l(d)i(as)f(a)g(sur) l(gery)456 1978 y(of)k FJ(S)609 1948 y FM(3)676 1978 y FO(along)g(a)h(link.)605 2119 y FQ(Note)h(that)h(the)g(de\014nition)f (ab)r(o)n(v)n(e)f(requires)g(that)i(w)n(e)f(sp)r(ecify)g(not)h(only)f (the)g(link)h(but)456 2218 y(also)i(the)i(attac)n(hmen)n(t)f(maps)g FJ(f)1497 2230 y FI(i)1524 2218 y FQ(.)63 b(Our)36 b(next)g(observ)-5 b(ation)35 b(is)i(that)f(there)g(is)h(a)f(canonical)456 2318 y(w)n(a)n(y)d(to)h(construct)g FJ(f)1152 2330 y FI(i)1214 2318 y FQ(if)h(the)g(link)f(is)h(framed)f(\(=)g(ribb)r(on\).) 58 b(Let)34 b FJ(L)h FQ(b)r(e)f(a)g(framed)h(link)f(in)456 2418 y FJ(S)512 2387 y FM(3)578 2418 y FQ(whic)n(h)29 b(is)g(directed,)g(i.e.,)h(eac)n(h)e(comp)r(onen)n(t)h(of)g FJ(L)g FQ(has)f(an)h(arro)n(w.)39 b(Let)29 b FJ(T)2935 2430 y FI(i)2992 2418 y FQ(b)r(e)g(a)g(tubular)456 2517 y(neigh)n(b)r(orho)r(o)r(d)f(of)h(the)h FJ(i)p FQ(th)f(comp)r(onen)n (t,)h(as)f(b)r(efore.)42 b(Then)30 b(the)f(link)h FJ(L)f FQ(determines)g(cycles)456 2617 y FJ(\013)509 2629 y FI(i)536 2617 y FQ(,)39 b FJ(\014)645 2629 y FI(i)708 2617 y FQ(in)e FJ(@)5 b(T)912 2629 y FI(i)938 2617 y FQ(.)63 b(Instead)35 b(of)h(giving)f(the)i(formal)e(de\014nition,)k(w)n (e)c(dra)n(w)g(a)h(picture)g(|)g(see)456 2716 y(Figure)27 b(4.3,)f(where)h(the)h(cycle)g FJ(\014)1510 2728 y FI(i)1565 2716 y FQ(winds)g(the)g(same)f(w)n(a)n(y)f(as)h(the)h FJ(i)p FQ(th)g(comp)r(onen)n(t)f(of)h FJ(L)p FQ(.)1746 3810 y @beginspecial 0 @llx 0 @lly 49 @urx 114 @ury 490 @rwi @setspecial %%BeginDocument: figures/aibi.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: aibi.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Wed Mar 22 12:27:59 2000 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 49 114 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -56.0 127.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc 15.000 slw % Polyline gs clippath 6690 3117 m 6750 2829 l 6810 3117 l 6810 2745 l 6690 2745 l cp clip n 6750 3300 m 6750 2775 l gs col-1 s gr gr % arrowhead n 6690 3117 m 6750 2829 l 6810 3117 l 6750 3069 l 6690 3117 l cp gs 0.00 setgray ef gr col-1 s 30.000 slw % Polyline [133.3] 0 sd n 6300 2325 m 6300 1800 l gs col-1 s gr [] 0 sd % Polyline [133.3] 0 sd n 7200 2325 m 7200 1800 l gs col-1 s gr [] 0 sd 15.000 slw % Polyline gs clippath 6283 9834 m 6547 9961 l 6254 9950 l 6615 10040 l 6644 9924 l cp clip n 6300 9900 m 6600 9975 l gs col-1 s gr gr % arrowhead n 6283 9834 m 6547 9961 l 6254 9950 l 6315 9904 l 6283 9834 l cp gs 0.00 setgray ef gr col-1 s % Polyline gs clippath 5226 3568 m 5192 3276 l 5340 3530 l 5222 3178 l 5109 3216 l cp clip n 5250 3450 m 5175 3225 l gs col-1 s gr gr % arrowhead n 5226 3568 m 5192 3276 l 5340 3530 l 5268 3504 l 5226 3568 l cp gs 0.00 setgray ef gr col-1 s % Open spline gs 30.000 slw n 5100.0 1725.0 m 4837.5 3525.0 l 4837.5 3525.0 4575.0 5325.0 4837.5 7275.0 DrawSplineSection 5100.0 9225.0 l gs col-1 s gr gr % Open spline gs n 8690.0 1725.0 m 8427.5 3525.0 l 8427.5 3525.0 8165.0 5325.0 8427.5 7275.0 DrawSplineSection 8690.0 9225.0 l gs col-1 s gr gr % Open spline gs n 5100.0 1800.0 m 5250.0 1612.5 l 5250.0 1612.5 5400.0 1425.0 5625.0 1350.0 DrawSplineSection 5625.0 1350.0 5850.0 1275.0 6112.5 1200.0 DrawSplineSection 6112.5 1200.0 6375.0 1125.0 6600.0 1125.0 DrawSplineSection 6600.0 1125.0 6825.0 1125.0 7162.5 1162.5 DrawSplineSection 7162.5 1162.5 7500.0 1200.0 7800.0 1237.5 DrawSplineSection 7800.0 1237.5 8100.0 1275.0 8287.5 1387.5 DrawSplineSection 8287.5 1387.5 8475.0 1500.0 8587.5 1612.5 DrawSplineSection 8700.0 1725.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 5100.0 9225.0 m 5250.0 9037.5 l 5250.0 9037.5 5400.0 8850.0 5625.0 8775.0 DrawSplineSection 5625.0 8775.0 5850.0 8700.0 6112.5 8625.0 DrawSplineSection 6112.5 8625.0 6375.0 8550.0 6600.0 8550.0 DrawSplineSection 6600.0 8550.0 6825.0 8550.0 7162.5 8587.5 DrawSplineSection 7162.5 8587.5 7500.0 8625.0 7800.0 8662.5 DrawSplineSection 7800.0 8662.5 8100.0 8700.0 8287.5 8812.5 DrawSplineSection 8287.5 8812.5 8475.0 8925.0 8587.5 9037.5 DrawSplineSection 8700.0 9150.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 6600.0 4275.0 m 6487.5 4500.0 l 6487.5 4500.0 6375.0 4725.0 6262.5 5062.5 DrawSplineSection 6262.5 5062.5 6150.0 5400.0 6187.5 5812.5 DrawSplineSection 6187.5 5812.5 6225.0 6225.0 6600.0 6825.0 DrawSplineSection 6600.0 6825.0 6975.0 7425.0 7087.5 7725.0 DrawSplineSection 7087.5 7725.0 7200.0 8025.0 7200.0 8737.5 DrawSplineSection 7200.0 9450.0 l gs col-1 s gr gr % Open spline gs n 6525.0 7050.0 m 6412.5 7350.0 l 6412.5 7350.0 6300.0 7650.0 6300.0 7875.0 DrawSplineSection 6300.0 7875.0 6300.0 8100.0 6300.0 8775.0 DrawSplineSection 6300.0 9450.0 l gs col-1 s gr gr % Open spline gs n 5100.0 1800.0 m 5212.5 1950.0 l 5212.5 1950.0 5325.0 2100.0 5550.0 2212.5 DrawSplineSection 5550.0 2212.5 5775.0 2325.0 6037.5 2400.0 DrawSplineSection 6037.5 2400.0 6300.0 2475.0 6525.0 2512.5 DrawSplineSection 6525.0 2512.5 6750.0 2550.0 7050.0 2512.5 DrawSplineSection 7050.0 2512.5 7350.0 2475.0 7575.0 2437.5 DrawSplineSection 7575.0 2437.5 7800.0 2400.0 7987.5 2325.0 DrawSplineSection 7987.5 2325.0 8175.0 2250.0 8362.5 2175.0 DrawSplineSection 8362.5 2175.0 8550.0 2100.0 8625.0 1950.0 DrawSplineSection 8700.0 1800.0 l gs col-1 s gr gr % Open spline gs n 7200.0 2700.0 m 7200.0 2925.0 l 7200.0 2925.0 7200.0 3150.0 7012.5 3562.5 DrawSplineSection 6825.0 3975.0 l gs col-1 s gr gr % Open spline gs n 5100.0 9225.0 m 5212.5 9375.0 l 5212.5 9375.0 5325.0 9525.0 5550.0 9637.5 DrawSplineSection 5550.0 9637.5 5775.0 9750.0 6037.5 9825.0 DrawSplineSection 6037.5 9825.0 6300.0 9900.0 6562.5 9937.5 DrawSplineSection 6562.5 9937.5 6825.0 9975.0 7087.5 9937.5 DrawSplineSection 7087.5 9937.5 7350.0 9900.0 7575.0 9862.5 DrawSplineSection 7575.0 9862.5 7800.0 9825.0 7987.5 9750.0 DrawSplineSection 7987.5 9750.0 8175.0 9675.0 8362.5 9600.0 DrawSplineSection 8362.5 9600.0 8550.0 9525.0 8625.0 9375.0 DrawSplineSection 8700.0 9225.0 l gs col-1 s gr gr % Open spline gs n 8325.0 5475.0 m 8250.0 5400.0 l 8250.0 5400.0 8175.0 5325.0 8062.5 5287.5 DrawSplineSection 8062.5 5287.5 7950.0 5250.0 7800.0 5212.5 DrawSplineSection 7800.0 5212.5 7650.0 5175.0 7312.5 5100.0 DrawSplineSection 7312.5 5100.0 6975.0 5025.0 6787.5 4987.5 DrawSplineSection 6787.5 4987.5 6600.0 4950.0 6375.0 4837.5 DrawSplineSection 6375.0 4837.5 6150.0 4725.0 5962.5 4612.5 DrawSplineSection 5962.5 4612.5 5775.0 4500.0 5587.5 4237.5 DrawSplineSection 5587.5 4237.5 5400.0 3975.0 5212.5 3300.0 DrawSplineSection 5212.5 3300.0 5025.0 2625.0 5062.5 2212.5 DrawSplineSection 5100.0 1800.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 5100.0 9225.0 m 5100.0 8625.0 l 5100.0 8625.0 5100.0 8025.0 5212.5 7537.5 DrawSplineSection 5212.5 7537.5 5325.0 7050.0 5737.5 6750.0 DrawSplineSection 5737.5 6750.0 6150.0 6450.0 6525.0 6337.5 DrawSplineSection 6525.0 6337.5 6900.0 6225.0 7200.0 6112.5 DrawSplineSection 7200.0 6112.5 7500.0 6000.0 7650.0 5962.5 DrawSplineSection 7650.0 5962.5 7800.0 5925.0 7875.0 5887.5 DrawSplineSection 7875.0 5887.5 7950.0 5850.0 8025.0 5812.5 DrawSplineSection 8025.0 5812.5 8100.0 5775.0 8212.5 5700.0 DrawSplineSection 8212.5 5700.0 8325.0 5625.0 8325.0 5587.5 DrawSplineSection 8325.0 5550.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 6300.0 2700.0 m 6300.0 3225.0 l 6300.0 3225.0 6300.0 3750.0 6675.0 4125.0 DrawSplineSection 6675.0 4125.0 7050.0 4500.0 7125.0 4912.5 DrawSplineSection 7125.0 4912.5 7200.0 5325.0 7200.0 5700.0 DrawSplineSection 7200.0 5700.0 7200.0 6075.0 7012.5 6412.5 DrawSplineSection 6825.0 6750.0 l gs col-1 s gr gr /Symbol ff 600.00 scf sf 5400 3375 m gs 1 -1 sc (b) col-1 sh gr /Symbol ff 600.00 scf sf 6225 10425 m gs 1 -1 sc (a) col-1 sh gr /Times-Italic ff 375.00 scf sf 5700 3450 m gs 1 -1 sc (i) col-1 sh gr /Times-Italic ff 375.00 scf sf 6600 10500 m gs 1 -1 sc (i) col-1 sh gr $F2psEnd rs %%EndDocument @endspecial 754 4011 a FP(Figure)k(4.3.)40 b FQ(A)27 b(ribb)r(on)f(link)h(and)g(the)g(corresp)r(onding)d(cycles)i FJ(\013)2897 4023 y FI(i)2925 4011 y FQ(,)h FJ(\014)3022 4023 y FI(i)3076 4011 y FQ(in)754 4110 y(its)h(tubular)g(neigh)n(b)r (orho)r(o)r(d.)605 4297 y(Let)23 b FJ(f)790 4309 y FI(i)827 4297 y FQ(:)28 b FJ(@)5 b(T)976 4309 y FI(i)1054 4250 y FE(\030)1025 4297 y FL(\000)-39 b(!)23 b FJ(@)5 b(T)1255 4309 y FM(0)1315 4297 y FQ(b)r(e)23 b(the)h(homeomorphism)e(whic)n(h)h (sends)f(the)i(cycle)f FJ(\013)3024 4309 y FI(i)3075 4297 y FQ(to)g FL(\000)p FJ(\014)k FQ(and)456 4396 y FJ(\014)503 4408 y FI(i)558 4396 y FQ(to)g FJ(\013)p FQ(.)38 b(\(By)27 b(Theorem)g(4.1.3,)f(suc)n(h)i FJ(f)1736 4408 y FI(i)1791 4396 y FQ(exists)f(and)g(is)h(unique)g(up)g(to)f (isotop)n(y)-7 b(.\))605 4537 y FP(Definition)32 b FQ(4.1.7)p FP(.)40 b FQ(Let)f FJ(L)g FQ(b)r(e)h(a)f(directed)g(framed)g(link)h(in) f FJ(S)2737 4506 y FM(3)2774 4537 y FQ(.)73 b(Then)39 b(w)n(e)g(de\014ne)456 4636 y FJ(M)537 4648 y FI(L)609 4636 y FQ(=)23 b FJ(M)778 4648 y FI(L;f)876 4656 y FG(i)931 4636 y FQ(to)j(b)r(e)h(the)f(surgery)e(of)i FJ(S)1725 4606 y FM(3)1789 4636 y FQ(along)e(the)j(link)f FJ(L)g FQ(with)g(the)h(attac)n(hmen)n(t)e(maps)h FJ(f)3417 4648 y FI(i)456 4736 y FQ(describ)r(ed)h(ab)r(o)n(v)n(e.)605 4876 y FP(Lemma)k FQ(4.1.8)p FP(.)40 b FJ(M)1234 4888 y FI(L)1318 4876 y FO(do)l(es)c(not)e(dep)l(end)i(on)f(the)g(choic)l(e) h(of)g(dir)l(e)l(ctions)f(of)h(the)f(c)l(omp)l(o-)456 4976 y(nents)28 b(of)j FJ(L)p FO(.)605 5116 y FP(Pr)n(oof.)41 b FQ(F)-7 b(ollo)n(ws)28 b(from)g(the)i(fact)f(that)g FJ(\013)d FL(7!)f(\000)p FJ(\013)p FQ(,)k FJ(\014)h FL(7!)25 b(\000)p FJ(\014)33 b FQ(can)c(b)r(e)g(extended)g(to)g(the)456 5216 y(whole)e FJ(T)740 5228 y FM(0)804 5216 y FQ(\(see)h(Theorem)f (4.1.3\(ii\)\).)p 3384 5216 4 57 v 3388 5163 50 4 v 3388 5216 V 3437 5216 4 57 v eop %%Page: 75 5 75 78 bop 1381 226 a FM(4.1.)29 b(INV)-7 b(ARIANTS)30 b(OF)e(3-MANIF)n(OLDS)837 b(75)605 425 y FQ(This)28 b(construction)e (giv)n(es)h(a)g(3-manifold)g FJ(M)2037 437 y FI(L)2114 425 y FQ(for)g(an)n(y)g(framed)g(link)h FJ(L)f FQ(in)h FJ(S)3078 395 y FM(3)3115 425 y FQ(.)605 570 y FP(Theorem)k FQ(4.1.9)p FP(.)40 b FO(A)n(ny)20 b(c)l(onne)l(cte)l(d)h(c)l(omp)l(act) h(oriente)l(d)g(3-manifold)i FJ(M)29 b FO(without)22 b(b)l(ound-)456 670 y(ary)30 b(c)l(an)g(b)l(e)g(obtaine)l(d)h(as)f FJ(M)1374 682 y FI(L)1453 670 y FO(for)g(some)g(fr)l(ame)l(d)h(link)f FJ(L)f FO(in)h FJ(S)2475 639 y FM(3)2512 670 y FO(.)605 814 y FP(Examples)h FQ(4.1.10)p FP(.)39 b FQ(\(i\))29 b(When)f FJ(L)22 b FQ(=)h FL(;)k FQ(is)h(the)g(empt)n(y)f(link,)h(then) g FJ(M)k FQ(=)22 b FJ(S)3021 784 y FM(3)3058 814 y FQ(.)605 914 y(\(ii\))33 b(Let)g FJ(L)e FQ(=)g FL(\015)i FQ(\(no)f(t)n (wisting\).)52 b(Then,)34 b(b)n(y)f(Example)e(4.1.2\(ii\),)j FJ(S)2861 884 y FM(3)2920 914 y FL(n)21 b FJ(T)3032 926 y FM(1)3100 914 y FQ(=)31 b FJ(T)3245 926 y FM(2)3314 914 y FQ(is)i(a)456 1014 y(solid)23 b(torus.)35 b(Then)23 b(gluing)g FJ(T)1396 1026 y FM(0)1457 1014 y FQ(and)g FJ(T)1663 1026 y FM(2)1723 1014 y FQ(w)n(e)h(obtain)f FJ(M)2177 1026 y FI(L)2249 1014 y FQ(=)g FJ(S)2393 983 y FM(2)2440 1014 y FL(\002)10 b FJ(S)2571 983 y FM(1)2632 1014 y FQ(as)23 b(in)g(Example)g(4.1.2\(i\).)605 1122 y(\(iii\))32 b(When)g FJ(L)c FQ(=)h FL(\015)1278 1092 y FM(1)1344 1122 y FQ(=)1438 1201 y @beginspecial 0 @llx 0 @lly 18 @urx 19 @ury 180 @rwi @setspecial %%BeginDocument: figures/frame1.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: frame1.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Mon Mar 31 11:04:04 1997 %%For: bakalov@schauder (Bojko Bakalov) %Magnification: 0.05 %%Orientation: Portrait %%BoundingBox: 0 0 18 19 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -5.0 24.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.00300 0.00300 sc % Open spline gs 60.000 slw n 7125.0 4350.0 m 7350.0 4537.5 l 7350.0 4537.5 7575.0 4725.0 7575.0 5175.0 DrawSplineSection 7575.0 5175.0 7575.0 5625.0 7275.0 5812.5 DrawSplineSection 7275.0 5812.5 6975.0 6000.0 6675.0 6187.5 DrawSplineSection 6675.0 6187.5 6375.0 6375.0 5925.0 6562.5 DrawSplineSection 5925.0 6562.5 5475.0 6750.0 4950.0 6712.5 DrawSplineSection 4950.0 6712.5 4425.0 6675.0 4050.0 6525.0 DrawSplineSection 4050.0 6525.0 3675.0 6375.0 3375.0 6000.0 DrawSplineSection 3375.0 6000.0 3075.0 5625.0 3037.5 5137.5 DrawSplineSection 3037.5 5137.5 3000.0 4650.0 3112.5 4275.0 DrawSplineSection 3112.5 4275.0 3225.0 3900.0 3562.5 3562.5 DrawSplineSection 3562.5 3562.5 3900.0 3225.0 4275.0 3112.5 DrawSplineSection 4275.0 3112.5 4650.0 3000.0 5100.0 3037.5 DrawSplineSection 5100.0 3037.5 5550.0 3075.0 5812.5 3375.0 DrawSplineSection 6075.0 3675.0 l gs col-1 s gr gr % Open spline gs n 7350.0 6450.0 m 7500.0 6712.5 l 7500.0 6712.5 7650.0 6975.0 7162.5 7312.5 DrawSplineSection 7162.5 7312.5 6675.0 7650.0 6150.0 7800.0 DrawSplineSection 6150.0 7800.0 5625.0 7950.0 5137.5 7950.0 DrawSplineSection 5137.5 7950.0 4650.0 7950.0 4012.5 7800.0 DrawSplineSection 4012.5 7800.0 3375.0 7650.0 2925.0 7312.5 DrawSplineSection 2925.0 7312.5 2475.0 6975.0 2212.5 6487.5 DrawSplineSection 2212.5 6487.5 1950.0 6000.0 1875.0 5287.5 DrawSplineSection 1875.0 5287.5 1800.0 4575.0 1950.0 4012.5 DrawSplineSection 1950.0 4012.5 2100.0 3450.0 2550.0 2887.5 DrawSplineSection 2550.0 2887.5 3000.0 2325.0 3600.0 2137.5 DrawSplineSection 3600.0 2137.5 4200.0 1950.0 4800.0 1950.0 DrawSplineSection 4800.0 1950.0 5400.0 1950.0 6037.5 2212.5 DrawSplineSection 6037.5 2212.5 6675.0 2475.0 6900.0 2775.0 DrawSplineSection 6900.0 2775.0 7125.0 3075.0 7237.5 3375.0 DrawSplineSection 7237.5 3375.0 7350.0 3675.0 6637.5 4087.5 DrawSplineSection 6637.5 4087.5 5925.0 4500.0 5962.5 4912.5 DrawSplineSection 5962.5 4912.5 6000.0 5325.0 6187.5 5475.0 DrawSplineSection 6375.0 5625.0 l gs col-1 s gr gr $F2psEnd rs %%EndDocument @endspecial 1619 1122 a(\(framing)i(1\),)h(then)f FJ(M)2364 1134 y FI(L)2443 1122 y FQ(=)d FJ(S)2592 1092 y FM(3)2629 1122 y FQ(.)48 b(This)31 b(is)g(b)n(y)g(no)g(means)456 1272 y(ob)n(vious;)24 b(w)n(e)f(lea)n(v)n(e)g(it)h(as)g(an)g(exercise)e (to)i(the)h(reader)d(to)i(deduce)h(it)f(from)g(Example)f(4.1.2\(ii\)) 456 1371 y(and)k(Theorem)g(4.1.3\(ii\).)605 1516 y(The)35 b(next)g(question)f(is)g(when)h(t)n(w)n(o)f(di\013eren)n(t)h(links)f FJ(L)h FQ(and)f FJ(L)2647 1486 y FE(0)2705 1516 y FQ(in)h FJ(S)2865 1486 y FM(3)2936 1516 y FQ(giv)n(e)f(the)h(same)456 1615 y(3-manifold.)59 b(The)36 b(answ)n(er)e(\(highly)h(non-trivial\))g (w)n(as)f(found)i(b)n(y)f(Kirb)n(y)-7 b(.)59 b(W)-7 b(e)36 b(presen)n(t)f(it)456 1715 y(here)27 b(in)h(a)f(form)g(due)h(to)f(F)-7 b(enn)28 b(and)g(Rourk)n(e)e(\(see)i([)p FK(PS)p FQ(])g(and)f (references)g(therein\).)605 1860 y FP(Theorem)32 b FQ(4.1.11)d(\(Kirb) n(y)e(calculus\))p FP(.)41 b FJ(M)1989 1872 y FI(L)2061 1860 y FL(')23 b FJ(M)2230 1872 y FI(L)2276 1856 y Fx(0)2325 1860 y FO(i\013)i FJ(L)2483 1830 y FE(0)2529 1860 y FO(c)l(an)f(b)l(e)g (obtaine)l(d)h(fr)l(om)g FJ(L)e FO(by)456 1959 y(a)30 b(se)l(quenc)l(e)h(of)49 b FQ(Kirb)n(y{F)-7 b(enn{Rourk)n(e)25 b(mo)n(v)n(es)k FO(shown)i(in)g(Figur)l(e)f FQ(4.4)g FO(b)l(elow)h(and)g(the)g(same)456 2059 y(with)i(over)l(cr)l(ossing)g (and)g(under)l(cr)l(ossing)g(inter)l(change)l(d.)47 b FQ(\()p FO(The)34 b(numb)l(er)d(of)j(str)l(ands)e(c)l(an)g(b)l(e)456 2159 y(arbitr)l(ary,)f(including)g(zer)l(o.)p FQ(\))1008 3164 y @beginspecial 0 @llx 0 @lly 226 @urx 102 @ury 2260 @rwi @setspecial %%BeginDocument: figures/kirbymv.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: kirbymv.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Fri Mar 28 18:03:17 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 226 102 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -23.0 116.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc 30.000 slw % Polyline n 4800 1200 m 4800 6600 l gs col-1 s gr % Polyline n 6000 1200 m 6000 6600 l gs col-1 s gr % Polyline n 3600 1200 m 3600 6450 l gs col-1 s gr % Polyline n 4800 7125 m 4800 9600 l gs col-1 s gr % Polyline n 6000 6975 m 6000 9600 l gs col-1 s gr % Polyline n 3600 6825 m 3600 9600 l gs col-1 s gr % Polyline gs clippath 10887 5310 m 11319 5400 l 10887 5490 l 11445 5490 l 11445 5310 l cp clip 10263 5490 m 9831 5400 l 10263 5310 l 9705 5310 l 9705 5490 l cp clip n 9750 5400 m 11400 5400 l gs col-1 s gr gr % arrowhead n 10263 5490 m 9831 5400 l 10263 5310 l 10191 5400 l 10263 5490 l cp gs 0.00 setgray ef gr col-1 s % arrowhead n 10887 5310 m 11319 5400 l 10887 5490 l 10959 5400 l 10887 5310 l cp gs 0.00 setgray ef gr col-1 s % Open spline gs n 3825.0 3975.0 m 4012.5 3937.5 l 4012.5 3937.5 4200.0 3900.0 4387.5 3900.0 DrawSplineSection 4575.0 3900.0 l gs col-1 s gr gr % Open spline gs n 5025.0 3825.0 m 5212.5 3825.0 l 5212.5 3825.0 5400.0 3825.0 5587.5 3862.5 DrawSplineSection 5775.0 3900.0 l gs col-1 s gr gr % Open spline gs n 8175.0 5100.0 m 8250.0 5250.0 l 8250.0 5250.0 8325.0 5400.0 8250.0 5737.5 DrawSplineSection 8250.0 5737.5 8175.0 6075.0 7837.5 6300.0 DrawSplineSection 7837.5 6300.0 7500.0 6525.0 6975.0 6637.5 DrawSplineSection 6975.0 6637.5 6450.0 6750.0 5962.5 6825.0 DrawSplineSection 5962.5 6825.0 5475.0 6900.0 4800.0 6862.5 DrawSplineSection 4800.0 6862.5 4125.0 6825.0 3262.5 6525.0 DrawSplineSection 3262.5 6525.0 2400.0 6225.0 2100.0 5775.0 DrawSplineSection 2100.0 5775.0 1800.0 5325.0 2212.5 4875.0 DrawSplineSection 2212.5 4875.0 2625.0 4425.0 3000.0 4275.0 DrawSplineSection 3375.0 4125.0 l gs col-1 s gr gr % Open spline gs n 6150.0 3975.0 m 6450.0 4012.5 l 6450.0 4012.5 6750.0 4050.0 7237.5 4200.0 DrawSplineSection 7237.5 4200.0 7725.0 4350.0 7950.0 4612.5 DrawSplineSection 7950.0 4612.5 8175.0 4875.0 7950.0 5325.0 DrawSplineSection 7950.0 5325.0 7725.0 5775.0 7462.5 5775.0 DrawSplineSection 7462.5 5775.0 7200.0 5775.0 7050.0 5512.5 DrawSplineSection 7050.0 5512.5 6900.0 5250.0 7012.5 4950.0 DrawSplineSection 7012.5 4950.0 7125.0 4650.0 7387.5 4650.0 DrawSplineSection 7387.5 4650.0 7650.0 4650.0 7762.5 4762.5 DrawSplineSection 7875.0 4875.0 l gs col-1 s gr gr % Open spline gs n 15600.0 1200.0 m 15600.0 2212.5 l 15600.0 2212.5 15600.0 3225.0 15750.0 3862.5 DrawSplineSection 15750.0 3862.5 15900.0 4500.0 16237.5 4950.0 DrawSplineSection 16237.5 4950.0 16575.0 5400.0 16875.0 5475.0 DrawSplineSection 16875.0 5475.0 17175.0 5550.0 17550.0 5437.5 DrawSplineSection 17550.0 5437.5 17925.0 5325.0 18000.0 4912.5 DrawSplineSection 18000.0 4912.5 18075.0 4500.0 17850.0 4312.5 DrawSplineSection 17850.0 4312.5 17625.0 4125.0 17250.0 4162.5 DrawSplineSection 17250.0 4162.5 16875.0 4200.0 16612.5 4425.0 DrawSplineSection 16350.0 4650.0 l gs col-1 s gr gr % Open spline gs n 14400.0 1200.0 m 14400.0 2212.5 l 14400.0 2212.5 14400.0 3225.0 14587.5 3937.5 DrawSplineSection 14587.5 3937.5 14775.0 4650.0 15112.5 5250.0 DrawSplineSection 15112.5 5250.0 15450.0 5850.0 16012.5 6187.5 DrawSplineSection 16012.5 6187.5 16575.0 6525.0 17137.5 6525.0 DrawSplineSection 17137.5 6525.0 17700.0 6525.0 18225.0 6225.0 DrawSplineSection 18225.0 6225.0 18750.0 5925.0 19125.0 5362.5 DrawSplineSection 19125.0 5362.5 19500.0 4800.0 19462.5 4200.0 DrawSplineSection 19462.5 4200.0 19425.0 3600.0 18937.5 3262.5 DrawSplineSection 18937.5 3262.5 18450.0 2925.0 17887.5 2925.0 DrawSplineSection 17887.5 2925.0 17325.0 2925.0 16875.0 3112.5 DrawSplineSection 16875.0 3112.5 16425.0 3300.0 16200.0 3450.0 DrawSplineSection 15975.0 3600.0 l gs col-1 s gr gr % Open spline gs n 13200.0 1200.0 m 13200.0 2175.0 l 13200.0 2175.0 13200.0 3150.0 13387.5 3975.0 DrawSplineSection 13387.5 3975.0 13575.0 4800.0 13987.5 5512.5 DrawSplineSection 13987.5 5512.5 14400.0 6225.0 14925.0 6712.5 DrawSplineSection 14925.0 6712.5 15450.0 7200.0 16125.0 7425.0 DrawSplineSection 16125.0 7425.0 16800.0 7650.0 17550.0 7537.5 DrawSplineSection 17550.0 7537.5 18300.0 7425.0 18862.5 7087.5 DrawSplineSection 18862.5 7087.5 19425.0 6750.0 19912.5 6150.0 DrawSplineSection 19912.5 6150.0 20400.0 5550.0 20550.0 4837.5 DrawSplineSection 20550.0 4837.5 20700.0 4125.0 20587.5 3487.5 DrawSplineSection 20587.5 3487.5 20475.0 2850.0 19950.0 2512.5 DrawSplineSection 19950.0 2512.5 19425.0 2175.0 18712.5 2025.0 DrawSplineSection 18712.5 2025.0 18000.0 1875.0 17475.0 1912.5 DrawSplineSection 17475.0 1912.5 16950.0 1950.0 16387.5 2250.0 DrawSplineSection 15825.0 2550.0 l gs col-1 s gr gr % Open spline gs n 15975.0 5025.0 m 15862.5 5137.5 l 15862.5 5137.5 15750.0 5250.0 15637.5 5400.0 DrawSplineSection 15525.0 5550.0 l gs col-1 s gr gr % Open spline gs n 15300.0 5925.0 m 15187.5 6075.0 l 15187.5 6075.0 15075.0 6225.0 15037.5 6337.5 DrawSplineSection 15000.0 6450.0 l gs col-1 s gr gr % Open spline gs n 14700.0 6825.0 m 14550.0 7200.0 l 14550.0 7200.0 14400.0 7575.0 14400.0 8100.0 DrawSplineSection 14400.0 8100.0 14400.0 8625.0 14400.0 9112.5 DrawSplineSection 14400.0 9600.0 l gs col-1 s gr gr % Open spline gs n 15525.0 3900.0 m 15375.0 4050.0 l 15375.0 4050.0 15225.0 4200.0 15112.5 4387.5 DrawSplineSection 15000.0 4575.0 l gs col-1 s gr gr % Open spline gs n 14700.0 4875.0 m 14587.5 5025.0 l 14587.5 5025.0 14475.0 5175.0 14400.0 5325.0 DrawSplineSection 14325.0 5475.0 l gs col-1 s gr gr % Open spline gs n 13950.0 6000.0 m 13687.5 6487.5 l 13687.5 6487.5 13425.0 6975.0 13350.0 7650.0 DrawSplineSection 13350.0 7650.0 13275.0 8325.0 13275.0 8962.5 DrawSplineSection 13275.0 9600.0 l gs col-1 s gr gr % Open spline gs n 15375.0 2775.0 m 15225.0 2925.0 l 15225.0 2925.0 15075.0 3075.0 14887.5 3300.0 DrawSplineSection 14700.0 3525.0 l gs col-1 s gr gr % Open spline gs n 14400.0 3750.0 m 14250.0 3937.5 l 14250.0 3937.5 14100.0 4125.0 13950.0 4350.0 DrawSplineSection 13800.0 4575.0 l gs col-1 s gr gr % Open spline gs n 13425.0 4875.0 m 13162.5 5250.0 l 13162.5 5250.0 12900.0 5625.0 12675.0 6262.5 DrawSplineSection 12675.0 6262.5 12450.0 6900.0 12375.0 7500.0 DrawSplineSection 12375.0 7500.0 12300.0 8100.0 12300.0 8850.0 DrawSplineSection 12300.0 9600.0 l gs col-1 s gr gr $F2psEnd rs %%EndDocument @endspecial 1200 3365 a FP(Figure)h(4.4.)41 b FQ(Kirb)n(y{F)-7 b(enn{Rourk)n(e)24 b(mo)n(v)n(es.)605 3597 y(The)k(pro)r(of)f(of)g (this)h(theorem)f(is)h(quite)g(di\016cult)g(and)f(will)h(not)g(b)r(e)g (giv)n(en)f(here.)605 3742 y FP(Theorem)32 b FQ(4.1.12)d (\(Reshetikhin{T)-7 b(uraev)27 b([)p FK(R)-8 b(T2)p FQ(]\))p FP(.)41 b FO(L)l(et)e FL(C)k FO(b)l(e)c(a)g(MTC)h(and)g FJ(L)e FO(b)l(e)h(a)456 3841 y(fr)l(ame)l(d)30 b(link)g(in)g FH(R)1045 3811 y FM(3)1112 3841 y FL(\032)22 b FJ(S)1255 3811 y FM(3)1292 3841 y FO(.)39 b(De\014ne)29 b(the)h(numb)l(er)f FJ(\034)9 b FQ(\()p FJ(M)2210 3853 y FI(L)2260 3841 y FQ(\))30 b FO(by)g(the)g(formula)1220 4050 y FJ(\034)9 b FQ(\()p FJ(M)1378 4062 y FI(L)1428 4050 y FQ(\))23 b(:=)g FJ(D)1665 4016 y FE(\000j)p FI(L)p FE(j\000)p FM(1)1891 4050 y FJ(F)1956 4016 y FE(\000)p FM(1)2045 4050 y FQ(\()p FJ(L)p FQ(\))2180 3933 y Fy(\022)2252 3994 y FJ(p)2294 3964 y FM(+)p 2251 4031 98 4 v 2251 4107 a FJ(p)2293 4083 y FE(\000)2359 3933 y Fy(\023)2420 3949 y FI(\033)r FM(\()p FI(L)p FM(\))p FI(=)p FM(2)2643 4050 y FJ(;)-2210 b FQ(\(4.1.2\))456 4239 y FO(wher)l(e)32 b FL(j)p FJ(L)p FL(j)f FO(is)h(the)g(numb)l(er)f(of)h(c)l(omp)l(onents) g(of)g FJ(L)p FO(,)g FJ(D)i FO(is)e(fr)l(om)39 b FQ(\(3.1.15\))n FO(,)33 b FJ(p)2892 4208 y FE(\006)2979 4239 y FO(fr)l(om)39 b FQ(\(3.1.7\))o FO(,)456 4338 y FJ(\033)s FQ(\()p FJ(L)p FQ(\))26 b FO(is)f(the)h(so-c)l(al)t(le)l(d)h(wr)l(e)l(ath)f(numb)l(er) e(of)j FJ(L)e FQ(\()p FO(se)l(e)g FQ([)p FK(R)-8 b(T2)p FQ(])26 b FO(for)g(its)f(de\014nition)6 b FQ(\))p FO(,)28 b(and)e FJ(F)3234 4308 y FE(\000)p FM(1)3323 4338 y FQ(\()p FJ(L)p FQ(\))456 4438 y FO(is)j(the)g(R)l(eshetikhin{T)-6 b(ur)l(aev)31 b(invariant)f(of)g(the)f(link)h FJ(L)f FO(fr)l(om)g(The)l(or)l(em)h FQ(2.3.11)e(\()p FO(we)h(use)g(the)456 4537 y(c)l(onvention)45 b FQ(\(3.1.4\))o(:)57 b FO(we)39 b(take)g(sum)f(over)i(al)t(l)g(p)l(ossible)g(lab)l(elings)g(of)g(unc)l (olor)l(e)l(d)f(str)l(ands,)456 4637 y(with)30 b(lab)l(eling)h FJ(V)981 4649 y FI(i)1039 4637 y FO(taken)f(with)g(weight)h FJ(d)1742 4649 y FI(i)1769 4637 y FQ(\))p FO(.)605 4737 y(Then)g FJ(\034)9 b FQ(\()p FJ(M)980 4749 y FI(L)1030 4737 y FQ(\))30 b FO(is)g(an)g(invariant)h(of)g(the)f(3-manifold)i FJ(M)2393 4749 y FI(L)2442 4737 y FO(,)e(i.e.,)i(it)e(do)l(es)h(not)e (dep)l(end)i(on)456 4836 y(the)f(link)g FJ(L)p FQ(:)1344 4971 y FJ(\034)9 b FQ(\()p FJ(M)1502 4983 y FI(L)1552 4971 y FQ(\))23 b(=)g FJ(\034)9 b FQ(\()p FJ(M)1853 4983 y FI(L)1899 4967 y Fx(0)1925 4971 y FQ(\))86 b FO(if)47 b FJ(M)2221 4983 y FI(L)2293 4971 y FL(')23 b FJ(M)2462 4983 y FI(L)2508 4967 y Fx(0)2533 4971 y FJ(:)605 5116 y FQ(This)42 b(in)n(v)-5 b(arian)n(t)41 b(can)g(b)r(e)i(de\014ned)f (for)f(an)h(arbitrary)e(3-manifold)h FJ(M)50 b FQ(and)42 b(is)g(called)456 5216 y FO(R)l(eshetikhin{T)-6 b(ur)l(aev)31 b(invariant)8 b FQ(.)p eop %%Page: 76 6 76 79 bop 456 226 a FM(76)404 b(4.)29 b(3-DIMENSIONAL)g(TOPOLOGICAL)h (QUANTUM)f(FIELD)g(THEOR)-5 b(Y)605 425 y FP(Pr)n(oof.)41 b FQ(If)21 b(w)n(e)g(assume)g(that)g FJ(p)1621 395 y FM(+)1676 425 y FJ(=p)1760 395 y FE(\000)1839 425 y FQ(=)h(1,)g(then)g (the)g(pro)r(of)e(immediately)i(follo)n(ws)e(from)456 525 y(Lemma)30 b(3.1.5.)46 b(The)31 b(general)f(case)g(is)h(not)g(m)n (uc)n(h)g(more)f(di\016cult;)k(w)n(e)c(refer)h(the)g(reader)f(to)456 624 y(the)e(original)e(pap)r(ers)h(for)g(details.)p 3384 624 4 57 v 3388 572 50 4 v 3388 624 V 3437 624 4 57 v 605 789 a FP(Examples)k FQ(4.1.13)p FP(.)39 b FQ(\(i\))29 b FJ(\034)9 b FQ(\()p FJ(S)1564 759 y FM(3)1601 789 y FQ(\))24 b(=)e FJ(D)1815 759 y FE(\000)p FM(1)1905 789 y FQ(,)27 b(cf.)h(4.1.10\(i\).)605 888 y(\(ii\))g FJ(\034)9 b FQ(\()p FJ(S)876 858 y FM(2)933 888 y FL(\002)18 b FJ(S)1072 858 y FM(1)1109 888 y FQ(\))23 b(=)g FJ(\034)9 b FQ(\()p FJ(M)1410 900 y FE(\015)1481 888 y FQ(\))23 b(=)g FJ(F)1689 858 y FE(\000)p FM(1)1778 888 y FQ(\()p FL(\015)p FQ(\))p FJ(D)1996 858 y FE(\000)p FM(2)2108 888 y FQ(=)g(1,)k(cf.)h(4.1.10\(ii\))f(and)g(\(3.1.20\))o(.)605 1044 y FP(Remark)32 b FQ(4.1.14)p FP(.)39 b FQ(One)32 b(easily)g(sees)g(that)g(if)h FJ(L)2153 1056 y FM(1)2190 1044 y FJ(;)14 b(L)2284 1056 y FM(2)2353 1044 y FQ(are)32 b(t)n(w)n(o)f(links)i(in)f FH(R)3015 1014 y FM(3)3091 1044 y FQ(whic)n(h)g(are)456 1144 y(not)25 b(link)n(ed)g(with)g(eac)n (h)f(other)h(\(i.e.,)h(they)f(can)g(b)r(e)g(separated)f(b)n(y)h(a)f (plane\),)i(then)f FJ(M)3152 1156 y FI(L)3198 1164 y FF(1)3230 1156 y FE(t)p FI(L)3321 1164 y FF(2)3380 1144 y FQ(=)456 1243 y FJ(M)537 1255 y FI(L)583 1263 y FF(1)618 1243 y FQ(#)p FJ(M)768 1255 y FI(L)814 1263 y FF(2)850 1243 y FQ(,)h(where)f(w)n(e)g(denote)g(b)n(y)g(#)h(the)f(connected)h (sum.)36 b(Th)n(us,)25 b(R)-7 b(T)26 b(in)n(v)-5 b(arian)n(ts)24 b(satisfy)456 1343 y(the)k(follo)n(wing)e(m)n(ultiplicativit)n(y)i (prop)r(ert)n(y:)1405 1488 y FJ(\034)9 b FQ(\()p FJ(M)1563 1500 y FM(1)1601 1488 y FQ(#)p FJ(M)1751 1500 y FM(2)1788 1488 y FQ(\))23 b(=)g FJ(D)16 b(\034)9 b FQ(\()p FJ(M)2174 1500 y FM(1)2211 1488 y FQ(\))p FJ(\034)g FQ(\()p FJ(M)2401 1500 y FM(2)2440 1488 y FQ(\))p FJ(:)-2039 b FQ(\(4.1.3\))605 1644 y(Reshetikhin{T)-7 b(uraev)40 b(in)n(v)-5 b(arian)n(ts)40 b(can)g(b)r(e)i(generalized)d(to)i(manifolds)g(with)h(ribb)r(on)456 1743 y(links)33 b(inside.)56 b(Let)34 b(us)g(assume)f(that)h(w)n(e)f (ha)n(v)n(e)g(a)g(partially)g FL(C)5 b FQ(-colored)32 b(ribb)r(on)h(link)h(in)g FH(R)3401 1713 y FM(3)456 1843 y FQ(whic)n(h)27 b(is)h(presen)n(ted)f(as)g(a)g(union)h(\012)18 b FL(t)h FJ(L)p FQ(;)27 b(here)g(\012)h(is)f(a)h FL(C)5 b FQ(-colored)25 b(ribb)r(on)j(link)f(\(whic)n(h)h(ma)n(y)456 1942 y(con)n(tain)d(coup)r(ons\),)i(and)f FJ(L)g FQ(is)g(an)h (uncolored)e(framed)h(link)h(without)g(coup)r(ons.)36 b(P)n(erforming)456 2042 y(surgery)g(along)i FJ(L)p FQ(,)j(w)n(e)d(get) h(the)g(manifold)f FJ(M)1986 2054 y FI(L)2074 2042 y FQ(with)h(a)g(ribb)r(on)f(link)h(\012)2866 2054 y FI(L)2954 2042 y FQ(inside.)70 b(Then)456 2142 y(Theorem)26 b(4.1.11)g(can)h(b)r (e)h(generalized)f(to)g(this)h(situation)f(as)g(follo)n(ws.)605 2297 y FP(Theorem)32 b FQ(4.1.15)d(\(Reshetikhin{T)-7 b(uraev)27 b([)p FK(R)-8 b(T2)p FQ(]\))p FP(.)41 b FQ(\(i\))22 b FO(A)n(ny)f(c)l(onne)l(cte)l(d)g(close)l(d)h(3-ma-)456 2397 y(nifold)31 b FJ(M)38 b FO(with)31 b(a)f(ribb)l(on)g(link)g FQ(\012)g FO(inside)h(c)l(an)f(b)l(e)g(obtaine)l(d)g(as)g FQ(\()p FJ(M)2607 2409 y FI(L)2657 2397 y FJ(;)14 b FQ(\012)2754 2409 y FI(L)2804 2397 y FQ(\))p FO(.)605 2496 y FQ(\(ii\))29 b(\()p FJ(M)857 2508 y FI(L)907 2496 y FJ(;)14 b FQ(\012)1004 2508 y FI(L)1053 2496 y FQ(\))24 b FL(')e FQ(\()p FJ(M)1309 2508 y FI(L)1355 2492 y Fx(0)1381 2496 y FJ(;)14 b FQ(\012)1478 2466 y FE(0)1478 2519 y FI(L)1524 2503 y Fx(0)1550 2496 y FQ(\))29 b FO(i\013)g(the)f(link)h FQ(\012)2072 2466 y FE(0)2111 2496 y FL([)16 b FJ(L)2239 2466 y FE(0)2290 2496 y FO(c)l(an)28 b(b)l(e)h(obtaine)l(d)g(fr)l(om)g FQ(\012)15 b FL([)h FJ(L)28 b FO(by)h(a)456 2596 y(se)l(quenc)l(e)j(of) i(Kirby{F)-6 b(enn{R)l(ourke)34 b(moves,)h(wher)l(e)f(the)f(annulus)f (in)i(Figur)l(e)f FQ(4.4)f FO(is)i(a)f(p)l(art)456 2696 y(of)d FJ(L)p FO(.)605 2851 y FP(Theorem)i FQ(4.1.16)d(\(Reshetikhin{T) -7 b(uraev)27 b([)p FK(R)-8 b(T2)p FQ(]\))p FP(.)41 b FO(L)l(et)28 b FL(C)k FO(b)l(e)c(a)g(MTC)h(and)f(let)g FQ(\012)14 b FL([)h FJ(L)456 2951 y FO(b)l(e)29 b(a)i(p)l(artial)t(ly)g (c)l(olor)l(e)l(d)g(fr)l(ame)l(d)g(link)f(as)g(ab)l(ove.)40 b(Then)1072 3166 y FJ(\034)1108 3178 y FE(C)1151 3166 y FQ(\()p FJ(M)1264 3178 y FI(L)1314 3166 y FJ(;)14 b FQ(\012)1411 3178 y FI(L)1461 3166 y FQ(\))23 b(:=)g FJ(D)1698 3131 y FE(\000j)p FI(L)p FE(j\000)p FM(1)1924 3166 y FJ(F)1989 3131 y FE(\000)p FM(1)2078 3166 y FQ(\()p FJ(L)18 b FL([)h FQ(\012\))2365 3049 y Fy(\022)2436 3110 y FJ(p)2478 3079 y FM(+)p 2436 3147 98 4 v 2436 3223 a FJ(p)2478 3199 y FE(\000)2544 3049 y Fy(\023)2605 3064 y FI(\033)r FM(\()p FI(L)p FM(\))p FI(=)p FM(2)456 3166 y FQ(\(4.1.4\))456 3361 y FO(is)30 b(an)g(invariant,)h(i.e.,)g(dep)l (ends)g(only)f(on)g FQ(\()p FJ(M)1940 3373 y FI(L)1990 3361 y FJ(;)14 b FQ(\012)2087 3373 y FI(L)2136 3361 y FQ(\))p FO(.)605 3516 y FQ(The)26 b(pro)r(of)f(is)h(similar)f(to)h(the) g(pro)r(of)g(of)g(the)g(previous)f(theorem.)36 b(The)26 b(explicit)g(compu-)456 3616 y(tation)d(of)g(Reshetikhin{T)-7 b(uraev)22 b(in)n(v)-5 b(arian)n(ts)22 b(is)h(not)g(di\016cult)h(for)f (lens)g(spaces)f(\(cf.)i(4.1.2\(iii\)\))456 3715 y(but)k(in)g(general)e (is)h(v)n(ery)g(complicated.)605 3815 y(One)32 b(ma)n(y)f(w)n(onder)g (is)h(there)f(a)h(reason)e(wh)n(y)i(MTCs)g(giv)n(e)f(in)n(v)-5 b(arian)n(ts)31 b(of)g(3-manifolds.)456 3914 y(The)26 b(reason)e(is)i(that)g(MTCs)g(giv)n(e)f(3-dimensional)g(T)-7 b(op)r(ological)24 b(Quan)n(tum)i(Field)h(Theories.)1116 4114 y FK(4.2.)47 b(T)-8 b(op)s(ological)30 b(Quan)m(tum)h(Field)g (Theory)605 4263 y FQ(In)26 b(this)g(section,)g(w)n(e)g(in)n(tro)r (duce)f(the)h(second)g(main)g(hero)f(of)g(our)h(lectures|top)r (ological)456 4363 y(quan)n(tum)31 b(\014eld)i(theory)e(\(TQFT\).)h (\(The)g(\014rst)g(hero)f(w)n(as)f(the)j(mo)r(dular)e(tensor)g (category)-7 b(.\))456 4462 y(This)26 b(notion)g(w)n(as)f(in)n(tro)r (duced)h(in)g([)p FK(W1)p FQ(],)h([)p FK(A)m(t)p FQ(])g(and)f(studied)h (extensiv)n(ely)e(in)h(man)n(y)g(pap)r(ers,)456 4562 y(suc)n(h)g(as)f([)p FK(Q)p FQ(].)36 b(As)27 b(b)r(efore,)f (\\manifold")f(=)h(\\compact)g(top)r(ological)e(orien)n(ted)i(manifold) g(with)456 4662 y(b)r(oundary".)76 b(W)-7 b(e)42 b(also)e(\014x)h(a)g (base)g(\014eld)g FJ(k)j FQ(of)d(c)n(haracteristic)f(zero;)47 b(all)41 b(v)n(ector)e(spaces)456 4761 y(considered)26 b(in)i(this)g(c)n(hapter)f(will)g(b)r(e)h(v)n(ector)f(spaces)f(o)n(v)n (er)g FJ(k)s FQ(.)605 4917 y FP(Definition)32 b FQ(4.2.1)p FP(.)40 b FQ(A)34 b(\()p FJ(d)24 b FQ(+)e(1\))p FO(-dimensional)37 b(T)-6 b(op)l(olo)l(gic)l(al)39 b(Quantum)34 b(Field)j(The)l(ory)456 5016 y FQ(\()p FJ(d)19 b FQ(+)f(1)27 b(D)h(TQFT\))g(is)f(the)h(follo)n (wing)f(collection)f(of)i FK(data)p FQ(:)605 5116 y(\(a\))22 b(T)-7 b(o)22 b(an)n(y)f FJ(d)p FQ(-manifold)h FJ(N)30 b FQ(without)23 b(b)r(oundary)e(assigned)f(a)i(\014nite)g(dimensional)g (v)n(ector)456 5216 y(space)k FJ(\034)9 b FQ(\()p FJ(N)g FQ(\).)p eop %%Page: 77 7 77 80 bop 1181 226 a FM(4.2.)30 b(TOPOLOGICAL)f(QUANTUM)h(FIELD)e (THEOR)-5 b(Y)637 b(77)605 425 y FQ(\(b\))39 b(T)-7 b(o)37 b(an)n(y)g(\()p FJ(d)26 b FQ(+)f(1\)-manifold)37 b FJ(M)47 b FQ(\(p)r(ossibly)38 b(with)g(b)r(oundary\))g(assigned)e(a)i(v)n (ector)456 525 y FJ(\034)9 b FQ(\()p FJ(M)g FQ(\))28 b(in)g(the)g(v)n(ector)e(space)h FJ(\034)9 b FQ(\()p FJ(@)c(M)k FQ(\).)605 632 y(\(c\))35 b(T)-7 b(o)34 b(an)n(y)g (homeomorphism)f(of)i FJ(d)p FQ(-manifolds)f FJ(f)18 b FQ(:)30 b FJ(N)2470 585 y FE(\030)2442 632 y FL(\000)-40 b(!)35 b FJ(N)2661 601 y FE(0)2719 632 y FQ(assigned)e(an)h(isomor-)456 738 y(phism)28 b(of)f(v)n(ector)f(spaces)h FJ(f)1340 750 y FE(\003)1387 738 y FQ(:)h FJ(\034)9 b FQ(\()p FJ(N)g FQ(\))1675 691 y FE(\030)1647 738 y FL(\000)-40 b(!)23 b FJ(\034)9 b FQ(\()p FJ(N)1931 708 y FE(0)1955 738 y FQ(\).)605 838 y(\(d\))28 b(F)-7 b(unctorial)27 b(isomorphisms)1615 1087 y FJ(\034)9 b FQ(\()p 1692 1021 76 4 v FJ(N)h FQ(\))1853 1040 y FE(\030)1824 1087 y FL(\000)-39 b(!)23 b FJ(\034)9 b FQ(\()p FJ(N)g FQ(\))2141 1053 y FE(\003)2180 1087 y FJ(;)-1734 b FQ(\(4.2.1\))1650 1232 y FJ(\034)9 b FQ(\()p FL(;)p FQ(\))1853 1185 y FE(\030)1824 1232 y FL(\000)-39 b(!)23 b FJ(k)s(;)-1556 b FQ(\(4.2.2\))1391 1377 y FJ(\034)9 b FQ(\()p FJ(N)1535 1389 y FM(1)1591 1377 y FL(t)19 b FJ(N)1732 1389 y FM(2)1769 1377 y FQ(\))1853 1330 y FE(\030)1824 1377 y FL(\000)-39 b(!)23 b FJ(\034)9 b FQ(\()p FJ(N)2100 1389 y FM(1)2138 1377 y FQ(\))19 b FL(\012)f FJ(\034)9 b FQ(\()p FJ(N)2416 1389 y FM(2)2454 1377 y FQ(\))p FJ(;)-2040 b FQ(\(4.2.3\))456 1543 y(where)p 703 1477 V 34 w FJ(N)44 b FQ(is)35 b(the)g(manifold)g FJ(N)44 b FQ(with)36 b(the)f(opp)r(osite) g(orien)n(tation,)h(whic)n(h)f(are)f(compatible)456 1643 y(in)27 b(an)g(ob)n(vious)e(sense)i(with)g(eac)n(h)f(other)h(and)g (with)g(the)g(comm)n(utativit)n(y)-7 b(,)27 b(asso)r(ciativit)n(y)f (and)456 1743 y(unit)i(morphisms.)605 1842 y(These)f(data)g(are)g (required)g(to)g(satisfy)g(the)h(follo)n(wing)f FK(axioms)p FQ(:)605 1944 y(\(i\))c FO(F)-6 b(unctoriality)p FQ(.)36 b(If)23 b FJ(f)18 b FQ(:)27 b FJ(M)1566 1897 y FE(\030)1538 1944 y FL(\000)-39 b(!)23 b FJ(M)1760 1914 y FE(0)1805 1944 y FQ(is)f(a)g(homeomorphism)f(of)h(\()p FJ(d)8 b FQ(+)g(1\)-manifolds)22 b(then)456 2044 y(\()p FJ(f)9 b FL(j)561 2056 y FI(@)t(M)673 2044 y FQ(\))705 2056 y FE(\003)744 2044 y FQ(\()p FJ(\034)g FQ(\()p FJ(M)g FQ(\)\))24 b(=)f FJ(\034)9 b FQ(\()p FJ(M)1286 2014 y FE(0)1310 2044 y FQ(\).)605 2144 y(\(ii\))35 b FO(Gluing)i(axiom)p FQ(.)59 b(Let)34 b FJ(M)44 b FQ(b)r(e)35 b(a)f(\()p FJ(d)23 b FQ(+)g(1\)-manifold,)36 b FJ(@)5 b(M)43 b FQ(=)34 b FJ(N)2803 2156 y FM(1)2863 2144 y FL(t)24 b FJ(N)3009 2156 y FM(2)3069 2144 y FL(t)f FJ(N)3214 2156 y FM(3)3251 2144 y FQ(,)37 b(and)456 2250 y FJ(f)17 b FQ(:)32 b FJ(N)636 2262 y FM(1)744 2203 y FE(\030)716 2250 y FL(\000)-40 b(!)p 867 2184 V 43 w FJ(N)943 2262 y FM(2)1019 2250 y FQ(b)r(e)40 b(a)f(homeomorphism.)71 b(Let)40 b FJ(M)2167 2220 y FE(0)2232 2250 y FQ(=)i FJ(M)t(=f)48 b FQ(b)r(e)40 b(the)f(\()p FJ(d)27 b FQ(+)f(1\)-manifold)456 2353 y(obtained)36 b(from)h FJ(M)46 b FQ(b)n(y)36 b(iden)n(tifying)i FJ(N)1753 2365 y FM(1)1827 2353 y FQ(with)p 2025 2286 V 37 w FJ(N)2101 2365 y FM(2)2175 2353 y FQ(using)f FJ(f)9 b FQ(,)39 b(i.e.,)g(b)n(y)e (gluing)g FJ(N)3133 2365 y FM(1)3207 2353 y FQ(to)f FJ(N)3384 2365 y FM(2)3421 2353 y FQ(.)456 2452 y(Then)27 b FJ(\034)9 b FQ(\()p FJ(M)839 2422 y FE(0)863 2452 y FQ(\))28 b(is)f(equal)g(to)h (the)f(image)g(of)g FJ(\034)9 b FQ(\()p FJ(M)g FQ(\))29 b(via)e(the)h(map)f FJ(\034)9 b FQ(\()p FJ(N)2638 2464 y FM(1)2676 2452 y FQ(\))18 b FL(\012)g FJ(\034)9 b FQ(\()p FJ(N)2953 2464 y FM(2)2991 2452 y FQ(\))18 b FL(\012)g FJ(\034)9 b FQ(\()p FJ(N)3268 2464 y FM(3)3306 2452 y FQ(\))23 b FL(!)456 2552 y FJ(\034)9 b FQ(\()p FJ(N)600 2564 y FM(2)638 2552 y FQ(\))670 2522 y FE(\003)726 2552 y FL(\012)18 b FJ(\034)9 b FQ(\()p FJ(N)953 2564 y FM(2)991 2552 y FQ(\))19 b FL(\012)f FJ(\034)9 b FQ(\()p FJ(N)1269 2564 y FM(3)1307 2552 y FQ(\))23 b FL(!)g FJ(\034)9 b FQ(\()p FJ(N)1612 2564 y FM(3)1650 2552 y FQ(\).)605 2652 y(\(iii\))30 b FO(Normalization)j(axiom)p FQ(.)42 b(Let)29 b FJ(I)37 b FQ(b)r(e)29 b(an)g(in)n(terv)-5 b(al)29 b(and)g FJ(N)38 b FQ(b)r(e)29 b(a)g FJ(d)p FQ(-manifold.)41 b(Then)456 2754 y FJ(@)5 b FQ(\()p FJ(I)30 b FL(\002)22 b FJ(N)9 b FQ(\))35 b(=)e FJ(N)f FL(t)p 1109 2687 V 24 w FJ(N)43 b FQ(and)34 b(w)n(e)g(require)f(that)i FJ(\034)9 b FQ(\()p FJ(I)31 b FL(\002)22 b FJ(N)9 b FQ(\))35 b(equals)f(the)g (image)g(of)g(id)3189 2769 y FI(\034)7 b FM(\()p FI(N)f FM(\))3375 2754 y FQ(in)456 2865 y FJ(\034)j FQ(\()p 533 2798 V FJ(N)g FQ(\))19 b FL(\012)f FJ(\034)9 b FQ(\()p FJ(N)g FQ(\))24 b FL(')f FJ(\034)9 b FQ(\()p FJ(N)g FQ(\))1225 2835 y FE(\003)1282 2865 y FL(\012)18 b FJ(\034)9 b FQ(\()p FJ(N)g FQ(\).)605 2965 y(\(iv\))28 b FO(Normalization)k(axiom)p FQ(.)38 b FJ(\034)9 b FQ(\()p FJ(S)1719 2935 y FI(d)1758 2965 y FQ(\))24 b(=)e FJ(k)31 b FQ(and)d FJ(\034)9 b FQ(\()p FJ(B)2281 2935 y FI(d)p FM(+1)2404 2965 y FQ(\))24 b(=)f(1)f FL(2)i FJ(k)s FQ(,)k(where)f FJ(B)3095 2935 y FI(d)p FM(+1)3246 2965 y FQ(is)g(the)456 3064 y(unit)h(ball)f(in)h FH(R)943 3034 y FI(d)p FM(+1)1072 3064 y FQ(,)g(and)f FJ(S)1340 3034 y FI(d)1402 3064 y FQ(=)22 b FJ(@)5 b(B)1605 3034 y FI(d)p FM(+1)1755 3064 y FQ(is)28 b(the)g FJ(d)p FQ(-sphere.)605 3164 y(This)g(completes)f(the)h(de\014nition.)605 3322 y FP(Remark)k FQ(4.2.2)p FP(.)39 b FQ(F)-7 b(or)30 b(a)f(more)g(p)r(edan)n(tic)h(reader,)f(w)n(e)g(list)h(here)f(all)h (the)g(compatibilit)n(y)456 3422 y(conditions)j(men)n(tioned)h(in)g (part)f(\(d\))i(ab)r(o)n(v)n(e.)54 b(F)-7 b(unctorialit)n(y)33 b(of)h(the)h(morphisms)e(\(4.2.1\))o({)456 3521 y(\(4.2.3\))27 b(means)g(that)1324 3675 y(\()p FJ(f)g FL(t)19 b FJ(g)s FQ(\))1573 3687 y FE(\003)1634 3675 y FQ(=)k FJ(f)1763 3687 y FE(\003)1819 3675 y FL(\012)18 b FJ(g)1942 3687 y FE(\003)1980 3675 y FJ(;)p 2100 3607 50 4 v 97 w(f)2149 3695 y FE(\003)2210 3675 y FQ(=)23 b(\()p FJ(f)2380 3641 y FE(\000)p FM(1)2371 3696 y FE(\003)2469 3675 y FQ(\))2501 3641 y FE(\003)2539 3675 y FJ(;)456 3845 y FQ(where)28 b(for)g FJ(f)18 b FQ(:)28 b FJ(N)1002 3857 y FM(1)1092 3798 y FE(\030)1064 3845 y FL(\000)-39 b(!)25 b FJ(N)1265 3857 y FM(2)1331 3845 y FQ(w)n(e)j(denote)h(b)n(y)p 1839 3778 V 28 w FJ(f)38 b FQ(the)29 b(same)f(map)h(considered)f(as)g(a)g (homeomor-)456 3947 y(phism)p 701 3881 104 4 v 28 w FJ(N)768 3959 y FM(1)857 3900 y FE(\030)828 3947 y FL(\000)-39 b(!)p 961 3881 V 24 w FJ(N)1028 3959 y FM(2)1065 3947 y FQ(,)28 b(and)f(for)h(a)f(map)h(of)g(v)n(ector)f(spaces)g FJ(')9 b FQ(:)28 b FJ(V)2421 3959 y FM(1)2482 3947 y FL(!)c FJ(V)2637 3959 y FM(2)2703 3947 y FQ(w)n(e)j(denote)h(b)n(y)g FJ(')3263 3917 y FE(\003)3329 3947 y FQ(the)456 4047 y(adjoin)n(t)f(map)g FJ(')975 4017 y FE(\003)1023 4047 y FQ(:)h FJ(V)1141 4017 y FE(\003)1122 4068 y FM(2)1202 4047 y FL(!)23 b FJ(V)1375 4017 y FE(\003)1356 4068 y FM(1)1413 4047 y FQ(.)605 4147 y(The)j(compatibilit)n(y)f(conditions)g (are)f(as)h(follo)n(ws:)35 b(to)25 b(the)h(canonical)e(homeomorphisms) 1663 4299 y FJ(N)j FL(t)19 b(;)1924 4252 y FE(\030)1896 4299 y FL(\000)-40 b(!)23 b FJ(N)t(;)1573 4444 y(N)1640 4456 y FM(1)1695 4444 y FL(t)c FJ(N)1836 4456 y FM(2)1924 4397 y FE(\030)1896 4444 y FL(\000)-40 b(!)23 b FJ(N)2094 4456 y FM(2)2150 4444 y FL(t)c FJ(N)2291 4456 y FM(1)2327 4444 y FJ(;)1312 4589 y FQ(\()p FJ(N)1411 4601 y FM(1)1466 4589 y FL(t)g FJ(N)1607 4601 y FM(2)1644 4589 y FQ(\))g FL(t)g FJ(N)1836 4601 y FM(3)1924 4542 y FE(\030)1896 4589 y FL(\000)-40 b(!)23 b FJ(N)2094 4601 y FM(1)2150 4589 y FL(t)c FQ(\()p FJ(N)2323 4601 y FM(2)2378 4589 y FL(t)g FJ(N)2519 4601 y FM(3)2556 4589 y FQ(\))456 4739 y(are)26 b(assigned)h(the)h(usual)f(isomorphisms)f(of)i(v)n(ector) e(spaces)1528 4892 y FJ(\034)9 b FQ(\()p FJ(N)g FQ(\))19 b FL(\012)f FJ(k)1913 4845 y FE(\030)1884 4892 y FL(\000)-39 b(!)23 b FJ(\034)9 b FQ(\()p FJ(N)g FQ(\))p FJ(;)1331 5037 y(\034)g FQ(\()p FJ(N)1475 5049 y FM(1)1513 5037 y FQ(\))19 b FL(\012)f FJ(\034)9 b FQ(\()p FJ(N)1791 5049 y FM(2)1829 5037 y FQ(\))1913 4990 y FE(\030)1884 5037 y FL(\000)-39 b(!)23 b FJ(\034)9 b FQ(\()p FJ(N)2160 5049 y FM(2)2198 5037 y FQ(\))18 b FL(\012)h FJ(\034)9 b FQ(\()p FJ(N)2476 5049 y FM(1)2513 5037 y FQ(\))p FJ(;)951 5182 y FQ(\()p FJ(\034)g FQ(\()p FJ(N)1127 5194 y FM(1)1165 5182 y FQ(\))19 b FL(\012)f FJ(\034)9 b FQ(\()p FJ(N)1443 5194 y FM(2)1481 5182 y FQ(\)\))19 b FL(\012)f FJ(\034)9 b FQ(\()p FJ(N)1791 5194 y FM(3)1829 5182 y FQ(\))1913 5134 y FE(\030)1884 5182 y FL(\000)-39 b(!)23 b FJ(\034)9 b FQ(\()p FJ(N)2160 5194 y FM(1)2198 5182 y FQ(\))18 b FL(\012)h FQ(\()p FJ(\034)9 b FQ(\()p FJ(N)2508 5194 y FM(2)2546 5182 y FQ(\))18 b FL(\012)g FJ(\034)9 b FQ(\()p FJ(N)2823 5194 y FM(3)2861 5182 y FQ(\)\))p FJ(:)p eop %%Page: 78 8 78 81 bop 456 226 a FM(78)404 b(4.)29 b(3-DIMENSIONAL)g(TOPOLOGICAL)h (QUANTUM)f(FIELD)g(THEOR)-5 b(Y)456 425 y FQ(Also,)27 b(to)g(the)h(canonical)f(homeomorphisms)1394 569 y FL(;)1487 522 y FE(\030)1458 569 y FL(\000)-39 b(!)p 1590 497 42 4 v 23 w(;)o FJ(;)p 1751 502 301 4 v 97 w(N)1818 581 y FM(1)1874 569 y FL(t)19 b FJ(N)2015 581 y FM(2)2103 522 y FE(\030)2075 569 y FL(\000)-40 b(!)p 2206 502 104 4 v 23 w FJ(N)2273 581 y FM(1)2329 569 y FL(t)p 2402 502 V 18 w FJ(N)2469 581 y FM(2)456 709 y FQ(are)26 b(assigned)h(the)h (usual)f(isomorphisms)1039 852 y FJ(k)1085 817 y FE(\003)1175 805 y(\030)1147 852 y FL(\000)-40 b(!)23 b FJ(k)s(;)97 b FQ(\()p FJ(\034)9 b FQ(\()p FJ(N)1620 864 y FM(1)1658 852 y FQ(\))19 b FL(\012)f FJ(\034)9 b FQ(\()p FJ(N)1936 864 y FM(2)1974 852 y FQ(\)\))2038 817 y FE(\003)2128 805 y(\030)2100 852 y FL(\000)-40 b(!)23 b FJ(\034)9 b FQ(\()p FJ(N)2375 864 y FM(1)2413 852 y FQ(\))2445 817 y FE(\003)2502 852 y FL(\012)18 b FJ(\034)9 b FQ(\()p FJ(N)2729 864 y FM(2)2767 852 y FQ(\))2799 817 y FE(\003)2837 852 y FJ(:)456 992 y FQ(This)27 b(completes)g(the)h(list)g(of)g (compatibilit)n(y)f(conditions.)605 1145 y(The)37 b(axioms)f(of)h(TQFT) g(sho)n(w)g(in)g(particular)f(that)h(for)g(ev)n(ery)f(\()p FJ(d)25 b FQ(+)g(1\)-dimensional)456 1244 y(manifold)40 b FJ(M)49 b FQ(without)40 b(b)r(oundary)-7 b(,)43 b(the)d(n)n(um)n(b)r (er)g FJ(\034)9 b FQ(\()p FJ(M)g FQ(\))45 b FL(2)f FJ(\034)9 b FQ(\()p FL(;)p FQ(\))45 b(=)e FJ(k)g FQ(is)d(a)g(top)r(ological)456 1344 y(in)n(v)-5 b(arian)n(t)23 b(of)i FJ(M)9 b FQ(.)36 b(Ho)n(w)n(ev)n(er,)24 b(not)h(ev)n(ery)e(in)n(v)-5 b(arian)n(t)24 b(can)h(b)r(e)g(extended)h(to)f(a)f(TQFT)h(\(see)g([)p FK(T)p FQ(],)456 1443 y([)p FK(F)-8 b(u)p FQ(]\).)605 1546 y(Note)39 b(that,)j(if)d FJ(M)47 b FQ(is)39 b(a)f(\()p FJ(d)27 b FQ(+)e(1\)-manifold)38 b(with)i FJ(@)5 b(M)49 b FQ(=)p 2559 1479 76 4 v 42 w FJ(N)2634 1558 y FM(1)2698 1546 y FL(t)26 b FJ(N)2846 1558 y FM(2)2883 1546 y FQ(,)41 b(then)f FJ(\034)9 b FQ(\()p FJ(M)g FQ(\))42 b FL(2)456 1646 y FJ(\034)9 b FQ(\()p FJ(N)600 1658 y FM(1)638 1646 y FQ(\))670 1615 y FE(\003)727 1646 y FL(\012)18 b FJ(\034)9 b FQ(\()p FJ(N)954 1658 y FM(2)992 1646 y FQ(\))25 b FL(')f FQ(Hom)1311 1658 y FI(k)1352 1646 y FQ(\()p FJ(\034)9 b FQ(\()p FJ(N)1528 1658 y FM(1)1566 1646 y FQ(\))p FJ(;)14 b(\034)9 b FQ(\()p FJ(N)1779 1658 y FM(2)1817 1646 y FQ(\)\).)40 b(The)28 b(gluing)g(axiom)g(sa)n(ys)e(that)j(gluing)f(of)g (t)n(w)n(o)456 1745 y(suc)n(h)f(manifolds)g FJ(M)37 b FQ(giv)n(es)26 b(rise)h(to)g(m)n(ultiplying)h(the)g(corresp)r(onding)e (op)r(erators.)605 1845 y(Another)g(example:)36 b FJ(M)c FQ(=)22 b FJ(S)1542 1815 y FM(1)1595 1845 y FL(\002)16 b FJ(N)35 b FQ(is)26 b(obtained)h(b)n(y)f(gluing)g(the)g(bases)g(of)g (the)h(cylinder)456 1944 y FJ(I)g FL(\002)21 b FJ(N)40 b FQ(and)31 b(it)h(is)f(easy)f(to)h(see)g(that)g FJ(\034)9 b FQ(\()p FJ(S)1796 1914 y FM(1)1855 1944 y FL(\002)20 b FJ(N)9 b FQ(\))29 b(=)g(tr)14 b FJ(\034)9 b FQ(\()p FJ(I)29 b FL(\002)20 b FJ(N)9 b FQ(\))29 b(=)g(dim)14 b FJ(\034)9 b FQ(\()p FJ(N)g FQ(\).)49 b(Compare)456 2044 y(this)27 b(with)i(\(2.3.12\))n(:)1675 2847 y @beginspecial 0 @llx 0 @lly 66 @urx 88 @ury 660 @rwi @setspecial %%BeginDocument: figures/tausn.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: tausn.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 11:09:28 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.15 %%Orientation: Portrait %%BoundingBox: 0 0 66 88 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -2.0 93.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.00900 0.00900 sc 30.000 slw % Polyline n 1200 7050 m 1200 3375 l gs col-1 s gr % Polyline n 3600 7050 m 3600 3375 l gs col-1 s gr % Open spline gs n 3600.0 7050.0 m 3450.0 7275.0 l 3450.0 7275.0 3300.0 7500.0 2850.0 7650.0 DrawSplineSection 2850.0 7650.0 2400.0 7800.0 1950.0 7650.0 DrawSplineSection 1950.0 7650.0 1500.0 7500.0 1350.0 7275.0 DrawSplineSection 1200.0 7050.0 l gs col-1 s gr gr % Open spline gs n 3600.0 3450.0 m 3450.0 3675.0 l 3450.0 3675.0 3300.0 3900.0 2850.0 4050.0 DrawSplineSection 2850.0 4050.0 2400.0 4200.0 1950.0 4050.0 DrawSplineSection 1950.0 4050.0 1500.0 3900.0 1350.0 3675.0 DrawSplineSection 1200.0 3450.0 l gs col-1 s gr gr % Open spline gs n 3600.0 3450.0 m 3450.0 3225.0 l 3450.0 3225.0 3300.0 3000.0 2850.0 2850.0 DrawSplineSection 2850.0 2850.0 2400.0 2700.0 1950.0 2850.0 DrawSplineSection 1950.0 2850.0 1500.0 3000.0 1350.0 3225.0 DrawSplineSection 1200.0 3450.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 3600.0 7050.0 m 3450.0 6825.0 l 3450.0 6825.0 3300.0 6600.0 2850.0 6450.0 DrawSplineSection 2850.0 6450.0 2400.0 6300.0 1950.0 6450.0 DrawSplineSection 1950.0 6450.0 1500.0 6600.0 1350.0 6825.0 DrawSplineSection 1200.0 7050.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 1200.0 3375.0 m 1200.0 2887.5 l 1200.0 2887.5 1200.0 2400.0 1800.0 1500.0 DrawSplineSection 1800.0 1500.0 2400.0 600.0 4200.0 600.0 DrawSplineSection 4200.0 600.0 6000.0 600.0 6750.0 2100.0 DrawSplineSection 6750.0 2100.0 7500.0 3600.0 7500.0 5400.0 DrawSplineSection 7500.0 5400.0 7500.0 7200.0 6750.0 8700.0 DrawSplineSection 6750.0 8700.0 6000.0 10200.0 4200.0 10200.0 DrawSplineSection 4200.0 10200.0 2400.0 10200.0 1800.0 9300.0 DrawSplineSection 1800.0 9300.0 1200.0 8400.0 1200.0 7725.0 DrawSplineSection 1200.0 7050.0 l gs col-1 s gr gr % Open spline gs n 3600.0 3450.0 m 3600.0 2925.0 l 3600.0 2925.0 3600.0 2400.0 4350.0 2400.0 DrawSplineSection 4350.0 2400.0 5100.0 2400.0 5400.0 3900.0 DrawSplineSection 5400.0 3900.0 5700.0 5400.0 5287.5 6900.0 DrawSplineSection 5287.5 6900.0 4875.0 8400.0 4237.5 8400.0 DrawSplineSection 4237.5 8400.0 3600.0 8400.0 3600.0 7725.0 DrawSplineSection 3600.0 7050.0 l gs col-1 s gr gr /Times-Italic ff 900.00 scf sf 300 7425 m gs 1 -1 sc (N) col-1 sh gr /Times-Italic ff 900.00 scf sf 300 3900 m gs 1 -1 sc (N) col-1 sh gr $F2psEnd rs %%EndDocument @endspecial 605 2953 a(Next,)f(w)n(e)f(ha)n(v)n(e)g(the)h(follo)n (wing)e(imp)r(ortan)n(t)h(result.)605 3106 y FP(Theorem)32 b FQ(4.2.3)p FP(.)40 b FO(In)29 b(any)h(TQFT,)h(we)f(have)p FQ(:)605 3205 y(\(i\))g(\()p FJ(f)9 b(g)s FQ(\))879 3217 y FE(\003)940 3205 y FQ(=)23 b FJ(f)1069 3217 y FE(\003)1107 3205 y FJ(g)1147 3217 y FE(\003)1185 3205 y FO(,)30 b FQ(id)1309 3217 y FE(\003)1370 3205 y FQ(=)23 b(id)p FO(.)605 3312 y FQ(\(ii\))36 b FO(F)-6 b(or)35 b FJ(f)18 b FQ(:)29 b FJ(N)1089 3324 y FM(1)1187 3265 y FE(\030)1159 3312 y FL(\000)-39 b(!)32 b FJ(N)1367 3324 y FM(2)1439 3312 y FO(the)j(isomorphism)j FJ(f)2118 3324 y FE(\003)2165 3312 y FQ(:)29 b FJ(\034)9 b FQ(\()p FJ(N)2361 3324 y FM(1)2399 3312 y FQ(\))2493 3265 y FE(\030)2464 3312 y FL(\000)-39 b(!)32 b FJ(\034)9 b FQ(\()p FJ(N)2749 3324 y FM(2)2787 3312 y FQ(\))36 b FO(dep)l(ends)g(only)f(on)456 3412 y(the)30 b(isotopy)h(class)f(of)h FJ(f)9 b FO(.)605 3567 y FP(Pr)n(oof.)41 b FQ(F)-7 b(or)36 b(a)g(homeomorphism)g FJ(f)17 b FQ(:)31 b FJ(N)1981 3579 y FM(1)2085 3520 y FE(\030)2056 3567 y FL(\000)-39 b(!)38 b FJ(N)2270 3579 y FM(2)2307 3567 y FQ(,)h(let)e FJ(M)2579 3579 y FI(f)2658 3567 y FQ(b)r(e)g(a)g(cylinder)f FJ(N)3251 3579 y FM(1)3312 3567 y FL(\002)24 b FJ(I)456 3672 y FQ(with)37 b(b)r(oundary)e FJ(@)5 b(M)1166 3684 y FI(f)1245 3672 y FQ(iden)n(ti\014ed)37 b(with)p 1814 3605 104 4 v 37 w FJ(N)1881 3684 y FM(1)1942 3672 y FL(t)25 b FJ(N)2089 3684 y FM(2)2163 3672 y FQ(using)36 b FJ(f)9 b FQ(.)63 b(Then)37 b(it)f(follo)n(ws)g(from)g(the)456 3772 y(normalization)26 b(axiom)i(that)g FJ(\034)9 b FQ(\()p FJ(M)1568 3784 y FI(f)1612 3772 y FQ(\))24 b(=)g FJ(f)1798 3784 y FE(\003)1845 3772 y FQ(:)k FJ(\034)9 b FQ(\()p FJ(N)2040 3784 y FM(1)2078 3772 y FQ(\))24 b FL(!)g FJ(\034)9 b FQ(\()p FJ(N)2385 3784 y FM(2)2423 3772 y FQ(\).)39 b(T)-7 b(o)28 b(pro)n(v)n(e)f(\(i\),)i(it)g(su\016ces) f(to)456 3871 y(notice)i(that)h(the)h(cylinder)e FJ(M)1433 3883 y FI(f)7 b(g)1541 3871 y FQ(is)31 b(homeomorphic)e(to)i(the)g (cylinder)g(obtained)f(b)n(y)h(gluing)456 3971 y FJ(M)537 3983 y FI(f)621 3971 y FQ(with)42 b FJ(M)905 3983 y FI(g)943 3971 y FQ(.)78 b(T)-7 b(o)41 b(pro)n(v)n(e)f(\(ii\),)45 b(note)d(that)f(if)h FJ(f)50 b FQ(is)41 b(isotopic)g(to)g(iden)n(tit)n (y)h(then)g FJ(M)3305 3983 y FI(f)3389 3971 y FQ(is)456 4071 y(homeomorphic)21 b(to)i(the)g(trivial)f(cylinder)h FJ(M)1879 4083 y FM(id)1961 4071 y FQ(=)f FJ(N)2115 4083 y FM(1)2161 4071 y FL(\002)9 b FJ(I)e FQ(;)24 b(th)n(us,)g(b)n(y)f (functorialit)n(y)-7 b(,)23 b FJ(\034)9 b FQ(\()p FJ(M)3281 4083 y FI(f)3324 4071 y FQ(\))24 b(=)456 4170 y(id.)37 b(W)-7 b(e)28 b(lea)n(v)n(e)e(the)i(details)f(to)h(the)g(reader.)p 3384 4170 4 57 v 3388 4118 50 4 v 3388 4170 V 3437 4170 4 57 v 605 4328 a FP(Cor)n(ollar)-6 b(y)33 b FQ(4.2.4)p FP(.)39 b FO(F)-6 b(or)27 b(every)g FJ(d)p FO(-manifold)i FJ(N)9 b FO(,)27 b(a)g(TQFT)g(gives)h(a)f(r)l(epr)l(esentation)g(of)456 4430 y(the)j(gr)l(oup)g(of)g(isotopy)h(classes)g(of)g(home)l (omorphisms)h FJ(f)18 b FQ(:)27 b FJ(N)2460 4383 y FE(\030)2431 4430 y FL(\000)-39 b(!)23 b FJ(N)38 b FO(in)30 b(the)g(sp)l(ac)l(e)h FJ(\034)9 b FQ(\()p FJ(N)g FQ(\))p FO(.)605 4582 y FQ(This)22 b(group)e(is)i(called)f(the)i FO(mapping)i(class)g(gr)l(oup)p FQ(.)36 b(W)-7 b(e)22 b(will)g(return)f(to)h(this)g(observ)-5 b(ation)456 4682 y(later.)1356 4867 y FK(4.3.)46 b(1+1)32 b(dimensional)c(TQFT)605 5016 y FQ(In)k(this)g(section,)h(w)n(e)e (consider)g(a)g(to)n(y)g(mo)r(del)h(of)g(a)g(TQFT:)f(a)h(\(1+1\))f(D)h (TQFT.)g(This)456 5116 y(case)23 b(is)i(rather)e(trivial;)i(ho)n(w)n (ev)n(er,)e(the)i(understanding)f(of)h(this)f(example)h(will)f(b)r(e)h (crucial)f(for)456 5216 y(some)j(of)g(our)g(future)h(constructions.)p eop %%Page: 79 9 79 82 bop 1474 226 a FM(4.3.)29 b(1+1)g(DIMENSIONAL)f(TQFT)930 b(79)605 425 y FP(Theorem)32 b FQ(4.3.1)p FP(.)40 b FO(1+1)34 b(D)f(TQFTs)i(ar)l(e)f(in)g(one-to-one)g(c)l(orr)l(esp)l(ondenc)l(e)g (with)h(\014nite)456 525 y(dimensional)30 b FQ(F)-7 b(rob)r(enius)27 b(algebras)p FO(,)g(i.e.,)k(c)l(ommutative)e(asso)l(ciative)i(algebr)l (as)f FJ(A)f FO(with)g(unit)456 624 y(and)21 b(with)h(a)g(line)l(ar)g (map)g FQ(tr)9 b(:)28 b FJ(A)23 b FL(!)g FJ(k)h FO(such)d(that)h(the)f (biline)l(ar)i(form)f FQ(tr)o(\()p FJ(ab)p FQ(\))g FO(is)f(non-de)l (gener)l(ate.)605 789 y FP(Pr)n(oof.)41 b FQ(1.)36 b FO(Every)31 b(1+1)f(D)g(TQFT)g(gives)h(a)f(F)-6 b(r)l(ob)l(enius)29 b(algebr)l(a)p FQ(.)456 891 y(There)24 b(is)i(only)e(one)h (1-dimensional)f(connected)i(closed)e(manifold:)36 b(the)26 b(circle)e FJ(S)3042 861 y FM(1)3105 891 y FQ(and)p 3264 820 93 4 v 25 w FJ(S)3320 867 y FM(1)3380 891 y FQ(=)456 991 y FJ(S)512 961 y FM(1)549 991 y FQ(.)37 b(Let)27 b FJ(A)h FQ(b)r(e)g(the)g(v)n(ector)e(space)h FJ(\034)9 b FQ(\()p FJ(S)1707 961 y FM(1)1745 991 y FQ(\):)1755 1152 y FJ(A)24 b FQ(=)e FJ(\034)9 b FQ(\()p FL(\015)p FQ(\))p FJ(:)456 1323 y FQ(The)30 b(disk)g FJ(D)876 1293 y FM(1)943 1323 y FQ(has)g(a)g(b)r(oundary)f FJ(@)5 b(D)1662 1293 y FM(1)1726 1323 y FQ(=)27 b FJ(S)1874 1293 y FM(1)1911 1323 y FQ(,)k(hence)f(it)h(giv)n(es)e(a)h(v)n(ector)e FJ(\034)9 b FQ(\()p FJ(D)2961 1293 y FM(1)3000 1323 y FQ(\))27 b FL(2)h FJ(A)j FQ(whic)n(h)456 1422 y(w)n(e)j(denote)g(b)n(y) h(1.)57 b(Since)35 b FJ(\034)9 b FQ(\()p FL(;)p FQ(\))35 b(:=)f FJ(k)s FQ(,)j(w)n(e)d(can)g(consider)f FJ(\034)9 b FQ(\()p FJ(D)2508 1392 y FM(1)2547 1422 y FQ(\))35 b(as)e(a)i(map)f(from)g FJ(k)k FQ(to)c FJ(A)456 1522 y FQ(giving)26 b(the)i(unit:)1533 1908 y @beginspecial 0 @llx 0 @lly 100 @urx 36 @ury 1000 @rwi @setspecial %%BeginDocument: figures/unit.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: unit.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 12:50:50 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 100 36 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /MyAppDict 100 dict dup begin def /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -6.0 69.0 translate 1 -1 scale .9 .9 scale % to make patterns same scale as in xfig % This junk string is used by the show operators /PATsstr 1 string def /PATawidthshow { % cx cy cchar rx ry string % Loop over each character in the string { % cx cy cchar rx ry char % Show the character dup % cx cy cchar rx ry char char PATsstr dup 0 4 -1 roll put % cx cy cchar rx ry char (char) false charpath % cx cy cchar rx ry char /clip load PATdraw % Move past the character (charpath modified the % current point) currentpoint % cx cy cchar rx ry char x y newpath moveto % cx cy cchar rx ry char % Reposition by cx,cy if the character in the string is cchar 3 index eq { % cx cy cchar rx ry 4 index 4 index rmoveto } if % Reposition all characters by rx ry 2 copy rmoveto % cx cy cchar rx ry } forall pop pop pop pop pop % - currentpoint newpath moveto } bind def /PATcg { 7 dict dup begin /lw currentlinewidth def /lc currentlinecap def /lj currentlinejoin def /ml currentmiterlimit def /ds [ currentdash ] def /cc [ currentrgbcolor ] def /cm matrix currentmatrix def end } bind def % PATdraw - calculates the boundaries of the object and % fills it with the current pattern /PATdraw { % proc save exch PATpcalc % proc nw nh px py 5 -1 roll exec % nw nh px py newpath PATfill % - restore } bind def % PATfill - performs the tiling for the shape /PATfill { % nw nh px py PATfill - PATDict /CurrentPattern get dup begin setfont % Set the coordinate system to Pattern Space PatternGState PATsg % Set the color for uncolored pattezns PaintType 2 eq { PATDict /PColor get PATsc } if % Create the string for showing 3 index string % nw nh px py str % Loop for each of the pattern sources 0 1 Multi 1 sub { % nw nh px py str source % Move to the starting location 3 index 3 index % nw nh px py str source px py moveto % nw nh px py str source % For multiple sources, set the appropriate color Multi 1 ne { dup PC exch get PATsc } if % Set the appropriate string for the source 0 1 7 index 1 sub { 2 index exch 2 index put } for pop % Loop over the number of vertical cells 3 index % nw nh px py str nh { % nw nh px py str currentpoint % nw nh px py str cx cy 2 index show % nw nh px py str cx cy YStep add moveto % nw nh px py str } repeat % nw nh px py str } for 5 { pop } repeat end } bind def % PATkshow - kshow with the current pattezn /PATkshow { % proc string exch bind % string proc 1 index 0 get % string proc char % Loop over all but the last character in the string 0 1 4 index length 2 sub { % string proc char idx % Find the n+1th character in the string 3 index exch 1 add get % string proe char char+1 exch 2 copy % strinq proc char+1 char char+1 char % Now show the nth character PATsstr dup 0 4 -1 roll put % string proc chr+1 chr chr+1 (chr) false charpath % string proc char+1 char char+1 /clip load PATdraw % Move past the character (charpath modified the current point) currentpoint newpath moveto % Execute the user proc (should consume char and char+1) mark 3 1 roll % string proc char+1 mark char char+1 4 index exec % string proc char+1 mark... cleartomark % string proc char+1 } for % Now display the last character PATsstr dup 0 4 -1 roll put % string proc (char+1) false charpath % string proc /clip load PATdraw neewath pop pop % - } bind def % PATmp - the makepattern equivalent /PATmp { % patdict patmtx PATmp patinstance exch dup length 7 add % We will add 6 new entries plus 1 FID dict copy % Create a new dictionary begin % Matrix to install when painting the pattern TilingType PATtcalc /PatternGState PATcg def PatternGState /cm 3 -1 roll put % Check for multi pattern sources (Level 1 fast color patterns) currentdict /Multi known not { /Multi 1 def } if % Font dictionary definitions /FontType 3 def % Create a dummy encoding vector /Encoding 256 array def 3 string 0 1 255 { Encoding exch dup 3 index cvs cvn put } for pop /FontMatrix matrix def /FontBBox BBox def /BuildChar { mark 3 1 roll % mark dict char exch begin Multi 1 ne {PaintData exch get}{pop} ifelse % mark [paintdata] PaintType 2 eq Multi 1 ne or { XStep 0 FontBBox aload pop setcachedevice } { XStep 0 setcharwidth } ifelse currentdict % mark [paintdata] dict /PaintProc load % mark [paintdata] dict paintproc end gsave false PATredef exec true PATredef grestore cleartomark % - } bind def currentdict end % newdict /foo exch % /foo newlict definefont % newfont } bind def % PATpcalc - calculates the starting point and width/height % of the tile fill for the shape /PATpcalc { % - PATpcalc nw nh px py PATDict /CurrentPattern get begin gsave % Set up the coordinate system to Pattern Space % and lock down pattern PatternGState /cm get setmatrix BBox aload pop pop pop translate % Determine the bounding box of the shape pathbbox % llx lly urx ury grestore % Determine (nw, nh) the # of cells to paint width and height PatHeight div ceiling % llx lly urx qh 4 1 roll % qh llx lly urx PatWidth div ceiling % qh llx lly qw 4 1 roll % qw qh llx lly PatHeight div floor % qw qh llx ph 4 1 roll % ph qw qh llx PatWidth div floor % ph qw qh pw 4 1 roll % pw ph qw qh 2 index sub cvi abs % pw ph qs qh-ph exch 3 index sub cvi abs exch % pw ph nw=qw-pw nh=qh-ph % Determine the starting point of the pattern fill %(px, py) 4 2 roll % nw nh pw ph PatHeight mul % nw nh pw py exch % nw nh py pw PatWidth mul exch % nw nh px py end } bind def % Save the original routines so that we can use them later on /oldfill /fill load def /oldeofill /eofill load def /oldstroke /stroke load def /oldshow /show load def /oldashow /ashow load def /oldwidthshow /widthshow load def /oldawidthshow /awidthshow load def /oldkshow /kshow load def % These defs are necessary so that subsequent procs don't bind in % the originals /fill { oldfill } bind def /eofill { oldeofill } bind def /stroke { oldstroke } bind def /show { oldshow } bind def /ashow { oldashow } bind def /widthshow { oldwidthshow } bind def /awidthshow { oldawidthshow } bind def /kshow { oldkshow } bind def /PATredef { MyAppDict begin { /fill { /clip load PATdraw newpath } bind def /eofill { /eoclip load PATdraw newpath } bind def /stroke { PATstroke } bind def /show { 0 0 null 0 0 6 -1 roll PATawidthshow } bind def /ashow { 0 0 null 6 3 roll PATawidthshow } bind def /widthshow { 0 0 3 -1 roll PATawidthshow } bind def /awidthshow { PATawidthshow } bind def /kshow { PATkshow } bind def } { /fill { oldfill } bind def /eofill { oldeofill } bind def /stroke { oldstroke } bind def /show { oldshow } bind def /ashow { oldashow } bind def /widthshow { oldwidthshow } bind def /awidthshow { oldawidthshow } bind def /kshow { oldkshow } bind def } ifelse end } bind def false PATredef % Conditionally define setcmykcolor if not available /setcmykcolor where { pop } { /setcmykcolor { 1 sub 4 1 roll 3 { 3 index add neg dup 0 lt { pop 0 } if 3 1 roll } repeat setrgbcolor - pop } bind def } ifelse /PATsc { % colorarray aload length % c1 ... cn length dup 1 eq { pop setgray } { 3 eq { setrgbcolor } { setcmykcolor } ifelse } ifelse } bind def /PATsg { % dict begin lw setlinewidth lc setlinecap lj setlinejoin ml setmiterlimit ds aload pop setdash cc aload pop setrgbcolor cm setmatrix end } bind def /PATDict 3 dict def /PATsp { true PATredef PATDict begin /CurrentPattern exch def % If it's an uncolored pattern, save the color CurrentPattern /PaintType get 2 eq { /PColor exch def } if /CColor [ currentrgbcolor ] def end } bind def % PATstroke - stroke with the current pattern /PATstroke { countdictstack save mark { currentpoint strokepath moveto PATpcalc % proc nw nh px py clip newpath PATfill } stopped { (*** PATstroke Warning: Path is too complex, stroking with gray) = cleartomark restore countdictstack exch sub dup 0 gt { { end } repeat } { pop } ifelse gsave 0.5 setgray oldstroke grestore } { pop restore pop } ifelse newpath } bind def /PATtcalc { % modmtx tilingtype PATtcalc tilematrix % Note: tiling types 2 and 3 are not supported gsave exch concat % tilingtype matrix currentmatrix exch % cmtx tilingtype % Tiling type 1 and 3: constant spacing 2 ne { % Distort the pattern so that it occupies % an integral number of device pixels dup 4 get exch dup 5 get exch % tx ty cmtx XStep 0 dtransform round exch round exch % tx ty cmtx dx.x dx.y XStep div exch XStep div exch % tx ty cmtx a b 0 YStep dtransform round exch round exch % tx ty cmtx a b dy.x dy.y YStep div exch YStep div exch % tx ty cmtx a b c d 7 -3 roll astore % { a b c d tx ty } } if grestore } bind def /PATusp { false PATredef PATDict begin CColor PATsc end } bind def % right45 11 dict begin /PaintType 1 def /PatternType 1 def /TilingType 1 def /BBox [0 0 1 1] def /XStep 1 def /YStep 1 def /PatWidth 1 def /PatHeight 1 def /Multi 2 def /PaintData [ { clippath } bind { 32 32 true [ 32 0 0 -32 0 32 ] {<010101010202020204040404080808081010101020202020 404040408080808001010101020202020404040408080808 101010102020202040404040808080800101010102020202 040404040808080810101010202020204040404080808080 010101010202020204040404080808081010101020202020 4040404080808080>} imagemask } bind ] def /PaintProc { pop exec fill } def currentdict end /P5 exch def 1.1111 1.1111 scale %restore scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc 30.000 slw % Arc gs n 2400.0 3879.9 1821.6 -171.2 -8.8 arcn gs col-1 s gr gr % Ellipse n 2400 3600 1800 825 0 360 DrawEllipse gs col-1 s gr % Polyline gs clippath 7512 4110 m 7944 4200 l 7512 4290 l 8070 4290 l 8070 4110 l cp clip n 6825 4200 m 8025 4200 l gs col-1 s gr gr % arrowhead n 7512 4110 m 7944 4200 l 7512 4290 l 7584 4200 l 7512 4110 l cp gs 0.00 setgray ef gr col-1 s % Open spline gs 0.000 slw n 600.0 3600.0 m 600.0 3862.5 l 600.0 3862.5 600.0 4125.0 675.0 4387.5 DrawSplineSection 675.0 4387.5 750.0 4650.0 862.5 4800.0 DrawSplineSection 862.5 4800.0 975.0 4950.0 1087.5 5062.5 DrawSplineSection 1087.5 5062.5 1200.0 5175.0 1350.0 5325.0 DrawSplineSection 1350.0 5325.0 1500.0 5475.0 1762.5 5550.0 DrawSplineSection 1762.5 5550.0 2025.0 5625.0 2250.0 5662.5 DrawSplineSection 2250.0 5662.5 2475.0 5700.0 2700.0 5662.5 DrawSplineSection 2700.0 5662.5 2925.0 5625.0 3112.5 5550.0 DrawSplineSection 3112.5 5550.0 3300.0 5475.0 3487.5 5325.0 DrawSplineSection 3487.5 5325.0 3675.0 5175.0 3787.5 5062.5 DrawSplineSection 3787.5 5062.5 3900.0 4950.0 3975.0 4800.0 DrawSplineSection 3975.0 4800.0 4050.0 4650.0 4125.0 4462.5 DrawSplineSection 4125.0 4462.5 4200.0 4275.0 4200.0 4125.0 DrawSplineSection 4200.0 4125.0 4200.0 3975.0 4200.0 3825.0 DrawSplineSection 4200.0 3825.0 4200.0 3675.0 4125.0 3825.0 DrawSplineSection 4125.0 3825.0 4050.0 3975.0 3900.0 4087.5 DrawSplineSection 3900.0 4087.5 3750.0 4200.0 3525.0 4275.0 DrawSplineSection 3525.0 4275.0 3300.0 4350.0 3037.5 4387.5 DrawSplineSection 3037.5 4387.5 2775.0 4425.0 2475.0 4425.0 DrawSplineSection 2475.0 4425.0 2175.0 4425.0 2062.5 4425.0 DrawSplineSection 2062.5 4425.0 1950.0 4425.0 1800.0 4387.5 DrawSplineSection 1800.0 4387.5 1650.0 4350.0 1462.5 4312.5 DrawSplineSection 1462.5 4312.5 1275.0 4275.0 1125.0 4200.0 DrawSplineSection 1125.0 4200.0 975.0 4125.0 862.5 4050.0 DrawSplineSection 862.5 4050.0 750.0 3975.0 675.0 3900.0 DrawSplineSection 675.0 3900.0 600.0 3825.0 600.0 3712.5 DrawSplineSection 600.0 3600.0 l gs /PC [[1.00 1.00 1.00] [0.00 0.00 0.00]] def 15.00 15.00 sc P5 [16 0 0 -16 40.00 245.00] PATmp PATsp ef gr PATusp gr /Times-Roman ff 750.00 scf sf 5325 4425 m gs 1 -1 sc (1:) col-1 sh gr /Times-Italic ff 750.00 scf sf 6150 4425 m gs 1 -1 sc (k) col-1 sh gr /Times-Italic ff 750.00 scf sf 8325 4425 m gs 1 -1 sc (A) col-1 sh gr $F2psEnd rs end %%EndDocument @endspecial 456 2055 a(On)h(the)i(other)e(hand,)i(since)p 1401 1984 V 30 w FJ(S)1457 2031 y FM(1)1520 2055 y FQ(=)c FJ(S)1668 2025 y FM(1)1705 2055 y FQ(,)k(w)n(e)e(can)h(also)f(write)h FJ(@)5 b(D)2542 2025 y FM(1)2606 2055 y FQ(=)p 2697 1984 V 26 w FJ(S)2753 2031 y FM(1)2810 2055 y FL(t)21 b(;)29 b FQ(whic)n(h)h(giv)n(es)f(a)456 2155 y(map)e(tr)9 b(:)28 b FJ(A)23 b FL(!)g FJ(k)s FQ(:)1538 2540 y @beginspecial 0 @llx 0 @lly 99 @urx 36 @ury 990 @rwi @setspecial %%BeginDocument: figures/tr.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: tr.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 12:08:38 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 99 36 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /MyAppDict 100 dict dup begin def /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -6.0 68.0 translate 1 -1 scale .9 .9 scale % to make patterns same scale as in xfig % This junk string is used by the show operators /PATsstr 1 string def /PATawidthshow { % cx cy cchar rx ry string % Loop over each character in the string { % cx cy cchar rx ry char % Show the character dup % cx cy cchar rx ry char char PATsstr dup 0 4 -1 roll put % cx cy cchar rx ry char (char) false charpath % cx cy cchar rx ry char /clip load PATdraw % Move past the character (charpath modified the % current point) currentpoint % cx cy cchar rx ry char x y newpath moveto % cx cy cchar rx ry char % Reposition by cx,cy if the character in the string is cchar 3 index eq { % cx cy cchar rx ry 4 index 4 index rmoveto } if % Reposition all characters by rx ry 2 copy rmoveto % cx cy cchar rx ry } forall pop pop pop pop pop % - currentpoint newpath moveto } bind def /PATcg { 7 dict dup begin /lw currentlinewidth def /lc currentlinecap def /lj currentlinejoin def /ml currentmiterlimit def /ds [ currentdash ] def /cc [ currentrgbcolor ] def /cm matrix currentmatrix def end } bind def % PATdraw - calculates the boundaries of the object and % fills it with the current pattern /PATdraw { % proc save exch PATpcalc % proc nw nh px py 5 -1 roll exec % nw nh px py newpath PATfill % - restore } bind def % PATfill - performs the tiling for the shape /PATfill { % nw nh px py PATfill - PATDict /CurrentPattern get dup begin setfont % Set the coordinate system to Pattern Space PatternGState PATsg % Set the color for uncolored pattezns PaintType 2 eq { PATDict /PColor get PATsc } if % Create the string for showing 3 index string % nw nh px py str % Loop for each of the pattern sources 0 1 Multi 1 sub { % nw nh px py str source % Move to the starting location 3 index 3 index % nw nh px py str source px py moveto % nw nh px py str source % For multiple sources, set the appropriate color Multi 1 ne { dup PC exch get PATsc } if % Set the appropriate string for the source 0 1 7 index 1 sub { 2 index exch 2 index put } for pop % Loop over the number of vertical cells 3 index % nw nh px py str nh { % nw nh px py str currentpoint % nw nh px py str cx cy 2 index show % nw nh px py str cx cy YStep add moveto % nw nh px py str } repeat % nw nh px py str } for 5 { pop } repeat end } bind def % PATkshow - kshow with the current pattezn /PATkshow { % proc string exch bind % string proc 1 index 0 get % string proc char % Loop over all but the last character in the string 0 1 4 index length 2 sub { % string proc char idx % Find the n+1th character in the string 3 index exch 1 add get % string proe char char+1 exch 2 copy % strinq proc char+1 char char+1 char % Now show the nth character PATsstr dup 0 4 -1 roll put % string proc chr+1 chr chr+1 (chr) false charpath % string proc char+1 char char+1 /clip load PATdraw % Move past the character (charpath modified the current point) currentpoint newpath moveto % Execute the user proc (should consume char and char+1) mark 3 1 roll % string proc char+1 mark char char+1 4 index exec % string proc char+1 mark... cleartomark % string proc char+1 } for % Now display the last character PATsstr dup 0 4 -1 roll put % string proc (char+1) false charpath % string proc /clip load PATdraw neewath pop pop % - } bind def % PATmp - the makepattern equivalent /PATmp { % patdict patmtx PATmp patinstance exch dup length 7 add % We will add 6 new entries plus 1 FID dict copy % Create a new dictionary begin % Matrix to install when painting the pattern TilingType PATtcalc /PatternGState PATcg def PatternGState /cm 3 -1 roll put % Check for multi pattern sources (Level 1 fast color patterns) currentdict /Multi known not { /Multi 1 def } if % Font dictionary definitions /FontType 3 def % Create a dummy encoding vector /Encoding 256 array def 3 string 0 1 255 { Encoding exch dup 3 index cvs cvn put } for pop /FontMatrix matrix def /FontBBox BBox def /BuildChar { mark 3 1 roll % mark dict char exch begin Multi 1 ne {PaintData exch get}{pop} ifelse % mark [paintdata] PaintType 2 eq Multi 1 ne or { XStep 0 FontBBox aload pop setcachedevice } { XStep 0 setcharwidth } ifelse currentdict % mark [paintdata] dict /PaintProc load % mark [paintdata] dict paintproc end gsave false PATredef exec true PATredef grestore cleartomark % - } bind def currentdict end % newdict /foo exch % /foo newlict definefont % newfont } bind def % PATpcalc - calculates the starting point and width/height % of the tile fill for the shape /PATpcalc { % - PATpcalc nw nh px py PATDict /CurrentPattern get begin gsave % Set up the coordinate system to Pattern Space % and lock down pattern PatternGState /cm get setmatrix BBox aload pop pop pop translate % Determine the bounding box of the shape pathbbox % llx lly urx ury grestore % Determine (nw, nh) the # of cells to paint width and height PatHeight div ceiling % llx lly urx qh 4 1 roll % qh llx lly urx PatWidth div ceiling % qh llx lly qw 4 1 roll % qw qh llx lly PatHeight div floor % qw qh llx ph 4 1 roll % ph qw qh llx PatWidth div floor % ph qw qh pw 4 1 roll % pw ph qw qh 2 index sub cvi abs % pw ph qs qh-ph exch 3 index sub cvi abs exch % pw ph nw=qw-pw nh=qh-ph % Determine the starting point of the pattern fill %(px, py) 4 2 roll % nw nh pw ph PatHeight mul % nw nh pw py exch % nw nh py pw PatWidth mul exch % nw nh px py end } bind def % Save the original routines so that we can use them later on /oldfill /fill load def /oldeofill /eofill load def /oldstroke /stroke load def /oldshow /show load def /oldashow /ashow load def /oldwidthshow /widthshow load def /oldawidthshow /awidthshow load def /oldkshow /kshow load def % These defs are necessary so that subsequent procs don't bind in % the originals /fill { oldfill } bind def /eofill { oldeofill } bind def /stroke { oldstroke } bind def /show { oldshow } bind def /ashow { oldashow } bind def /widthshow { oldwidthshow } bind def /awidthshow { oldawidthshow } bind def /kshow { oldkshow } bind def /PATredef { MyAppDict begin { /fill { /clip load PATdraw newpath } bind def /eofill { /eoclip load PATdraw newpath } bind def /stroke { PATstroke } bind def /show { 0 0 null 0 0 6 -1 roll PATawidthshow } bind def /ashow { 0 0 null 6 3 roll PATawidthshow } bind def /widthshow { 0 0 3 -1 roll PATawidthshow } bind def /awidthshow { PATawidthshow } bind def /kshow { PATkshow } bind def } { /fill { oldfill } bind def /eofill { oldeofill } bind def /stroke { oldstroke } bind def /show { oldshow } bind def /ashow { oldashow } bind def /widthshow { oldwidthshow } bind def /awidthshow { oldawidthshow } bind def /kshow { oldkshow } bind def } ifelse end } bind def false PATredef % Conditionally define setcmykcolor if not available /setcmykcolor where { pop } { /setcmykcolor { 1 sub 4 1 roll 3 { 3 index add neg dup 0 lt { pop 0 } if 3 1 roll } repeat setrgbcolor - pop } bind def } ifelse /PATsc { % colorarray aload length % c1 ... cn length dup 1 eq { pop setgray } { 3 eq { setrgbcolor } { setcmykcolor } ifelse } ifelse } bind def /PATsg { % dict begin lw setlinewidth lc setlinecap lj setlinejoin ml setmiterlimit ds aload pop setdash cc aload pop setrgbcolor cm setmatrix end } bind def /PATDict 3 dict def /PATsp { true PATredef PATDict begin /CurrentPattern exch def % If it's an uncolored pattern, save the color CurrentPattern /PaintType get 2 eq { /PColor exch def } if /CColor [ currentrgbcolor ] def end } bind def % PATstroke - stroke with the current pattern /PATstroke { countdictstack save mark { currentpoint strokepath moveto PATpcalc % proc nw nh px py clip newpath PATfill } stopped { (*** PATstroke Warning: Path is too complex, stroking with gray) = cleartomark restore countdictstack exch sub dup 0 gt { { end } repeat } { pop } ifelse gsave 0.5 setgray oldstroke grestore } { pop restore pop } ifelse newpath } bind def /PATtcalc { % modmtx tilingtype PATtcalc tilematrix % Note: tiling types 2 and 3 are not supported gsave exch concat % tilingtype matrix currentmatrix exch % cmtx tilingtype % Tiling type 1 and 3: constant spacing 2 ne { % Distort the pattern so that it occupies % an integral number of device pixels dup 4 get exch dup 5 get exch % tx ty cmtx XStep 0 dtransform round exch round exch % tx ty cmtx dx.x dx.y XStep div exch XStep div exch % tx ty cmtx a b 0 YStep dtransform round exch round exch % tx ty cmtx a b dy.x dy.y YStep div exch YStep div exch % tx ty cmtx a b c d 7 -3 roll astore % { a b c d tx ty } } if grestore } bind def /PATusp { false PATredef PATDict begin CColor PATsc end } bind def % right45 11 dict begin /PaintType 1 def /PatternType 1 def /TilingType 1 def /BBox [0 0 1 1] def /XStep 1 def /YStep 1 def /PatWidth 1 def /PatHeight 1 def /Multi 2 def /PaintData [ { clippath } bind { 32 32 true [ 32 0 0 -32 0 32 ] {<010101010202020204040404080808081010101020202020 404040408080808001010101020202020404040408080808 101010102020202040404040808080800101010102020202 040404040808080810101010202020204040404080808080 010101010202020204040404080808081010101020202020 4040404080808080>} imagemask } bind ] def /PaintProc { pop exec fill } def currentdict end /P5 exch def 1.1111 1.1111 scale %restore scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc 30.000 slw % Arc gs n 2400.0 4520.1 1821.6 171.2 8.8 arc gs col-1 s gr gr % Ellipse n 2400 4800 1800 825 0 360 DrawEllipse gs col-1 s gr % Polyline gs clippath 7512 4110 m 7944 4200 l 7512 4290 l 8070 4290 l 8070 4110 l cp clip n 6825 4200 m 8025 4200 l gs col-1 s gr gr % arrowhead n 7512 4110 m 7944 4200 l 7512 4290 l 7584 4200 l 7512 4110 l cp gs 0.00 setgray ef gr col-1 s % Open spline gs 0.000 slw n 600.0 4800.0 m 600.0 4537.5 l 600.0 4537.5 600.0 4275.0 675.0 4012.5 DrawSplineSection 675.0 4012.5 750.0 3750.0 862.5 3600.0 DrawSplineSection 862.5 3600.0 975.0 3450.0 1087.5 3337.5 DrawSplineSection 1087.5 3337.5 1200.0 3225.0 1350.0 3075.0 DrawSplineSection 1350.0 3075.0 1500.0 2925.0 1762.5 2850.0 DrawSplineSection 1762.5 2850.0 2025.0 2775.0 2250.0 2737.5 DrawSplineSection 2250.0 2737.5 2475.0 2700.0 2700.0 2737.5 DrawSplineSection 2700.0 2737.5 2925.0 2775.0 3112.5 2850.0 DrawSplineSection 3112.5 2850.0 3300.0 2925.0 3487.5 3075.0 DrawSplineSection 3487.5 3075.0 3675.0 3225.0 3787.5 3337.5 DrawSplineSection 3787.5 3337.5 3900.0 3450.0 3975.0 3600.0 DrawSplineSection 3975.0 3600.0 4050.0 3750.0 4125.0 3937.5 DrawSplineSection 4125.0 3937.5 4200.0 4125.0 4200.0 4275.0 DrawSplineSection 4200.0 4275.0 4200.0 4425.0 4200.0 4575.0 DrawSplineSection 4200.0 4575.0 4200.0 4725.0 4125.0 4575.0 DrawSplineSection 4125.0 4575.0 4050.0 4425.0 3900.0 4312.5 DrawSplineSection 3900.0 4312.5 3750.0 4200.0 3525.0 4125.0 DrawSplineSection 3525.0 4125.0 3300.0 4050.0 3037.5 4012.5 DrawSplineSection 3037.5 4012.5 2775.0 3975.0 2475.0 3975.0 DrawSplineSection 2475.0 3975.0 2175.0 3975.0 2062.5 3975.0 DrawSplineSection 2062.5 3975.0 1950.0 3975.0 1800.0 4012.5 DrawSplineSection 1800.0 4012.5 1650.0 4050.0 1462.5 4087.5 DrawSplineSection 1462.5 4087.5 1275.0 4125.0 1125.0 4200.0 DrawSplineSection 1125.0 4200.0 975.0 4275.0 862.5 4350.0 DrawSplineSection 862.5 4350.0 750.0 4425.0 675.0 4500.0 DrawSplineSection 675.0 4500.0 600.0 4575.0 600.0 4687.5 DrawSplineSection 600.0 4800.0 l gs /PC [[1.00 1.00 1.00] [0.00 0.00 0.00]] def 15.00 15.00 sc P5 [16 0 0 -16 40.00 180.00] PATmp PATsp ef gr PATusp gr /Times-Roman ff 750.00 scf sf 5325 4425 m gs 1 -1 sc (tr:) col-1 sh gr /Times-Italic ff 750.00 scf sf 6150 4425 m gs 1 -1 sc (A) col-1 sh gr /Times-Italic ff 750.00 scf sf 8325 4425 m gs 1 -1 sc (k) col-1 sh gr $F2psEnd rs end %%EndDocument @endspecial 456 2672 a(The)36 b(pair)g(of)h(pan)n(ts)g(\(also)f (called)g(a)g FO(trinion)6 b FQ(\))38 b(giv)n(es)e(a)g(map)h FJ(A)24 b FL(\012)h FJ(A)38 b FL(!)h FJ(A)e FQ(whic)n(h)f(is)h(the)456 2772 y(m)n(ultiplication)27 b FJ(a)19 b FL(\012)f FJ(b)k FL(7!)h FJ(ab)p FQ(:)1421 3349 y @beginspecial 0 @llx 0 @lly 127 @urx 59 @ury 1270 @rwi @setspecial %%BeginDocument: figures/mult.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: mult.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 14:55:34 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 127 59 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -6.0 80.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc 30.000 slw % Polyline gs clippath 9687 4110 m 10119 4200 l 9687 4290 l 10245 4290 l 10245 4110 l cp clip n 9000 4200 m 10200 4200 l gs col-1 s gr gr % arrowhead n 9687 4110 m 10119 4200 l 9687 4290 l 9759 4200 l 9687 4110 l cp gs 0.00 setgray ef gr col-1 s % Polyline % % Begin Imported EPS File: pants.eps %BeginDocument: pants.eps % n gs 525 1800 tr 45.714286 -52.747253 sc 0 -91 tr 0 0 tr sa /showpage {} def % EPS file follows: %!PS-Adobe-2.0 EPSF-2.0 %%Title: pants.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 12:45:11 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.18 %%Orientation: Portrait %%BoundingBox: 0 0 105 91 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -19.0 101.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01080 0.01080 sc 30.000 slw % Arc gs n 6615.2 8400.5 1200.6 178.6 2.1 arc gs col-1 s gr gr % Ellipse n 6600 1800 1800 825 0 360 DrawEllipse gs col-1 s gr % Open spline gs n 4800.0 1785.0 m 4807.5 2685.0 l 4807.5 2685.0 4815.0 3585.0 3315.0 4800.0 DrawSplineSection 3315.0 4800.0 1815.0 6015.0 1815.0 7200.0 DrawSplineSection 1815.0 8385.0 l gs col-1 s gr gr % Open spline gs n 1800.0 8415.0 m 1807.5 8482.5 l 1807.5 8482.5 1815.0 8550.0 1905.0 8670.0 DrawSplineSection 1905.0 8670.0 1995.0 8790.0 2122.5 8865.0 DrawSplineSection 2122.5 8865.0 2250.0 8940.0 2407.5 9030.0 DrawSplineSection 2407.5 9030.0 2565.0 9120.0 2730.0 9157.5 DrawSplineSection 2730.0 9157.5 2895.0 9195.0 3060.0 9217.5 DrawSplineSection 3060.0 9217.5 3225.0 9240.0 3397.5 9247.5 DrawSplineSection 3397.5 9247.5 3570.0 9255.0 3780.0 9247.5 DrawSplineSection 3780.0 9247.5 3990.0 9240.0 4162.5 9217.5 DrawSplineSection 4162.5 9217.5 4335.0 9195.0 4477.5 9150.0 DrawSplineSection 4477.5 9150.0 4620.0 9105.0 4747.5 9060.0 DrawSplineSection 4747.5 9060.0 4875.0 9015.0 5032.5 8925.0 DrawSplineSection 5032.5 8925.0 5190.0 8835.0 5295.0 8700.0 DrawSplineSection 5295.0 8700.0 5400.0 8565.0 5400.0 8490.0 DrawSplineSection 5400.0 8415.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 1800.0 8385.0 m 1807.5 8317.5 l 1807.5 8317.5 1815.0 8250.0 1905.0 8130.0 DrawSplineSection 1905.0 8130.0 1995.0 8010.0 2122.5 7935.0 DrawSplineSection 2122.5 7935.0 2250.0 7860.0 2407.5 7770.0 DrawSplineSection 2407.5 7770.0 2565.0 7680.0 2730.0 7642.5 DrawSplineSection 2730.0 7642.5 2895.0 7605.0 3060.0 7582.5 DrawSplineSection 3060.0 7582.5 3225.0 7560.0 3397.5 7552.5 DrawSplineSection 3397.5 7552.5 3570.0 7545.0 3780.0 7552.5 DrawSplineSection 3780.0 7552.5 3990.0 7560.0 4162.5 7582.5 DrawSplineSection 4162.5 7582.5 4335.0 7605.0 4477.5 7650.0 DrawSplineSection 4477.5 7650.0 4620.0 7695.0 4747.5 7740.0 DrawSplineSection 4747.5 7740.0 4875.0 7785.0 5032.5 7875.0 DrawSplineSection 5032.5 7875.0 5190.0 7965.0 5295.0 8100.0 DrawSplineSection 5295.0 8100.0 5400.0 8235.0 5400.0 8310.0 DrawSplineSection 5400.0 8385.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 7815.0 8460.0 m 7822.5 8527.5 l 7822.5 8527.5 7830.0 8595.0 7920.0 8715.0 DrawSplineSection 7920.0 8715.0 8010.0 8835.0 8137.5 8910.0 DrawSplineSection 8137.5 8910.0 8265.0 8985.0 8422.5 9075.0 DrawSplineSection 8422.5 9075.0 8580.0 9165.0 8745.0 9202.5 DrawSplineSection 8745.0 9202.5 8910.0 9240.0 9075.0 9262.5 DrawSplineSection 9075.0 9262.5 9240.0 9285.0 9412.5 9292.5 DrawSplineSection 9412.5 9292.5 9585.0 9300.0 9795.0 9292.5 DrawSplineSection 9795.0 9292.5 10005.0 9285.0 10177.5 9262.5 DrawSplineSection 10177.5 9262.5 10350.0 9240.0 10492.5 9195.0 DrawSplineSection 10492.5 9195.0 10635.0 9150.0 10762.5 9105.0 DrawSplineSection 10762.5 9105.0 10890.0 9060.0 11047.5 8970.0 DrawSplineSection 11047.5 8970.0 11205.0 8880.0 11310.0 8745.0 DrawSplineSection 11310.0 8745.0 11415.0 8610.0 11415.0 8535.0 DrawSplineSection 11415.0 8460.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 7800.0 8385.0 m 7807.5 8317.5 l 7807.5 8317.5 7815.0 8250.0 7905.0 8130.0 DrawSplineSection 7905.0 8130.0 7995.0 8010.0 8122.5 7935.0 DrawSplineSection 8122.5 7935.0 8250.0 7860.0 8407.5 7770.0 DrawSplineSection 8407.5 7770.0 8565.0 7680.0 8730.0 7642.5 DrawSplineSection 8730.0 7642.5 8895.0 7605.0 9060.0 7582.5 DrawSplineSection 9060.0 7582.5 9225.0 7560.0 9397.5 7552.5 DrawSplineSection 9397.5 7552.5 9570.0 7545.0 9780.0 7552.5 DrawSplineSection 9780.0 7552.5 9990.0 7560.0 10162.5 7582.5 DrawSplineSection 10162.5 7582.5 10335.0 7605.0 10477.5 7650.0 DrawSplineSection 10477.5 7650.0 10620.0 7695.0 10747.5 7740.0 DrawSplineSection 10747.5 7740.0 10875.0 7785.0 11032.5 7875.0 DrawSplineSection 11032.5 7875.0 11190.0 7965.0 11295.0 8100.0 DrawSplineSection 11295.0 8100.0 11400.0 8235.0 11400.0 8310.0 DrawSplineSection 11400.0 8385.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 8415.0 1785.0 m 8407.5 2685.0 l 8407.5 2685.0 8400.0 3585.0 9900.0 4800.0 DrawSplineSection 9900.0 4800.0 11400.0 6015.0 11400.0 7200.0 DrawSplineSection 11400.0 8385.0 l gs col-1 s gr gr $F2psEnd rs rs gr % % End Imported PIC File: pants.eps %EndDocument % % Polyline % % Begin Imported EPS File: tensor.eps %BeginDocument: tensor.eps % n gs 7350 3900 tr 85.714286 -85.714286 sc 0 -7 tr 0 0 tr sa /showpage {} def % EPS file follows: %!PS-Adobe-2.0 EPSF-2.0 %%Title: tensor.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 12:53:56 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 7 7 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -67.0 80.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc 15.000 slw % Ellipse n 5850 6375 225 225 0 360 DrawEllipse gs col-1 s gr % Polyline n 6000 6225 m 5700 6525 l gs col-1 s gr % Polyline n 5700 6225 m 6000 6525 l gs col-1 s gr $F2psEnd rs rs gr % % End Imported PIC File: tensor.eps %EndDocument % /Times-Italic ff 750.00 scf sf 10575 4425 m gs 1 -1 sc (A) col-1 sh gr /Times-Italic ff 750.00 scf sf 8175 4425 m gs 1 -1 sc (A) col-1 sh gr /Times-Italic ff 750.00 scf sf 6675 4425 m gs 1 -1 sc (A) col-1 sh gr $F2psEnd rs %%EndDocument @endspecial 456 3476 a(No)n(w)k(the)i(comm)n(utativit)n(y)e(of)h(m)n (ultiplication)h(follo)n(ws)e(from)h(the)g(fact)g(that)h(the)f (\015ipping)h(of)456 3576 y(the)f(legs)e(is)i(a)f(homeomorphism:)1304 4236 y @beginspecial 0 @llx 0 @lly 155 @urx 69 @ury 1550 @rwi @setspecial %%BeginDocument: figures/commut.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: commut.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 13:03:07 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 155 69 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -6.0 90.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc % Polyline % % Begin Imported EPS File: pants.eps %BeginDocument: pants.eps % n gs 525 1800 tr 45.714286 -52.747253 sc 0 -91 tr 0 0 tr sa /showpage {} def % EPS file follows: %!PS-Adobe-2.0 EPSF-2.0 %%Title: pants.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 12:45:11 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.18 %%Orientation: Portrait %%BoundingBox: 0 0 105 91 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -19.0 101.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01080 0.01080 sc 30.000 slw % Arc gs n 6615.2 8400.5 1200.6 178.6 2.1 arc gs col-1 s gr gr % Ellipse n 6600 1800 1800 825 0 360 DrawEllipse gs col-1 s gr % Open spline gs n 4800.0 1785.0 m 4807.5 2685.0 l 4807.5 2685.0 4815.0 3585.0 3315.0 4800.0 DrawSplineSection 3315.0 4800.0 1815.0 6015.0 1815.0 7200.0 DrawSplineSection 1815.0 8385.0 l gs col-1 s gr gr % Open spline gs n 1800.0 8415.0 m 1807.5 8482.5 l 1807.5 8482.5 1815.0 8550.0 1905.0 8670.0 DrawSplineSection 1905.0 8670.0 1995.0 8790.0 2122.5 8865.0 DrawSplineSection 2122.5 8865.0 2250.0 8940.0 2407.5 9030.0 DrawSplineSection 2407.5 9030.0 2565.0 9120.0 2730.0 9157.5 DrawSplineSection 2730.0 9157.5 2895.0 9195.0 3060.0 9217.5 DrawSplineSection 3060.0 9217.5 3225.0 9240.0 3397.5 9247.5 DrawSplineSection 3397.5 9247.5 3570.0 9255.0 3780.0 9247.5 DrawSplineSection 3780.0 9247.5 3990.0 9240.0 4162.5 9217.5 DrawSplineSection 4162.5 9217.5 4335.0 9195.0 4477.5 9150.0 DrawSplineSection 4477.5 9150.0 4620.0 9105.0 4747.5 9060.0 DrawSplineSection 4747.5 9060.0 4875.0 9015.0 5032.5 8925.0 DrawSplineSection 5032.5 8925.0 5190.0 8835.0 5295.0 8700.0 DrawSplineSection 5295.0 8700.0 5400.0 8565.0 5400.0 8490.0 DrawSplineSection 5400.0 8415.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 1800.0 8385.0 m 1807.5 8317.5 l 1807.5 8317.5 1815.0 8250.0 1905.0 8130.0 DrawSplineSection 1905.0 8130.0 1995.0 8010.0 2122.5 7935.0 DrawSplineSection 2122.5 7935.0 2250.0 7860.0 2407.5 7770.0 DrawSplineSection 2407.5 7770.0 2565.0 7680.0 2730.0 7642.5 DrawSplineSection 2730.0 7642.5 2895.0 7605.0 3060.0 7582.5 DrawSplineSection 3060.0 7582.5 3225.0 7560.0 3397.5 7552.5 DrawSplineSection 3397.5 7552.5 3570.0 7545.0 3780.0 7552.5 DrawSplineSection 3780.0 7552.5 3990.0 7560.0 4162.5 7582.5 DrawSplineSection 4162.5 7582.5 4335.0 7605.0 4477.5 7650.0 DrawSplineSection 4477.5 7650.0 4620.0 7695.0 4747.5 7740.0 DrawSplineSection 4747.5 7740.0 4875.0 7785.0 5032.5 7875.0 DrawSplineSection 5032.5 7875.0 5190.0 7965.0 5295.0 8100.0 DrawSplineSection 5295.0 8100.0 5400.0 8235.0 5400.0 8310.0 DrawSplineSection 5400.0 8385.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 7815.0 8460.0 m 7822.5 8527.5 l 7822.5 8527.5 7830.0 8595.0 7920.0 8715.0 DrawSplineSection 7920.0 8715.0 8010.0 8835.0 8137.5 8910.0 DrawSplineSection 8137.5 8910.0 8265.0 8985.0 8422.5 9075.0 DrawSplineSection 8422.5 9075.0 8580.0 9165.0 8745.0 9202.5 DrawSplineSection 8745.0 9202.5 8910.0 9240.0 9075.0 9262.5 DrawSplineSection 9075.0 9262.5 9240.0 9285.0 9412.5 9292.5 DrawSplineSection 9412.5 9292.5 9585.0 9300.0 9795.0 9292.5 DrawSplineSection 9795.0 9292.5 10005.0 9285.0 10177.5 9262.5 DrawSplineSection 10177.5 9262.5 10350.0 9240.0 10492.5 9195.0 DrawSplineSection 10492.5 9195.0 10635.0 9150.0 10762.5 9105.0 DrawSplineSection 10762.5 9105.0 10890.0 9060.0 11047.5 8970.0 DrawSplineSection 11047.5 8970.0 11205.0 8880.0 11310.0 8745.0 DrawSplineSection 11310.0 8745.0 11415.0 8610.0 11415.0 8535.0 DrawSplineSection 11415.0 8460.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 7800.0 8385.0 m 7807.5 8317.5 l 7807.5 8317.5 7815.0 8250.0 7905.0 8130.0 DrawSplineSection 7905.0 8130.0 7995.0 8010.0 8122.5 7935.0 DrawSplineSection 8122.5 7935.0 8250.0 7860.0 8407.5 7770.0 DrawSplineSection 8407.5 7770.0 8565.0 7680.0 8730.0 7642.5 DrawSplineSection 8730.0 7642.5 8895.0 7605.0 9060.0 7582.5 DrawSplineSection 9060.0 7582.5 9225.0 7560.0 9397.5 7552.5 DrawSplineSection 9397.5 7552.5 9570.0 7545.0 9780.0 7552.5 DrawSplineSection 9780.0 7552.5 9990.0 7560.0 10162.5 7582.5 DrawSplineSection 10162.5 7582.5 10335.0 7605.0 10477.5 7650.0 DrawSplineSection 10477.5 7650.0 10620.0 7695.0 10747.5 7740.0 DrawSplineSection 10747.5 7740.0 10875.0 7785.0 11032.5 7875.0 DrawSplineSection 11032.5 7875.0 11190.0 7965.0 11295.0 8100.0 DrawSplineSection 11295.0 8100.0 11400.0 8235.0 11400.0 8310.0 DrawSplineSection 11400.0 8385.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 8415.0 1785.0 m 8407.5 2685.0 l 8407.5 2685.0 8400.0 3585.0 9900.0 4800.0 DrawSplineSection 9900.0 4800.0 11400.0 6015.0 11400.0 7200.0 DrawSplineSection 11400.0 8385.0 l gs col-1 s gr gr $F2psEnd rs rs gr % % End Imported PIC File: pants.eps %EndDocument % % Polyline % % Begin Imported EPS File: pants.eps %BeginDocument: pants.eps % n gs 8550 1800 tr 45.714286 -52.747253 sc 0 -91 tr 0 0 tr sa /showpage {} def % EPS file follows: %!PS-Adobe-2.0 EPSF-2.0 %%Title: pants.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 12:45:11 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.18 %%Orientation: Portrait %%BoundingBox: 0 0 105 91 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -19.0 101.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01080 0.01080 sc 30.000 slw % Arc gs n 6615.2 8400.5 1200.6 178.6 2.1 arc gs col-1 s gr gr % Ellipse n 6600 1800 1800 825 0 360 DrawEllipse gs col-1 s gr % Open spline gs n 4800.0 1785.0 m 4807.5 2685.0 l 4807.5 2685.0 4815.0 3585.0 3315.0 4800.0 DrawSplineSection 3315.0 4800.0 1815.0 6015.0 1815.0 7200.0 DrawSplineSection 1815.0 8385.0 l gs col-1 s gr gr % Open spline gs n 1800.0 8415.0 m 1807.5 8482.5 l 1807.5 8482.5 1815.0 8550.0 1905.0 8670.0 DrawSplineSection 1905.0 8670.0 1995.0 8790.0 2122.5 8865.0 DrawSplineSection 2122.5 8865.0 2250.0 8940.0 2407.5 9030.0 DrawSplineSection 2407.5 9030.0 2565.0 9120.0 2730.0 9157.5 DrawSplineSection 2730.0 9157.5 2895.0 9195.0 3060.0 9217.5 DrawSplineSection 3060.0 9217.5 3225.0 9240.0 3397.5 9247.5 DrawSplineSection 3397.5 9247.5 3570.0 9255.0 3780.0 9247.5 DrawSplineSection 3780.0 9247.5 3990.0 9240.0 4162.5 9217.5 DrawSplineSection 4162.5 9217.5 4335.0 9195.0 4477.5 9150.0 DrawSplineSection 4477.5 9150.0 4620.0 9105.0 4747.5 9060.0 DrawSplineSection 4747.5 9060.0 4875.0 9015.0 5032.5 8925.0 DrawSplineSection 5032.5 8925.0 5190.0 8835.0 5295.0 8700.0 DrawSplineSection 5295.0 8700.0 5400.0 8565.0 5400.0 8490.0 DrawSplineSection 5400.0 8415.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 1800.0 8385.0 m 1807.5 8317.5 l 1807.5 8317.5 1815.0 8250.0 1905.0 8130.0 DrawSplineSection 1905.0 8130.0 1995.0 8010.0 2122.5 7935.0 DrawSplineSection 2122.5 7935.0 2250.0 7860.0 2407.5 7770.0 DrawSplineSection 2407.5 7770.0 2565.0 7680.0 2730.0 7642.5 DrawSplineSection 2730.0 7642.5 2895.0 7605.0 3060.0 7582.5 DrawSplineSection 3060.0 7582.5 3225.0 7560.0 3397.5 7552.5 DrawSplineSection 3397.5 7552.5 3570.0 7545.0 3780.0 7552.5 DrawSplineSection 3780.0 7552.5 3990.0 7560.0 4162.5 7582.5 DrawSplineSection 4162.5 7582.5 4335.0 7605.0 4477.5 7650.0 DrawSplineSection 4477.5 7650.0 4620.0 7695.0 4747.5 7740.0 DrawSplineSection 4747.5 7740.0 4875.0 7785.0 5032.5 7875.0 DrawSplineSection 5032.5 7875.0 5190.0 7965.0 5295.0 8100.0 DrawSplineSection 5295.0 8100.0 5400.0 8235.0 5400.0 8310.0 DrawSplineSection 5400.0 8385.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 7815.0 8460.0 m 7822.5 8527.5 l 7822.5 8527.5 7830.0 8595.0 7920.0 8715.0 DrawSplineSection 7920.0 8715.0 8010.0 8835.0 8137.5 8910.0 DrawSplineSection 8137.5 8910.0 8265.0 8985.0 8422.5 9075.0 DrawSplineSection 8422.5 9075.0 8580.0 9165.0 8745.0 9202.5 DrawSplineSection 8745.0 9202.5 8910.0 9240.0 9075.0 9262.5 DrawSplineSection 9075.0 9262.5 9240.0 9285.0 9412.5 9292.5 DrawSplineSection 9412.5 9292.5 9585.0 9300.0 9795.0 9292.5 DrawSplineSection 9795.0 9292.5 10005.0 9285.0 10177.5 9262.5 DrawSplineSection 10177.5 9262.5 10350.0 9240.0 10492.5 9195.0 DrawSplineSection 10492.5 9195.0 10635.0 9150.0 10762.5 9105.0 DrawSplineSection 10762.5 9105.0 10890.0 9060.0 11047.5 8970.0 DrawSplineSection 11047.5 8970.0 11205.0 8880.0 11310.0 8745.0 DrawSplineSection 11310.0 8745.0 11415.0 8610.0 11415.0 8535.0 DrawSplineSection 11415.0 8460.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 7800.0 8385.0 m 7807.5 8317.5 l 7807.5 8317.5 7815.0 8250.0 7905.0 8130.0 DrawSplineSection 7905.0 8130.0 7995.0 8010.0 8122.5 7935.0 DrawSplineSection 8122.5 7935.0 8250.0 7860.0 8407.5 7770.0 DrawSplineSection 8407.5 7770.0 8565.0 7680.0 8730.0 7642.5 DrawSplineSection 8730.0 7642.5 8895.0 7605.0 9060.0 7582.5 DrawSplineSection 9060.0 7582.5 9225.0 7560.0 9397.5 7552.5 DrawSplineSection 9397.5 7552.5 9570.0 7545.0 9780.0 7552.5 DrawSplineSection 9780.0 7552.5 9990.0 7560.0 10162.5 7582.5 DrawSplineSection 10162.5 7582.5 10335.0 7605.0 10477.5 7650.0 DrawSplineSection 10477.5 7650.0 10620.0 7695.0 10747.5 7740.0 DrawSplineSection 10747.5 7740.0 10875.0 7785.0 11032.5 7875.0 DrawSplineSection 11032.5 7875.0 11190.0 7965.0 11295.0 8100.0 DrawSplineSection 11295.0 8100.0 11400.0 8235.0 11400.0 8310.0 DrawSplineSection 11400.0 8385.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 8415.0 1785.0 m 8407.5 2685.0 l 8407.5 2685.0 8400.0 3585.0 9900.0 4800.0 DrawSplineSection 9900.0 4800.0 11400.0 6015.0 11400.0 7200.0 DrawSplineSection 11400.0 8385.0 l gs col-1 s gr gr $F2psEnd rs rs gr % % End Imported PIC File: pants.eps %EndDocument % /Times-Roman ff 900.00 scf sf 6675 4725 m gs 1 -1 sc (=) col-1 sh gr /Times-Roman ff 675.00 scf sf 1200 7350 m gs 1 -1 sc (1) col-1 sh gr /Times-Roman ff 675.00 scf sf 12225 7350 m gs 1 -1 sc (1) col-1 sh gr /Times-Roman ff 675.00 scf sf 4200 7350 m gs 1 -1 sc (2) col-1 sh gr /Times-Roman ff 675.00 scf sf 9300 7350 m gs 1 -1 sc (2) col-1 sh gr $F2psEnd rs %%EndDocument @endspecial 456 4363 a(Similarly)-7 b(,)27 b(asso)r(ciativit)n(y)f (follo)n(ws)g(from)i(the)g(picture)983 5216 y @beginspecial 0 @llx 0 @lly 232 @urx 92 @ury 2320 @rwi @setspecial %%BeginDocument: figures/assoc.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: assoc.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 15:01:50 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.18 %%Orientation: Portrait %%BoundingBox: 0 0 232 92 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -5.0 130.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01080 0.01080 sc 30.000 slw % Ellipse n 5025 4125 900 525 0 360 DrawEllipse gs col-1 s gr % Ellipse n 17250 4125 900 525 0 360 DrawEllipse gs col-1 s gr % Polyline % % Begin Imported EPS File: ellips.eps %BeginDocument: ellips.eps % n gs 7800 10800 tr 41.666667 -54.545455 sc 0 -22 tr 0 0 tr sa /showpage {} def % EPS file follows: %!PS-Adobe-2.0 EPSF-2.0 %%Title: ellips.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 13:32:03 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 45 22 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -21.0 83.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc % Open spline gs 30.000 slw n 1800.0 6000.0 m 1807.5 6067.5 l 1807.5 6067.5 1815.0 6135.0 1905.0 6255.0 DrawSplineSection 1905.0 6255.0 1995.0 6375.0 2122.5 6450.0 DrawSplineSection 2122.5 6450.0 2250.0 6525.0 2407.5 6615.0 DrawSplineSection 2407.5 6615.0 2565.0 6705.0 2730.0 6742.5 DrawSplineSection 2730.0 6742.5 2895.0 6780.0 3060.0 6802.5 DrawSplineSection 3060.0 6802.5 3225.0 6825.0 3397.5 6832.5 DrawSplineSection 3397.5 6832.5 3570.0 6840.0 3780.0 6832.5 DrawSplineSection 3780.0 6832.5 3990.0 6825.0 4162.5 6802.5 DrawSplineSection 4162.5 6802.5 4335.0 6780.0 4477.5 6735.0 DrawSplineSection 4477.5 6735.0 4620.0 6690.0 4747.5 6645.0 DrawSplineSection 4747.5 6645.0 4875.0 6600.0 5032.5 6510.0 DrawSplineSection 5032.5 6510.0 5190.0 6420.0 5295.0 6285.0 DrawSplineSection 5295.0 6285.0 5400.0 6150.0 5400.0 6075.0 DrawSplineSection 5400.0 6000.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 1800.0 6000.0 m 1807.5 5932.5 l 1807.5 5932.5 1815.0 5865.0 1905.0 5745.0 DrawSplineSection 1905.0 5745.0 1995.0 5625.0 2122.5 5550.0 DrawSplineSection 2122.5 5550.0 2250.0 5475.0 2407.5 5385.0 DrawSplineSection 2407.5 5385.0 2565.0 5295.0 2730.0 5257.5 DrawSplineSection 2730.0 5257.5 2895.0 5220.0 3060.0 5197.5 DrawSplineSection 3060.0 5197.5 3225.0 5175.0 3397.5 5167.5 DrawSplineSection 3397.5 5167.5 3570.0 5160.0 3780.0 5167.5 DrawSplineSection 3780.0 5167.5 3990.0 5175.0 4162.5 5197.5 DrawSplineSection 4162.5 5197.5 4335.0 5220.0 4477.5 5265.0 DrawSplineSection 4477.5 5265.0 4620.0 5310.0 4747.5 5355.0 DrawSplineSection 4747.5 5355.0 4875.0 5400.0 5032.5 5490.0 DrawSplineSection 5032.5 5490.0 5190.0 5580.0 5295.0 5715.0 DrawSplineSection 5295.0 5715.0 5400.0 5850.0 5400.0 5925.0 DrawSplineSection 5400.0 6000.0 l gs col-1 s gr gr [] 0 sd $F2psEnd rs rs gr % % End Imported PIC File: ellips.eps %EndDocument % % Polyline % % Begin Imported EPS File: ellips.eps %BeginDocument: ellips.eps % n gs 12675 10800 tr 41.666667 -54.545455 sc 0 -22 tr 0 0 tr sa /showpage {} def % EPS file follows: %!PS-Adobe-2.0 EPSF-2.0 %%Title: ellips.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 13:32:03 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 45 22 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -21.0 83.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc % Open spline gs 30.000 slw n 1800.0 6000.0 m 1807.5 6067.5 l 1807.5 6067.5 1815.0 6135.0 1905.0 6255.0 DrawSplineSection 1905.0 6255.0 1995.0 6375.0 2122.5 6450.0 DrawSplineSection 2122.5 6450.0 2250.0 6525.0 2407.5 6615.0 DrawSplineSection 2407.5 6615.0 2565.0 6705.0 2730.0 6742.5 DrawSplineSection 2730.0 6742.5 2895.0 6780.0 3060.0 6802.5 DrawSplineSection 3060.0 6802.5 3225.0 6825.0 3397.5 6832.5 DrawSplineSection 3397.5 6832.5 3570.0 6840.0 3780.0 6832.5 DrawSplineSection 3780.0 6832.5 3990.0 6825.0 4162.5 6802.5 DrawSplineSection 4162.5 6802.5 4335.0 6780.0 4477.5 6735.0 DrawSplineSection 4477.5 6735.0 4620.0 6690.0 4747.5 6645.0 DrawSplineSection 4747.5 6645.0 4875.0 6600.0 5032.5 6510.0 DrawSplineSection 5032.5 6510.0 5190.0 6420.0 5295.0 6285.0 DrawSplineSection 5295.0 6285.0 5400.0 6150.0 5400.0 6075.0 DrawSplineSection 5400.0 6000.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 1800.0 6000.0 m 1807.5 5932.5 l 1807.5 5932.5 1815.0 5865.0 1905.0 5745.0 DrawSplineSection 1905.0 5745.0 1995.0 5625.0 2122.5 5550.0 DrawSplineSection 2122.5 5550.0 2250.0 5475.0 2407.5 5385.0 DrawSplineSection 2407.5 5385.0 2565.0 5295.0 2730.0 5257.5 DrawSplineSection 2730.0 5257.5 2895.0 5220.0 3060.0 5197.5 DrawSplineSection 3060.0 5197.5 3225.0 5175.0 3397.5 5167.5 DrawSplineSection 3397.5 5167.5 3570.0 5160.0 3780.0 5167.5 DrawSplineSection 3780.0 5167.5 3990.0 5175.0 4162.5 5197.5 DrawSplineSection 4162.5 5197.5 4335.0 5220.0 4477.5 5265.0 DrawSplineSection 4477.5 5265.0 4620.0 5310.0 4747.5 5355.0 DrawSplineSection 4747.5 5355.0 4875.0 5400.0 5032.5 5490.0 DrawSplineSection 5032.5 5490.0 5190.0 5580.0 5295.0 5715.0 DrawSplineSection 5295.0 5715.0 5400.0 5850.0 5400.0 5925.0 DrawSplineSection 5400.0 6000.0 l gs col-1 s gr gr [] 0 sd $F2psEnd rs rs gr % % End Imported PIC File: ellips.eps %EndDocument % % Polyline % % Begin Imported EPS File: pants2.eps %BeginDocument: pants2.eps % n gs 525 7125 tr 41.025641 -47.058824 sc 0 -102 tr 0 0 tr sa /showpage {} def % EPS file follows: %!PS-Adobe-2.0 EPSF-2.0 %%Title: pants2.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 14:58:42 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 117 102 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -21.0 112.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc 30.000 slw % Arc gs n 6615.2 8400.5 1200.6 178.6 2.1 arc gs col-1 s gr gr % Open spline gs n 4800.0 1785.0 m 4807.5 2685.0 l 4807.5 2685.0 4815.0 3585.0 3315.0 4800.0 DrawSplineSection 3315.0 4800.0 1815.0 6015.0 1815.0 7200.0 DrawSplineSection 1815.0 8385.0 l gs col-1 s gr gr % Open spline gs n 1800.0 8415.0 m 1807.5 8482.5 l 1807.5 8482.5 1815.0 8550.0 1905.0 8670.0 DrawSplineSection 1905.0 8670.0 1995.0 8790.0 2122.5 8865.0 DrawSplineSection 2122.5 8865.0 2250.0 8940.0 2407.5 9030.0 DrawSplineSection 2407.5 9030.0 2565.0 9120.0 2730.0 9157.5 DrawSplineSection 2730.0 9157.5 2895.0 9195.0 3060.0 9217.5 DrawSplineSection 3060.0 9217.5 3225.0 9240.0 3397.5 9247.5 DrawSplineSection 3397.5 9247.5 3570.0 9255.0 3780.0 9247.5 DrawSplineSection 3780.0 9247.5 3990.0 9240.0 4162.5 9217.5 DrawSplineSection 4162.5 9217.5 4335.0 9195.0 4477.5 9150.0 DrawSplineSection 4477.5 9150.0 4620.0 9105.0 4747.5 9060.0 DrawSplineSection 4747.5 9060.0 4875.0 9015.0 5032.5 8925.0 DrawSplineSection 5032.5 8925.0 5190.0 8835.0 5295.0 8700.0 DrawSplineSection 5295.0 8700.0 5400.0 8565.0 5400.0 8490.0 DrawSplineSection 5400.0 8415.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 1800.0 8385.0 m 1807.5 8317.5 l 1807.5 8317.5 1815.0 8250.0 1905.0 8130.0 DrawSplineSection 1905.0 8130.0 1995.0 8010.0 2122.5 7935.0 DrawSplineSection 2122.5 7935.0 2250.0 7860.0 2407.5 7770.0 DrawSplineSection 2407.5 7770.0 2565.0 7680.0 2730.0 7642.5 DrawSplineSection 2730.0 7642.5 2895.0 7605.0 3060.0 7582.5 DrawSplineSection 3060.0 7582.5 3225.0 7560.0 3397.5 7552.5 DrawSplineSection 3397.5 7552.5 3570.0 7545.0 3780.0 7552.5 DrawSplineSection 3780.0 7552.5 3990.0 7560.0 4162.5 7582.5 DrawSplineSection 4162.5 7582.5 4335.0 7605.0 4477.5 7650.0 DrawSplineSection 4477.5 7650.0 4620.0 7695.0 4747.5 7740.0 DrawSplineSection 4747.5 7740.0 4875.0 7785.0 5032.5 7875.0 DrawSplineSection 5032.5 7875.0 5190.0 7965.0 5295.0 8100.0 DrawSplineSection 5295.0 8100.0 5400.0 8235.0 5400.0 8310.0 DrawSplineSection 5400.0 8385.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 7815.0 8460.0 m 7822.5 8527.5 l 7822.5 8527.5 7830.0 8595.0 7920.0 8715.0 DrawSplineSection 7920.0 8715.0 8010.0 8835.0 8137.5 8910.0 DrawSplineSection 8137.5 8910.0 8265.0 8985.0 8422.5 9075.0 DrawSplineSection 8422.5 9075.0 8580.0 9165.0 8745.0 9202.5 DrawSplineSection 8745.0 9202.5 8910.0 9240.0 9075.0 9262.5 DrawSplineSection 9075.0 9262.5 9240.0 9285.0 9412.5 9292.5 DrawSplineSection 9412.5 9292.5 9585.0 9300.0 9795.0 9292.5 DrawSplineSection 9795.0 9292.5 10005.0 9285.0 10177.5 9262.5 DrawSplineSection 10177.5 9262.5 10350.0 9240.0 10492.5 9195.0 DrawSplineSection 10492.5 9195.0 10635.0 9150.0 10762.5 9105.0 DrawSplineSection 10762.5 9105.0 10890.0 9060.0 11047.5 8970.0 DrawSplineSection 11047.5 8970.0 11205.0 8880.0 11310.0 8745.0 DrawSplineSection 11310.0 8745.0 11415.0 8610.0 11415.0 8535.0 DrawSplineSection 11415.0 8460.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 7800.0 8385.0 m 7807.5 8317.5 l 7807.5 8317.5 7815.0 8250.0 7905.0 8130.0 DrawSplineSection 7905.0 8130.0 7995.0 8010.0 8122.5 7935.0 DrawSplineSection 8122.5 7935.0 8250.0 7860.0 8407.5 7770.0 DrawSplineSection 8407.5 7770.0 8565.0 7680.0 8730.0 7642.5 DrawSplineSection 8730.0 7642.5 8895.0 7605.0 9060.0 7582.5 DrawSplineSection 9060.0 7582.5 9225.0 7560.0 9397.5 7552.5 DrawSplineSection 9397.5 7552.5 9570.0 7545.0 9780.0 7552.5 DrawSplineSection 9780.0 7552.5 9990.0 7560.0 10162.5 7582.5 DrawSplineSection 10162.5 7582.5 10335.0 7605.0 10477.5 7650.0 DrawSplineSection 10477.5 7650.0 10620.0 7695.0 10747.5 7740.0 DrawSplineSection 10747.5 7740.0 10875.0 7785.0 11032.5 7875.0 DrawSplineSection 11032.5 7875.0 11190.0 7965.0 11295.0 8100.0 DrawSplineSection 11295.0 8100.0 11400.0 8235.0 11400.0 8310.0 DrawSplineSection 11400.0 8385.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 8415.0 1785.0 m 8407.5 2685.0 l 8407.5 2685.0 8400.0 3585.0 9900.0 4800.0 DrawSplineSection 9900.0 4800.0 11400.0 6015.0 11400.0 7200.0 DrawSplineSection 11400.0 8385.0 l gs col-1 s gr gr % Open spline gs n 4785.0 1755.0 m 4792.5 1822.5 l 4792.5 1822.5 4800.0 1890.0 4890.0 2010.0 DrawSplineSection 4890.0 2010.0 4980.0 2130.0 5107.5 2205.0 DrawSplineSection 5107.5 2205.0 5235.0 2280.0 5392.5 2370.0 DrawSplineSection 5392.5 2370.0 5550.0 2460.0 5715.0 2497.5 DrawSplineSection 5715.0 2497.5 5880.0 2535.0 6045.0 2557.5 DrawSplineSection 6045.0 2557.5 6210.0 2580.0 6382.5 2587.5 DrawSplineSection 6382.5 2587.5 6555.0 2595.0 6765.0 2587.5 DrawSplineSection 6765.0 2587.5 6975.0 2580.0 7147.5 2557.5 DrawSplineSection 7147.5 2557.5 7320.0 2535.0 7462.5 2490.0 DrawSplineSection 7462.5 2490.0 7605.0 2445.0 7732.5 2400.0 DrawSplineSection 7732.5 2400.0 7860.0 2355.0 8017.5 2265.0 DrawSplineSection 8017.5 2265.0 8175.0 2175.0 8280.0 2040.0 DrawSplineSection 8280.0 2040.0 8385.0 1905.0 8385.0 1830.0 DrawSplineSection 8385.0 1755.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 4830.0 1740.0 m 4837.5 1672.5 l 4837.5 1672.5 4845.0 1605.0 4935.0 1485.0 DrawSplineSection 4935.0 1485.0 5025.0 1365.0 5152.5 1290.0 DrawSplineSection 5152.5 1290.0 5280.0 1215.0 5437.5 1125.0 DrawSplineSection 5437.5 1125.0 5595.0 1035.0 5760.0 997.5 DrawSplineSection 5760.0 997.5 5925.0 960.0 6090.0 937.5 DrawSplineSection 6090.0 937.5 6255.0 915.0 6427.5 907.5 DrawSplineSection 6427.5 907.5 6600.0 900.0 6810.0 907.5 DrawSplineSection 6810.0 907.5 7020.0 915.0 7192.5 937.5 DrawSplineSection 7192.5 937.5 7365.0 960.0 7507.5 1005.0 DrawSplineSection 7507.5 1005.0 7650.0 1050.0 7777.5 1095.0 DrawSplineSection 7777.5 1095.0 7905.0 1140.0 8062.5 1230.0 DrawSplineSection 8062.5 1230.0 8220.0 1320.0 8325.0 1455.0 DrawSplineSection 8325.0 1455.0 8430.0 1590.0 8430.0 1665.0 DrawSplineSection 8430.0 1740.0 l gs col-1 s gr gr [] 0 sd $F2psEnd rs rs gr % % End Imported PIC File: pants2.eps %EndDocument % % Polyline % % Begin Imported EPS File: pants2.eps %BeginDocument: pants2.eps % n gs 17100 7050 tr 41.025641 -47.058824 sc 0 -102 tr 0 0 tr sa /showpage {} def % EPS file follows: %!PS-Adobe-2.0 EPSF-2.0 %%Title: pants2.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 14:58:42 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 117 102 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -21.0 112.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc 30.000 slw % Arc gs n 6615.2 8400.5 1200.6 178.6 2.1 arc gs col-1 s gr gr % Open spline gs n 4800.0 1785.0 m 4807.5 2685.0 l 4807.5 2685.0 4815.0 3585.0 3315.0 4800.0 DrawSplineSection 3315.0 4800.0 1815.0 6015.0 1815.0 7200.0 DrawSplineSection 1815.0 8385.0 l gs col-1 s gr gr % Open spline gs n 1800.0 8415.0 m 1807.5 8482.5 l 1807.5 8482.5 1815.0 8550.0 1905.0 8670.0 DrawSplineSection 1905.0 8670.0 1995.0 8790.0 2122.5 8865.0 DrawSplineSection 2122.5 8865.0 2250.0 8940.0 2407.5 9030.0 DrawSplineSection 2407.5 9030.0 2565.0 9120.0 2730.0 9157.5 DrawSplineSection 2730.0 9157.5 2895.0 9195.0 3060.0 9217.5 DrawSplineSection 3060.0 9217.5 3225.0 9240.0 3397.5 9247.5 DrawSplineSection 3397.5 9247.5 3570.0 9255.0 3780.0 9247.5 DrawSplineSection 3780.0 9247.5 3990.0 9240.0 4162.5 9217.5 DrawSplineSection 4162.5 9217.5 4335.0 9195.0 4477.5 9150.0 DrawSplineSection 4477.5 9150.0 4620.0 9105.0 4747.5 9060.0 DrawSplineSection 4747.5 9060.0 4875.0 9015.0 5032.5 8925.0 DrawSplineSection 5032.5 8925.0 5190.0 8835.0 5295.0 8700.0 DrawSplineSection 5295.0 8700.0 5400.0 8565.0 5400.0 8490.0 DrawSplineSection 5400.0 8415.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 1800.0 8385.0 m 1807.5 8317.5 l 1807.5 8317.5 1815.0 8250.0 1905.0 8130.0 DrawSplineSection 1905.0 8130.0 1995.0 8010.0 2122.5 7935.0 DrawSplineSection 2122.5 7935.0 2250.0 7860.0 2407.5 7770.0 DrawSplineSection 2407.5 7770.0 2565.0 7680.0 2730.0 7642.5 DrawSplineSection 2730.0 7642.5 2895.0 7605.0 3060.0 7582.5 DrawSplineSection 3060.0 7582.5 3225.0 7560.0 3397.5 7552.5 DrawSplineSection 3397.5 7552.5 3570.0 7545.0 3780.0 7552.5 DrawSplineSection 3780.0 7552.5 3990.0 7560.0 4162.5 7582.5 DrawSplineSection 4162.5 7582.5 4335.0 7605.0 4477.5 7650.0 DrawSplineSection 4477.5 7650.0 4620.0 7695.0 4747.5 7740.0 DrawSplineSection 4747.5 7740.0 4875.0 7785.0 5032.5 7875.0 DrawSplineSection 5032.5 7875.0 5190.0 7965.0 5295.0 8100.0 DrawSplineSection 5295.0 8100.0 5400.0 8235.0 5400.0 8310.0 DrawSplineSection 5400.0 8385.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 7815.0 8460.0 m 7822.5 8527.5 l 7822.5 8527.5 7830.0 8595.0 7920.0 8715.0 DrawSplineSection 7920.0 8715.0 8010.0 8835.0 8137.5 8910.0 DrawSplineSection 8137.5 8910.0 8265.0 8985.0 8422.5 9075.0 DrawSplineSection 8422.5 9075.0 8580.0 9165.0 8745.0 9202.5 DrawSplineSection 8745.0 9202.5 8910.0 9240.0 9075.0 9262.5 DrawSplineSection 9075.0 9262.5 9240.0 9285.0 9412.5 9292.5 DrawSplineSection 9412.5 9292.5 9585.0 9300.0 9795.0 9292.5 DrawSplineSection 9795.0 9292.5 10005.0 9285.0 10177.5 9262.5 DrawSplineSection 10177.5 9262.5 10350.0 9240.0 10492.5 9195.0 DrawSplineSection 10492.5 9195.0 10635.0 9150.0 10762.5 9105.0 DrawSplineSection 10762.5 9105.0 10890.0 9060.0 11047.5 8970.0 DrawSplineSection 11047.5 8970.0 11205.0 8880.0 11310.0 8745.0 DrawSplineSection 11310.0 8745.0 11415.0 8610.0 11415.0 8535.0 DrawSplineSection 11415.0 8460.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 7800.0 8385.0 m 7807.5 8317.5 l 7807.5 8317.5 7815.0 8250.0 7905.0 8130.0 DrawSplineSection 7905.0 8130.0 7995.0 8010.0 8122.5 7935.0 DrawSplineSection 8122.5 7935.0 8250.0 7860.0 8407.5 7770.0 DrawSplineSection 8407.5 7770.0 8565.0 7680.0 8730.0 7642.5 DrawSplineSection 8730.0 7642.5 8895.0 7605.0 9060.0 7582.5 DrawSplineSection 9060.0 7582.5 9225.0 7560.0 9397.5 7552.5 DrawSplineSection 9397.5 7552.5 9570.0 7545.0 9780.0 7552.5 DrawSplineSection 9780.0 7552.5 9990.0 7560.0 10162.5 7582.5 DrawSplineSection 10162.5 7582.5 10335.0 7605.0 10477.5 7650.0 DrawSplineSection 10477.5 7650.0 10620.0 7695.0 10747.5 7740.0 DrawSplineSection 10747.5 7740.0 10875.0 7785.0 11032.5 7875.0 DrawSplineSection 11032.5 7875.0 11190.0 7965.0 11295.0 8100.0 DrawSplineSection 11295.0 8100.0 11400.0 8235.0 11400.0 8310.0 DrawSplineSection 11400.0 8385.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 8415.0 1785.0 m 8407.5 2685.0 l 8407.5 2685.0 8400.0 3585.0 9900.0 4800.0 DrawSplineSection 9900.0 4800.0 11400.0 6015.0 11400.0 7200.0 DrawSplineSection 11400.0 8385.0 l gs col-1 s gr gr % Open spline gs n 4785.0 1755.0 m 4792.5 1822.5 l 4792.5 1822.5 4800.0 1890.0 4890.0 2010.0 DrawSplineSection 4890.0 2010.0 4980.0 2130.0 5107.5 2205.0 DrawSplineSection 5107.5 2205.0 5235.0 2280.0 5392.5 2370.0 DrawSplineSection 5392.5 2370.0 5550.0 2460.0 5715.0 2497.5 DrawSplineSection 5715.0 2497.5 5880.0 2535.0 6045.0 2557.5 DrawSplineSection 6045.0 2557.5 6210.0 2580.0 6382.5 2587.5 DrawSplineSection 6382.5 2587.5 6555.0 2595.0 6765.0 2587.5 DrawSplineSection 6765.0 2587.5 6975.0 2580.0 7147.5 2557.5 DrawSplineSection 7147.5 2557.5 7320.0 2535.0 7462.5 2490.0 DrawSplineSection 7462.5 2490.0 7605.0 2445.0 7732.5 2400.0 DrawSplineSection 7732.5 2400.0 7860.0 2355.0 8017.5 2265.0 DrawSplineSection 8017.5 2265.0 8175.0 2175.0 8280.0 2040.0 DrawSplineSection 8280.0 2040.0 8385.0 1905.0 8385.0 1830.0 DrawSplineSection 8385.0 1755.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 4830.0 1740.0 m 4837.5 1672.5 l 4837.5 1672.5 4845.0 1605.0 4935.0 1485.0 DrawSplineSection 4935.0 1485.0 5025.0 1365.0 5152.5 1290.0 DrawSplineSection 5152.5 1290.0 5280.0 1215.0 5437.5 1125.0 DrawSplineSection 5437.5 1125.0 5595.0 1035.0 5760.0 997.5 DrawSplineSection 5760.0 997.5 5925.0 960.0 6090.0 937.5 DrawSplineSection 6090.0 937.5 6255.0 915.0 6427.5 907.5 DrawSplineSection 6427.5 907.5 6600.0 900.0 6810.0 907.5 DrawSplineSection 6810.0 907.5 7020.0 915.0 7192.5 937.5 DrawSplineSection 7192.5 937.5 7365.0 960.0 7507.5 1005.0 DrawSplineSection 7507.5 1005.0 7650.0 1050.0 7777.5 1095.0 DrawSplineSection 7777.5 1095.0 7905.0 1140.0 8062.5 1230.0 DrawSplineSection 8062.5 1230.0 8220.0 1320.0 8325.0 1455.0 DrawSplineSection 8325.0 1455.0 8430.0 1590.0 8430.0 1665.0 DrawSplineSection 8430.0 1740.0 l gs col-1 s gr gr [] 0 sd $F2psEnd rs rs gr % % End Imported PIC File: pants2.eps %EndDocument % % Open spline gs n 4125.0 4200.0 m 4125.0 4612.5 l 4125.0 4612.5 4125.0 5025.0 3075.0 5850.0 DrawSplineSection 3075.0 5850.0 2025.0 6675.0 2010.0 7237.5 DrawSplineSection 1995.0 7800.0 l gs col-1 s gr gr % Open spline gs n 3750.0 7725.0 m 3750.0 7312.5 l 3750.0 7312.5 3750.0 6900.0 4200.0 6675.0 DrawSplineSection 4200.0 6675.0 4650.0 6450.0 5475.0 6487.5 DrawSplineSection 5475.0 6487.5 6300.0 6525.0 6862.5 7875.0 DrawSplineSection 6862.5 7875.0 7425.0 9225.0 7612.5 9975.0 DrawSplineSection 7612.5 9975.0 7800.0 10725.0 7800.0 11062.5 DrawSplineSection 7800.0 11400.0 l gs col-1 s gr gr % Open spline gs n 5925.0 4125.0 m 5925.0 4575.0 l 5925.0 4575.0 5925.0 5025.0 6787.5 5437.5 DrawSplineSection 6787.5 5437.5 7650.0 5850.0 8287.5 7087.5 DrawSplineSection 8287.5 7087.5 8925.0 8325.0 9262.5 9487.5 DrawSplineSection 9262.5 9487.5 9600.0 10650.0 9600.0 11062.5 DrawSplineSection 9600.0 11475.0 l gs col-1 s gr gr % Open spline gs n 16350.0 4125.0 m 16350.0 4575.0 l 16350.0 4575.0 16350.0 5025.0 15487.5 5437.5 DrawSplineSection 15487.5 5437.5 14625.0 5850.0 13987.5 7087.5 DrawSplineSection 13987.5 7087.5 13350.0 8325.0 13012.5 9487.5 DrawSplineSection 13012.5 9487.5 12675.0 10650.0 12675.0 11062.5 DrawSplineSection 12675.0 11475.0 l gs col-1 s gr gr % Open spline gs n 18600.0 7725.0 m 18600.0 7312.5 l 18600.0 7312.5 18600.0 6900.0 18112.5 6675.0 DrawSplineSection 18112.5 6675.0 17625.0 6450.0 16800.0 6487.5 DrawSplineSection 16800.0 6487.5 15975.0 6525.0 15412.5 7875.0 DrawSplineSection 15412.5 7875.0 14850.0 9225.0 14662.5 9975.0 DrawSplineSection 14662.5 9975.0 14475.0 10725.0 14475.0 11062.5 DrawSplineSection 14475.0 11400.0 l gs col-1 s gr gr % Open spline gs n 18150.0 4200.0 m 18150.0 4612.5 l 18150.0 4612.5 18150.0 5025.0 19237.5 5812.5 DrawSplineSection 19237.5 5812.5 20325.0 6600.0 20325.0 7125.0 DrawSplineSection 20325.0 7650.0 l gs col-1 s gr gr /Times-Roman ff 1050.00 scf sf 11175 8250 m gs 1 -1 sc (=) col-1 sh gr $F2psEnd rs %%EndDocument @endspecial eop %%Page: 80 10 80 83 bop 456 226 a FM(80)404 b(4.)29 b(3-DIMENSIONAL)g(TOPOLOGICAL)h (QUANTUM)f(FIELD)g(THEOR)-5 b(Y)456 425 y FQ(and)31 b(the)h(gluing)f (axiom.)47 b(The)32 b(unit)g(prop)r(ert)n(y)e(of)i(1)f(is)g(a)g (consequence)f(of)i(the)g(gluing)f(and)456 525 y(normalization)26 b(axioms:)1492 1131 y @beginspecial 0 @llx 0 @lly 110 @urx 67 @ury 1100 @rwi @setspecial %%BeginDocument: figures/unit2.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: unit2.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 15:33:43 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 110 67 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /MyAppDict 100 dict dup begin def /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -13.0 123.0 translate 1 -1 scale .9 .9 scale % to make patterns same scale as in xfig % This junk string is used by the show operators /PATsstr 1 string def /PATawidthshow { % cx cy cchar rx ry string % Loop over each character in the string { % cx cy cchar rx ry char % Show the character dup % cx cy cchar rx ry char char PATsstr dup 0 4 -1 roll put % cx cy cchar rx ry char (char) false charpath % cx cy cchar rx ry char /clip load PATdraw % Move past the character (charpath modified the % current point) currentpoint % cx cy cchar rx ry char x y newpath moveto % cx cy cchar rx ry char % Reposition by cx,cy if the character in the string is cchar 3 index eq { % cx cy cchar rx ry 4 index 4 index rmoveto } if % Reposition all characters by rx ry 2 copy rmoveto % cx cy cchar rx ry } forall pop pop pop pop pop % - currentpoint newpath moveto } bind def /PATcg { 7 dict dup begin /lw currentlinewidth def /lc currentlinecap def /lj currentlinejoin def /ml currentmiterlimit def /ds [ currentdash ] def /cc [ currentrgbcolor ] def /cm matrix currentmatrix def end } bind def % PATdraw - calculates the boundaries of the object and % fills it with the current pattern /PATdraw { % proc save exch PATpcalc % proc nw nh px py 5 -1 roll exec % nw nh px py newpath PATfill % - restore } bind def % PATfill - performs the tiling for the shape /PATfill { % nw nh px py PATfill - PATDict /CurrentPattern get dup begin setfont % Set the coordinate system to Pattern Space PatternGState PATsg % Set the color for uncolored pattezns PaintType 2 eq { PATDict /PColor get PATsc } if % Create the string for showing 3 index string % nw nh px py str % Loop for each of the pattern sources 0 1 Multi 1 sub { % nw nh px py str source % Move to the starting location 3 index 3 index % nw nh px py str source px py moveto % nw nh px py str source % For multiple sources, set the appropriate color Multi 1 ne { dup PC exch get PATsc } if % Set the appropriate string for the source 0 1 7 index 1 sub { 2 index exch 2 index put } for pop % Loop over the number of vertical cells 3 index % nw nh px py str nh { % nw nh px py str currentpoint % nw nh px py str cx cy 2 index show % nw nh px py str cx cy YStep add moveto % nw nh px py str } repeat % nw nh px py str } for 5 { pop } repeat end } bind def % PATkshow - kshow with the current pattezn /PATkshow { % proc string exch bind % string proc 1 index 0 get % string proc char % Loop over all but the last character in the string 0 1 4 index length 2 sub { % string proc char idx % Find the n+1th character in the string 3 index exch 1 add get % string proe char char+1 exch 2 copy % strinq proc char+1 char char+1 char % Now show the nth character PATsstr dup 0 4 -1 roll put % string proc chr+1 chr chr+1 (chr) false charpath % string proc char+1 char char+1 /clip load PATdraw % Move past the character (charpath modified the current point) currentpoint newpath moveto % Execute the user proc (should consume char and char+1) mark 3 1 roll % string proc char+1 mark char char+1 4 index exec % string proc char+1 mark... cleartomark % string proc char+1 } for % Now display the last character PATsstr dup 0 4 -1 roll put % string proc (char+1) false charpath % string proc /clip load PATdraw neewath pop pop % - } bind def % PATmp - the makepattern equivalent /PATmp { % patdict patmtx PATmp patinstance exch dup length 7 add % We will add 6 new entries plus 1 FID dict copy % Create a new dictionary begin % Matrix to install when painting the pattern TilingType PATtcalc /PatternGState PATcg def PatternGState /cm 3 -1 roll put % Check for multi pattern sources (Level 1 fast color patterns) currentdict /Multi known not { /Multi 1 def } if % Font dictionary definitions /FontType 3 def % Create a dummy encoding vector /Encoding 256 array def 3 string 0 1 255 { Encoding exch dup 3 index cvs cvn put } for pop /FontMatrix matrix def /FontBBox BBox def /BuildChar { mark 3 1 roll % mark dict char exch begin Multi 1 ne {PaintData exch get}{pop} ifelse % mark [paintdata] PaintType 2 eq Multi 1 ne or { XStep 0 FontBBox aload pop setcachedevice } { XStep 0 setcharwidth } ifelse currentdict % mark [paintdata] dict /PaintProc load % mark [paintdata] dict paintproc end gsave false PATredef exec true PATredef grestore cleartomark % - } bind def currentdict end % newdict /foo exch % /foo newlict definefont % newfont } bind def % PATpcalc - calculates the starting point and width/height % of the tile fill for the shape /PATpcalc { % - PATpcalc nw nh px py PATDict /CurrentPattern get begin gsave % Set up the coordinate system to Pattern Space % and lock down pattern PatternGState /cm get setmatrix BBox aload pop pop pop translate % Determine the bounding box of the shape pathbbox % llx lly urx ury grestore % Determine (nw, nh) the # of cells to paint width and height PatHeight div ceiling % llx lly urx qh 4 1 roll % qh llx lly urx PatWidth div ceiling % qh llx lly qw 4 1 roll % qw qh llx lly PatHeight div floor % qw qh llx ph 4 1 roll % ph qw qh llx PatWidth div floor % ph qw qh pw 4 1 roll % pw ph qw qh 2 index sub cvi abs % pw ph qs qh-ph exch 3 index sub cvi abs exch % pw ph nw=qw-pw nh=qh-ph % Determine the starting point of the pattern fill %(px, py) 4 2 roll % nw nh pw ph PatHeight mul % nw nh pw py exch % nw nh py pw PatWidth mul exch % nw nh px py end } bind def % Save the original routines so that we can use them later on /oldfill /fill load def /oldeofill /eofill load def /oldstroke /stroke load def /oldshow /show load def /oldashow /ashow load def /oldwidthshow /widthshow load def /oldawidthshow /awidthshow load def /oldkshow /kshow load def % These defs are necessary so that subsequent procs don't bind in % the originals /fill { oldfill } bind def /eofill { oldeofill } bind def /stroke { oldstroke } bind def /show { oldshow } bind def /ashow { oldashow } bind def /widthshow { oldwidthshow } bind def /awidthshow { oldawidthshow } bind def /kshow { oldkshow } bind def /PATredef { MyAppDict begin { /fill { /clip load PATdraw newpath } bind def /eofill { /eoclip load PATdraw newpath } bind def /stroke { PATstroke } bind def /show { 0 0 null 0 0 6 -1 roll PATawidthshow } bind def /ashow { 0 0 null 6 3 roll PATawidthshow } bind def /widthshow { 0 0 3 -1 roll PATawidthshow } bind def /awidthshow { PATawidthshow } bind def /kshow { PATkshow } bind def } { /fill { oldfill } bind def /eofill { oldeofill } bind def /stroke { oldstroke } bind def /show { oldshow } bind def /ashow { oldashow } bind def /widthshow { oldwidthshow } bind def /awidthshow { oldawidthshow } bind def /kshow { oldkshow } bind def } ifelse end } bind def false PATredef % Conditionally define setcmykcolor if not available /setcmykcolor where { pop } { /setcmykcolor { 1 sub 4 1 roll 3 { 3 index add neg dup 0 lt { pop 0 } if 3 1 roll } repeat setrgbcolor - pop } bind def } ifelse /PATsc { % colorarray aload length % c1 ... cn length dup 1 eq { pop setgray } { 3 eq { setrgbcolor } { setcmykcolor } ifelse } ifelse } bind def /PATsg { % dict begin lw setlinewidth lc setlinecap lj setlinejoin ml setmiterlimit ds aload pop setdash cc aload pop setrgbcolor cm setmatrix end } bind def /PATDict 3 dict def /PATsp { true PATredef PATDict begin /CurrentPattern exch def % If it's an uncolored pattern, save the color CurrentPattern /PaintType get 2 eq { /PColor exch def } if /CColor [ currentrgbcolor ] def end } bind def % PATstroke - stroke with the current pattern /PATstroke { countdictstack save mark { currentpoint strokepath moveto PATpcalc % proc nw nh px py clip newpath PATfill } stopped { (*** PATstroke Warning: Path is too complex, stroking with gray) = cleartomark restore countdictstack exch sub dup 0 gt { { end } repeat } { pop } ifelse gsave 0.5 setgray oldstroke grestore } { pop restore pop } ifelse newpath } bind def /PATtcalc { % modmtx tilingtype PATtcalc tilematrix % Note: tiling types 2 and 3 are not supported gsave exch concat % tilingtype matrix currentmatrix exch % cmtx tilingtype % Tiling type 1 and 3: constant spacing 2 ne { % Distort the pattern so that it occupies % an integral number of device pixels dup 4 get exch dup 5 get exch % tx ty cmtx XStep 0 dtransform round exch round exch % tx ty cmtx dx.x dx.y XStep div exch XStep div exch % tx ty cmtx a b 0 YStep dtransform round exch round exch % tx ty cmtx a b dy.x dy.y YStep div exch YStep div exch % tx ty cmtx a b c d 7 -3 roll astore % { a b c d tx ty } } if grestore } bind def /PATusp { false PATredef PATDict begin CColor PATsc end } bind def % right45 11 dict begin /PaintType 1 def /PatternType 1 def /TilingType 1 def /BBox [0 0 1 1] def /XStep 1 def /YStep 1 def /PatWidth 1 def /PatHeight 1 def /Multi 2 def /PaintData [ { clippath } bind { 32 32 true [ 32 0 0 -32 0 32 ] {<010101010202020204040404080808081010101020202020 404040408080808001010101020202020404040408080808 101010102020202040404040808080800101010102020202 040404040808080810101010202020204040404080808080 010101010202020204040404080808081010101020202020 4040404080808080>} imagemask } bind ] def /PaintProc { pop exec fill } def currentdict end /P5 exch def 1.1111 1.1111 scale %restore scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc 30.000 slw % Arc gs n 2100.0 9289.3 910.7 -171.2 -8.8 arcn gs col-1 s gr gr % Ellipse n 9262 5250 862 525 0 360 DrawEllipse gs col-1 s gr % Polyline % % Begin Imported EPS File: pants.eps %BeginDocument: pants.eps % n gs 1200 4800 tr 45.714286 -52.747253 sc 0 -91 tr 0 0 tr sa /showpage {} def % EPS file follows: %!PS-Adobe-2.0 EPSF-2.0 %%Title: pants.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 12:45:11 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.18 %%Orientation: Portrait %%BoundingBox: 0 0 105 91 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -19.0 101.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01080 0.01080 sc 30.000 slw % Arc gs n 6615.2 8400.5 1200.6 178.6 2.1 arc gs col-1 s gr gr % Ellipse n 6600 1800 1800 825 0 360 DrawEllipse gs col-1 s gr % Open spline gs n 4800.0 1785.0 m 4807.5 2685.0 l 4807.5 2685.0 4815.0 3585.0 3315.0 4800.0 DrawSplineSection 3315.0 4800.0 1815.0 6015.0 1815.0 7200.0 DrawSplineSection 1815.0 8385.0 l gs col-1 s gr gr % Open spline gs n 1800.0 8415.0 m 1807.5 8482.5 l 1807.5 8482.5 1815.0 8550.0 1905.0 8670.0 DrawSplineSection 1905.0 8670.0 1995.0 8790.0 2122.5 8865.0 DrawSplineSection 2122.5 8865.0 2250.0 8940.0 2407.5 9030.0 DrawSplineSection 2407.5 9030.0 2565.0 9120.0 2730.0 9157.5 DrawSplineSection 2730.0 9157.5 2895.0 9195.0 3060.0 9217.5 DrawSplineSection 3060.0 9217.5 3225.0 9240.0 3397.5 9247.5 DrawSplineSection 3397.5 9247.5 3570.0 9255.0 3780.0 9247.5 DrawSplineSection 3780.0 9247.5 3990.0 9240.0 4162.5 9217.5 DrawSplineSection 4162.5 9217.5 4335.0 9195.0 4477.5 9150.0 DrawSplineSection 4477.5 9150.0 4620.0 9105.0 4747.5 9060.0 DrawSplineSection 4747.5 9060.0 4875.0 9015.0 5032.5 8925.0 DrawSplineSection 5032.5 8925.0 5190.0 8835.0 5295.0 8700.0 DrawSplineSection 5295.0 8700.0 5400.0 8565.0 5400.0 8490.0 DrawSplineSection 5400.0 8415.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 1800.0 8385.0 m 1807.5 8317.5 l 1807.5 8317.5 1815.0 8250.0 1905.0 8130.0 DrawSplineSection 1905.0 8130.0 1995.0 8010.0 2122.5 7935.0 DrawSplineSection 2122.5 7935.0 2250.0 7860.0 2407.5 7770.0 DrawSplineSection 2407.5 7770.0 2565.0 7680.0 2730.0 7642.5 DrawSplineSection 2730.0 7642.5 2895.0 7605.0 3060.0 7582.5 DrawSplineSection 3060.0 7582.5 3225.0 7560.0 3397.5 7552.5 DrawSplineSection 3397.5 7552.5 3570.0 7545.0 3780.0 7552.5 DrawSplineSection 3780.0 7552.5 3990.0 7560.0 4162.5 7582.5 DrawSplineSection 4162.5 7582.5 4335.0 7605.0 4477.5 7650.0 DrawSplineSection 4477.5 7650.0 4620.0 7695.0 4747.5 7740.0 DrawSplineSection 4747.5 7740.0 4875.0 7785.0 5032.5 7875.0 DrawSplineSection 5032.5 7875.0 5190.0 7965.0 5295.0 8100.0 DrawSplineSection 5295.0 8100.0 5400.0 8235.0 5400.0 8310.0 DrawSplineSection 5400.0 8385.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 7815.0 8460.0 m 7822.5 8527.5 l 7822.5 8527.5 7830.0 8595.0 7920.0 8715.0 DrawSplineSection 7920.0 8715.0 8010.0 8835.0 8137.5 8910.0 DrawSplineSection 8137.5 8910.0 8265.0 8985.0 8422.5 9075.0 DrawSplineSection 8422.5 9075.0 8580.0 9165.0 8745.0 9202.5 DrawSplineSection 8745.0 9202.5 8910.0 9240.0 9075.0 9262.5 DrawSplineSection 9075.0 9262.5 9240.0 9285.0 9412.5 9292.5 DrawSplineSection 9412.5 9292.5 9585.0 9300.0 9795.0 9292.5 DrawSplineSection 9795.0 9292.5 10005.0 9285.0 10177.5 9262.5 DrawSplineSection 10177.5 9262.5 10350.0 9240.0 10492.5 9195.0 DrawSplineSection 10492.5 9195.0 10635.0 9150.0 10762.5 9105.0 DrawSplineSection 10762.5 9105.0 10890.0 9060.0 11047.5 8970.0 DrawSplineSection 11047.5 8970.0 11205.0 8880.0 11310.0 8745.0 DrawSplineSection 11310.0 8745.0 11415.0 8610.0 11415.0 8535.0 DrawSplineSection 11415.0 8460.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 7800.0 8385.0 m 7807.5 8317.5 l 7807.5 8317.5 7815.0 8250.0 7905.0 8130.0 DrawSplineSection 7905.0 8130.0 7995.0 8010.0 8122.5 7935.0 DrawSplineSection 8122.5 7935.0 8250.0 7860.0 8407.5 7770.0 DrawSplineSection 8407.5 7770.0 8565.0 7680.0 8730.0 7642.5 DrawSplineSection 8730.0 7642.5 8895.0 7605.0 9060.0 7582.5 DrawSplineSection 9060.0 7582.5 9225.0 7560.0 9397.5 7552.5 DrawSplineSection 9397.5 7552.5 9570.0 7545.0 9780.0 7552.5 DrawSplineSection 9780.0 7552.5 9990.0 7560.0 10162.5 7582.5 DrawSplineSection 10162.5 7582.5 10335.0 7605.0 10477.5 7650.0 DrawSplineSection 10477.5 7650.0 10620.0 7695.0 10747.5 7740.0 DrawSplineSection 10747.5 7740.0 10875.0 7785.0 11032.5 7875.0 DrawSplineSection 11032.5 7875.0 11190.0 7965.0 11295.0 8100.0 DrawSplineSection 11295.0 8100.0 11400.0 8235.0 11400.0 8310.0 DrawSplineSection 11400.0 8385.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 8415.0 1785.0 m 8407.5 2685.0 l 8407.5 2685.0 8400.0 3585.0 9900.0 4800.0 DrawSplineSection 9900.0 4800.0 11400.0 6015.0 11400.0 7200.0 DrawSplineSection 11400.0 8385.0 l gs col-1 s gr gr $F2psEnd rs rs gr % % End Imported PIC File: pants.eps %EndDocument % % Polyline % % Begin Imported EPS File: ellips.eps %BeginDocument: ellips.eps % n gs 8400 8400 tr 40.000000 -57.954545 sc 0 -22 tr 0 0 tr sa /showpage {} def % EPS file follows: %!PS-Adobe-2.0 EPSF-2.0 %%Title: ellips.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 13:32:03 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 45 22 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -21.0 83.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc % Open spline gs 30.000 slw n 1800.0 6000.0 m 1807.5 6067.5 l 1807.5 6067.5 1815.0 6135.0 1905.0 6255.0 DrawSplineSection 1905.0 6255.0 1995.0 6375.0 2122.5 6450.0 DrawSplineSection 2122.5 6450.0 2250.0 6525.0 2407.5 6615.0 DrawSplineSection 2407.5 6615.0 2565.0 6705.0 2730.0 6742.5 DrawSplineSection 2730.0 6742.5 2895.0 6780.0 3060.0 6802.5 DrawSplineSection 3060.0 6802.5 3225.0 6825.0 3397.5 6832.5 DrawSplineSection 3397.5 6832.5 3570.0 6840.0 3780.0 6832.5 DrawSplineSection 3780.0 6832.5 3990.0 6825.0 4162.5 6802.5 DrawSplineSection 4162.5 6802.5 4335.0 6780.0 4477.5 6735.0 DrawSplineSection 4477.5 6735.0 4620.0 6690.0 4747.5 6645.0 DrawSplineSection 4747.5 6645.0 4875.0 6600.0 5032.5 6510.0 DrawSplineSection 5032.5 6510.0 5190.0 6420.0 5295.0 6285.0 DrawSplineSection 5295.0 6285.0 5400.0 6150.0 5400.0 6075.0 DrawSplineSection 5400.0 6000.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 1800.0 6000.0 m 1807.5 5932.5 l 1807.5 5932.5 1815.0 5865.0 1905.0 5745.0 DrawSplineSection 1905.0 5745.0 1995.0 5625.0 2122.5 5550.0 DrawSplineSection 2122.5 5550.0 2250.0 5475.0 2407.5 5385.0 DrawSplineSection 2407.5 5385.0 2565.0 5295.0 2730.0 5257.5 DrawSplineSection 2730.0 5257.5 2895.0 5220.0 3060.0 5197.5 DrawSplineSection 3060.0 5197.5 3225.0 5175.0 3397.5 5167.5 DrawSplineSection 3397.5 5167.5 3570.0 5160.0 3780.0 5167.5 DrawSplineSection 3780.0 5167.5 3990.0 5175.0 4162.5 5197.5 DrawSplineSection 4162.5 5197.5 4335.0 5220.0 4477.5 5265.0 DrawSplineSection 4477.5 5265.0 4620.0 5310.0 4747.5 5355.0 DrawSplineSection 4747.5 5355.0 4875.0 5400.0 5032.5 5490.0 DrawSplineSection 5032.5 5490.0 5190.0 5580.0 5295.0 5715.0 DrawSplineSection 5295.0 5715.0 5400.0 5850.0 5400.0 5925.0 DrawSplineSection 5400.0 6000.0 l gs col-1 s gr gr [] 0 sd $F2psEnd rs rs gr % % End Imported PIC File: ellips.eps %EndDocument % % Polyline n 8400 9075 m 8400 5325 l gs col-1 s gr % Polyline n 10125 9075 m 10125 5325 l gs col-1 s gr % Open spline gs 0.000 slw n 1200.0 9150.0 m 1200.0 9225.0 l 1200.0 9225.0 1200.0 9300.0 1215.0 9390.0 DrawSplineSection 1215.0 9390.0 1230.0 9480.0 1260.0 9570.0 DrawSplineSection 1260.0 9570.0 1290.0 9660.0 1320.0 9742.5 DrawSplineSection 1320.0 9742.5 1350.0 9825.0 1425.0 9862.5 DrawSplineSection 1425.0 9862.5 1500.0 9900.0 1537.5 9937.5 DrawSplineSection 1537.5 9937.5 1575.0 9975.0 1650.0 10012.5 DrawSplineSection 1650.0 10012.5 1725.0 10050.0 1800.0 10087.5 DrawSplineSection 1800.0 10087.5 1875.0 10125.0 1957.5 10132.5 DrawSplineSection 1957.5 10132.5 2040.0 10140.0 2107.5 10147.5 DrawSplineSection 2107.5 10147.5 2175.0 10155.0 2257.5 10140.0 DrawSplineSection 2257.5 10140.0 2340.0 10125.0 2437.5 10072.5 DrawSplineSection 2437.5 10072.5 2535.0 10020.0 2602.5 9975.0 DrawSplineSection 2602.5 9975.0 2670.0 9930.0 2722.5 9877.5 DrawSplineSection 2722.5 9877.5 2775.0 9825.0 2812.5 9787.5 DrawSplineSection 2812.5 9787.5 2850.0 9750.0 2887.5 9675.0 DrawSplineSection 2887.5 9675.0 2925.0 9600.0 2925.0 9562.5 DrawSplineSection 2925.0 9562.5 2925.0 9525.0 2925.0 9450.0 DrawSplineSection 2925.0 9450.0 2925.0 9375.0 2962.5 9300.0 DrawSplineSection 2962.5 9300.0 3000.0 9225.0 2962.5 9262.5 DrawSplineSection 2962.5 9262.5 2925.0 9300.0 2850.0 9337.5 DrawSplineSection 2850.0 9337.5 2775.0 9375.0 2752.5 9427.5 DrawSplineSection 2752.5 9427.5 2730.0 9480.0 2602.5 9502.5 DrawSplineSection 2602.5 9502.5 2475.0 9525.0 2400.0 9525.0 DrawSplineSection 2400.0 9525.0 2325.0 9525.0 2250.0 9562.5 DrawSplineSection 2250.0 9562.5 2175.0 9600.0 2062.5 9600.0 DrawSplineSection 2062.5 9600.0 1950.0 9600.0 1875.0 9562.5 DrawSplineSection 1875.0 9562.5 1800.0 9525.0 1762.5 9525.0 DrawSplineSection 1762.5 9525.0 1725.0 9525.0 1650.0 9487.5 DrawSplineSection 1650.0 9487.5 1575.0 9450.0 1537.5 9412.5 DrawSplineSection 1537.5 9412.5 1500.0 9375.0 1462.5 9375.0 DrawSplineSection 1462.5 9375.0 1425.0 9375.0 1387.5 9337.5 DrawSplineSection 1387.5 9337.5 1350.0 9300.0 1275.0 9225.0 DrawSplineSection 1200.0 9150.0 l gs /PC [[1.00 1.00 1.00] [0.00 0.00 0.00]] def 15.00 15.00 sc P5 [16 0 0 -16 80.00 615.00] PATmp PATsp ef gr PATusp gr /Times-Roman ff 900.00 scf sf 6975 7350 m gs 1 -1 sc (=) col-1 sh gr $F2psEnd rs end %%EndDocument @endspecial 456 1240 a(Similarly)-7 b(,)27 b(the)h(non-degeneracy)d (of)j(the)g(bilinear)f(form)g(tr\()p FJ(ab)p FQ(\))g(follo)n(ws)g(from) 1496 1867 y @beginspecial 0 @llx 0 @lly 109 @urx 67 @ury 1090 @rwi @setspecial %%BeginDocument: figures/nondeg.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: nondeg.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Mon Mar 31 11:20:58 1997 %%For: bakalov@schauder (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 109 67 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /MyAppDict 100 dict dup begin def /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -14.0 117.0 translate 1 -1 scale .9 .9 scale % to make patterns same scale as in xfig % This junk string is used by the show operators /PATsstr 1 string def /PATawidthshow { % cx cy cchar rx ry string % Loop over each character in the string { % cx cy cchar rx ry char % Show the character dup % cx cy cchar rx ry char char PATsstr dup 0 4 -1 roll put % cx cy cchar rx ry char (char) false charpath % cx cy cchar rx ry char /clip load PATdraw % Move past the character (charpath modified the % current point) currentpoint % cx cy cchar rx ry char x y newpath moveto % cx cy cchar rx ry char % Reposition by cx,cy if the character in the string is cchar 3 index eq { % cx cy cchar rx ry 4 index 4 index rmoveto } if % Reposition all characters by rx ry 2 copy rmoveto % cx cy cchar rx ry } forall pop pop pop pop pop % - currentpoint newpath moveto } bind def /PATcg { 7 dict dup begin /lw currentlinewidth def /lc currentlinecap def /lj currentlinejoin def /ml currentmiterlimit def /ds [ currentdash ] def /cc [ currentrgbcolor ] def /cm matrix currentmatrix def end } bind def % PATdraw - calculates the boundaries of the object and % fills it with the current pattern /PATdraw { % proc save exch PATpcalc % proc nw nh px py 5 -1 roll exec % nw nh px py newpath PATfill % - restore } bind def % PATfill - performs the tiling for the shape /PATfill { % nw nh px py PATfill - PATDict /CurrentPattern get dup begin setfont % Set the coordinate system to Pattern Space PatternGState PATsg % Set the color for uncolored pattezns PaintType 2 eq { PATDict /PColor get PATsc } if % Create the string for showing 3 index string % nw nh px py str % Loop for each of the pattern sources 0 1 Multi 1 sub { % nw nh px py str source % Move to the starting location 3 index 3 index % nw nh px py str source px py moveto % nw nh px py str source % For multiple sources, set the appropriate color Multi 1 ne { dup PC exch get PATsc } if % Set the appropriate string for the source 0 1 7 index 1 sub { 2 index exch 2 index put } for pop % Loop over the number of vertical cells 3 index % nw nh px py str nh { % nw nh px py str currentpoint % nw nh px py str cx cy 2 index show % nw nh px py str cx cy YStep add moveto % nw nh px py str } repeat % nw nh px py str } for 5 { pop } repeat end } bind def % PATkshow - kshow with the current pattezn /PATkshow { % proc string exch bind % string proc 1 index 0 get % string proc char % Loop over all but the last character in the string 0 1 4 index length 2 sub { % string proc char idx % Find the n+1th character in the string 3 index exch 1 add get % string proe char char+1 exch 2 copy % strinq proc char+1 char char+1 char % Now show the nth character PATsstr dup 0 4 -1 roll put % string proc chr+1 chr chr+1 (chr) false charpath % string proc char+1 char char+1 /clip load PATdraw % Move past the character (charpath modified the current point) currentpoint newpath moveto % Execute the user proc (should consume char and char+1) mark 3 1 roll % string proc char+1 mark char char+1 4 index exec % string proc char+1 mark... cleartomark % string proc char+1 } for % Now display the last character PATsstr dup 0 4 -1 roll put % string proc (char+1) false charpath % string proc /clip load PATdraw neewath pop pop % - } bind def % PATmp - the makepattern equivalent /PATmp { % patdict patmtx PATmp patinstance exch dup length 7 add % We will add 6 new entries plus 1 FID dict copy % Create a new dictionary begin % Matrix to install when painting the pattern TilingType PATtcalc /PatternGState PATcg def PatternGState /cm 3 -1 roll put % Check for multi pattern sources (Level 1 fast color patterns) currentdict /Multi known not { /Multi 1 def } if % Font dictionary definitions /FontType 3 def % Create a dummy encoding vector /Encoding 256 array def 3 string 0 1 255 { Encoding exch dup 3 index cvs cvn put } for pop /FontMatrix matrix def /FontBBox BBox def /BuildChar { mark 3 1 roll % mark dict char exch begin Multi 1 ne {PaintData exch get}{pop} ifelse % mark [paintdata] PaintType 2 eq Multi 1 ne or { XStep 0 FontBBox aload pop setcachedevice } { XStep 0 setcharwidth } ifelse currentdict % mark [paintdata] dict /PaintProc load % mark [paintdata] dict paintproc end gsave false PATredef exec true PATredef grestore cleartomark % - } bind def currentdict end % newdict /foo exch % /foo newlict definefont % newfont } bind def % PATpcalc - calculates the starting point and width/height % of the tile fill for the shape /PATpcalc { % - PATpcalc nw nh px py PATDict /CurrentPattern get begin gsave % Set up the coordinate system to Pattern Space % and lock down pattern PatternGState /cm get setmatrix BBox aload pop pop pop translate % Determine the bounding box of the shape pathbbox % llx lly urx ury grestore % Determine (nw, nh) the # of cells to paint width and height PatHeight div ceiling % llx lly urx qh 4 1 roll % qh llx lly urx PatWidth div ceiling % qh llx lly qw 4 1 roll % qw qh llx lly PatHeight div floor % qw qh llx ph 4 1 roll % ph qw qh llx PatWidth div floor % ph qw qh pw 4 1 roll % pw ph qw qh 2 index sub cvi abs % pw ph qs qh-ph exch 3 index sub cvi abs exch % pw ph nw=qw-pw nh=qh-ph % Determine the starting point of the pattern fill %(px, py) 4 2 roll % nw nh pw ph PatHeight mul % nw nh pw py exch % nw nh py pw PatWidth mul exch % nw nh px py end } bind def % Save the original routines so that we can use them later on /oldfill /fill load def /oldeofill /eofill load def /oldstroke /stroke load def /oldshow /show load def /oldashow /ashow load def /oldwidthshow /widthshow load def /oldawidthshow /awidthshow load def /oldkshow /kshow load def % These defs are necessary so that subsequent procs don't bind in % the originals /fill { oldfill } bind def /eofill { oldeofill } bind def /stroke { oldstroke } bind def /show { oldshow } bind def /ashow { oldashow } bind def /widthshow { oldwidthshow } bind def /awidthshow { oldawidthshow } bind def /kshow { oldkshow } bind def /PATredef { MyAppDict begin { /fill { /clip load PATdraw newpath } bind def /eofill { /eoclip load PATdraw newpath } bind def /stroke { PATstroke } bind def /show { 0 0 null 0 0 6 -1 roll PATawidthshow } bind def /ashow { 0 0 null 6 3 roll PATawidthshow } bind def /widthshow { 0 0 3 -1 roll PATawidthshow } bind def /awidthshow { PATawidthshow } bind def /kshow { PATkshow } bind def } { /fill { oldfill } bind def /eofill { oldeofill } bind def /stroke { oldstroke } bind def /show { oldshow } bind def /ashow { oldashow } bind def /widthshow { oldwidthshow } bind def /awidthshow { oldawidthshow } bind def /kshow { oldkshow } bind def } ifelse end } bind def false PATredef % Conditionally define setcmykcolor if not available /setcmykcolor where { pop } { /setcmykcolor { 1 sub 4 1 roll 3 { 3 index add neg dup 0 lt { pop 0 } if 3 1 roll } repeat setrgbcolor - pop } bind def } ifelse /PATsc { % colorarray aload length % c1 ... cn length dup 1 eq { pop setgray } { 3 eq { setrgbcolor } { setcmykcolor } ifelse } ifelse } bind def /PATsg { % dict begin lw setlinewidth lc setlinecap lj setlinejoin ml setmiterlimit ds aload pop setdash cc aload pop setrgbcolor cm setmatrix end } bind def /PATDict 3 dict def /PATsp { true PATredef PATDict begin /CurrentPattern exch def % If it's an uncolored pattern, save the color CurrentPattern /PaintType get 2 eq { /PColor exch def } if /CColor [ currentrgbcolor ] def end } bind def % PATstroke - stroke with the current pattern /PATstroke { countdictstack save mark { currentpoint strokepath moveto PATpcalc % proc nw nh px py clip newpath PATfill } stopped { (*** PATstroke Warning: Path is too complex, stroking with gray) = cleartomark restore countdictstack exch sub dup 0 gt { { end } repeat } { pop } ifelse gsave 0.5 setgray oldstroke grestore } { pop restore pop } ifelse newpath } bind def /PATtcalc { % modmtx tilingtype PATtcalc tilematrix % Note: tiling types 2 and 3 are not supported gsave exch concat % tilingtype matrix currentmatrix exch % cmtx tilingtype % Tiling type 1 and 3: constant spacing 2 ne { % Distort the pattern so that it occupies % an integral number of device pixels dup 4 get exch dup 5 get exch % tx ty cmtx XStep 0 dtransform round exch round exch % tx ty cmtx dx.x dx.y XStep div exch XStep div exch % tx ty cmtx a b 0 YStep dtransform round exch round exch % tx ty cmtx a b dy.x dy.y YStep div exch YStep div exch % tx ty cmtx a b c d 7 -3 roll astore % { a b c d tx ty } } if grestore } bind def /PATusp { false PATredef PATDict begin CColor PATsc end } bind def % right45 11 dict begin /PaintType 1 def /PatternType 1 def /TilingType 1 def /BBox [0 0 1 1] def /XStep 1 def /YStep 1 def /PatWidth 1 def /PatHeight 1 def /Multi 2 def /PaintData [ { clippath } bind { 32 32 true [ 32 0 0 -32 0 32 ] {<010101010202020204040404080808081010101020202020 404040408080808001010101020202020404040408080808 101010102020202040404040808080800101010102020202 040404040808080810101010202020204040404080808080 010101010202020204040404080808081010101020202020 4040404080808080>} imagemask } bind ] def /PaintProc { pop exec fill } def currentdict end /P5 exch def 1.1111 1.1111 scale %restore scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc 30.000 slw % Arc gs n 3585.0 5170.7 910.7 171.2 8.8 arc gs col-1 s gr gr % Ellipse n 9262 5250 862 525 0 360 DrawEllipse gs col-1 s gr % Polyline % % Begin Imported EPS File: pants.eps %BeginDocument: pants.eps % n gs 1200 4800 tr 45.714286 -52.747253 sc 0 -91 tr 0 0 tr sa /showpage {} def % EPS file follows: %!PS-Adobe-2.0 EPSF-2.0 %%Title: pants.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 12:45:11 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.18 %%Orientation: Portrait %%BoundingBox: 0 0 105 91 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -19.0 101.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01080 0.01080 sc 30.000 slw % Arc gs n 6615.2 8400.5 1200.6 178.6 2.1 arc gs col-1 s gr gr % Ellipse n 6600 1800 1800 825 0 360 DrawEllipse gs col-1 s gr % Open spline gs n 4800.0 1785.0 m 4807.5 2685.0 l 4807.5 2685.0 4815.0 3585.0 3315.0 4800.0 DrawSplineSection 3315.0 4800.0 1815.0 6015.0 1815.0 7200.0 DrawSplineSection 1815.0 8385.0 l gs col-1 s gr gr % Open spline gs n 1800.0 8415.0 m 1807.5 8482.5 l 1807.5 8482.5 1815.0 8550.0 1905.0 8670.0 DrawSplineSection 1905.0 8670.0 1995.0 8790.0 2122.5 8865.0 DrawSplineSection 2122.5 8865.0 2250.0 8940.0 2407.5 9030.0 DrawSplineSection 2407.5 9030.0 2565.0 9120.0 2730.0 9157.5 DrawSplineSection 2730.0 9157.5 2895.0 9195.0 3060.0 9217.5 DrawSplineSection 3060.0 9217.5 3225.0 9240.0 3397.5 9247.5 DrawSplineSection 3397.5 9247.5 3570.0 9255.0 3780.0 9247.5 DrawSplineSection 3780.0 9247.5 3990.0 9240.0 4162.5 9217.5 DrawSplineSection 4162.5 9217.5 4335.0 9195.0 4477.5 9150.0 DrawSplineSection 4477.5 9150.0 4620.0 9105.0 4747.5 9060.0 DrawSplineSection 4747.5 9060.0 4875.0 9015.0 5032.5 8925.0 DrawSplineSection 5032.5 8925.0 5190.0 8835.0 5295.0 8700.0 DrawSplineSection 5295.0 8700.0 5400.0 8565.0 5400.0 8490.0 DrawSplineSection 5400.0 8415.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 1800.0 8385.0 m 1807.5 8317.5 l 1807.5 8317.5 1815.0 8250.0 1905.0 8130.0 DrawSplineSection 1905.0 8130.0 1995.0 8010.0 2122.5 7935.0 DrawSplineSection 2122.5 7935.0 2250.0 7860.0 2407.5 7770.0 DrawSplineSection 2407.5 7770.0 2565.0 7680.0 2730.0 7642.5 DrawSplineSection 2730.0 7642.5 2895.0 7605.0 3060.0 7582.5 DrawSplineSection 3060.0 7582.5 3225.0 7560.0 3397.5 7552.5 DrawSplineSection 3397.5 7552.5 3570.0 7545.0 3780.0 7552.5 DrawSplineSection 3780.0 7552.5 3990.0 7560.0 4162.5 7582.5 DrawSplineSection 4162.5 7582.5 4335.0 7605.0 4477.5 7650.0 DrawSplineSection 4477.5 7650.0 4620.0 7695.0 4747.5 7740.0 DrawSplineSection 4747.5 7740.0 4875.0 7785.0 5032.5 7875.0 DrawSplineSection 5032.5 7875.0 5190.0 7965.0 5295.0 8100.0 DrawSplineSection 5295.0 8100.0 5400.0 8235.0 5400.0 8310.0 DrawSplineSection 5400.0 8385.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 7815.0 8460.0 m 7822.5 8527.5 l 7822.5 8527.5 7830.0 8595.0 7920.0 8715.0 DrawSplineSection 7920.0 8715.0 8010.0 8835.0 8137.5 8910.0 DrawSplineSection 8137.5 8910.0 8265.0 8985.0 8422.5 9075.0 DrawSplineSection 8422.5 9075.0 8580.0 9165.0 8745.0 9202.5 DrawSplineSection 8745.0 9202.5 8910.0 9240.0 9075.0 9262.5 DrawSplineSection 9075.0 9262.5 9240.0 9285.0 9412.5 9292.5 DrawSplineSection 9412.5 9292.5 9585.0 9300.0 9795.0 9292.5 DrawSplineSection 9795.0 9292.5 10005.0 9285.0 10177.5 9262.5 DrawSplineSection 10177.5 9262.5 10350.0 9240.0 10492.5 9195.0 DrawSplineSection 10492.5 9195.0 10635.0 9150.0 10762.5 9105.0 DrawSplineSection 10762.5 9105.0 10890.0 9060.0 11047.5 8970.0 DrawSplineSection 11047.5 8970.0 11205.0 8880.0 11310.0 8745.0 DrawSplineSection 11310.0 8745.0 11415.0 8610.0 11415.0 8535.0 DrawSplineSection 11415.0 8460.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 7800.0 8385.0 m 7807.5 8317.5 l 7807.5 8317.5 7815.0 8250.0 7905.0 8130.0 DrawSplineSection 7905.0 8130.0 7995.0 8010.0 8122.5 7935.0 DrawSplineSection 8122.5 7935.0 8250.0 7860.0 8407.5 7770.0 DrawSplineSection 8407.5 7770.0 8565.0 7680.0 8730.0 7642.5 DrawSplineSection 8730.0 7642.5 8895.0 7605.0 9060.0 7582.5 DrawSplineSection 9060.0 7582.5 9225.0 7560.0 9397.5 7552.5 DrawSplineSection 9397.5 7552.5 9570.0 7545.0 9780.0 7552.5 DrawSplineSection 9780.0 7552.5 9990.0 7560.0 10162.5 7582.5 DrawSplineSection 10162.5 7582.5 10335.0 7605.0 10477.5 7650.0 DrawSplineSection 10477.5 7650.0 10620.0 7695.0 10747.5 7740.0 DrawSplineSection 10747.5 7740.0 10875.0 7785.0 11032.5 7875.0 DrawSplineSection 11032.5 7875.0 11190.0 7965.0 11295.0 8100.0 DrawSplineSection 11295.0 8100.0 11400.0 8235.0 11400.0 8310.0 DrawSplineSection 11400.0 8385.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 8415.0 1785.0 m 8407.5 2685.0 l 8407.5 2685.0 8400.0 3585.0 9900.0 4800.0 DrawSplineSection 9900.0 4800.0 11400.0 6015.0 11400.0 7200.0 DrawSplineSection 11400.0 8385.0 l gs col-1 s gr gr $F2psEnd rs rs gr % % End Imported PIC File: pants.eps %EndDocument % % Polyline % % Begin Imported EPS File: ellips.eps %BeginDocument: ellips.eps % n gs 8400 8400 tr 40.000000 -57.954545 sc 0 -22 tr 0 0 tr sa /showpage {} def % EPS file follows: %!PS-Adobe-2.0 EPSF-2.0 %%Title: ellips.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 13:32:03 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 45 22 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -21.0 83.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc % Open spline gs 30.000 slw n 1800.0 6000.0 m 1807.5 6067.5 l 1807.5 6067.5 1815.0 6135.0 1905.0 6255.0 DrawSplineSection 1905.0 6255.0 1995.0 6375.0 2122.5 6450.0 DrawSplineSection 2122.5 6450.0 2250.0 6525.0 2407.5 6615.0 DrawSplineSection 2407.5 6615.0 2565.0 6705.0 2730.0 6742.5 DrawSplineSection 2730.0 6742.5 2895.0 6780.0 3060.0 6802.5 DrawSplineSection 3060.0 6802.5 3225.0 6825.0 3397.5 6832.5 DrawSplineSection 3397.5 6832.5 3570.0 6840.0 3780.0 6832.5 DrawSplineSection 3780.0 6832.5 3990.0 6825.0 4162.5 6802.5 DrawSplineSection 4162.5 6802.5 4335.0 6780.0 4477.5 6735.0 DrawSplineSection 4477.5 6735.0 4620.0 6690.0 4747.5 6645.0 DrawSplineSection 4747.5 6645.0 4875.0 6600.0 5032.5 6510.0 DrawSplineSection 5032.5 6510.0 5190.0 6420.0 5295.0 6285.0 DrawSplineSection 5295.0 6285.0 5400.0 6150.0 5400.0 6075.0 DrawSplineSection 5400.0 6000.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 1800.0 6000.0 m 1807.5 5932.5 l 1807.5 5932.5 1815.0 5865.0 1905.0 5745.0 DrawSplineSection 1905.0 5745.0 1995.0 5625.0 2122.5 5550.0 DrawSplineSection 2122.5 5550.0 2250.0 5475.0 2407.5 5385.0 DrawSplineSection 2407.5 5385.0 2565.0 5295.0 2730.0 5257.5 DrawSplineSection 2730.0 5257.5 2895.0 5220.0 3060.0 5197.5 DrawSplineSection 3060.0 5197.5 3225.0 5175.0 3397.5 5167.5 DrawSplineSection 3397.5 5167.5 3570.0 5160.0 3780.0 5167.5 DrawSplineSection 3780.0 5167.5 3990.0 5175.0 4162.5 5197.5 DrawSplineSection 4162.5 5197.5 4335.0 5220.0 4477.5 5265.0 DrawSplineSection 4477.5 5265.0 4620.0 5310.0 4747.5 5355.0 DrawSplineSection 4747.5 5355.0 4875.0 5400.0 5032.5 5490.0 DrawSplineSection 5032.5 5490.0 5190.0 5580.0 5295.0 5715.0 DrawSplineSection 5295.0 5715.0 5400.0 5850.0 5400.0 5925.0 DrawSplineSection 5400.0 6000.0 l gs col-1 s gr gr [] 0 sd $F2psEnd rs rs gr % % End Imported PIC File: ellips.eps %EndDocument % % Polyline n 8400 9075 m 8400 5325 l gs col-1 s gr % Polyline n 10125 9075 m 10125 5325 l gs col-1 s gr % Open spline gs 0.000 slw n 2700.0 5325.0 m 2775.0 5437.5 l 2775.0 5437.5 2850.0 5550.0 2925.0 5587.5 DrawSplineSection 2925.0 5587.5 3000.0 5625.0 3075.0 5662.5 DrawSplineSection 3075.0 5662.5 3150.0 5700.0 3262.5 5737.5 DrawSplineSection 3262.5 5737.5 3375.0 5775.0 3450.0 5775.0 DrawSplineSection 3450.0 5775.0 3525.0 5775.0 3675.0 5775.0 DrawSplineSection 3675.0 5775.0 3825.0 5775.0 3900.0 5737.5 DrawSplineSection 3900.0 5737.5 3975.0 5700.0 4087.5 5662.5 DrawSplineSection 4087.5 5662.5 4200.0 5625.0 4275.0 5587.5 DrawSplineSection 4275.0 5587.5 4350.0 5550.0 4387.5 5475.0 DrawSplineSection 4387.5 5475.0 4425.0 5400.0 4425.0 5325.0 DrawSplineSection 4425.0 5325.0 4425.0 5250.0 4425.0 5137.5 DrawSplineSection 4425.0 5137.5 4425.0 5025.0 4425.0 4950.0 DrawSplineSection 4425.0 4950.0 4425.0 4875.0 4387.5 4837.5 DrawSplineSection 4387.5 4837.5 4350.0 4800.0 4350.0 4725.0 DrawSplineSection 4350.0 4725.0 4350.0 4650.0 4312.5 4612.5 DrawSplineSection 4312.5 4612.5 4275.0 4575.0 4237.5 4537.5 DrawSplineSection 4237.5 4537.5 4200.0 4500.0 4162.5 4462.5 DrawSplineSection 4162.5 4462.5 4125.0 4425.0 4050.0 4387.5 DrawSplineSection 4050.0 4387.5 3975.0 4350.0 3900.0 4312.5 DrawSplineSection 3900.0 4312.5 3825.0 4275.0 3750.0 4275.0 DrawSplineSection 3750.0 4275.0 3675.0 4275.0 3600.0 4275.0 DrawSplineSection 3600.0 4275.0 3525.0 4275.0 3412.5 4312.5 DrawSplineSection 3412.5 4312.5 3300.0 4350.0 3262.5 4350.0 DrawSplineSection 3262.5 4350.0 3225.0 4350.0 3150.0 4387.5 DrawSplineSection 3150.0 4387.5 3075.0 4425.0 3037.5 4462.5 DrawSplineSection 3037.5 4462.5 3000.0 4500.0 2962.5 4575.0 DrawSplineSection 2962.5 4575.0 2925.0 4650.0 2887.5 4687.5 DrawSplineSection 2887.5 4687.5 2850.0 4725.0 2812.5 4762.5 DrawSplineSection 2812.5 4762.5 2775.0 4800.0 2775.0 4875.0 DrawSplineSection 2775.0 4875.0 2775.0 4950.0 2775.0 5025.0 DrawSplineSection 2775.0 5025.0 2775.0 5100.0 2775.0 5137.5 DrawSplineSection 2775.0 5137.5 2775.0 5175.0 2737.5 5250.0 DrawSplineSection 2700.0 5325.0 l gs /PC [[1.00 1.00 1.00] [0.00 0.00 0.00]] def 15.00 15.00 sc P5 [16 0 0 -16 185.00 285.00] PATmp PATsp ef gr PATusp gr /Times-Roman ff 900.00 scf sf 6975 7350 m gs 1 -1 sc (=) col-1 sh gr $F2psEnd rs end %%EndDocument @endspecial 456 1972 a(This)g(sho)n(ws)g(that)h FJ(A)f FQ(is)h(a)f(F)-7 b(rob)r(enius)27 b(algebra.)605 2071 y(2.)37 b FO(Every)30 b(F)-6 b(r)l(ob)l(enius)30 b(algebr)l(a)h(gives)g (a)f(1+1)g(D)f(TQFT)p FQ(.)456 2171 y(Let)35 b FJ(A)h FQ(b)r(e)g(a)f(F)-7 b(rob)r(enius)35 b(algebra.)59 b(T)-7 b(o)35 b(the)h(circle)f FJ(S)2207 2141 y FM(1)2280 2171 y FQ(w)n(e)g(assign)f FJ(\034)9 b FQ(\()p FJ(S)2796 2141 y FM(1)2834 2171 y FQ(\))36 b(:=)g FJ(A)g FQ(and)g(to)f(a)456 2272 y(disjoin)n(t)26 b(union)g(of)h(circles)e(a)h(tensor)g(pro)r(duct) g(of)g FJ(A)h FQ(with)g(itself:)37 b FJ(\034)9 b FQ(\()p FJ(S)2684 2238 y FM(1)2740 2272 y FL(t)19 b(\001)14 b(\001)g(\001)k(t)h FJ(S)3059 2238 y FM(1)2628 2307 y Fy(|)p 2665 2307 159 10 v 159 w({z)p 2898 2307 V 159 w(})2842 2381 y FI(n)3096 2272 y FQ(\))k(:=)g FJ(A)3324 2242 y FE(\012)p FI(n)3421 2272 y FQ(.)456 2476 y(F)-7 b(or)33 b FJ(f)17 b FQ(:)30 b FJ(S)778 2446 y FM(1)876 2429 y FE(\030)848 2476 y FL(\000)-39 b(!)33 b FJ(S)1046 2446 y FM(1)1116 2476 y FQ(w)n(e)g(let)h FJ(f)1411 2488 y FE(\003)1482 2476 y FQ(=)f(id)g(and)h(for)f FJ(g)12 b FQ(:)29 b FJ(S)2143 2446 y FM(1)2242 2429 y FE(\030)2213 2476 y FL(\000)-39 b(!)p 2355 2405 93 4 v 33 w FJ(S)2411 2452 y FM(1)2481 2476 y FQ(let)34 b FJ(g)2647 2488 y FE(\003)2719 2476 y FQ(b)r(e)g(the)g(isomorphism)456 2578 y FJ(A)569 2531 y FE(\030)541 2578 y FL(\000)-40 b(!)24 b FJ(A)735 2548 y FE(\003)801 2578 y FQ(giv)n(en)i(b)n(y)i(the)g(non-degenerate)e (bilinear)h(form)g(tr\()p FJ(ab)p FQ(\).)605 2678 y(It)33 b(is)g(clear)e(ho)n(w)h(to)h(de\014ne)g FJ(\034)9 b FQ(\(disk\))32 b FL(2)g FJ(A)p FQ(,)i FJ(\034)9 b FQ(\(cylinder)q(\))32 b FL(2)f FJ(A)2594 2648 y FE(\003)2655 2678 y FL(\012)21 b FJ(A)33 b FQ(and)g FJ(\034)9 b FQ(\(trinion\))32 b FL(2)456 2778 y FJ(A)518 2747 y FE(\003)577 2778 y FL(\012)20 b FJ(A)724 2747 y FE(\003)783 2778 y FL(\012)g FJ(A)p FQ(.)47 b(The)31 b(next)g(lemma)g(allo)n(ws)e(to)i(extend)g(this)g(to)g (an)n(y)f(2-manifold)g(using)g(the)456 2877 y(gluing)h(axiom.)48 b(Let)32 b(us)g(sa)n(y)f(that)h(a)f FO(cutting)39 b FQ(of)31 b(a)h(2-dimensional)e(manifold)i(\006)g(is)g(a)f(\014nite)456 2977 y(collection)22 b(of)i(simple)f(non-in)n(tersecting)g(curv)n(es)f (on)h(\006,)h(whic)n(h)g(are)e(not)i(allo)n(w)n(ed)e(to)h(in)n(tersect) 456 3076 y(with)34 b(the)g(b)r(oundary)-7 b(.)55 b(Equiv)-5 b(alen)n(tly)e(,)35 b(w)n(e)f(will)g(sa)n(y)e(that)i(these)g(curv)n(es) f(cut)h(the)g(manifold)456 3176 y(in)n(to)28 b(a)h(union)g(of)g (\\pieces",)f(i.e.,)h(the)g(connected)g(comp)r(onen)n(ts)f(of)h(the)g (complemen)n(t)g(to)g(the)456 3276 y(curv)n(es.)605 3428 y FP(Lemma)i FQ(4.3.2)p FP(.)40 b FO(Every)31 b(2-manifold)h(with)e(a)g (b)l(oundary)h(c)l(an)e(b)l(e)h(cut)f(into)h(a)g(union)g(of:)1328 3566 y FQ(\(a\))g FO(disks)2492 3633 y @beginspecial 0 @llx 0 @lly 18 @urx 16 @ury 180 @rwi @setspecial %%BeginDocument: figures/cap.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: cap.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 16:16:42 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.25 %%Orientation: Portrait %%BoundingBox: 0 0 18 16 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /MyAppDict 100 dict dup begin def /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -82.0 83.0 translate 1 -1 scale .9 .9 scale % to make patterns same scale as in xfig % This junk string is used by the show operators /PATsstr 1 string def /PATawidthshow { % cx cy cchar rx ry string % Loop over each character in the string { % cx cy cchar rx ry char % Show the character dup % cx cy cchar rx ry char char PATsstr dup 0 4 -1 roll put % cx cy cchar rx ry char (char) false charpath % cx cy cchar rx ry char /clip load PATdraw % Move past the character (charpath modified the % current point) currentpoint % cx cy cchar rx ry char x y newpath moveto % cx cy cchar rx ry char % Reposition by cx,cy if the character in the string is cchar 3 index eq { % cx cy cchar rx ry 4 index 4 index rmoveto } if % Reposition all characters by rx ry 2 copy rmoveto % cx cy cchar rx ry } forall pop pop pop pop pop % - currentpoint newpath moveto } bind def /PATcg { 7 dict dup begin /lw currentlinewidth def /lc currentlinecap def /lj currentlinejoin def /ml currentmiterlimit def /ds [ currentdash ] def /cc [ currentrgbcolor ] def /cm matrix currentmatrix def end } bind def % PATdraw - calculates the boundaries of the object and % fills it with the current pattern /PATdraw { % proc save exch PATpcalc % proc nw nh px py 5 -1 roll exec % nw nh px py newpath PATfill % - restore } bind def % PATfill - performs the tiling for the shape /PATfill { % nw nh px py PATfill - PATDict /CurrentPattern get dup begin setfont % Set the coordinate system to Pattern Space PatternGState PATsg % Set the color for uncolored pattezns PaintType 2 eq { PATDict /PColor get PATsc } if % Create the string for showing 3 index string % nw nh px py str % Loop for each of the pattern sources 0 1 Multi 1 sub { % nw nh px py str source % Move to the starting location 3 index 3 index % nw nh px py str source px py moveto % nw nh px py str source % For multiple sources, set the appropriate color Multi 1 ne { dup PC exch get PATsc } if % Set the appropriate string for the source 0 1 7 index 1 sub { 2 index exch 2 index put } for pop % Loop over the number of vertical cells 3 index % nw nh px py str nh { % nw nh px py str currentpoint % nw nh px py str cx cy 2 index show % nw nh px py str cx cy YStep add moveto % nw nh px py str } repeat % nw nh px py str } for 5 { pop } repeat end } bind def % PATkshow - kshow with the current pattezn /PATkshow { % proc string exch bind % string proc 1 index 0 get % string proc char % Loop over all but the last character in the string 0 1 4 index length 2 sub { % string proc char idx % Find the n+1th character in the string 3 index exch 1 add get % string proe char char+1 exch 2 copy % strinq proc char+1 char char+1 char % Now show the nth character PATsstr dup 0 4 -1 roll put % string proc chr+1 chr chr+1 (chr) false charpath % string proc char+1 char char+1 /clip load PATdraw % Move past the character (charpath modified the current point) currentpoint newpath moveto % Execute the user proc (should consume char and char+1) mark 3 1 roll % string proc char+1 mark char char+1 4 index exec % string proc char+1 mark... cleartomark % string proc char+1 } for % Now display the last character PATsstr dup 0 4 -1 roll put % string proc (char+1) false charpath % string proc /clip load PATdraw neewath pop pop % - } bind def % PATmp - the makepattern equivalent /PATmp { % patdict patmtx PATmp patinstance exch dup length 7 add % We will add 6 new entries plus 1 FID dict copy % Create a new dictionary begin % Matrix to install when painting the pattern TilingType PATtcalc /PatternGState PATcg def PatternGState /cm 3 -1 roll put % Check for multi pattern sources (Level 1 fast color patterns) currentdict /Multi known not { /Multi 1 def } if % Font dictionary definitions /FontType 3 def % Create a dummy encoding vector /Encoding 256 array def 3 string 0 1 255 { Encoding exch dup 3 index cvs cvn put } for pop /FontMatrix matrix def /FontBBox BBox def /BuildChar { mark 3 1 roll % mark dict char exch begin Multi 1 ne {PaintData exch get}{pop} ifelse % mark [paintdata] PaintType 2 eq Multi 1 ne or { XStep 0 FontBBox aload pop setcachedevice } { XStep 0 setcharwidth } ifelse currentdict % mark [paintdata] dict /PaintProc load % mark [paintdata] dict paintproc end gsave false PATredef exec true PATredef grestore cleartomark % - } bind def currentdict end % newdict /foo exch % /foo newlict definefont % newfont } bind def % PATpcalc - calculates the starting point and width/height % of the tile fill for the shape /PATpcalc { % - PATpcalc nw nh px py PATDict /CurrentPattern get begin gsave % Set up the coordinate system to Pattern Space % and lock down pattern PatternGState /cm get setmatrix BBox aload pop pop pop translate % Determine the bounding box of the shape pathbbox % llx lly urx ury grestore % Determine (nw, nh) the # of cells to paint width and height PatHeight div ceiling % llx lly urx qh 4 1 roll % qh llx lly urx PatWidth div ceiling % qh llx lly qw 4 1 roll % qw qh llx lly PatHeight div floor % qw qh llx ph 4 1 roll % ph qw qh llx PatWidth div floor % ph qw qh pw 4 1 roll % pw ph qw qh 2 index sub cvi abs % pw ph qs qh-ph exch 3 index sub cvi abs exch % pw ph nw=qw-pw nh=qh-ph % Determine the starting point of the pattern fill %(px, py) 4 2 roll % nw nh pw ph PatHeight mul % nw nh pw py exch % nw nh py pw PatWidth mul exch % nw nh px py end } bind def % Save the original routines so that we can use them later on /oldfill /fill load def /oldeofill /eofill load def /oldstroke /stroke load def /oldshow /show load def /oldashow /ashow load def /oldwidthshow /widthshow load def /oldawidthshow /awidthshow load def /oldkshow /kshow load def % These defs are necessary so that subsequent procs don't bind in % the originals /fill { oldfill } bind def /eofill { oldeofill } bind def /stroke { oldstroke } bind def /show { oldshow } bind def /ashow { oldashow } bind def /widthshow { oldwidthshow } bind def /awidthshow { oldawidthshow } bind def /kshow { oldkshow } bind def /PATredef { MyAppDict begin { /fill { /clip load PATdraw newpath } bind def /eofill { /eoclip load PATdraw newpath } bind def /stroke { PATstroke } bind def /show { 0 0 null 0 0 6 -1 roll PATawidthshow } bind def /ashow { 0 0 null 6 3 roll PATawidthshow } bind def /widthshow { 0 0 3 -1 roll PATawidthshow } bind def /awidthshow { PATawidthshow } bind def /kshow { PATkshow } bind def } { /fill { oldfill } bind def /eofill { oldeofill } bind def /stroke { oldstroke } bind def /show { oldshow } bind def /ashow { oldashow } bind def /widthshow { oldwidthshow } bind def /awidthshow { oldawidthshow } bind def /kshow { oldkshow } bind def } ifelse end } bind def false PATredef % Conditionally define setcmykcolor if not available /setcmykcolor where { pop } { /setcmykcolor { 1 sub 4 1 roll 3 { 3 index add neg dup 0 lt { pop 0 } if 3 1 roll } repeat setrgbcolor - pop } bind def } ifelse /PATsc { % colorarray aload length % c1 ... cn length dup 1 eq { pop setgray } { 3 eq { setrgbcolor } { setcmykcolor } ifelse } ifelse } bind def /PATsg { % dict begin lw setlinewidth lc setlinecap lj setlinejoin ml setmiterlimit ds aload pop setdash cc aload pop setrgbcolor cm setmatrix end } bind def /PATDict 3 dict def /PATsp { true PATredef PATDict begin /CurrentPattern exch def % If it's an uncolored pattern, save the color CurrentPattern /PaintType get 2 eq { /PColor exch def } if /CColor [ currentrgbcolor ] def end } bind def % PATstroke - stroke with the current pattern /PATstroke { countdictstack save mark { currentpoint strokepath moveto PATpcalc % proc nw nh px py clip newpath PATfill } stopped { (*** PATstroke Warning: Path is too complex, stroking with gray) = cleartomark restore countdictstack exch sub dup 0 gt { { end } repeat } { pop } ifelse gsave 0.5 setgray oldstroke grestore } { pop restore pop } ifelse newpath } bind def /PATtcalc { % modmtx tilingtype PATtcalc tilematrix % Note: tiling types 2 and 3 are not supported gsave exch concat % tilingtype matrix currentmatrix exch % cmtx tilingtype % Tiling type 1 and 3: constant spacing 2 ne { % Distort the pattern so that it occupies % an integral number of device pixels dup 4 get exch dup 5 get exch % tx ty cmtx XStep 0 dtransform round exch round exch % tx ty cmtx dx.x dx.y XStep div exch XStep div exch % tx ty cmtx a b 0 YStep dtransform round exch round exch % tx ty cmtx a b dy.x dy.y YStep div exch YStep div exch % tx ty cmtx a b c d 7 -3 roll astore % { a b c d tx ty } } if grestore } bind def /PATusp { false PATredef PATDict begin CColor PATsc end } bind def % right45 11 dict begin /PaintType 1 def /PatternType 1 def /TilingType 1 def /BBox [0 0 1 1] def /XStep 1 def /YStep 1 def /PatWidth 1 def /PatHeight 1 def /Multi 2 def /PaintData [ { clippath } bind { 32 32 true [ 32 0 0 -32 0 32 ] {<010101010202020204040404080808081010101020202020 404040408080808001010101020202020404040408080808 101010102020202040404040808080800101010102020202 040404040808080810101010202020204040404080808080 010101010202020204040404080808081010101020202020 4040404080808080>} imagemask } bind ] def /PaintProc { pop exec fill } def currentdict end /P5 exch def 1.1111 1.1111 scale %restore scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01500 0.01500 sc 7.500 slw % Arc gs n 6075.0 4933.3 541.7 -165.8 -14.2 arcn gs col-1 s gr gr % Ellipse n 6075 4800 525 300 0 360 DrawEllipse gs col-1 s gr % Open spline gs 0.000 slw n 5550.0 4875.0 m 5550.0 4912.5 l 5550.0 4912.5 5550.0 4950.0 5550.0 5025.0 DrawSplineSection 5550.0 5025.0 5550.0 5100.0 5587.5 5137.5 DrawSplineSection 5587.5 5137.5 5625.0 5175.0 5662.5 5250.0 DrawSplineSection 5662.5 5250.0 5700.0 5325.0 5775.0 5362.5 DrawSplineSection 5775.0 5362.5 5850.0 5400.0 5887.5 5400.0 DrawSplineSection 5887.5 5400.0 5925.0 5400.0 5962.5 5437.5 DrawSplineSection 5962.5 5437.5 6000.0 5475.0 6075.0 5437.5 DrawSplineSection 6075.0 5437.5 6150.0 5400.0 6217.5 5385.0 DrawSplineSection 6217.5 5385.0 6285.0 5370.0 6352.5 5332.5 DrawSplineSection 6352.5 5332.5 6420.0 5295.0 6450.0 5250.0 DrawSplineSection 6450.0 5250.0 6480.0 5205.0 6510.0 5175.0 DrawSplineSection 6510.0 5175.0 6540.0 5145.0 6555.0 5070.0 DrawSplineSection 6555.0 5070.0 6570.0 4995.0 6585.0 4935.0 DrawSplineSection 6585.0 4935.0 6600.0 4875.0 6600.0 4875.0 DrawSplineSection 6600.0 4875.0 6600.0 4875.0 6562.5 4912.5 DrawSplineSection 6562.5 4912.5 6525.0 4950.0 6525.0 4987.5 DrawSplineSection 6525.0 4987.5 6525.0 5025.0 6457.5 5047.5 DrawSplineSection 6457.5 5047.5 6390.0 5070.0 6352.5 5092.5 DrawSplineSection 6352.5 5092.5 6315.0 5115.0 6232.5 5100.0 DrawSplineSection 6232.5 5100.0 6150.0 5085.0 6075.0 5092.5 DrawSplineSection 6075.0 5092.5 6000.0 5100.0 5962.5 5100.0 DrawSplineSection 5962.5 5100.0 5925.0 5100.0 5850.0 5062.5 DrawSplineSection 5850.0 5062.5 5775.0 5025.0 5737.5 5025.0 DrawSplineSection 5737.5 5025.0 5700.0 5025.0 5662.5 4987.5 DrawSplineSection 5662.5 4987.5 5625.0 4950.0 5587.5 4912.5 DrawSplineSection 5550.0 4875.0 l gs /PC [[1.00 1.00 1.00] [0.00 0.00 0.00]] def 15.00 15.00 sc P5 [16 0 0 -16 370.00 325.00] PATmp PATsp ef gr PATusp gr $F2psEnd rs end %%EndDocument @endspecial 1328 3770 a FQ(\(b\))g FO(cylinders)2492 3874 y @beginspecial 0 @llx 0 @lly 13 @urx 25 @ury 130 @rwi @setspecial %%BeginDocument: figures/cylinder.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: cylinder.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 16:25:34 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.08 %%Orientation: Portrait %%BoundingBox: 0 0 13 25 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -5.0 38.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.00480 0.00480 sc 30.000 slw % Polyline n 1200 7050 m 1200 3375 l gs col-1 s gr % Polyline n 3600 7050 m 3600 3375 l gs col-1 s gr % Open spline gs n 3600.0 7050.0 m 3450.0 7275.0 l 3450.0 7275.0 3300.0 7500.0 2850.0 7650.0 DrawSplineSection 2850.0 7650.0 2400.0 7800.0 1950.0 7650.0 DrawSplineSection 1950.0 7650.0 1500.0 7500.0 1350.0 7275.0 DrawSplineSection 1200.0 7050.0 l gs col-1 s gr gr % Open spline gs n 3600.0 3450.0 m 3450.0 3675.0 l 3450.0 3675.0 3300.0 3900.0 2850.0 4050.0 DrawSplineSection 2850.0 4050.0 2400.0 4200.0 1950.0 4050.0 DrawSplineSection 1950.0 4050.0 1500.0 3900.0 1350.0 3675.0 DrawSplineSection 1200.0 3450.0 l gs col-1 s gr gr % Open spline gs n 3600.0 3450.0 m 3450.0 3225.0 l 3450.0 3225.0 3300.0 3000.0 2850.0 2850.0 DrawSplineSection 2850.0 2850.0 2400.0 2700.0 1950.0 2850.0 DrawSplineSection 1950.0 2850.0 1500.0 3000.0 1350.0 3225.0 DrawSplineSection 1200.0 3450.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 3600.0 7050.0 m 3450.0 6825.0 l 3450.0 6825.0 3300.0 6600.0 2850.0 6450.0 DrawSplineSection 2850.0 6450.0 2400.0 6300.0 1950.0 6450.0 DrawSplineSection 1950.0 6450.0 1500.0 6600.0 1350.0 6825.0 DrawSplineSection 1200.0 7050.0 l gs col-1 s gr gr [] 0 sd $F2psEnd rs %%EndDocument @endspecial 1328 4016 a FQ(\(c\))g FO(trinions)2492 4124 y @beginspecial 0 @llx 0 @lly 30 @urx 26 @ury 300 @rwi @setspecial %%BeginDocument: figures/pants3.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: pants3.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 16:24:47 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.05 %%Orientation: Portrait %%BoundingBox: 0 0 30 26 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -5.0 28.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.00300 0.00300 sc 30.000 slw % Arc gs n 6615.2 8400.5 1200.6 178.6 2.1 arc gs col-1 s gr gr % Ellipse n 6600 1800 1800 825 0 360 DrawEllipse gs col-1 s gr % Open spline gs n 4800.0 1785.0 m 4807.5 2685.0 l 4807.5 2685.0 4815.0 3585.0 3315.0 4800.0 DrawSplineSection 3315.0 4800.0 1815.0 6015.0 1815.0 7200.0 DrawSplineSection 1815.0 8385.0 l gs col-1 s gr gr % Open spline gs n 1800.0 8415.0 m 1807.5 8482.5 l 1807.5 8482.5 1815.0 8550.0 1905.0 8670.0 DrawSplineSection 1905.0 8670.0 1995.0 8790.0 2122.5 8865.0 DrawSplineSection 2122.5 8865.0 2250.0 8940.0 2407.5 9030.0 DrawSplineSection 2407.5 9030.0 2565.0 9120.0 2730.0 9157.5 DrawSplineSection 2730.0 9157.5 2895.0 9195.0 3060.0 9217.5 DrawSplineSection 3060.0 9217.5 3225.0 9240.0 3397.5 9247.5 DrawSplineSection 3397.5 9247.5 3570.0 9255.0 3780.0 9247.5 DrawSplineSection 3780.0 9247.5 3990.0 9240.0 4162.5 9217.5 DrawSplineSection 4162.5 9217.5 4335.0 9195.0 4477.5 9150.0 DrawSplineSection 4477.5 9150.0 4620.0 9105.0 4747.5 9060.0 DrawSplineSection 4747.5 9060.0 4875.0 9015.0 5032.5 8925.0 DrawSplineSection 5032.5 8925.0 5190.0 8835.0 5295.0 8700.0 DrawSplineSection 5295.0 8700.0 5400.0 8565.0 5400.0 8490.0 DrawSplineSection 5400.0 8415.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 1800.0 8385.0 m 1807.5 8317.5 l 1807.5 8317.5 1815.0 8250.0 1905.0 8130.0 DrawSplineSection 1905.0 8130.0 1995.0 8010.0 2122.5 7935.0 DrawSplineSection 2122.5 7935.0 2250.0 7860.0 2407.5 7770.0 DrawSplineSection 2407.5 7770.0 2565.0 7680.0 2730.0 7642.5 DrawSplineSection 2730.0 7642.5 2895.0 7605.0 3060.0 7582.5 DrawSplineSection 3060.0 7582.5 3225.0 7560.0 3397.5 7552.5 DrawSplineSection 3397.5 7552.5 3570.0 7545.0 3780.0 7552.5 DrawSplineSection 3780.0 7552.5 3990.0 7560.0 4162.5 7582.5 DrawSplineSection 4162.5 7582.5 4335.0 7605.0 4477.5 7650.0 DrawSplineSection 4477.5 7650.0 4620.0 7695.0 4747.5 7740.0 DrawSplineSection 4747.5 7740.0 4875.0 7785.0 5032.5 7875.0 DrawSplineSection 5032.5 7875.0 5190.0 7965.0 5295.0 8100.0 DrawSplineSection 5295.0 8100.0 5400.0 8235.0 5400.0 8310.0 DrawSplineSection 5400.0 8385.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 7815.0 8460.0 m 7822.5 8527.5 l 7822.5 8527.5 7830.0 8595.0 7920.0 8715.0 DrawSplineSection 7920.0 8715.0 8010.0 8835.0 8137.5 8910.0 DrawSplineSection 8137.5 8910.0 8265.0 8985.0 8422.5 9075.0 DrawSplineSection 8422.5 9075.0 8580.0 9165.0 8745.0 9202.5 DrawSplineSection 8745.0 9202.5 8910.0 9240.0 9075.0 9262.5 DrawSplineSection 9075.0 9262.5 9240.0 9285.0 9412.5 9292.5 DrawSplineSection 9412.5 9292.5 9585.0 9300.0 9795.0 9292.5 DrawSplineSection 9795.0 9292.5 10005.0 9285.0 10177.5 9262.5 DrawSplineSection 10177.5 9262.5 10350.0 9240.0 10492.5 9195.0 DrawSplineSection 10492.5 9195.0 10635.0 9150.0 10762.5 9105.0 DrawSplineSection 10762.5 9105.0 10890.0 9060.0 11047.5 8970.0 DrawSplineSection 11047.5 8970.0 11205.0 8880.0 11310.0 8745.0 DrawSplineSection 11310.0 8745.0 11415.0 8610.0 11415.0 8535.0 DrawSplineSection 11415.0 8460.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 7800.0 8385.0 m 7807.5 8317.5 l 7807.5 8317.5 7815.0 8250.0 7905.0 8130.0 DrawSplineSection 7905.0 8130.0 7995.0 8010.0 8122.5 7935.0 DrawSplineSection 8122.5 7935.0 8250.0 7860.0 8407.5 7770.0 DrawSplineSection 8407.5 7770.0 8565.0 7680.0 8730.0 7642.5 DrawSplineSection 8730.0 7642.5 8895.0 7605.0 9060.0 7582.5 DrawSplineSection 9060.0 7582.5 9225.0 7560.0 9397.5 7552.5 DrawSplineSection 9397.5 7552.5 9570.0 7545.0 9780.0 7552.5 DrawSplineSection 9780.0 7552.5 9990.0 7560.0 10162.5 7582.5 DrawSplineSection 10162.5 7582.5 10335.0 7605.0 10477.5 7650.0 DrawSplineSection 10477.5 7650.0 10620.0 7695.0 10747.5 7740.0 DrawSplineSection 10747.5 7740.0 10875.0 7785.0 11032.5 7875.0 DrawSplineSection 11032.5 7875.0 11190.0 7965.0 11295.0 8100.0 DrawSplineSection 11295.0 8100.0 11400.0 8235.0 11400.0 8310.0 DrawSplineSection 11400.0 8385.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 8415.0 1785.0 m 8407.5 2685.0 l 8407.5 2685.0 8400.0 3585.0 9900.0 4800.0 DrawSplineSection 9900.0 4800.0 11400.0 6015.0 11400.0 7200.0 DrawSplineSection 11400.0 8385.0 l gs col-1 s gr gr $F2psEnd rs %%EndDocument @endspecial 605 4243 a FQ(Ho)n(w)n(ev)n(er,)f(a)i(2-manifold)e FJ(M)40 b FQ(can)30 b(b)r(e)h(cut)g(in)g(sev)n(eral)d(di\013eren)n(t)j (w)n(a)n(ys.)44 b(T)-7 b(o)31 b(c)n(hec)n(k)e(that)456 4342 y FJ(\034)9 b FQ(\()p FJ(M)g FQ(\))28 b(is)g(w)n(ell-de\014ned,)f (w)n(e)g(need)h(the)g(next)g(result.)605 4494 y FP(Lemma)j FQ(4.3.3)f(\([)p FK(HT)q FQ(]\))p FP(.)41 b FO(A)n(ny)32 b(two)g(ways)i(to)e(cut)f(a)i(2-manifold)h FJ(M)41 b FO(into)33 b(disks,)h(cylin-)456 4594 y(ders)26 b(and)h(trinions)g(c)l (an)f(b)l(e)h(r)l(elate)l(d)f(by)h(isotopy)h(of)f FJ(M)35 b FO(and)27 b(a)g(se)l(quenc)l(e)f(of)h(\\simple)g(moves")p FQ(:)1492 5216 y @beginspecial 0 @llx 0 @lly 110 @urx 67 @ury 1100 @rwi @setspecial %%BeginDocument: figures/unit2.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: unit2.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 15:33:43 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 110 67 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /MyAppDict 100 dict dup begin def /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -13.0 123.0 translate 1 -1 scale .9 .9 scale % to make patterns same scale as in xfig % This junk string is used by the show operators /PATsstr 1 string def /PATawidthshow { % cx cy cchar rx ry string % Loop over each character in the string { % cx cy cchar rx ry char % Show the character dup % cx cy cchar rx ry char char PATsstr dup 0 4 -1 roll put % cx cy cchar rx ry char (char) false charpath % cx cy cchar rx ry char /clip load PATdraw % Move past the character (charpath modified the % current point) currentpoint % cx cy cchar rx ry char x y newpath moveto % cx cy cchar rx ry char % Reposition by cx,cy if the character in the string is cchar 3 index eq { % cx cy cchar rx ry 4 index 4 index rmoveto } if % Reposition all characters by rx ry 2 copy rmoveto % cx cy cchar rx ry } forall pop pop pop pop pop % - currentpoint newpath moveto } bind def /PATcg { 7 dict dup begin /lw currentlinewidth def /lc currentlinecap def /lj currentlinejoin def /ml currentmiterlimit def /ds [ currentdash ] def /cc [ currentrgbcolor ] def /cm matrix currentmatrix def end } bind def % PATdraw - calculates the boundaries of the object and % fills it with the current pattern /PATdraw { % proc save exch PATpcalc % proc nw nh px py 5 -1 roll exec % nw nh px py newpath PATfill % - restore } bind def % PATfill - performs the tiling for the shape /PATfill { % nw nh px py PATfill - PATDict /CurrentPattern get dup begin setfont % Set the coordinate system to Pattern Space PatternGState PATsg % Set the color for uncolored pattezns PaintType 2 eq { PATDict /PColor get PATsc } if % Create the string for showing 3 index string % nw nh px py str % Loop for each of the pattern sources 0 1 Multi 1 sub { % nw nh px py str source % Move to the starting location 3 index 3 index % nw nh px py str source px py moveto % nw nh px py str source % For multiple sources, set the appropriate color Multi 1 ne { dup PC exch get PATsc } if % Set the appropriate string for the source 0 1 7 index 1 sub { 2 index exch 2 index put } for pop % Loop over the number of vertical cells 3 index % nw nh px py str nh { % nw nh px py str currentpoint % nw nh px py str cx cy 2 index show % nw nh px py str cx cy YStep add moveto % nw nh px py str } repeat % nw nh px py str } for 5 { pop } repeat end } bind def % PATkshow - kshow with the current pattezn /PATkshow { % proc string exch bind % string proc 1 index 0 get % string proc char % Loop over all but the last character in the string 0 1 4 index length 2 sub { % string proc char idx % Find the n+1th character in the string 3 index exch 1 add get % string proe char char+1 exch 2 copy % strinq proc char+1 char char+1 char % Now show the nth character PATsstr dup 0 4 -1 roll put % string proc chr+1 chr chr+1 (chr) false charpath % string proc char+1 char char+1 /clip load PATdraw % Move past the character (charpath modified the current point) currentpoint newpath moveto % Execute the user proc (should consume char and char+1) mark 3 1 roll % string proc char+1 mark char char+1 4 index exec % string proc char+1 mark... cleartomark % string proc char+1 } for % Now display the last character PATsstr dup 0 4 -1 roll put % string proc (char+1) false charpath % string proc /clip load PATdraw neewath pop pop % - } bind def % PATmp - the makepattern equivalent /PATmp { % patdict patmtx PATmp patinstance exch dup length 7 add % We will add 6 new entries plus 1 FID dict copy % Create a new dictionary begin % Matrix to install when painting the pattern TilingType PATtcalc /PatternGState PATcg def PatternGState /cm 3 -1 roll put % Check for multi pattern sources (Level 1 fast color patterns) currentdict /Multi known not { /Multi 1 def } if % Font dictionary definitions /FontType 3 def % Create a dummy encoding vector /Encoding 256 array def 3 string 0 1 255 { Encoding exch dup 3 index cvs cvn put } for pop /FontMatrix matrix def /FontBBox BBox def /BuildChar { mark 3 1 roll % mark dict char exch begin Multi 1 ne {PaintData exch get}{pop} ifelse % mark [paintdata] PaintType 2 eq Multi 1 ne or { XStep 0 FontBBox aload pop setcachedevice } { XStep 0 setcharwidth } ifelse currentdict % mark [paintdata] dict /PaintProc load % mark [paintdata] dict paintproc end gsave false PATredef exec true PATredef grestore cleartomark % - } bind def currentdict end % newdict /foo exch % /foo newlict definefont % newfont } bind def % PATpcalc - calculates the starting point and width/height % of the tile fill for the shape /PATpcalc { % - PATpcalc nw nh px py PATDict /CurrentPattern get begin gsave % Set up the coordinate system to Pattern Space % and lock down pattern PatternGState /cm get setmatrix BBox aload pop pop pop translate % Determine the bounding box of the shape pathbbox % llx lly urx ury grestore % Determine (nw, nh) the # of cells to paint width and height PatHeight div ceiling % llx lly urx qh 4 1 roll % qh llx lly urx PatWidth div ceiling % qh llx lly qw 4 1 roll % qw qh llx lly PatHeight div floor % qw qh llx ph 4 1 roll % ph qw qh llx PatWidth div floor % ph qw qh pw 4 1 roll % pw ph qw qh 2 index sub cvi abs % pw ph qs qh-ph exch 3 index sub cvi abs exch % pw ph nw=qw-pw nh=qh-ph % Determine the starting point of the pattern fill %(px, py) 4 2 roll % nw nh pw ph PatHeight mul % nw nh pw py exch % nw nh py pw PatWidth mul exch % nw nh px py end } bind def % Save the original routines so that we can use them later on /oldfill /fill load def /oldeofill /eofill load def /oldstroke /stroke load def /oldshow /show load def /oldashow /ashow load def /oldwidthshow /widthshow load def /oldawidthshow /awidthshow load def /oldkshow /kshow load def % These defs are necessary so that subsequent procs don't bind in % the originals /fill { oldfill } bind def /eofill { oldeofill } bind def /stroke { oldstroke } bind def /show { oldshow } bind def /ashow { oldashow } bind def /widthshow { oldwidthshow } bind def /awidthshow { oldawidthshow } bind def /kshow { oldkshow } bind def /PATredef { MyAppDict begin { /fill { /clip load PATdraw newpath } bind def /eofill { /eoclip load PATdraw newpath } bind def /stroke { PATstroke } bind def /show { 0 0 null 0 0 6 -1 roll PATawidthshow } bind def /ashow { 0 0 null 6 3 roll PATawidthshow } bind def /widthshow { 0 0 3 -1 roll PATawidthshow } bind def /awidthshow { PATawidthshow } bind def /kshow { PATkshow } bind def } { /fill { oldfill } bind def /eofill { oldeofill } bind def /stroke { oldstroke } bind def /show { oldshow } bind def /ashow { oldashow } bind def /widthshow { oldwidthshow } bind def /awidthshow { oldawidthshow } bind def /kshow { oldkshow } bind def } ifelse end } bind def false PATredef % Conditionally define setcmykcolor if not available /setcmykcolor where { pop } { /setcmykcolor { 1 sub 4 1 roll 3 { 3 index add neg dup 0 lt { pop 0 } if 3 1 roll } repeat setrgbcolor - pop } bind def } ifelse /PATsc { % colorarray aload length % c1 ... cn length dup 1 eq { pop setgray } { 3 eq { setrgbcolor } { setcmykcolor } ifelse } ifelse } bind def /PATsg { % dict begin lw setlinewidth lc setlinecap lj setlinejoin ml setmiterlimit ds aload pop setdash cc aload pop setrgbcolor cm setmatrix end } bind def /PATDict 3 dict def /PATsp { true PATredef PATDict begin /CurrentPattern exch def % If it's an uncolored pattern, save the color CurrentPattern /PaintType get 2 eq { /PColor exch def } if /CColor [ currentrgbcolor ] def end } bind def % PATstroke - stroke with the current pattern /PATstroke { countdictstack save mark { currentpoint strokepath moveto PATpcalc % proc nw nh px py clip newpath PATfill } stopped { (*** PATstroke Warning: Path is too complex, stroking with gray) = cleartomark restore countdictstack exch sub dup 0 gt { { end } repeat } { pop } ifelse gsave 0.5 setgray oldstroke grestore } { pop restore pop } ifelse newpath } bind def /PATtcalc { % modmtx tilingtype PATtcalc tilematrix % Note: tiling types 2 and 3 are not supported gsave exch concat % tilingtype matrix currentmatrix exch % cmtx tilingtype % Tiling type 1 and 3: constant spacing 2 ne { % Distort the pattern so that it occupies % an integral number of device pixels dup 4 get exch dup 5 get exch % tx ty cmtx XStep 0 dtransform round exch round exch % tx ty cmtx dx.x dx.y XStep div exch XStep div exch % tx ty cmtx a b 0 YStep dtransform round exch round exch % tx ty cmtx a b dy.x dy.y YStep div exch YStep div exch % tx ty cmtx a b c d 7 -3 roll astore % { a b c d tx ty } } if grestore } bind def /PATusp { false PATredef PATDict begin CColor PATsc end } bind def % right45 11 dict begin /PaintType 1 def /PatternType 1 def /TilingType 1 def /BBox [0 0 1 1] def /XStep 1 def /YStep 1 def /PatWidth 1 def /PatHeight 1 def /Multi 2 def /PaintData [ { clippath } bind { 32 32 true [ 32 0 0 -32 0 32 ] {<010101010202020204040404080808081010101020202020 404040408080808001010101020202020404040408080808 101010102020202040404040808080800101010102020202 040404040808080810101010202020204040404080808080 010101010202020204040404080808081010101020202020 4040404080808080>} imagemask } bind ] def /PaintProc { pop exec fill } def currentdict end /P5 exch def 1.1111 1.1111 scale %restore scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc 30.000 slw % Arc gs n 2100.0 9289.3 910.7 -171.2 -8.8 arcn gs col-1 s gr gr % Ellipse n 9262 5250 862 525 0 360 DrawEllipse gs col-1 s gr % Polyline % % Begin Imported EPS File: pants.eps %BeginDocument: pants.eps % n gs 1200 4800 tr 45.714286 -52.747253 sc 0 -91 tr 0 0 tr sa /showpage {} def % EPS file follows: %!PS-Adobe-2.0 EPSF-2.0 %%Title: pants.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 12:45:11 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.18 %%Orientation: Portrait %%BoundingBox: 0 0 105 91 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -19.0 101.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01080 0.01080 sc 30.000 slw % Arc gs n 6615.2 8400.5 1200.6 178.6 2.1 arc gs col-1 s gr gr % Ellipse n 6600 1800 1800 825 0 360 DrawEllipse gs col-1 s gr % Open spline gs n 4800.0 1785.0 m 4807.5 2685.0 l 4807.5 2685.0 4815.0 3585.0 3315.0 4800.0 DrawSplineSection 3315.0 4800.0 1815.0 6015.0 1815.0 7200.0 DrawSplineSection 1815.0 8385.0 l gs col-1 s gr gr % Open spline gs n 1800.0 8415.0 m 1807.5 8482.5 l 1807.5 8482.5 1815.0 8550.0 1905.0 8670.0 DrawSplineSection 1905.0 8670.0 1995.0 8790.0 2122.5 8865.0 DrawSplineSection 2122.5 8865.0 2250.0 8940.0 2407.5 9030.0 DrawSplineSection 2407.5 9030.0 2565.0 9120.0 2730.0 9157.5 DrawSplineSection 2730.0 9157.5 2895.0 9195.0 3060.0 9217.5 DrawSplineSection 3060.0 9217.5 3225.0 9240.0 3397.5 9247.5 DrawSplineSection 3397.5 9247.5 3570.0 9255.0 3780.0 9247.5 DrawSplineSection 3780.0 9247.5 3990.0 9240.0 4162.5 9217.5 DrawSplineSection 4162.5 9217.5 4335.0 9195.0 4477.5 9150.0 DrawSplineSection 4477.5 9150.0 4620.0 9105.0 4747.5 9060.0 DrawSplineSection 4747.5 9060.0 4875.0 9015.0 5032.5 8925.0 DrawSplineSection 5032.5 8925.0 5190.0 8835.0 5295.0 8700.0 DrawSplineSection 5295.0 8700.0 5400.0 8565.0 5400.0 8490.0 DrawSplineSection 5400.0 8415.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 1800.0 8385.0 m 1807.5 8317.5 l 1807.5 8317.5 1815.0 8250.0 1905.0 8130.0 DrawSplineSection 1905.0 8130.0 1995.0 8010.0 2122.5 7935.0 DrawSplineSection 2122.5 7935.0 2250.0 7860.0 2407.5 7770.0 DrawSplineSection 2407.5 7770.0 2565.0 7680.0 2730.0 7642.5 DrawSplineSection 2730.0 7642.5 2895.0 7605.0 3060.0 7582.5 DrawSplineSection 3060.0 7582.5 3225.0 7560.0 3397.5 7552.5 DrawSplineSection 3397.5 7552.5 3570.0 7545.0 3780.0 7552.5 DrawSplineSection 3780.0 7552.5 3990.0 7560.0 4162.5 7582.5 DrawSplineSection 4162.5 7582.5 4335.0 7605.0 4477.5 7650.0 DrawSplineSection 4477.5 7650.0 4620.0 7695.0 4747.5 7740.0 DrawSplineSection 4747.5 7740.0 4875.0 7785.0 5032.5 7875.0 DrawSplineSection 5032.5 7875.0 5190.0 7965.0 5295.0 8100.0 DrawSplineSection 5295.0 8100.0 5400.0 8235.0 5400.0 8310.0 DrawSplineSection 5400.0 8385.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 7815.0 8460.0 m 7822.5 8527.5 l 7822.5 8527.5 7830.0 8595.0 7920.0 8715.0 DrawSplineSection 7920.0 8715.0 8010.0 8835.0 8137.5 8910.0 DrawSplineSection 8137.5 8910.0 8265.0 8985.0 8422.5 9075.0 DrawSplineSection 8422.5 9075.0 8580.0 9165.0 8745.0 9202.5 DrawSplineSection 8745.0 9202.5 8910.0 9240.0 9075.0 9262.5 DrawSplineSection 9075.0 9262.5 9240.0 9285.0 9412.5 9292.5 DrawSplineSection 9412.5 9292.5 9585.0 9300.0 9795.0 9292.5 DrawSplineSection 9795.0 9292.5 10005.0 9285.0 10177.5 9262.5 DrawSplineSection 10177.5 9262.5 10350.0 9240.0 10492.5 9195.0 DrawSplineSection 10492.5 9195.0 10635.0 9150.0 10762.5 9105.0 DrawSplineSection 10762.5 9105.0 10890.0 9060.0 11047.5 8970.0 DrawSplineSection 11047.5 8970.0 11205.0 8880.0 11310.0 8745.0 DrawSplineSection 11310.0 8745.0 11415.0 8610.0 11415.0 8535.0 DrawSplineSection 11415.0 8460.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 7800.0 8385.0 m 7807.5 8317.5 l 7807.5 8317.5 7815.0 8250.0 7905.0 8130.0 DrawSplineSection 7905.0 8130.0 7995.0 8010.0 8122.5 7935.0 DrawSplineSection 8122.5 7935.0 8250.0 7860.0 8407.5 7770.0 DrawSplineSection 8407.5 7770.0 8565.0 7680.0 8730.0 7642.5 DrawSplineSection 8730.0 7642.5 8895.0 7605.0 9060.0 7582.5 DrawSplineSection 9060.0 7582.5 9225.0 7560.0 9397.5 7552.5 DrawSplineSection 9397.5 7552.5 9570.0 7545.0 9780.0 7552.5 DrawSplineSection 9780.0 7552.5 9990.0 7560.0 10162.5 7582.5 DrawSplineSection 10162.5 7582.5 10335.0 7605.0 10477.5 7650.0 DrawSplineSection 10477.5 7650.0 10620.0 7695.0 10747.5 7740.0 DrawSplineSection 10747.5 7740.0 10875.0 7785.0 11032.5 7875.0 DrawSplineSection 11032.5 7875.0 11190.0 7965.0 11295.0 8100.0 DrawSplineSection 11295.0 8100.0 11400.0 8235.0 11400.0 8310.0 DrawSplineSection 11400.0 8385.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 8415.0 1785.0 m 8407.5 2685.0 l 8407.5 2685.0 8400.0 3585.0 9900.0 4800.0 DrawSplineSection 9900.0 4800.0 11400.0 6015.0 11400.0 7200.0 DrawSplineSection 11400.0 8385.0 l gs col-1 s gr gr $F2psEnd rs rs gr % % End Imported PIC File: pants.eps %EndDocument % % Polyline % % Begin Imported EPS File: ellips.eps %BeginDocument: ellips.eps % n gs 8400 8400 tr 40.000000 -57.954545 sc 0 -22 tr 0 0 tr sa /showpage {} def % EPS file follows: %!PS-Adobe-2.0 EPSF-2.0 %%Title: ellips.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 13:32:03 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 45 22 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -21.0 83.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc % Open spline gs 30.000 slw n 1800.0 6000.0 m 1807.5 6067.5 l 1807.5 6067.5 1815.0 6135.0 1905.0 6255.0 DrawSplineSection 1905.0 6255.0 1995.0 6375.0 2122.5 6450.0 DrawSplineSection 2122.5 6450.0 2250.0 6525.0 2407.5 6615.0 DrawSplineSection 2407.5 6615.0 2565.0 6705.0 2730.0 6742.5 DrawSplineSection 2730.0 6742.5 2895.0 6780.0 3060.0 6802.5 DrawSplineSection 3060.0 6802.5 3225.0 6825.0 3397.5 6832.5 DrawSplineSection 3397.5 6832.5 3570.0 6840.0 3780.0 6832.5 DrawSplineSection 3780.0 6832.5 3990.0 6825.0 4162.5 6802.5 DrawSplineSection 4162.5 6802.5 4335.0 6780.0 4477.5 6735.0 DrawSplineSection 4477.5 6735.0 4620.0 6690.0 4747.5 6645.0 DrawSplineSection 4747.5 6645.0 4875.0 6600.0 5032.5 6510.0 DrawSplineSection 5032.5 6510.0 5190.0 6420.0 5295.0 6285.0 DrawSplineSection 5295.0 6285.0 5400.0 6150.0 5400.0 6075.0 DrawSplineSection 5400.0 6000.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 1800.0 6000.0 m 1807.5 5932.5 l 1807.5 5932.5 1815.0 5865.0 1905.0 5745.0 DrawSplineSection 1905.0 5745.0 1995.0 5625.0 2122.5 5550.0 DrawSplineSection 2122.5 5550.0 2250.0 5475.0 2407.5 5385.0 DrawSplineSection 2407.5 5385.0 2565.0 5295.0 2730.0 5257.5 DrawSplineSection 2730.0 5257.5 2895.0 5220.0 3060.0 5197.5 DrawSplineSection 3060.0 5197.5 3225.0 5175.0 3397.5 5167.5 DrawSplineSection 3397.5 5167.5 3570.0 5160.0 3780.0 5167.5 DrawSplineSection 3780.0 5167.5 3990.0 5175.0 4162.5 5197.5 DrawSplineSection 4162.5 5197.5 4335.0 5220.0 4477.5 5265.0 DrawSplineSection 4477.5 5265.0 4620.0 5310.0 4747.5 5355.0 DrawSplineSection 4747.5 5355.0 4875.0 5400.0 5032.5 5490.0 DrawSplineSection 5032.5 5490.0 5190.0 5580.0 5295.0 5715.0 DrawSplineSection 5295.0 5715.0 5400.0 5850.0 5400.0 5925.0 DrawSplineSection 5400.0 6000.0 l gs col-1 s gr gr [] 0 sd $F2psEnd rs rs gr % % End Imported PIC File: ellips.eps %EndDocument % % Polyline n 8400 9075 m 8400 5325 l gs col-1 s gr % Polyline n 10125 9075 m 10125 5325 l gs col-1 s gr % Open spline gs 0.000 slw n 1200.0 9150.0 m 1200.0 9225.0 l 1200.0 9225.0 1200.0 9300.0 1215.0 9390.0 DrawSplineSection 1215.0 9390.0 1230.0 9480.0 1260.0 9570.0 DrawSplineSection 1260.0 9570.0 1290.0 9660.0 1320.0 9742.5 DrawSplineSection 1320.0 9742.5 1350.0 9825.0 1425.0 9862.5 DrawSplineSection 1425.0 9862.5 1500.0 9900.0 1537.5 9937.5 DrawSplineSection 1537.5 9937.5 1575.0 9975.0 1650.0 10012.5 DrawSplineSection 1650.0 10012.5 1725.0 10050.0 1800.0 10087.5 DrawSplineSection 1800.0 10087.5 1875.0 10125.0 1957.5 10132.5 DrawSplineSection 1957.5 10132.5 2040.0 10140.0 2107.5 10147.5 DrawSplineSection 2107.5 10147.5 2175.0 10155.0 2257.5 10140.0 DrawSplineSection 2257.5 10140.0 2340.0 10125.0 2437.5 10072.5 DrawSplineSection 2437.5 10072.5 2535.0 10020.0 2602.5 9975.0 DrawSplineSection 2602.5 9975.0 2670.0 9930.0 2722.5 9877.5 DrawSplineSection 2722.5 9877.5 2775.0 9825.0 2812.5 9787.5 DrawSplineSection 2812.5 9787.5 2850.0 9750.0 2887.5 9675.0 DrawSplineSection 2887.5 9675.0 2925.0 9600.0 2925.0 9562.5 DrawSplineSection 2925.0 9562.5 2925.0 9525.0 2925.0 9450.0 DrawSplineSection 2925.0 9450.0 2925.0 9375.0 2962.5 9300.0 DrawSplineSection 2962.5 9300.0 3000.0 9225.0 2962.5 9262.5 DrawSplineSection 2962.5 9262.5 2925.0 9300.0 2850.0 9337.5 DrawSplineSection 2850.0 9337.5 2775.0 9375.0 2752.5 9427.5 DrawSplineSection 2752.5 9427.5 2730.0 9480.0 2602.5 9502.5 DrawSplineSection 2602.5 9502.5 2475.0 9525.0 2400.0 9525.0 DrawSplineSection 2400.0 9525.0 2325.0 9525.0 2250.0 9562.5 DrawSplineSection 2250.0 9562.5 2175.0 9600.0 2062.5 9600.0 DrawSplineSection 2062.5 9600.0 1950.0 9600.0 1875.0 9562.5 DrawSplineSection 1875.0 9562.5 1800.0 9525.0 1762.5 9525.0 DrawSplineSection 1762.5 9525.0 1725.0 9525.0 1650.0 9487.5 DrawSplineSection 1650.0 9487.5 1575.0 9450.0 1537.5 9412.5 DrawSplineSection 1537.5 9412.5 1500.0 9375.0 1462.5 9375.0 DrawSplineSection 1462.5 9375.0 1425.0 9375.0 1387.5 9337.5 DrawSplineSection 1387.5 9337.5 1350.0 9300.0 1275.0 9225.0 DrawSplineSection 1200.0 9150.0 l gs /PC [[1.00 1.00 1.00] [0.00 0.00 0.00]] def 15.00 15.00 sc P5 [16 0 0 -16 80.00 615.00] PATmp PATsp ef gr PATusp gr /Times-Roman ff 900.00 scf sf 6975 7350 m gs 1 -1 sc (=) col-1 sh gr $F2psEnd rs end %%EndDocument @endspecial 456 4936 a(\(i\))p eop %%Page: 81 11 81 84 bop 1538 226 a FM(4.4.)29 b(3D)g(TQFT)h(FR)n(OM)f(MTC)994 b(81)1675 876 y @beginspecial 0 @llx 0 @lly 66 @urx 64 @ury 660 @rwi @setspecial %%BeginDocument: figures/mv2.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: mv2.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 17:13:06 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.15 %%Orientation: Portrait %%BoundingBox: 0 0 66 64 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -10.0 88.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.00900 0.00900 sc 30.000 slw % Ellipse n 7275 5955 1125 705 0 360 DrawEllipse gs col-1 s gr % Polyline n 3600 8985 m 3600 3375 l gs col-1 s gr % Polyline n 1200 8985 m 1200 3375 l gs col-1 s gr % Open spline gs n 3600.0 3450.0 m 3450.0 3675.0 l 3450.0 3675.0 3300.0 3900.0 2850.0 4050.0 DrawSplineSection 2850.0 4050.0 2400.0 4200.0 1950.0 4050.0 DrawSplineSection 1950.0 4050.0 1500.0 3900.0 1350.0 3675.0 DrawSplineSection 1200.0 3450.0 l gs col-1 s gr gr % Open spline gs n 3600.0 3450.0 m 3450.0 3225.0 l 3450.0 3225.0 3300.0 3000.0 2850.0 2850.0 DrawSplineSection 2850.0 2850.0 2400.0 2700.0 1950.0 2850.0 DrawSplineSection 1950.0 2850.0 1500.0 3000.0 1350.0 3225.0 DrawSplineSection 1200.0 3450.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 3600.0 8970.0 m 3450.0 8745.0 l 3450.0 8745.0 3300.0 8520.0 2850.0 8370.0 DrawSplineSection 2850.0 8370.0 2400.0 8220.0 1950.0 8370.0 DrawSplineSection 1950.0 8370.0 1500.0 8520.0 1350.0 8745.0 DrawSplineSection 1200.0 8970.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 3600.0 9030.0 m 3450.0 9255.0 l 3450.0 9255.0 3300.0 9480.0 2850.0 9630.0 DrawSplineSection 2850.0 9630.0 2400.0 9780.0 1950.0 9630.0 DrawSplineSection 1950.0 9630.0 1500.0 9480.0 1350.0 9255.0 DrawSplineSection 1200.0 9030.0 l gs col-1 s gr gr /Times-Roman ff 900.00 scf sf 4725 6210 m gs 1 -1 sc (=) col-1 sh gr $F2psEnd rs %%EndDocument @endspecial 456 609 a FQ(\(ii\))1142 1616 y @beginspecial 0 @llx 0 @lly 194 @urx 77 @ury 1940 @rwi @setspecial %%BeginDocument: figures/mv3.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: mv3.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 16:59:27 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.15 %%Orientation: Portrait %%BoundingBox: 0 0 194 77 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -4.0 109.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.00900 0.00900 sc 30.000 slw % Ellipse n 5025 4125 900 525 0 360 DrawEllipse gs col-1 s gr % Ellipse n 17250 4125 900 525 0 360 DrawEllipse gs col-1 s gr % Polyline % % Begin Imported EPS File: ellips.eps %BeginDocument: ellips.eps % n gs 7800 10800 tr 41.666667 -54.545455 sc 0 -22 tr 0 0 tr sa /showpage {} def % EPS file follows: %!PS-Adobe-2.0 EPSF-2.0 %%Title: ellips.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 13:32:03 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 45 22 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -21.0 83.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc % Open spline gs 30.000 slw n 1800.0 6000.0 m 1807.5 6067.5 l 1807.5 6067.5 1815.0 6135.0 1905.0 6255.0 DrawSplineSection 1905.0 6255.0 1995.0 6375.0 2122.5 6450.0 DrawSplineSection 2122.5 6450.0 2250.0 6525.0 2407.5 6615.0 DrawSplineSection 2407.5 6615.0 2565.0 6705.0 2730.0 6742.5 DrawSplineSection 2730.0 6742.5 2895.0 6780.0 3060.0 6802.5 DrawSplineSection 3060.0 6802.5 3225.0 6825.0 3397.5 6832.5 DrawSplineSection 3397.5 6832.5 3570.0 6840.0 3780.0 6832.5 DrawSplineSection 3780.0 6832.5 3990.0 6825.0 4162.5 6802.5 DrawSplineSection 4162.5 6802.5 4335.0 6780.0 4477.5 6735.0 DrawSplineSection 4477.5 6735.0 4620.0 6690.0 4747.5 6645.0 DrawSplineSection 4747.5 6645.0 4875.0 6600.0 5032.5 6510.0 DrawSplineSection 5032.5 6510.0 5190.0 6420.0 5295.0 6285.0 DrawSplineSection 5295.0 6285.0 5400.0 6150.0 5400.0 6075.0 DrawSplineSection 5400.0 6000.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 1800.0 6000.0 m 1807.5 5932.5 l 1807.5 5932.5 1815.0 5865.0 1905.0 5745.0 DrawSplineSection 1905.0 5745.0 1995.0 5625.0 2122.5 5550.0 DrawSplineSection 2122.5 5550.0 2250.0 5475.0 2407.5 5385.0 DrawSplineSection 2407.5 5385.0 2565.0 5295.0 2730.0 5257.5 DrawSplineSection 2730.0 5257.5 2895.0 5220.0 3060.0 5197.5 DrawSplineSection 3060.0 5197.5 3225.0 5175.0 3397.5 5167.5 DrawSplineSection 3397.5 5167.5 3570.0 5160.0 3780.0 5167.5 DrawSplineSection 3780.0 5167.5 3990.0 5175.0 4162.5 5197.5 DrawSplineSection 4162.5 5197.5 4335.0 5220.0 4477.5 5265.0 DrawSplineSection 4477.5 5265.0 4620.0 5310.0 4747.5 5355.0 DrawSplineSection 4747.5 5355.0 4875.0 5400.0 5032.5 5490.0 DrawSplineSection 5032.5 5490.0 5190.0 5580.0 5295.0 5715.0 DrawSplineSection 5295.0 5715.0 5400.0 5850.0 5400.0 5925.0 DrawSplineSection 5400.0 6000.0 l gs col-1 s gr gr [] 0 sd $F2psEnd rs rs gr % % End Imported PIC File: ellips.eps %EndDocument % % Polyline % % Begin Imported EPS File: ellips.eps %BeginDocument: ellips.eps % n gs 12675 10800 tr 41.666667 -54.545455 sc 0 -22 tr 0 0 tr sa /showpage {} def % EPS file follows: %!PS-Adobe-2.0 EPSF-2.0 %%Title: ellips.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 13:32:03 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 45 22 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -21.0 83.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc % Open spline gs 30.000 slw n 1800.0 6000.0 m 1807.5 6067.5 l 1807.5 6067.5 1815.0 6135.0 1905.0 6255.0 DrawSplineSection 1905.0 6255.0 1995.0 6375.0 2122.5 6450.0 DrawSplineSection 2122.5 6450.0 2250.0 6525.0 2407.5 6615.0 DrawSplineSection 2407.5 6615.0 2565.0 6705.0 2730.0 6742.5 DrawSplineSection 2730.0 6742.5 2895.0 6780.0 3060.0 6802.5 DrawSplineSection 3060.0 6802.5 3225.0 6825.0 3397.5 6832.5 DrawSplineSection 3397.5 6832.5 3570.0 6840.0 3780.0 6832.5 DrawSplineSection 3780.0 6832.5 3990.0 6825.0 4162.5 6802.5 DrawSplineSection 4162.5 6802.5 4335.0 6780.0 4477.5 6735.0 DrawSplineSection 4477.5 6735.0 4620.0 6690.0 4747.5 6645.0 DrawSplineSection 4747.5 6645.0 4875.0 6600.0 5032.5 6510.0 DrawSplineSection 5032.5 6510.0 5190.0 6420.0 5295.0 6285.0 DrawSplineSection 5295.0 6285.0 5400.0 6150.0 5400.0 6075.0 DrawSplineSection 5400.0 6000.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 1800.0 6000.0 m 1807.5 5932.5 l 1807.5 5932.5 1815.0 5865.0 1905.0 5745.0 DrawSplineSection 1905.0 5745.0 1995.0 5625.0 2122.5 5550.0 DrawSplineSection 2122.5 5550.0 2250.0 5475.0 2407.5 5385.0 DrawSplineSection 2407.5 5385.0 2565.0 5295.0 2730.0 5257.5 DrawSplineSection 2730.0 5257.5 2895.0 5220.0 3060.0 5197.5 DrawSplineSection 3060.0 5197.5 3225.0 5175.0 3397.5 5167.5 DrawSplineSection 3397.5 5167.5 3570.0 5160.0 3780.0 5167.5 DrawSplineSection 3780.0 5167.5 3990.0 5175.0 4162.5 5197.5 DrawSplineSection 4162.5 5197.5 4335.0 5220.0 4477.5 5265.0 DrawSplineSection 4477.5 5265.0 4620.0 5310.0 4747.5 5355.0 DrawSplineSection 4747.5 5355.0 4875.0 5400.0 5032.5 5490.0 DrawSplineSection 5032.5 5490.0 5190.0 5580.0 5295.0 5715.0 DrawSplineSection 5295.0 5715.0 5400.0 5850.0 5400.0 5925.0 DrawSplineSection 5400.0 6000.0 l gs col-1 s gr gr [] 0 sd $F2psEnd rs rs gr % % End Imported PIC File: ellips.eps %EndDocument % % Polyline % % Begin Imported EPS File: pants2.eps %BeginDocument: pants2.eps % n gs 525 7125 tr 41.025641 -47.058824 sc 0 -102 tr 0 0 tr sa /showpage {} def % EPS file follows: %!PS-Adobe-2.0 EPSF-2.0 %%Title: pants2.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 14:58:42 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 117 102 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -21.0 112.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc 30.000 slw % Arc gs n 6615.2 8400.5 1200.6 178.6 2.1 arc gs col-1 s gr gr % Open spline gs n 4800.0 1785.0 m 4807.5 2685.0 l 4807.5 2685.0 4815.0 3585.0 3315.0 4800.0 DrawSplineSection 3315.0 4800.0 1815.0 6015.0 1815.0 7200.0 DrawSplineSection 1815.0 8385.0 l gs col-1 s gr gr % Open spline gs n 1800.0 8415.0 m 1807.5 8482.5 l 1807.5 8482.5 1815.0 8550.0 1905.0 8670.0 DrawSplineSection 1905.0 8670.0 1995.0 8790.0 2122.5 8865.0 DrawSplineSection 2122.5 8865.0 2250.0 8940.0 2407.5 9030.0 DrawSplineSection 2407.5 9030.0 2565.0 9120.0 2730.0 9157.5 DrawSplineSection 2730.0 9157.5 2895.0 9195.0 3060.0 9217.5 DrawSplineSection 3060.0 9217.5 3225.0 9240.0 3397.5 9247.5 DrawSplineSection 3397.5 9247.5 3570.0 9255.0 3780.0 9247.5 DrawSplineSection 3780.0 9247.5 3990.0 9240.0 4162.5 9217.5 DrawSplineSection 4162.5 9217.5 4335.0 9195.0 4477.5 9150.0 DrawSplineSection 4477.5 9150.0 4620.0 9105.0 4747.5 9060.0 DrawSplineSection 4747.5 9060.0 4875.0 9015.0 5032.5 8925.0 DrawSplineSection 5032.5 8925.0 5190.0 8835.0 5295.0 8700.0 DrawSplineSection 5295.0 8700.0 5400.0 8565.0 5400.0 8490.0 DrawSplineSection 5400.0 8415.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 1800.0 8385.0 m 1807.5 8317.5 l 1807.5 8317.5 1815.0 8250.0 1905.0 8130.0 DrawSplineSection 1905.0 8130.0 1995.0 8010.0 2122.5 7935.0 DrawSplineSection 2122.5 7935.0 2250.0 7860.0 2407.5 7770.0 DrawSplineSection 2407.5 7770.0 2565.0 7680.0 2730.0 7642.5 DrawSplineSection 2730.0 7642.5 2895.0 7605.0 3060.0 7582.5 DrawSplineSection 3060.0 7582.5 3225.0 7560.0 3397.5 7552.5 DrawSplineSection 3397.5 7552.5 3570.0 7545.0 3780.0 7552.5 DrawSplineSection 3780.0 7552.5 3990.0 7560.0 4162.5 7582.5 DrawSplineSection 4162.5 7582.5 4335.0 7605.0 4477.5 7650.0 DrawSplineSection 4477.5 7650.0 4620.0 7695.0 4747.5 7740.0 DrawSplineSection 4747.5 7740.0 4875.0 7785.0 5032.5 7875.0 DrawSplineSection 5032.5 7875.0 5190.0 7965.0 5295.0 8100.0 DrawSplineSection 5295.0 8100.0 5400.0 8235.0 5400.0 8310.0 DrawSplineSection 5400.0 8385.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 7815.0 8460.0 m 7822.5 8527.5 l 7822.5 8527.5 7830.0 8595.0 7920.0 8715.0 DrawSplineSection 7920.0 8715.0 8010.0 8835.0 8137.5 8910.0 DrawSplineSection 8137.5 8910.0 8265.0 8985.0 8422.5 9075.0 DrawSplineSection 8422.5 9075.0 8580.0 9165.0 8745.0 9202.5 DrawSplineSection 8745.0 9202.5 8910.0 9240.0 9075.0 9262.5 DrawSplineSection 9075.0 9262.5 9240.0 9285.0 9412.5 9292.5 DrawSplineSection 9412.5 9292.5 9585.0 9300.0 9795.0 9292.5 DrawSplineSection 9795.0 9292.5 10005.0 9285.0 10177.5 9262.5 DrawSplineSection 10177.5 9262.5 10350.0 9240.0 10492.5 9195.0 DrawSplineSection 10492.5 9195.0 10635.0 9150.0 10762.5 9105.0 DrawSplineSection 10762.5 9105.0 10890.0 9060.0 11047.5 8970.0 DrawSplineSection 11047.5 8970.0 11205.0 8880.0 11310.0 8745.0 DrawSplineSection 11310.0 8745.0 11415.0 8610.0 11415.0 8535.0 DrawSplineSection 11415.0 8460.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 7800.0 8385.0 m 7807.5 8317.5 l 7807.5 8317.5 7815.0 8250.0 7905.0 8130.0 DrawSplineSection 7905.0 8130.0 7995.0 8010.0 8122.5 7935.0 DrawSplineSection 8122.5 7935.0 8250.0 7860.0 8407.5 7770.0 DrawSplineSection 8407.5 7770.0 8565.0 7680.0 8730.0 7642.5 DrawSplineSection 8730.0 7642.5 8895.0 7605.0 9060.0 7582.5 DrawSplineSection 9060.0 7582.5 9225.0 7560.0 9397.5 7552.5 DrawSplineSection 9397.5 7552.5 9570.0 7545.0 9780.0 7552.5 DrawSplineSection 9780.0 7552.5 9990.0 7560.0 10162.5 7582.5 DrawSplineSection 10162.5 7582.5 10335.0 7605.0 10477.5 7650.0 DrawSplineSection 10477.5 7650.0 10620.0 7695.0 10747.5 7740.0 DrawSplineSection 10747.5 7740.0 10875.0 7785.0 11032.5 7875.0 DrawSplineSection 11032.5 7875.0 11190.0 7965.0 11295.0 8100.0 DrawSplineSection 11295.0 8100.0 11400.0 8235.0 11400.0 8310.0 DrawSplineSection 11400.0 8385.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 8415.0 1785.0 m 8407.5 2685.0 l 8407.5 2685.0 8400.0 3585.0 9900.0 4800.0 DrawSplineSection 9900.0 4800.0 11400.0 6015.0 11400.0 7200.0 DrawSplineSection 11400.0 8385.0 l gs col-1 s gr gr % Open spline gs n 4785.0 1755.0 m 4792.5 1822.5 l 4792.5 1822.5 4800.0 1890.0 4890.0 2010.0 DrawSplineSection 4890.0 2010.0 4980.0 2130.0 5107.5 2205.0 DrawSplineSection 5107.5 2205.0 5235.0 2280.0 5392.5 2370.0 DrawSplineSection 5392.5 2370.0 5550.0 2460.0 5715.0 2497.5 DrawSplineSection 5715.0 2497.5 5880.0 2535.0 6045.0 2557.5 DrawSplineSection 6045.0 2557.5 6210.0 2580.0 6382.5 2587.5 DrawSplineSection 6382.5 2587.5 6555.0 2595.0 6765.0 2587.5 DrawSplineSection 6765.0 2587.5 6975.0 2580.0 7147.5 2557.5 DrawSplineSection 7147.5 2557.5 7320.0 2535.0 7462.5 2490.0 DrawSplineSection 7462.5 2490.0 7605.0 2445.0 7732.5 2400.0 DrawSplineSection 7732.5 2400.0 7860.0 2355.0 8017.5 2265.0 DrawSplineSection 8017.5 2265.0 8175.0 2175.0 8280.0 2040.0 DrawSplineSection 8280.0 2040.0 8385.0 1905.0 8385.0 1830.0 DrawSplineSection 8385.0 1755.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 4830.0 1740.0 m 4837.5 1672.5 l 4837.5 1672.5 4845.0 1605.0 4935.0 1485.0 DrawSplineSection 4935.0 1485.0 5025.0 1365.0 5152.5 1290.0 DrawSplineSection 5152.5 1290.0 5280.0 1215.0 5437.5 1125.0 DrawSplineSection 5437.5 1125.0 5595.0 1035.0 5760.0 997.5 DrawSplineSection 5760.0 997.5 5925.0 960.0 6090.0 937.5 DrawSplineSection 6090.0 937.5 6255.0 915.0 6427.5 907.5 DrawSplineSection 6427.5 907.5 6600.0 900.0 6810.0 907.5 DrawSplineSection 6810.0 907.5 7020.0 915.0 7192.5 937.5 DrawSplineSection 7192.5 937.5 7365.0 960.0 7507.5 1005.0 DrawSplineSection 7507.5 1005.0 7650.0 1050.0 7777.5 1095.0 DrawSplineSection 7777.5 1095.0 7905.0 1140.0 8062.5 1230.0 DrawSplineSection 8062.5 1230.0 8220.0 1320.0 8325.0 1455.0 DrawSplineSection 8325.0 1455.0 8430.0 1590.0 8430.0 1665.0 DrawSplineSection 8430.0 1740.0 l gs col-1 s gr gr [] 0 sd $F2psEnd rs rs gr % % End Imported PIC File: pants2.eps %EndDocument % % Polyline % % Begin Imported EPS File: pants2.eps %BeginDocument: pants2.eps % n gs 17100 7050 tr 41.025641 -47.058824 sc 0 -102 tr 0 0 tr sa /showpage {} def % EPS file follows: %!PS-Adobe-2.0 EPSF-2.0 %%Title: pants2.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 14:58:42 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 117 102 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -21.0 112.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc 30.000 slw % Arc gs n 6615.2 8400.5 1200.6 178.6 2.1 arc gs col-1 s gr gr % Open spline gs n 4800.0 1785.0 m 4807.5 2685.0 l 4807.5 2685.0 4815.0 3585.0 3315.0 4800.0 DrawSplineSection 3315.0 4800.0 1815.0 6015.0 1815.0 7200.0 DrawSplineSection 1815.0 8385.0 l gs col-1 s gr gr % Open spline gs n 1800.0 8415.0 m 1807.5 8482.5 l 1807.5 8482.5 1815.0 8550.0 1905.0 8670.0 DrawSplineSection 1905.0 8670.0 1995.0 8790.0 2122.5 8865.0 DrawSplineSection 2122.5 8865.0 2250.0 8940.0 2407.5 9030.0 DrawSplineSection 2407.5 9030.0 2565.0 9120.0 2730.0 9157.5 DrawSplineSection 2730.0 9157.5 2895.0 9195.0 3060.0 9217.5 DrawSplineSection 3060.0 9217.5 3225.0 9240.0 3397.5 9247.5 DrawSplineSection 3397.5 9247.5 3570.0 9255.0 3780.0 9247.5 DrawSplineSection 3780.0 9247.5 3990.0 9240.0 4162.5 9217.5 DrawSplineSection 4162.5 9217.5 4335.0 9195.0 4477.5 9150.0 DrawSplineSection 4477.5 9150.0 4620.0 9105.0 4747.5 9060.0 DrawSplineSection 4747.5 9060.0 4875.0 9015.0 5032.5 8925.0 DrawSplineSection 5032.5 8925.0 5190.0 8835.0 5295.0 8700.0 DrawSplineSection 5295.0 8700.0 5400.0 8565.0 5400.0 8490.0 DrawSplineSection 5400.0 8415.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 1800.0 8385.0 m 1807.5 8317.5 l 1807.5 8317.5 1815.0 8250.0 1905.0 8130.0 DrawSplineSection 1905.0 8130.0 1995.0 8010.0 2122.5 7935.0 DrawSplineSection 2122.5 7935.0 2250.0 7860.0 2407.5 7770.0 DrawSplineSection 2407.5 7770.0 2565.0 7680.0 2730.0 7642.5 DrawSplineSection 2730.0 7642.5 2895.0 7605.0 3060.0 7582.5 DrawSplineSection 3060.0 7582.5 3225.0 7560.0 3397.5 7552.5 DrawSplineSection 3397.5 7552.5 3570.0 7545.0 3780.0 7552.5 DrawSplineSection 3780.0 7552.5 3990.0 7560.0 4162.5 7582.5 DrawSplineSection 4162.5 7582.5 4335.0 7605.0 4477.5 7650.0 DrawSplineSection 4477.5 7650.0 4620.0 7695.0 4747.5 7740.0 DrawSplineSection 4747.5 7740.0 4875.0 7785.0 5032.5 7875.0 DrawSplineSection 5032.5 7875.0 5190.0 7965.0 5295.0 8100.0 DrawSplineSection 5295.0 8100.0 5400.0 8235.0 5400.0 8310.0 DrawSplineSection 5400.0 8385.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 7815.0 8460.0 m 7822.5 8527.5 l 7822.5 8527.5 7830.0 8595.0 7920.0 8715.0 DrawSplineSection 7920.0 8715.0 8010.0 8835.0 8137.5 8910.0 DrawSplineSection 8137.5 8910.0 8265.0 8985.0 8422.5 9075.0 DrawSplineSection 8422.5 9075.0 8580.0 9165.0 8745.0 9202.5 DrawSplineSection 8745.0 9202.5 8910.0 9240.0 9075.0 9262.5 DrawSplineSection 9075.0 9262.5 9240.0 9285.0 9412.5 9292.5 DrawSplineSection 9412.5 9292.5 9585.0 9300.0 9795.0 9292.5 DrawSplineSection 9795.0 9292.5 10005.0 9285.0 10177.5 9262.5 DrawSplineSection 10177.5 9262.5 10350.0 9240.0 10492.5 9195.0 DrawSplineSection 10492.5 9195.0 10635.0 9150.0 10762.5 9105.0 DrawSplineSection 10762.5 9105.0 10890.0 9060.0 11047.5 8970.0 DrawSplineSection 11047.5 8970.0 11205.0 8880.0 11310.0 8745.0 DrawSplineSection 11310.0 8745.0 11415.0 8610.0 11415.0 8535.0 DrawSplineSection 11415.0 8460.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 7800.0 8385.0 m 7807.5 8317.5 l 7807.5 8317.5 7815.0 8250.0 7905.0 8130.0 DrawSplineSection 7905.0 8130.0 7995.0 8010.0 8122.5 7935.0 DrawSplineSection 8122.5 7935.0 8250.0 7860.0 8407.5 7770.0 DrawSplineSection 8407.5 7770.0 8565.0 7680.0 8730.0 7642.5 DrawSplineSection 8730.0 7642.5 8895.0 7605.0 9060.0 7582.5 DrawSplineSection 9060.0 7582.5 9225.0 7560.0 9397.5 7552.5 DrawSplineSection 9397.5 7552.5 9570.0 7545.0 9780.0 7552.5 DrawSplineSection 9780.0 7552.5 9990.0 7560.0 10162.5 7582.5 DrawSplineSection 10162.5 7582.5 10335.0 7605.0 10477.5 7650.0 DrawSplineSection 10477.5 7650.0 10620.0 7695.0 10747.5 7740.0 DrawSplineSection 10747.5 7740.0 10875.0 7785.0 11032.5 7875.0 DrawSplineSection 11032.5 7875.0 11190.0 7965.0 11295.0 8100.0 DrawSplineSection 11295.0 8100.0 11400.0 8235.0 11400.0 8310.0 DrawSplineSection 11400.0 8385.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 8415.0 1785.0 m 8407.5 2685.0 l 8407.5 2685.0 8400.0 3585.0 9900.0 4800.0 DrawSplineSection 9900.0 4800.0 11400.0 6015.0 11400.0 7200.0 DrawSplineSection 11400.0 8385.0 l gs col-1 s gr gr % Open spline gs n 4785.0 1755.0 m 4792.5 1822.5 l 4792.5 1822.5 4800.0 1890.0 4890.0 2010.0 DrawSplineSection 4890.0 2010.0 4980.0 2130.0 5107.5 2205.0 DrawSplineSection 5107.5 2205.0 5235.0 2280.0 5392.5 2370.0 DrawSplineSection 5392.5 2370.0 5550.0 2460.0 5715.0 2497.5 DrawSplineSection 5715.0 2497.5 5880.0 2535.0 6045.0 2557.5 DrawSplineSection 6045.0 2557.5 6210.0 2580.0 6382.5 2587.5 DrawSplineSection 6382.5 2587.5 6555.0 2595.0 6765.0 2587.5 DrawSplineSection 6765.0 2587.5 6975.0 2580.0 7147.5 2557.5 DrawSplineSection 7147.5 2557.5 7320.0 2535.0 7462.5 2490.0 DrawSplineSection 7462.5 2490.0 7605.0 2445.0 7732.5 2400.0 DrawSplineSection 7732.5 2400.0 7860.0 2355.0 8017.5 2265.0 DrawSplineSection 8017.5 2265.0 8175.0 2175.0 8280.0 2040.0 DrawSplineSection 8280.0 2040.0 8385.0 1905.0 8385.0 1830.0 DrawSplineSection 8385.0 1755.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 4830.0 1740.0 m 4837.5 1672.5 l 4837.5 1672.5 4845.0 1605.0 4935.0 1485.0 DrawSplineSection 4935.0 1485.0 5025.0 1365.0 5152.5 1290.0 DrawSplineSection 5152.5 1290.0 5280.0 1215.0 5437.5 1125.0 DrawSplineSection 5437.5 1125.0 5595.0 1035.0 5760.0 997.5 DrawSplineSection 5760.0 997.5 5925.0 960.0 6090.0 937.5 DrawSplineSection 6090.0 937.5 6255.0 915.0 6427.5 907.5 DrawSplineSection 6427.5 907.5 6600.0 900.0 6810.0 907.5 DrawSplineSection 6810.0 907.5 7020.0 915.0 7192.5 937.5 DrawSplineSection 7192.5 937.5 7365.0 960.0 7507.5 1005.0 DrawSplineSection 7507.5 1005.0 7650.0 1050.0 7777.5 1095.0 DrawSplineSection 7777.5 1095.0 7905.0 1140.0 8062.5 1230.0 DrawSplineSection 8062.5 1230.0 8220.0 1320.0 8325.0 1455.0 DrawSplineSection 8325.0 1455.0 8430.0 1590.0 8430.0 1665.0 DrawSplineSection 8430.0 1740.0 l gs col-1 s gr gr [] 0 sd $F2psEnd rs rs gr % % End Imported PIC File: pants2.eps %EndDocument % % Open spline gs n 4125.0 4200.0 m 4125.0 4612.5 l 4125.0 4612.5 4125.0 5025.0 3075.0 5850.0 DrawSplineSection 3075.0 5850.0 2025.0 6675.0 2010.0 7237.5 DrawSplineSection 1995.0 7800.0 l gs col-1 s gr gr % Open spline gs n 3750.0 7725.0 m 3750.0 7312.5 l 3750.0 7312.5 3750.0 6900.0 4200.0 6675.0 DrawSplineSection 4200.0 6675.0 4650.0 6450.0 5475.0 6487.5 DrawSplineSection 5475.0 6487.5 6300.0 6525.0 6862.5 7875.0 DrawSplineSection 6862.5 7875.0 7425.0 9225.0 7612.5 9975.0 DrawSplineSection 7612.5 9975.0 7800.0 10725.0 7800.0 11062.5 DrawSplineSection 7800.0 11400.0 l gs col-1 s gr gr % Open spline gs n 5925.0 4125.0 m 5925.0 4575.0 l 5925.0 4575.0 5925.0 5025.0 6787.5 5437.5 DrawSplineSection 6787.5 5437.5 7650.0 5850.0 8287.5 7087.5 DrawSplineSection 8287.5 7087.5 8925.0 8325.0 9262.5 9487.5 DrawSplineSection 9262.5 9487.5 9600.0 10650.0 9600.0 11062.5 DrawSplineSection 9600.0 11475.0 l gs col-1 s gr gr % Open spline gs n 16350.0 4125.0 m 16350.0 4575.0 l 16350.0 4575.0 16350.0 5025.0 15487.5 5437.5 DrawSplineSection 15487.5 5437.5 14625.0 5850.0 13987.5 7087.5 DrawSplineSection 13987.5 7087.5 13350.0 8325.0 13012.5 9487.5 DrawSplineSection 13012.5 9487.5 12675.0 10650.0 12675.0 11062.5 DrawSplineSection 12675.0 11475.0 l gs col-1 s gr gr % Open spline gs n 18600.0 7725.0 m 18600.0 7312.5 l 18600.0 7312.5 18600.0 6900.0 18112.5 6675.0 DrawSplineSection 18112.5 6675.0 17625.0 6450.0 16800.0 6487.5 DrawSplineSection 16800.0 6487.5 15975.0 6525.0 15412.5 7875.0 DrawSplineSection 15412.5 7875.0 14850.0 9225.0 14662.5 9975.0 DrawSplineSection 14662.5 9975.0 14475.0 10725.0 14475.0 11062.5 DrawSplineSection 14475.0 11400.0 l gs col-1 s gr gr % Open spline gs n 18150.0 4200.0 m 18150.0 4612.5 l 18150.0 4612.5 18150.0 5025.0 19237.5 5812.5 DrawSplineSection 19237.5 5812.5 20325.0 6600.0 20325.0 7125.0 DrawSplineSection 20325.0 7650.0 l gs col-1 s gr gr /Times-Roman ff 1050.00 scf sf 11175 8250 m gs 1 -1 sc (=) col-1 sh gr $F2psEnd rs %%EndDocument @endspecial 456 1296 a(\(iii\))904 2341 y @beginspecial 0 @llx 0 @lly 251 @urx 75 @ury 2510 @rwi @setspecial %%BeginDocument: figures/mv4.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: mv4.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Mon Apr 14 20:19:09 1997 %%For: bakalov@schauder (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 251 75 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -14.0 124.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc 30.000 slw % Ellipse n 7725 7200 600 1125 0 360 DrawEllipse gs col-1 s gr % Ellipse n 19800 7200 600 1125 0 360 DrawEllipse gs col-1 s gr 15.000 slw % Ellipse n 19800 7200 1500 2025 0 360 DrawEllipse gs col-1 s gr 30.000 slw % Ellipse n 13800 7200 600 900 0 360 DrawEllipse gs col-1 s gr % Ellipse n 1800 7200 600 900 0 360 DrawEllipse gs col-1 s gr % Polyline % % Begin Imported EPS File: ellips.eps %BeginDocument: ellips.eps % n gs 8325 6600 tr 40.000000 -61.363636 sc 0 -22 tr 0 0 tr sa /showpage {} def % EPS file follows: %!PS-Adobe-2.0 EPSF-2.0 %%Title: ellips.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Sun Mar 30 13:32:03 1997 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 45 22 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -21.0 83.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc % Open spline gs 30.000 slw n 1800.0 6000.0 m 1807.5 6067.5 l 1807.5 6067.5 1815.0 6135.0 1905.0 6255.0 DrawSplineSection 1905.0 6255.0 1995.0 6375.0 2122.5 6450.0 DrawSplineSection 2122.5 6450.0 2250.0 6525.0 2407.5 6615.0 DrawSplineSection 2407.5 6615.0 2565.0 6705.0 2730.0 6742.5 DrawSplineSection 2730.0 6742.5 2895.0 6780.0 3060.0 6802.5 DrawSplineSection 3060.0 6802.5 3225.0 6825.0 3397.5 6832.5 DrawSplineSection 3397.5 6832.5 3570.0 6840.0 3780.0 6832.5 DrawSplineSection 3780.0 6832.5 3990.0 6825.0 4162.5 6802.5 DrawSplineSection 4162.5 6802.5 4335.0 6780.0 4477.5 6735.0 DrawSplineSection 4477.5 6735.0 4620.0 6690.0 4747.5 6645.0 DrawSplineSection 4747.5 6645.0 4875.0 6600.0 5032.5 6510.0 DrawSplineSection 5032.5 6510.0 5190.0 6420.0 5295.0 6285.0 DrawSplineSection 5295.0 6285.0 5400.0 6150.0 5400.0 6075.0 DrawSplineSection 5400.0 6000.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 1800.0 6000.0 m 1807.5 5932.5 l 1807.5 5932.5 1815.0 5865.0 1905.0 5745.0 DrawSplineSection 1905.0 5745.0 1995.0 5625.0 2122.5 5550.0 DrawSplineSection 2122.5 5550.0 2250.0 5475.0 2407.5 5385.0 DrawSplineSection 2407.5 5385.0 2565.0 5295.0 2730.0 5257.5 DrawSplineSection 2730.0 5257.5 2895.0 5220.0 3060.0 5197.5 DrawSplineSection 3060.0 5197.5 3225.0 5175.0 3397.5 5167.5 DrawSplineSection 3397.5 5167.5 3570.0 5160.0 3780.0 5167.5 DrawSplineSection 3780.0 5167.5 3990.0 5175.0 4162.5 5197.5 DrawSplineSection 4162.5 5197.5 4335.0 5220.0 4477.5 5265.0 DrawSplineSection 4477.5 5265.0 4620.0 5310.0 4747.5 5355.0 DrawSplineSection 4747.5 5355.0 4875.0 5400.0 5032.5 5490.0 DrawSplineSection 5032.5 5490.0 5190.0 5580.0 5295.0 5715.0 DrawSplineSection 5295.0 5715.0 5400.0 5850.0 5400.0 5925.0 DrawSplineSection 5400.0 6000.0 l gs col-1 s gr gr [] 0 sd $F2psEnd rs rs gr % % End Imported PIC File: ellips.eps %EndDocument % % Open spline gs n 1800.0 6300.0 m 3300.0 6300.0 l 3300.0 6300.0 4800.0 6300.0 6000.0 5100.0 DrawSplineSection 6000.0 5100.0 7200.0 3900.0 8400.0 4350.0 DrawSplineSection 8400.0 4350.0 9600.0 4800.0 9900.0 6000.0 DrawSplineSection 9900.0 6000.0 10200.0 7200.0 9900.0 8400.0 DrawSplineSection 9900.0 8400.0 9600.0 9600.0 8400.0 10050.0 DrawSplineSection 8400.0 10050.0 7200.0 10500.0 6000.0 9300.0 DrawSplineSection 6000.0 9300.0 4800.0 8100.0 3300.0 8100.0 DrawSplineSection 1800.0 8100.0 l gs col-1 s gr gr % Open spline gs n 13800.0 6300.0 m 15300.0 6300.0 l 15300.0 6300.0 16800.0 6300.0 18000.0 5100.0 DrawSplineSection 18000.0 5100.0 19200.0 3900.0 20400.0 4350.0 DrawSplineSection 20400.0 4350.0 21600.0 4800.0 21900.0 6000.0 DrawSplineSection 21900.0 6000.0 22200.0 7200.0 21900.0 8400.0 DrawSplineSection 21900.0 8400.0 21600.0 9600.0 20400.0 10050.0 DrawSplineSection 20400.0 10050.0 19200.0 10500.0 18000.0 9300.0 DrawSplineSection 18000.0 9300.0 16800.0 8100.0 15300.0 8100.0 DrawSplineSection 13800.0 8100.0 l gs col-1 s gr gr /Times-Roman ff 1050.00 scf sf 11250 7425 m gs 1 -1 sc (=) col-1 sh gr $F2psEnd rs %%EndDocument @endspecial 456 2028 a(\(iv)q(\))605 2467 y(It)25 b(is)f(easy)f(to)h (c)n(hec)n(k)f(that)i FJ(\034)34 b FQ(giv)n(es)23 b(the)h(same)g (result)g(on)g(b)r(oth)g(sides)g(of)g(\(i{iv\),)h(therefore)456 2567 y(it)i(is)g(w)n(ell)g(de\014ned)g(on)g(an)n(y)f(2-manifold)g FJ(M)9 b FQ(.)36 b(F)-7 b(or)27 b(example,)g(b)r(oth)g(sides)g(of)g (\(iv\))g(corresp)r(ond)456 2666 y(to)g(the)h(v)n(ector)949 2604 y Fy(P)1037 2691 y FI(i)1078 2666 y FJ(v)1118 2678 y FI(i)1146 2666 y FJ(v)1189 2636 y FI(i)1240 2666 y FL(2)c FJ(A)j FQ(where)g FL(f)p FJ(v)1730 2678 y FI(i)1758 2666 y FL(g)g FQ(and)g FL(f)p FJ(v)2073 2636 y FI(i)2101 2666 y FL(g)g FQ(are)f(dual)i(bases)f(in)g FJ(A)h FQ(with)g(resp)r(ect) g(to)456 2766 y(the)g(bilinear)f(form)g(tr\()p FJ(ab)p FQ(\).)605 2866 y(This)h(completes)f(the)h(pro)r(of)f(of)g(the)h (theorem.)p 3384 2866 4 57 v 3388 2813 50 4 v 3388 2866 V 3437 2866 4 57 v 605 3030 a FP(Remark)k FQ(4.3.4)p FP(.)39 b FQ(Note)25 b(that)g(ev)n(ery)e(F)-7 b(rob)r(enius)24 b(algebra)f(is)h(also)g(a)g(coalgebra:)33 b(one)24 b(can)456 3130 y(de\014ne)35 b(com)n(ultiplication)g(\001)9 b(:)30 b FJ(A)36 b FL(!)g FJ(A)24 b FL(\012)f FJ(A)35 b FQ(as)g(the)g(adjoin)n (t)g(of)g(the)h(m)n(ultiplication)f(with)456 3229 y(resp)r(ect)25 b(to)h(the)h(bilinear)e(form)h(tr\()p FJ(ab)p FQ(\).)36 b(Ho)n(w)n(ev)n(er,)25 b(the)h(relation)f(b)r(et)n(w)n(een)h(com)n (ultiplication)456 3329 y(and)19 b(m)n(ultiplication)h(in)g(a)f(F)-7 b(rob)r(enius)19 b(algebra)f(is)h(di\013eren)n(t)h(than)g(in)f(a)h (Hopf)g(algebra:)31 b(instead)456 3429 y(of)c(\001\()p FJ(ab)p FQ(\))c(=)g(\001\()p FJ(a)p FQ(\)\001\()p FJ(b)p FQ(\),)29 b(one)e(has)1300 3574 y(\001\()p FJ(ab)p FQ(\))d(=)e(\()p FJ(a)d FL(\012)f FQ(1\)\001\()p FJ(b)p FQ(\))23 b(=)g(\(1)18 b FL(\012)g FJ(b)p FQ(\)\001\()p FJ(a)p FQ(\))p FJ(:)605 3734 y FP(Example)31 b FQ(4.3.5)p FP(.)40 b FQ(Let)g FJ(X)46 b FQ(b)r(e)40 b(a)g(\014nite)g(set,)j FJ(A)h FQ(=)f FL(F)8 b FQ(\()p FJ(X)f FQ(\))40 b(the)g(algebra)e(of)i FJ(k)s FQ(-v)-5 b(alued)456 3834 y(functions)32 b(on)f FJ(X)38 b FQ(\(with)32 b(resp)r(ect)g(to)f(m)n(ultiplication\),)j(and)d (tr)9 b(:)29 b FJ(A)h FL(!)g FJ(k)35 b FQ(giv)n(en)c(b)n(y)g(tr\()p FJ(f)9 b FQ(\))30 b(=)456 3871 y Fy(P)543 3958 y FI(x)p FE(2)p FI(X)703 3934 y FJ(f)9 b FQ(\()p FJ(x)p FQ(\).)41 b(This)28 b(ob)n(viously)g(is)g(a)g(F)-7 b(rob)r(enius)29 b(algebra.)39 b(Moreo)n(v)n(er,)26 b(one)i(easily)g(sees)g(that)456 4033 y(in)39 b(this)h(case)f(the)g(com)n(ultiplication)g(is)h(giv)n(en) e(b)n(y)i(\001\()p FJ(\016)2293 4045 y FI(x)2335 4033 y FQ(\))j(=)f FJ(\016)2554 4045 y FI(x)2622 4033 y FL(\012)26 b FJ(\016)2750 4045 y FI(x)2831 4033 y FQ(\(where)40 b FJ(\016)3153 4045 y FI(x)3234 4033 y FQ(is)f(the)456 4133 y(delta)31 b(function)h(at)f FJ(x)p FQ(:)45 b FJ(\016)1253 4145 y FI(x)1295 4133 y FQ(\()p FJ(y)s FQ(\))30 b(=)f FJ(\016)1564 4145 y FI(x)p FM(=)p FI(y)1692 4133 y FQ(\),)k(and)e(for)g (a)g(connected)g(surface)g(with)h FJ(n)f FQ(b)r(oundary)456 4233 y(comp)r(onen)n(ts,)c(indep)r(enden)n(t)h(of)g(gen)n(us,)f(one)g (has)1284 4390 y FJ(\034)9 b FQ(\(\006\))24 b(=)f(\001)1634 4355 y FI(n)p FE(\000)p FM(1)1764 4390 y FQ(\(1\))g(=)1992 4311 y Fy(X)1981 4489 y FI(x)p FE(2)p FI(X)2136 4390 y FJ(\016)2173 4402 y FI(x)2233 4390 y FL(\012)18 b(\001)c(\001)g(\001) k(\012)g FJ(\016)2551 4402 y FI(x)2593 4390 y FJ(:)1400 4668 y FK(4.4.)47 b(3D)31 b(TQFT)i(from)e(MTC)605 4817 y FQ(In)d(this)g(section)f(w)n(e)g(will)h(sho)n(w)e(that)i(ev)n(ery)e (mo)r(dular)h(tensor)g(category)e(giv)n(es)i(rise)f(to)i(a)456 4917 y(3D)k(TQFT,)g(whic)n(h)g(generalizes)f(the)h(in)n(v)-5 b(arian)n(t)31 b(of)i(3-manifolds)e(without)i(b)r(oundary)e(con-)456 5016 y(structed)e(in)h(Section)g(4.1.)42 b(These)30 b(ideas)f(w)n(ere)g (\014rst)g(suggested)g(b)n(y)g(Witten)i([)p FK(W2)p FQ(])f(\(for)f(the) 456 5116 y(mo)r(dular)j(category)g(arising)g(from)h(represen)n(tations) e(of)j FJ(U)2347 5128 y FI(q)2383 5116 y FQ(\()p FA(sl)2475 5128 y FM(2)2513 5116 y FQ(\))f(at)h(ro)r(ots)e(of)h(unit)n(y\).)55 b(Our)456 5216 y(exp)r(osition)27 b(is)g(based)g(on)h(the)g (construction)e(in)i([)p FK(T)q FQ(],)f(with)i(some)e(mo)r (di\014cations.)p eop %%Page: 82 12 82 85 bop 456 226 a FM(82)404 b(4.)29 b(3-DIMENSIONAL)g(TOPOLOGICAL)h (QUANTUM)f(FIELD)g(THEOR)-5 b(Y)605 425 y FQ(Before)32 b(giving)g(the)i(precise)e(de\014nitions,)j(let)e(us)g(note)g(that)g(w) n(e)g(could)g(ha)n(v)n(e)e(replaced)456 525 y(in)26 b(the)g (de\014nition)g(of)g(a)f(TQFT)h(top)r(ological)e(manifolds)i(b)n(y)-7 b(,)26 b(sa)n(y)-7 b(,)25 b(smo)r(oth)h(manifolds,)g(or)f(b)n(y)456 624 y(manifolds)f(with)i(some)f(additional)f(structure.)36 b(The)25 b(only)f(things)i(w)n(e)e(need)h(are)g(the)g(notions)456 724 y(of)k(b)r(oundary)-7 b(,)30 b(orien)n(tation)e(rev)n(ersing,)g (gluing,)h(and)h(disjoin)n(t)f(unions.)43 b(One)29 b(can)g(formalize) 456 824 y(the)39 b(requiremen)n(ts,)j(but)e(it)g(is)f(hardly)g (necessary)-7 b(.)70 b(Note)40 b(that)g(in)f(dimensions)h(2)f(and)g(3) 456 923 y(smo)r(oth)28 b(and)h(top)r(ological)e(theories)h(are)g(equiv) -5 b(alen)n(t:)40 b(ev)n(ery)27 b(top)r(ological)h(manifold)h(can)f(b)r (e)456 1023 y(endo)n(w)n(ed)h(with)j(a)e(smo)r(oth)h(structure,)g(and)f (an)n(y)g(t)n(w)n(o)g(smo)r(oth)h(structures)f(are)g(equiv)-5 b(alen)n(t.)456 1123 y(Therefore,)30 b(in)h(this)g(section)g(w)n(e)f (will)h(not)g(distinguish)g(b)r(et)n(w)n(een)g(smo)r(oth)f(and)h(top)r (ological)456 1222 y(structures.)605 1322 y(In)23 b(this)f(section,)h (w)n(e)f(will)h(construct)f(an)g(\\extended")f(TQFT)h(in)h(the)g(sense) f(that)g(w)n(e)g(will)456 1421 y(consider)k(manifolds)i(with)g(some)f (additional)g(structure.)36 b(Let)28 b FL(C)k FQ(b)r(e)c(an)f(ab)r (elian)h(category)-7 b(.)605 1563 y FP(Definition)32 b FQ(4.4.1)p FP(.)40 b FQ(\(i\))d(A)g FL(C)5 b FO(-marke)l(d)38 b(surfac)l(e)43 b FQ(is)36 b(an)g(orien)n(ted)g(compact)g(surface)f (\006)456 1663 y(with)g(a)g(\014nite)h(n)n(um)n(b)r(er)e(of)h(p)r(oin)n (ts)g FJ(p)1659 1675 y FM(1)1696 1663 y FJ(;)14 b(:)g(:)g(:)g(;)g(p) 1923 1675 y FI(m)2021 1663 y FQ(on)35 b(it,)i(and)e(the)g(follo)n(wing) f(data)h(attac)n(hed)456 1763 y(to)d(ev)n(ery)g(p)r(oin)n(t)h FJ(p)1051 1775 y FI(i)1078 1763 y FQ(:)48 b(a)32 b(non-zero)f(tangen)n (t)h(v)n(ector)g FJ(v)2167 1775 y FI(i)2195 1763 y FQ(,)i(an)f(ob)5 b(ject)32 b FJ(W)2707 1775 y FI(i)2767 1763 y FL(2)g FQ(Ob)13 b FL(C)38 b FQ(and)33 b(a)f(sign)456 1862 y FJ(")495 1874 y FI(i)545 1862 y FQ(=)23 b FL(\006)p FQ(.)605 1962 y(W)-7 b(e)28 b(de\014ne)f(a)g(c)n(hange)f(of)i(orien)n(tation)e (of)h(a)g FL(C)5 b FQ(-mark)n(ed)25 b(surface)i(\006)g(to)g(b)r(e)h (the)g(surface)p 3384 1895 60 4 v 26 w(\006)456 2062 y(with)g(the)g(same)f(data)g(as)g(\006)g(but)i(with)f FJ(")1755 2074 y FI(i)1782 2062 y FJ(;)14 b(v)1859 2074 y FI(i)1915 2062 y FQ(replaced)26 b(b)n(y)i FL(\000)p FJ(")2462 2074 y FI(i)2488 2062 y FJ(;)14 b FL(\000)p FJ(v)2630 2074 y FI(i)2658 2062 y FQ(.)605 2161 y(\(ii\))24 b(A)f FL(C)5 b FO(-marke)l(d)25 b(3-manifold)33 b FQ(is)23 b(a)f(pair)g(\()p FJ(M)t(;)14 b(T)e FQ(\),)24 b(where)e FJ(M)31 b FQ(is)23 b(an)f(orien)n(ted)g(3-manifold)456 2261 y(with)31 b(a)f(b)r(oundary)g(and)h FJ(T)41 b FQ(is)31 b(a)f(partially)g FL(C)5 b FQ(-colored)29 b(ribb)r(on)h(tangle)g(in)h FJ(M)40 b FQ(suc)n(h)30 b(that)h(the)456 2360 y(only)j(uncolored)h (comp)r(onen)n(ts)f(are)h(ann)n(uli,)h(and)g(the)f(colored)f(comp)r (onen)n(ts)h(ma)n(y)f(end)i(on)456 2464 y(the)27 b(b)r(oundary)g(of)g FJ(M)9 b FQ(.)36 b(Orien)n(tation)26 b(rev)n(ersal)f(is)i(de\014ned)h (b)n(y)p 2449 2392 247 4 v 27 w(\()p FJ(M)t(;)14 b(T)e FQ(\))22 b(=)h(\()p 2838 2397 90 4 v FJ(M)9 b(;)p 2965 2397 61 4 v 14 w(T)i FQ(\),)27 b(where,)g(as)456 2566 y(usual,)p 695 2499 90 4 v 26 w FJ(M)34 b FQ(is)26 b FJ(M)35 b FQ(with)27 b(rev)n(ersed)d(orien)n(tation,)h(and)p 2122 2499 61 4 v 26 w FJ(T)37 b FQ(is)26 b FJ(T)37 b FQ(with)27 b(rev)n(ersed)d(directions)i(of)g(all)456 2666 y(strands.)605 2808 y(F)-7 b(or)28 b(a)f FL(C)5 b FQ(-mark)n(ed)27 b(3-manifold)g FJ(M)37 b FQ(w)n(e)28 b(will)g(denote)h(b)n(y)f FJ(@)5 b(M)36 b FQ(its)29 b(top)r(ological)d (b)r(oundary)456 2907 y(pro)n(vided)e(with)h(the)g(follo)n(wing)f (structure)h(of)g(a)f FL(C)5 b FQ(-mark)n(ed)23 b(surface)h(\(see)h (Figure)f(4.5)g(b)r(elo)n(w\):)605 3007 y(|)k(the)g(p)r(oin)n(ts)f FJ(p)1150 3019 y FI(i)1205 3007 y FQ(are)g(the)h(ends)f(of)h(the)g (ribb)r(on)f(tangle)h FJ(T)12 b FQ(,)605 3107 y(|)28 b FJ(W)794 3119 y FI(i)849 3107 y FQ(is)g(the)g(color)e(of)i(the)g (corresp)r(onding)d(strand)i(of)h FJ(T)12 b FQ(,)605 3206 y(|)34 b(the)g(sign)f FJ(")1087 3218 y FI(i)1148 3206 y FQ(is)h(+)f(if)h(the)g(tangle)f(go)r(es)g(out)n(w)n(ard)f(and)i FJ(")2547 3218 y FI(i)2607 3206 y FQ(=)f FL(\000)g FQ(if)h(the)g (tangle)f(go)r(es)456 3306 y(in)n(w)n(ard,)605 3405 y(|)h(the)h(tangen) n(t)f(v)n(ector)f FJ(v)1477 3417 y FI(i)1539 3405 y FQ(at)h(the)g(p)r (oin)n(t)h FJ(p)2062 3417 y FI(i)2123 3405 y FQ(is)g(determined)f(\(up) h(to)f(a)g(p)r(ositiv)n(e)f(real)456 3505 y(factor\))39 b(b)n(y)h(the)g(condition)g(that)g(it)h(is)f(tangen)n(t)f(to)h(the)h (base)e(of)h FJ(T)12 b FQ(,)43 b(and)c(the)i(direction)456 3605 y(is)c(c)n(hosen)f(so)h(that)g(the)h(rep)r(er)e(\()p FJ(n)1584 3617 y FI(i)1612 3605 y FJ(;)14 b(v)1689 3617 y FI(i)1717 3605 y FQ(\))38 b(has)e(p)r(ositiv)n(e)h(orien)n(tation)f (\(with)i(resp)r(ect)f(ot)g(the)456 3704 y(orien)n(tation)25 b(in)i FJ(@)5 b(M)k FQ(\),)27 b(where)f FJ(n)1483 3716 y FI(i)1537 3704 y FQ(is)h(the)g(unit)h(normal)d(v)n(ector)h(to)g(the)i (ribb)r(on)e(\(on)h(the)g(\\face)456 3804 y(side"\).)1408 4730 y @beginspecial 0 @llx 0 @lly 130 @urx 93 @ury 1300 @rwi @setspecial %%BeginDocument: figures/dmmarked.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: dmmarked.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Wed Apr 2 14:16:14 1997 %%For: bakalov@schauder (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 130 93 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /MyAppDict 100 dict dup begin def /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -9.0 109.0 translate 1 -1 scale .9 .9 scale % to make patterns same scale as in xfig % This junk string is used by the show operators /PATsstr 1 string def /PATawidthshow { % cx cy cchar rx ry string % Loop over each character in the string { % cx cy cchar rx ry char % Show the character dup % cx cy cchar rx ry char char PATsstr dup 0 4 -1 roll put % cx cy cchar rx ry char (char) false charpath % cx cy cchar rx ry char /clip load PATdraw % Move past the character (charpath modified the % current point) currentpoint % cx cy cchar rx ry char x y newpath moveto % cx cy cchar rx ry char % Reposition by cx,cy if the character in the string is cchar 3 index eq { % cx cy cchar rx ry 4 index 4 index rmoveto } if % Reposition all characters by rx ry 2 copy rmoveto % cx cy cchar rx ry } forall pop pop pop pop pop % - currentpoint newpath moveto } bind def /PATcg { 7 dict dup begin /lw currentlinewidth def /lc currentlinecap def /lj currentlinejoin def /ml currentmiterlimit def /ds [ currentdash ] def /cc [ currentrgbcolor ] def /cm matrix currentmatrix def end } bind def % PATdraw - calculates the boundaries of the object and % fills it with the current pattern /PATdraw { % proc save exch PATpcalc % proc nw nh px py 5 -1 roll exec % nw nh px py newpath PATfill % - restore } bind def % PATfill - performs the tiling for the shape /PATfill { % nw nh px py PATfill - PATDict /CurrentPattern get dup begin setfont % Set the coordinate system to Pattern Space PatternGState PATsg % Set the color for uncolored pattezns PaintType 2 eq { PATDict /PColor get PATsc } if % Create the string for showing 3 index string % nw nh px py str % Loop for each of the pattern sources 0 1 Multi 1 sub { % nw nh px py str source % Move to the starting location 3 index 3 index % nw nh px py str source px py moveto % nw nh px py str source % For multiple sources, set the appropriate color Multi 1 ne { dup PC exch get PATsc } if % Set the appropriate string for the source 0 1 7 index 1 sub { 2 index exch 2 index put } for pop % Loop over the number of vertical cells 3 index % nw nh px py str nh { % nw nh px py str currentpoint % nw nh px py str cx cy 2 index show % nw nh px py str cx cy YStep add moveto % nw nh px py str } repeat % nw nh px py str } for 5 { pop } repeat end } bind def % PATkshow - kshow with the current pattezn /PATkshow { % proc string exch bind % string proc 1 index 0 get % string proc char % Loop over all but the last character in the string 0 1 4 index length 2 sub { % string proc char idx % Find the n+1th character in the string 3 index exch 1 add get % string proe char char+1 exch 2 copy % strinq proc char+1 char char+1 char % Now show the nth character PATsstr dup 0 4 -1 roll put % string proc chr+1 chr chr+1 (chr) false charpath % string proc char+1 char char+1 /clip load PATdraw % Move past the character (charpath modified the current point) currentpoint newpath moveto % Execute the user proc (should consume char and char+1) mark 3 1 roll % string proc char+1 mark char char+1 4 index exec % string proc char+1 mark... cleartomark % string proc char+1 } for % Now display the last character PATsstr dup 0 4 -1 roll put % string proc (char+1) false charpath % string proc /clip load PATdraw neewath pop pop % - } bind def % PATmp - the makepattern equivalent /PATmp { % patdict patmtx PATmp patinstance exch dup length 7 add % We will add 6 new entries plus 1 FID dict copy % Create a new dictionary begin % Matrix to install when painting the pattern TilingType PATtcalc /PatternGState PATcg def PatternGState /cm 3 -1 roll put % Check for multi pattern sources (Level 1 fast color patterns) currentdict /Multi known not { /Multi 1 def } if % Font dictionary definitions /FontType 3 def % Create a dummy encoding vector /Encoding 256 array def 3 string 0 1 255 { Encoding exch dup 3 index cvs cvn put } for pop /FontMatrix matrix def /FontBBox BBox def /BuildChar { mark 3 1 roll % mark dict char exch begin Multi 1 ne {PaintData exch get}{pop} ifelse % mark [paintdata] PaintType 2 eq Multi 1 ne or { XStep 0 FontBBox aload pop setcachedevice } { XStep 0 setcharwidth } ifelse currentdict % mark [paintdata] dict /PaintProc load % mark [paintdata] dict paintproc end gsave false PATredef exec true PATredef grestore cleartomark % - } bind def currentdict end % newdict /foo exch % /foo newlict definefont % newfont } bind def % PATpcalc - calculates the starting point and width/height % of the tile fill for the shape /PATpcalc { % - PATpcalc nw nh px py PATDict /CurrentPattern get begin gsave % Set up the coordinate system to Pattern Space % and lock down pattern PatternGState /cm get setmatrix BBox aload pop pop pop translate % Determine the bounding box of the shape pathbbox % llx lly urx ury grestore % Determine (nw, nh) the # of cells to paint width and height PatHeight div ceiling % llx lly urx qh 4 1 roll % qh llx lly urx PatWidth div ceiling % qh llx lly qw 4 1 roll % qw qh llx lly PatHeight div floor % qw qh llx ph 4 1 roll % ph qw qh llx PatWidth div floor % ph qw qh pw 4 1 roll % pw ph qw qh 2 index sub cvi abs % pw ph qs qh-ph exch 3 index sub cvi abs exch % pw ph nw=qw-pw nh=qh-ph % Determine the starting point of the pattern fill %(px, py) 4 2 roll % nw nh pw ph PatHeight mul % nw nh pw py exch % nw nh py pw PatWidth mul exch % nw nh px py end } bind def % Save the original routines so that we can use them later on /oldfill /fill load def /oldeofill /eofill load def /oldstroke /stroke load def /oldshow /show load def /oldashow /ashow load def /oldwidthshow /widthshow load def /oldawidthshow /awidthshow load def /oldkshow /kshow load def % These defs are necessary so that subsequent procs don't bind in % the originals /fill { oldfill } bind def /eofill { oldeofill } bind def /stroke { oldstroke } bind def /show { oldshow } bind def /ashow { oldashow } bind def /widthshow { oldwidthshow } bind def /awidthshow { oldawidthshow } bind def /kshow { oldkshow } bind def /PATredef { MyAppDict begin { /fill { /clip load PATdraw newpath } bind def /eofill { /eoclip load PATdraw newpath } bind def /stroke { PATstroke } bind def /show { 0 0 null 0 0 6 -1 roll PATawidthshow } bind def /ashow { 0 0 null 6 3 roll PATawidthshow } bind def /widthshow { 0 0 3 -1 roll PATawidthshow } bind def /awidthshow { PATawidthshow } bind def /kshow { PATkshow } bind def } { /fill { oldfill } bind def /eofill { oldeofill } bind def /stroke { oldstroke } bind def /show { oldshow } bind def /ashow { oldashow } bind def /widthshow { oldwidthshow } bind def /awidthshow { oldawidthshow } bind def /kshow { oldkshow } bind def } ifelse end } bind def false PATredef % Conditionally define setcmykcolor if not available /setcmykcolor where { pop } { /setcmykcolor { 1 sub 4 1 roll 3 { 3 index add neg dup 0 lt { pop 0 } if 3 1 roll } repeat setrgbcolor - pop } bind def } ifelse /PATsc { % colorarray aload length % c1 ... cn length dup 1 eq { pop setgray } { 3 eq { setrgbcolor } { setcmykcolor } ifelse } ifelse } bind def /PATsg { % dict begin lw setlinewidth lc setlinecap lj setlinejoin ml setmiterlimit ds aload pop setdash cc aload pop setrgbcolor cm setmatrix end } bind def /PATDict 3 dict def /PATsp { true PATredef PATDict begin /CurrentPattern exch def % If it's an uncolored pattern, save the color CurrentPattern /PaintType get 2 eq { /PColor exch def } if /CColor [ currentrgbcolor ] def end } bind def % PATstroke - stroke with the current pattern /PATstroke { countdictstack save mark { currentpoint strokepath moveto PATpcalc % proc nw nh px py clip newpath PATfill } stopped { (*** PATstroke Warning: Path is too complex, stroking with gray) = cleartomark restore countdictstack exch sub dup 0 gt { { end } repeat } { pop } ifelse gsave 0.5 setgray oldstroke grestore } { pop restore pop } ifelse newpath } bind def /PATtcalc { % modmtx tilingtype PATtcalc tilematrix % Note: tiling types 2 and 3 are not supported gsave exch concat % tilingtype matrix currentmatrix exch % cmtx tilingtype % Tiling type 1 and 3: constant spacing 2 ne { % Distort the pattern so that it occupies % an integral number of device pixels dup 4 get exch dup 5 get exch % tx ty cmtx XStep 0 dtransform round exch round exch % tx ty cmtx dx.x dx.y XStep div exch XStep div exch % tx ty cmtx a b 0 YStep dtransform round exch round exch % tx ty cmtx a b dy.x dy.y YStep div exch YStep div exch % tx ty cmtx a b c d 7 -3 roll astore % { a b c d tx ty } } if grestore } bind def /PATusp { false PATredef PATDict begin CColor PATsc end } bind def % right45 11 dict begin /PaintType 1 def /PatternType 1 def /TilingType 1 def /BBox [0 0 1 1] def /XStep 1 def /YStep 1 def /PatWidth 1 def /PatHeight 1 def /Multi 2 def /PaintData [ { clippath } bind { 32 32 true [ 32 0 0 -32 0 32 ] {<010101010202020204040404080808081010101020202020 404040408080808001010101020202020404040408080808 101010102020202040404040808080800101010102020202 040404040808080810101010202020204040404080808080 010101010202020204040404080808081010101020202020 4040404080808080>} imagemask } bind ] def /PaintProc { pop exec fill } def currentdict end /P5 exch def 1.1111 1.1111 scale %restore scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /DrawSplineSection { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def /xa x1 x2 x1 sub 0.666667 mul add def /ya y1 y2 y1 sub 0.666667 mul add def /xb x3 x2 x3 sub 0.666667 mul add def /yb y3 y2 y3 sub 0.666667 mul add def x1 y1 lineto xa ya xb yb x3 y3 curveto } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc 30.000 slw % Ellipse n 4200 7800 75 75 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr 15.000 slw % Polyline n 3900 7800 m 4575 7800 l gs col-1 s gr 45.000 slw % Polyline gs clippath 5262 7710 m 5694 7800 l 5262 7890 l 5835 7890 l 5835 7710 l cp clip n 4275 7800 m 5775 7800 l gs col-1 s gr gr % arrowhead 30.000 slw n 5262 7710 m 5694 7800 l 5262 7890 l 5334 7800 l 5262 7710 l cp gs 0.00 setgray ef gr col-1 s % Open spline gs 15.000 slw n 4800.0 2400.0 m 4350.0 3900.0 l 4350.0 3900.0 3900.0 5400.0 3900.0 6600.0 DrawSplineSection 3900.0 7800.0 l gs col-1 s gr gr % Open spline gs n 5475.0 2400.0 m 5025.0 3900.0 l 5025.0 3900.0 4575.0 5400.0 4575.0 6600.0 DrawSplineSection 4575.0 7800.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 5475.0 2400.0 m 5625.0 1987.5 l 5775.0 1575.0 l gs col-1 s gr gr [] 0 sd % Open spline gs [133.3] 0 sd n 4800.0 2400.0 m 4950.0 1987.5 l 5100.0 1575.0 l gs col-1 s gr gr [] 0 sd % Open spline gs 30.000 slw n 825.0 7050.0 m 825.0 7200.0 l 825.0 7200.0 825.0 7350.0 1500.0 8025.0 DrawSplineSection 1500.0 8025.0 2175.0 8700.0 3000.0 8887.5 DrawSplineSection 3000.0 8887.5 3825.0 9075.0 5437.5 9037.5 DrawSplineSection 5437.5 9037.5 7050.0 9000.0 9300.0 8437.5 DrawSplineSection 9300.0 8437.5 11550.0 7875.0 11550.0 7462.5 DrawSplineSection 11550.0 7050.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 825.0 7050.0 m 825.0 7012.5 l 825.0 7012.5 825.0 6975.0 1350.0 6637.5 DrawSplineSection 1350.0 6637.5 1875.0 6300.0 2737.5 6225.0 DrawSplineSection 3600.0 6150.0 l gs col-1 s gr gr [] 0 sd % Open spline gs [133.3] 0 sd n 4875.0 6225.0 m 5512.5 6225.0 l 5512.5 6225.0 6150.0 6225.0 7162.5 6375.0 DrawSplineSection 7162.5 6375.0 8175.0 6525.0 9112.5 6637.5 DrawSplineSection 9112.5 6637.5 10050.0 6750.0 10800.0 6900.0 DrawSplineSection 11550.0 7050.0 l gs col-1 s gr gr [] 0 sd % Open spline gs n 825.0 6975.0 m 1012.5 5962.5 l 1012.5 5962.5 1200.0 4950.0 1425.0 3787.5 DrawSplineSection 1650.0 2625.0 l gs col-1 s gr gr % Open spline gs n 11550.0 7050.0 m 11400.0 6037.5 l 11400.0 6037.5 11250.0 5025.0 10912.5 3637.5 DrawSplineSection 10575.0 2250.0 l gs col-1 s gr gr % Open spline gs [133.3] 0 sd n 1650.0 2625.0 m 1800.0 2025.0 l 1950.0 1425.0 l gs col-1 s gr gr [] 0 sd % Open spline gs [133.3] 0 sd n 10575.0 2250.0 m 10500.0 1875.0 l 10425.0 1500.0 l gs col-1 s gr gr [] 0 sd % Open spline gs 0.000 slw n 2175.0 2250.0 m 3337.5 2250.0 l 3337.5 2250.0 4500.0 2250.0 4200.0 3187.5 DrawSplineSection 4200.0 3187.5 3900.0 4125.0 3787.5 4875.0 DrawSplineSection 3787.5 4875.0 3675.0 5625.0 2625.0 5775.0 DrawSplineSection 2625.0 5775.0 1575.0 5925.0 1762.5 5025.0 DrawSplineSection 1762.5 5025.0 1950.0 4125.0 2100.0 3187.5 DrawSplineSection 2250.0 2250.0 l gs /PC [[1.00 1.00 1.00] [0.00 0.00 0.00]] def 15.00 15.00 sc P5 [16 0 0 -16 105.00 150.00] PATmp PATsp ef gr PATusp gr % Open spline gs n 6075.0 2250.0 m 8137.5 2250.0 l 8137.5 2250.0 10200.0 2250.0 10312.5 3000.0 DrawSplineSection 10312.5 3000.0 10425.0 3750.0 10687.5 4987.5 DrawSplineSection 10687.5 4987.5 10950.0 6225.0 10275.0 6225.0 DrawSplineSection 10275.0 6225.0 9600.0 6225.0 7425.0 5887.5 DrawSplineSection 7425.0 5887.5 5250.0 5550.0 5475.0 4687.5 DrawSplineSection 5475.0 4687.5 5700.0 3825.0 5887.5 3037.5 DrawSplineSection 6075.0 2250.0 l gs /PC [[1.00 1.00 1.00] [0.00 0.00 0.00]] def 15.00 15.00 sc P5 [16 0 0 -16 350.00 150.00] PATmp PATsp ef gr PATusp gr % Open spline gs clippath 4177 6266 m 4336 5854 l 4354 6296 l 4446 5745 l 4269 5716 l cp clip 30.000 slw n 4200.0 7350.0 m 4200.0 7012.5 l 4200.0 7012.5 4200.0 6675.0 4275.0 6225.0 DrawSplineSection 4350.0 5775.0 l gs col-1 s gr gr % arrowhead n 4177 6266 m 4336 5854 l 4354 6296 l 4278 6210 l 4177 6266 l cp gs 0.00 setgray ef gr col-1 s /Times-Italic ff 360.00 scf sf 4275 8625 m gs 1 -1 sc (i) col-1 sh gr /Times-Italic ff 600.00 scf sf 4050 8325 m gs 1 -1 sc (p) col-1 sh gr /Times-Italic ff 600.00 scf sf 5325 8325 m gs 1 -1 sc (v) col-1 sh gr /Times-Italic ff 360.00 scf sf 5550 8550 m gs 1 -1 sc (i) col-1 sh gr /Symbol ff 600.00 scf sf 4725 6900 m gs 1 -1 sc (e) col-1 sh gr /Times-Italic ff 360.00 scf sf 4950 7125 m gs 1 -1 sc (i) col-1 sh gr /Times-Italic ff 600.00 scf sf 4200 4950 m gs 1 -1 sc (W) col-1 sh gr /Times-Italic ff 360.00 scf sf 4575 5175 m gs 1 -1 sc (i) col-1 sh gr /Times-Italic ff 675.00 scf sf 9000 4575 m gs 1 -1 sc (M) col-1 sh gr /Times-Roman ff 600.00 scf sf 5100 6900 m gs 1 -1 sc (= -1) col-1 sh gr $F2psEnd rs end %%EndDocument @endspecial 1264 4931 a FP(Figure)32 b(4.5.)40 b FQ(A)28 b FL(C)5 b FQ(-mark)n(ed)26 b(3-manifold.)605 5116 y(It)35 b(is)g(clear)f(that)p 1186 5048 139 4 v 35 w FJ(@)5 b(M)44 b FQ(=)35 b FJ(@)p 1509 5049 90 4 v 5 w(M)8 b FQ(,)37 b(and)p 1827 5033 V 1827 5049 V 35 w FJ(M)44 b FQ(=)35 b FJ(M)9 b FQ(.)59 b(With)35 b(this)h(extended)f(notions)f(of)h(3-)456 5216 y(manifolds,)e(b)r(oundaries,)f(etc.,)i(one)e(can)f(also)h (de\014ne)g(the)h(notion)e(of)i(3D)f(TQFT.)g(W)-7 b(e)32 b(will)p eop %%Page: 83 13 83 86 bop 1538 226 a FM(4.4.)29 b(3D)g(TQFT)h(FR)n(OM)f(MTC)994 b(83)456 425 y FQ(call)25 b(suc)n(h)g(TQFT's)g FO(\\)p FL(C)5 b FO(-extende)l(d")p FQ(,)24 b(or)h(for)f(brevit)n(y)-7 b(,)26 b(simply)f(\\extended")g(when)g(there)h(is)f(no)456 525 y(am)n(biguit)n(y)-7 b(.)605 678 y FP(Remark)32 b FQ(4.4.2)p FP(.)39 b FQ(Instead)g(of)f(considering)f(manifolds)h(with)h (ribb)r(on)f(tangles)f(inside,)456 778 y(w)n(e)d(could)g(ha)n(v)n(e)g (considered)g(manifolds)g(with)h(tubular)g(neigh)n(b)r(orho)r(o)r(ds)e (of)i(these)f(tangles)456 877 y(remo)n(v)n(ed,)24 b(and)g(a)h(certain)f (framing)h(and)f(coloring)g(of)h(these)g(tub)r(es.)36 b(Suc)n(h)25 b(a)g(manifold)g(is)f(not)456 977 y(ev)n(en)33 b(a)h(manifold)g(with)h(a)f(b)r(oundary)-7 b(,)35 b(but)g(a)e(manifold) h(with)h(corners.)55 b(F)-7 b(or)34 b(this)g(reason,)456 1077 y(extended)27 b(TQFT's)h(are)e(sometimes)h(called)h(\\TQFT's)e (with)i(corners".)605 1230 y FP(Theorem)k FQ(4.4.3)e(\(T)-7 b(uraev)27 b([)p FK(T)p FQ(]\))p FP(.)42 b FO(T)-6 b(o)35 b(any)h(MTC)g FL(C)k FO(such)35 b(that)h FJ(p)2758 1200 y FM(+)2812 1230 y FJ(=p)2896 1200 y FE(\000)2985 1230 y FQ(=)c(1)j FO(one)g(c)l(an)456 1330 y(asso)l(ciate)29 b(a)f FL(C)5 b FO(-extende)l(d)27 b(3D)i(TQFT)f(which)i(gener)l(alizes) f(the)f(R)l(eshetikhin{T)-6 b(ur)l(aev)29 b(invari-)456 1429 y(ants)g FJ(\034)9 b FQ(\()p FJ(M)t(;)14 b FQ(\012\))31 b FO(of)f(close)l(d)h(3-manifolds)h(de\014ne)l(d)e(in)g(Se)l(ction)g FQ(4.1)p FO(.)605 1583 y FP(Remark)i FQ(4.4.4)p FP(.)39 b FQ(It)c(w)n(as)f(sho)n(wn)g(in)h([)p FK(F)-8 b(u)p FQ(])35 b(that)g(ev)n(ery)e(complex-v)-5 b(alued)34 b(in)n(v)-5 b(arian)n(t)34 b(of)456 1682 y(closed)f(3-manifolds)f(satisfying)h(the) h(m)n(ultiplicativit)n(y)g FJ(\034)9 b FQ(\()p FJ(M)2433 1694 y FM(1)2471 1682 y FQ(#)p FJ(M)2621 1694 y FM(2)2658 1682 y FQ(\))33 b(=)g FJ(\034)9 b FQ(\()p FJ(M)2979 1694 y FM(1)3017 1682 y FQ(\))p FJ(\034)g FQ(\()p FJ(M)3207 1694 y FM(2)3245 1682 y FQ(\))34 b(and)456 1790 y(realit)n(y)21 b FJ(\034)9 b FQ(\()p 786 1724 90 4 v FJ(M)g FQ(\))24 b(=)p 1019 1718 200 4 v 22 w FJ(\034)9 b FQ(\()p FJ(M)g FQ(\))23 b(prop)r(erties)e(can)h(b)r(e)g(obtained)g(from)g(some)f (\(non-extended\))i(TQFT,)456 1890 y(whic)n(h)32 b(is)g(essen)n(tially) f(uniquely)h(de\014ned)g(b)n(y)g(this)g(in)n(v)-5 b(arian)n(t.)49 b(Since)33 b(Reshetikhin{T)-7 b(uraev)456 1990 y(in)n(v)i(arian)n(ts,) 25 b(up)h(to)h(a)e(constan)n(t,)h(satisfy)g(the)h(m)n(ultiplicativit)n (y)f(prop)r(ert)n(y)f(\(see)i(\(4.1.3\))o(\),)g(it)g(is)456 2089 y(not)h(surprising)e(that)j(they)f(come)g(from)f(some)h(TQFT.)g (The)g(problem)g(is)g(to)g(construct)f(this)456 2189 y(TQFT)g(explicitly)-7 b(.)605 2342 y(The)24 b(remaining)f(part)h(of)g (this)h(section)e(is)i(dev)n(oted)e(to)h(the)h(construction)e(of)h(the) h(TQFT,)456 2442 y(and)36 b(th)n(us,)j(the)e(pro)r(of)f(of)h(Theorem)f (4.4.3.)63 b(The)37 b(main)f(idea)h(of)g(the)g(pro)r(of)f(is)g(to)h (reduce)456 2541 y(ev)n(erything)c(to)i(manifolds)f(without)i(b)r (oundary)e(\(but)h(with)g(some)g(kind)g(of)f(a)h(ribb)r(on)f(link)456 2641 y(inside\))28 b(and)f(then)h(use)g(the)g(results)f(of)g(Section)h (4.1.)605 2741 y FK(Step)k(1.)42 b(P)m(arameterized)31 b(manifolds.)605 2840 y FQ(Let)h(us)g(start)f(with)i(constructing)e (some)g(supply)h(of)g(\\standard")e FL(C)5 b FQ(-mark)n(ed)30 b(surfaces.)456 2940 y(Let)d(us)h(call)f(a)g FO(typ)l(e)34 b FJ(t)28 b FQ(a)f(\014nite)h(sequence)g(of)f(the)h(form)1189 3081 y FJ(t)23 b FQ(=)g(\(\()p FJ(W)1472 3093 y FM(1)1510 3081 y FJ(;)14 b(")1586 3093 y FM(1)1623 3081 y FQ(\))p FJ(;)g FQ(\()p FJ(W)1802 3093 y FM(2)1840 3081 y FJ(;)g(")1916 3093 y FM(2)1953 3081 y FQ(\))p FJ(;)g(H)r(;)g FQ(\()p FJ(W)2240 3093 y FM(3)2278 3081 y FJ(;)g(")2354 3093 y FM(3)2391 3081 y FQ(\))p FJ(;)g(H)r(;)g(:)g(:)g(:)g FQ(\))-2255 b(\(4.4.1\))456 3223 y(where)28 b FJ(W)775 3235 y FI(i)833 3223 y FQ(are)g(ob)5 b(jects)28 b(of)i FL(C)5 b FQ(,)29 b FJ(")1495 3235 y FI(i)1548 3223 y FQ(=)c FL(\006)p FQ(,)k(and)g FJ(H)36 b FQ(is)29 b(some)g(formal)f(sym) n(b)r(ol.)42 b(W)-7 b(e)29 b(will)h(denote)456 3323 y(b)n(y)d FJ(g)f FQ(=)c FJ(g)s FQ(\()p FJ(t)p FQ(\))28 b(the)g(n)n(um)n(b)r(er)f (of)h(o)r(ccurrences)e(of)h FJ(H)7 b FQ(.)605 3422 y(F)-7 b(or)18 b(ev)n(ery)f(t)n(yp)r(e)i FJ(t)g FQ(as)f(ab)r(o)n(v)n(e,)h(w)n (e)f(de\014ne)h(some)f(\\standard")f FL(C)5 b FQ(-mark)n(ed)17 b(surface)g(\006)3183 3434 y FI(t)3213 3422 y FQ(.)34 b(First)456 3522 y(of)23 b(all,)h(let)f(us)h(de\014ne)f(the)h (\\standard)e(sphere")g(to)h(b)r(e)h FJ(S)2215 3492 y FM(2)2275 3522 y FQ(=)e FL(f)p FQ(\()p FJ(x;)14 b(y)s(;)g(z)t FQ(\))22 b FL(2)i FH(R)2831 3492 y FM(3)2897 3522 y FL(j)f FJ(x)2990 3492 y FM(2)3038 3522 y FQ(+)10 b FJ(y)3157 3492 y FM(2)3203 3522 y FQ(+)g FJ(z)3321 3492 y FM(2)3380 3522 y FQ(=)456 3622 y(1)p FL(g)p FQ(,)36 b(whic)n(h)f(w)n(e)h (consider)e(as)h(the)g(b)r(oundary)g(of)g(the)h(unit)g(ball)g(in)f FH(R)2712 3591 y FM(3)2755 3622 y FQ(.)61 b(W)-7 b(e)36 b(will)f(also)g(use)456 3721 y(the)g(\\equator")e(of)h(this)i(sphere,)g (whic)n(h)f(w)n(e)f(de\014ne)i(to)e(b)r(e)i(the)f(circle)f(giv)n(en)g (b)n(y)h(equation)456 3821 y FJ(y)27 b FQ(=)c(0)28 b(\(see)h(Figure)e (4.6\).)39 b(The)28 b(clo)r(c)n(kwise)f(direction)h(\(in)h(the)g FJ(xz)t FQ(-plane\))f(of)g(this)h(circle)e(will)456 3920 y(b)r(e)33 b(referred)f(to)i(as)e(the)i(p)r(ositiv)n(e)f(direction.)54 b(Equiv)-5 b(alen)n(tly)e(,)34 b(one)f(can)g(view)g(the)g(standard)456 4020 y(sphere)39 b(as)g FJ(S)897 3990 y FM(2)978 4020 y FQ(=)44 b FH(C)15 b(P)1193 3990 y FM(1)1235 4020 y FQ(,)43 b(with)e(the)f(equator)f(b)r(eing)h(the)g(completed)h(real)e (axis,)j(and)e(the)456 4120 y(p)r(ositiv)n(e)30 b(direction)g(giv)n(en) g(b)n(y)h(the)g(p)r(ositiv)n(e)f(direction)h(on)f(the)i(real)d(axis.)46 b(W)-7 b(e)31 b(will)g(alw)n(a)n(ys)456 4219 y(iden)n(tify)j(these)g(t) n(w)n(o)f(realizations)f(b)n(y)i(stereographic)d(pro)5 b(jection,)35 b(so)e(that)h(the)g(the)h(south)456 4319 y(p)r(ole)27 b(\(0)p FJ(;)14 b FQ(0)p FJ(;)g FL(\000)p FQ(1\))22 b FL(2)h FH(R)1116 4289 y FM(3)1187 4319 y FQ(is)k(iden)n(ti\014ed)i(with)f FL(1)23 b(2)g FH(C)15 b(P)2112 4289 y FM(1)2154 4319 y FQ(.)605 4419 y(No)n(w,)40 b(giv)n(en)d(a)g(t)n(yp)r(e)h FJ(t)p FQ(,)i(w)n(e)d(construct)g(\006) 1993 4431 y FI(t)2060 4419 y FQ(as)g(follo)n(ws.)66 b(Let)38 b(us)g(tak)n(e)e(the)i(standard)456 4518 y(sphere.)43 b(Cho)r(ose)29 b(p)r(oin)n(ts)h FJ(p)1339 4530 y FM(1)1404 4518 y FJ(<)c FL(\001)14 b(\001)g(\001)27 b FJ(<)g(p)1753 4530 y FI(n)1828 4518 y FQ(on)j(the)g(equator)f(\()p FJ(n)h FQ(is)g(the)h(n)n(um)n(b)r(er)e(of)h(terms)g(in)456 4618 y FJ(t)p FQ(\).)48 b(F)-7 b(or)30 b(ev)n(ery)g(term)i(\()p FJ(W)1277 4630 y FI(i)1305 4618 y FJ(;)14 b(")1381 4630 y FI(i)1408 4618 y FQ(\))32 b(of)f FJ(t)p FQ(,)h(assign)e(to)h(the)h (corresp)r(onding)d(p)r(oin)n(t)j(the)f(ob)5 b(ject)31 b FJ(W)3393 4630 y FI(i)3421 4618 y FQ(,)456 4717 y(the)23 b(sign)g FJ(")800 4729 y FI(i)827 4717 y FQ(,)i(and)e(the)g(v)n(ector)f FJ(v)1455 4729 y FI(i)1506 4717 y FQ(whic)n(h)h(go)r(es)g(along)f(the)h (p)r(ositiv)n(e)g(direction)g(of)g(the)h(equator.)456 4817 y(F)-7 b(or)35 b(ev)n(ery)f(o)r(ccurrence)h(of)g FJ(H)7 b FQ(,)38 b(glue)d(a)h(handle)f(to)h(the)g(corresp)r(onding)e FJ(p)2882 4829 y FI(i)2909 4817 y FQ(.)62 b(This)35 b(giv)n(es)g(a)456 4917 y FL(C)5 b FQ(-mark)n(ed)25 b(surface)i(\006)1167 4929 y FI(t)1224 4917 y FQ(whic)n(h)g(is)h(de\014ned)g(uniquely)g(up)f (to)h(a)f(unique)h(homeomorphism.)605 5016 y(More)20 b(formally)-7 b(,)22 b(\006)1212 5028 y FI(t)1262 5016 y FQ(can)f(b)r(e)h(de\014ned)f(as)g(follo)n(ws.)33 b(De\014ne)22 b(for)f(ev)n(ery)e FJ(t)j FQ(the)f(ribb)r(on)g(tangle)456 5116 y FJ(T)505 5128 y FI(t)561 5116 y FQ(whic)n(h)28 b(consists)e(of:)605 5216 y(\(a\))i(One)f(\(uncolored\))g(coup)r(on)g (\(placed)h(in)g(the)g(b)r(ottom)g(of)f FJ(T)2612 5228 y FI(t)2641 5216 y FQ(\).)p eop %%Page: 84 14 84 87 bop 456 226 a FM(84)404 b(4.)29 b(3-DIMENSIONAL)g(TOPOLOGICAL)h (QUANTUM)f(FIELD)g(THEOR)-5 b(Y)1496 1252 y @beginspecial 0 @llx 0 @lly 109 @urx 104 @ury 1090 @rwi @setspecial %%BeginDocument: figures/sphequa.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: sphequa.eps %%Creator: fig2dev Version 3.2 Patchlevel 1 %%CreationDate: Tue Apr 4 12:22:02 2000 %%For: kirillov@copiague (Alexander Kirillov) %%Orientation: Portrait %%BoundingBox: 0 0 109 104 %%Pages: 0 %%BeginSetup %%EndSetup %%Magnification: 0.2500 %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -42.0 117.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n -1000 8800 m -1000 -1000 l 11008 -1000 l 11008 8800 l cp clip 0.01500 0.01500 sc 30.000 slw % Ellipse n 6000 4800 2400 2400 0 360 DrawEllipse gs col0 s gr 7.500 slw % Ellipse n 6000 4800 80 80 0 360 DrawEllipse gs 0.00 setgray ef gr gs col0 s gr % Ellipse n 6000 2400 80 80 0 360 DrawEllipse gs 0.00 setgray ef gr gs col0 s gr % Ellipse n 4710 6090 80 80 0 360 DrawEllipse gs 0.00 setgray ef gr gs col0 s gr % Ellipse n 5985 7200 80 80 0 360 DrawEllipse gs 0.00 setgray ef gr gs col0 s gr % Ellipse n 7635 5430 80 80 0 360 DrawEllipse gs 0.00 setgray ef gr gs col0 s gr % Polyline 30.000 slw gs clippath 5910 1406 m 6000 973 l 6090 1406 l 6090 855 l 5910 855 l cp clip n 6000 4800 m 6000 900 l gs col0 s gr gr % arrowhead n 5910 1406 m 6000 973 l 6090 1406 l 6000 1334 l 5910 1406 l cp gs 0.00 setgray ef gr col0 s % Polyline gs clippath 3654 7217 m 3278 7449 l 3530 7087 l 3130 7466 l 3254 7596 l cp clip n 4725 6075 m 3225 7500 l gs col0 s gr gr % arrowhead n 3654 7217 m 3278 7449 l 3530 7087 l 3539 7201 l 3654 7217 l cp gs 0.00 setgray ef gr col0 s % Polyline [120] 0 sd n 6000 4800 m 4725 6075 l gs col0 s gr [] 0 sd % Polyline [120] 0 sd n 6036 4800 m 7725 5475 l gs col0 s gr [] 0 sd % Polyline gs clippath 9539 6104 m 9906 6347 l 9472 6271 l 9983 6475 l 10050 6308 l cp clip n 7725 5475 m 9975 6375 l gs col0 s gr gr % arrowhead n 9539 6104 m 9906 6347 l 9472 6271 l 9572 6214 l 9539 6104 l cp gs 0.00 setgray ef gr col0 s % Polyline gs clippath 4760 3704 m 4562 4098 l 4586 3658 l 4446 4191 l 4620 4236 l cp clip n 4619 3885 m 4544 4170 l gs col0 s gr gr % arrowhead n 4760 3704 m 4562 4098 l 4586 3658 l 4654 3751 l 4760 3704 l cp gs 0.00 setgray ef gr col0 s % Polyline n 5977 2407 m 5976 2407 l 5973 2408 l 5965 2409 l 5951 2412 l 5931 2415 l 5906 2420 l 5877 2425 l 5846 2431 l 5816 2437 l 5786 2443 l 5759 2449 l 5733 2454 l 5710 2460 l 5688 2465 l 5668 2471 l 5650 2476 l 5632 2482 l 5615 2488 l 5597 2495 l 5580 2502 l 5563 2509 l 5545 2517 l 5528 2526 l 5509 2535 l 5491 2545 l 5473 2555 l 5454 2566 l 5436 2577 l 5418 2588 l 5401 2600 l 5384 2611 l 5367 2623 l 5351 2634 l 5336 2646 l 5321 2657 l 5306 2669 l 5291 2680 l 5276 2693 l 5261 2705 l 5246 2719 l 5230 2732 l 5215 2747 l 5198 2762 l 5182 2777 l 5166 2793 l 5150 2809 l 5135 2825 l 5120 2840 l 5105 2856 l 5091 2872 l 5078 2887 l 5065 2902 l 5053 2916 l 5041 2931 l 5030 2946 l 5018 2961 l 5007 2977 l 4995 2993 l 4984 3009 l 4972 3026 l 4961 3044 l 4949 3062 l 4937 3081 l 4926 3099 l 4915 3118 l 4904 3136 l 4894 3155 l 4884 3173 l 4874 3190 l 4864 3208 l 4855 3225 l 4846 3242 l 4837 3259 l 4828 3277 l 4819 3295 l 4809 3314 l 4800 3334 l 4790 3354 l 4780 3375 l 4770 3397 l 4760 3418 l 4750 3440 l 4740 3462 l 4731 3484 l 4722 3505 l 4713 3526 l 4704 3547 l 4696 3567 l 4688 3586 l 4681 3606 l 4674 3624 l 4668 3642 l 4661 3660 l 4654 3679 l 4648 3699 l 4641 3719 l 4634 3739 l 4628 3760 l 4621 3781 l 4615 3802 l 4609 3823 l 4602 3844 l 4597 3865 l 4591 3885 l 4586 3904 l 4581 3924 l 4576 3942 l 4572 3960 l 4567 3978 l 4563 3995 l 4559 4014 l 4555 4033 l 4551 4053 l 4547 4072 l 4543 4093 l 4539 4113 l 4535 4134 l 4531 4156 l 4528 4177 l 4524 4198 l 4521 4219 l 4518 4240 l 4515 4261 l 4512 4281 l 4510 4300 l 4507 4319 l 4505 4338 l 4502 4356 l 4500 4375 l 4498 4394 l 4496 4413 l 4493 4433 l 4491 4454 l 4489 4475 l 4487 4497 l 4485 4519 l 4483 4541 l 4481 4563 l 4479 4585 l 4478 4607 l 4476 4628 l 4475 4648 l 4474 4668 l 4473 4687 l 4473 4706 l 4472 4725 l 4472 4743 l 4472 4761 l 4472 4780 l 4472 4799 l 4472 4819 l 4473 4839 l 4473 4859 l 4474 4879 l 4475 4900 l 4476 4920 l 4477 4940 l 4478 4960 l 4480 4979 l 4481 4998 l 4482 5016 l 4483 5033 l 4485 5050 l 4486 5067 l 4488 5084 l 4489 5101 l 4490 5119 l 4492 5136 l 4494 5155 l 4495 5174 l 4497 5193 l 4499 5213 l 4501 5233 l 4504 5253 l 4506 5273 l 4508 5293 l 4511 5313 l 4513 5333 l 4516 5352 l 4518 5371 l 4521 5390 l 4524 5408 l 4527 5427 l 4530 5447 l 4533 5467 l 4537 5488 l 4540 5510 l 4545 5532 l 4549 5555 l 4553 5578 l 4558 5601 l 4563 5624 l 4568 5647 l 4573 5670 l 4578 5692 l 4583 5713 l 4588 5733 l 4593 5753 l 4598 5771 l 4603 5790 l 4609 5807 l 4614 5825 l 4620 5843 l 4625 5861 l 4632 5879 l 4638 5897 l 4645 5916 l 4652 5934 l 4659 5953 l 4666 5971 l 4674 5990 l 4681 6008 l 4688 6025 l 4696 6043 l 4703 6059 l 4710 6076 l 4717 6092 l 4725 6108 l 4732 6125 l 4739 6141 l 4747 6159 l 4755 6177 l 4764 6195 l 4773 6214 l 4782 6233 l 4791 6253 l 4800 6273 l 4810 6292 l 4819 6312 l 4828 6331 l 4838 6350 l 4846 6368 l 4855 6385 l 4864 6402 l 4872 6418 l 4880 6433 l 4889 6450 l 4898 6468 l 4908 6485 l 4918 6502 l 4928 6520 l 4938 6538 l 4949 6555 l 4960 6573 l 4971 6590 l 4982 6607 l 4993 6624 l 5004 6640 l 5015 6655 l 5026 6670 l 5036 6684 l 5047 6698 l 5058 6711 l 5069 6725 l 5081 6739 l 5094 6753 l 5107 6768 l 5121 6783 l 5135 6797 l 5149 6812 l 5164 6827 l 5178 6841 l 5193 6855 l 5207 6868 l 5221 6880 l 5234 6892 l 5247 6904 l 5260 6915 l 5273 6925 l 5286 6936 l 5300 6946 l 5313 6957 l 5328 6968 l 5342 6978 l 5357 6989 l 5373 6999 l 5388 7010 l 5403 7019 l 5418 7029 l 5432 7038 l 5446 7047 l 5460 7055 l 5473 7063 l 5486 7070 l 5499 7077 l 5512 7085 l 5526 7092 l 5540 7099 l 5555 7107 l 5570 7114 l 5586 7121 l 5601 7128 l 5617 7135 l 5633 7141 l 5649 7147 l 5664 7153 l 5680 7158 l 5695 7163 l 5709 7167 l 5724 7171 l 5739 7174 l 5754 7178 l 5770 7181 l 5788 7184 l 5807 7186 l 5828 7189 l 5852 7192 l 5877 7195 l 5903 7198 l 5929 7200 l 5953 7203 l 5972 7205 l 5987 7206 l 5995 7207 l 5998 7207 l 5999 7207 l gs col0 s gr % Polyline [120] 0 sd n 6000 2400 m 6001 2400 l 6005 2402 l 6014 2405 l 6029 2410 l 6050 2418 l 6073 2426 l 6096 2435 l 6118 2443 l 6138 2452 l 6156 2459 l 6172 2466 l 6187 2473 l 6200 2480 l 6213 2488 l 6225 2495 l 6237 2503 l 6249 2512 l 6261 2521 l 6274 2531 l 6287 2542 l 6300 2553 l 6313 2565 l 6326 2577 l 6339 2589 l 6351 2601 l 6363 2613 l 6375 2625 l 6388 2638 l 6398 2648 l 6410 2660 l 6422 2672 l 6434 2685 l 6447 2698 l 6460 2712 l 6474 2727 l 6488 2743 l 6501 2759 l 6515 2775 l 6528 2791 l 6541 2808 l 6553 2825 l 6565 2841 l 6577 2858 l 6588 2875 l 6597 2891 l 6606 2907 l 6616 2923 l 6625 2941 l 6634 2959 l 6644 2979 l 6653 2998 l 6662 3019 l 6672 3039 l 6680 3060 l 6689 3081 l 6697 3101 l 6705 3121 l 6712 3140 l 6719 3159 l 6726 3177 l 6732 3195 l 6738 3213 l 6743 3230 l 6749 3247 l 6754 3264 l 6759 3282 l 6765 3300 l 6770 3319 l 6775 3338 l 6781 3357 l 6786 3377 l 6791 3396 l 6796 3416 l 6800 3436 l 6805 3455 l 6809 3474 l 6813 3493 l 6817 3512 l 6821 3531 l 6825 3550 l 6828 3567 l 6832 3585 l 6835 3604 l 6839 3623 l 6843 3643 l 6847 3663 l 6851 3684 l 6854 3706 l 6858 3728 l 6863 3750 l 6867 3772 l 6871 3794 l 6874 3816 l 6878 3837 l 6882 3857 l 6886 3877 l 6890 3896 l 6893 3915 l 6897 3933 l 6900 3950 l 6904 3969 l 6908 3988 l 6912 4007 l 6916 4026 l 6920 4045 l 6924 4065 l 6928 4085 l 6932 4105 l 6936 4125 l 6940 4145 l 6943 4165 l 6947 4185 l 6950 4205 l 6953 4224 l 6956 4243 l 6958 4262 l 6960 4281 l 6963 4300 l 6964 4317 l 6966 4335 l 6967 4354 l 6968 4373 l 6969 4393 l 6970 4413 l 6971 4434 l 6972 4456 l 6973 4478 l 6973 4500 l 6974 4522 l 6974 4544 l 6974 4566 l 6975 4587 l 6975 4607 l 6975 4627 l 6975 4646 l 6975 4665 l 6975 4683 l 6975 4700 l 6975 4719 l 6975 4738 l 6975 4757 l 6975 4776 l 6975 4795 l 6974 4814 l 6974 4834 l 6974 4854 l 6973 4873 l 6973 4893 l 6972 4912 l 6971 4931 l 6970 4950 l 6969 4968 l 6967 4986 l 6966 5003 l 6964 5020 l 6963 5038 l 6960 5055 l 6958 5073 l 6956 5091 l 6953 5110 l 6950 5130 l 6947 5150 l 6943 5171 l 6940 5192 l 6936 5214 l 6932 5236 l 6928 5258 l 6924 5279 l 6920 5301 l 6916 5321 l 6912 5342 l 6908 5361 l 6904 5381 l 6900 5400 l 6896 5419 l 6892 5439 l 6888 5458 l 6884 5479 l 6880 5500 l 6875 5521 l 6871 5543 l 6866 5565 l 6861 5588 l 6856 5610 l 6850 5632 l 6845 5654 l 6840 5675 l 6834 5696 l 6829 5717 l 6824 5736 l 6818 5756 l 6813 5775 l 6807 5794 l 6801 5814 l 6794 5833 l 6787 5854 l 6780 5875 l 6773 5896 l 6765 5918 l 6757 5940 l 6748 5963 l 6740 5985 l 6731 6007 l 6723 6029 l 6715 6050 l 6706 6071 l 6698 6092 l 6690 6111 l 6683 6131 l 6675 6150 l 6667 6169 l 6660 6188 l 6652 6208 l 6644 6228 l 6635 6249 l 6627 6270 l 6618 6291 l 6609 6313 l 6600 6334 l 6591 6355 l 6582 6376 l 6573 6396 l 6565 6415 l 6556 6434 l 6548 6451 l 6540 6468 l 6533 6484 l 6525 6500 l 6516 6517 l 6508 6534 l 6499 6550 l 6489 6567 l 6480 6584 l 6470 6601 l 6460 6619 l 6450 6636 l 6440 6653 l 6430 6669 l 6420 6686 l 6411 6702 l 6401 6717 l 6392 6733 l 6384 6748 l 6375 6763 l 6366 6778 l 6358 6793 l 6349 6810 l 6339 6826 l 6329 6844 l 6319 6862 l 6309 6880 l 6298 6898 l 6287 6916 l 6277 6934 l 6266 6951 l 6255 6968 l 6244 6983 l 6234 6998 l 6223 7012 l 6213 7025 l 6200 7039 l 6187 7053 l 6174 7067 l 6159 7081 l 6145 7094 l 6130 7106 l 6116 7118 l 6102 7129 l 6088 7139 l 6076 7148 l 6065 7157 l 6054 7164 l 6045 7170 l 6038 7175 l 6023 7185 l 6013 7191 l 6006 7196 l 6002 7199 l 6000 7200 l gs col0 s gr [] 0 sd /Times-Roman ff 750.00 scf sf 6375 7800 m gs 1 -1 sc 90.0 rot (8) col0 sh gr /Times-Italic ff 750.00 scf sf 2850 7200 m gs 1 -1 sc (x) col0 sh gr /Times-Italic ff 750.00 scf sf 6450 1350 m gs 1 -1 sc (z) col0 sh gr /Times-Roman ff 750.00 scf sf 6300 4650 m gs 1 -1 sc (0) col0 sh gr /Times-Italic ff 750.00 scf sf 9600 5775 m gs 1 -1 sc (y) col0 sh gr $F2psEnd rs %%EndDocument @endspecial 1392 1452 a FP(Figure)32 b(4.6.)40 b FQ(Standard)27 b(sphere.)605 1687 y(\(b\))40 b(A)g(strand)f(of)h(color)e FJ(W)51 b FQ(for)39 b(eac)n(h)g(o)r(ccurrence)f(of)i(\()p FJ(W)n(;)14 b(")p FQ(\),)43 b(whic)n(h)c(connects)g(the)456 1787 y(coup)r(on)32 b(with)i(the)f(top)g(of)g(the)h(tangle.)52 b(This)33 b(strand)f(is)h(directed)g(up)n(w)n(ard)f(if)i FJ(")d FQ(=)h(+)h(and)456 1886 y(do)n(wn)n(w)n(ard)25 b(if)j FJ(")23 b FQ(=)g FL(\000)p FQ(.)605 1986 y(\(c\))28 b(An)g(arc)f(\(uncolored)g(and)g(non-directed\))g(for)g(eac)n(h)g(o)r (ccurrence)f(of)i FJ(H)7 b FQ(.)456 2085 y(De\014ne)20 b(the)g(handleb)r(o)r(dy)f FJ(M)1362 2097 y FI(t)1410 2085 y FQ(as)g(a)g(neigh)n(b)r(orho)r(o)r(d)g(of)g(the)h(coup)r(on)f (and)g(arcs)g(of)g FJ(T)3032 2097 y FI(t)3080 2085 y FQ(in)h FH(R)3223 2055 y FM(3)3266 2085 y FQ(,)i(and)456 2185 y(let)e(\006)628 2197 y FI(t)680 2185 y FQ(=)i FJ(@)5 b(M)897 2197 y FI(t)926 2185 y FQ(.)34 b(One)20 b(easily)e(sees)i(that) f(this)h(de\014nes)g(\006)2181 2197 y FI(t)2230 2185 y FQ(uniquely)g(up)g(to)f(a)h(homeomorphism,)456 2285 y(and)27 b(the)h(homeomorphism)e(is)i(unique)g(up)g(to)f(isotop)n(y)-7 b(.)605 2384 y(F)g(or)33 b(example,)h(for)f FJ(t)g FQ(=)f(\(\()p FJ(W)1550 2396 y FM(1)1588 2384 y FJ(;)14 b FQ(+\))p FJ(;)g(H)r(;)g FQ(\()p FJ(W)1977 2396 y FM(2)2015 2384 y FJ(;)g FL(\000)p FQ(\)\),)35 b(the)f(tangle)f FJ(T)2692 2396 y FI(t)2754 2384 y FQ(and)g(the)h(surface)e(\006)3415 2396 y FI(t)456 2484 y FQ(are)27 b(sho)n(wn)g(in)i(Figure)e(4.7)h(b)r (elo)n(w)f(\(for)h(tec)n(hnical)g(resons,)f(the)i(tangen)n(t)e(v)n (ectors)g FJ(v)3129 2496 y FI(i)3185 2484 y FQ(are)g(not)456 2584 y(sho)n(wn)f(in)i(the)g(\014gure\).)1125 3222 y @beginspecial 0 @llx 0 @lly 76 @urx 44 @ury 760 @rwi @setspecial %%BeginDocument: figures/tta.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: tta.eps %%Creator: fig2dev Version 3.2 Patchlevel 0-beta3 %%CreationDate: Mon Dec 14 12:29:58 1998 %%For: shurik@localhost.localdomain (Alexander Kirillov,,,) %%Orientation: Portrait %%BoundingBox: 0 0 76 44 %%Pages: 0 %%BeginSetup %%EndSetup %%Magnification: 0.3300 %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -25.0 49.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n -1000 3433 m -1000 -1000 l 6086 -1000 l 6086 3433 l cp clip 0.01980 0.01980 sc /Times-Roman ff 450.00 scf sf 1275 1125 m gs 1 -1 sc (W) col0 sh gr /Times-Roman ff 330.00 scf sf 1654 1301 m gs 1 -1 sc (1) col0 sh gr /Times-Roman ff 450.00 scf sf 4538 1118 m gs 1 -1 sc (W) col0 sh gr /Times-Roman ff 330.00 scf sf 4917 1294 m gs 1 -1 sc (2) col0 sh gr % Polyline 30.000 slw n 1800 1800 m 1800 2400 l 4515 2400 l 4515 1800 l 1800 1800 l cp gs col0 s gr % Polyline gs clippath 2040 669 m 2100 381 l 2160 669 l 2160 255 l 2040 255 l cp clip n 2100 1800 m 2100 300 l gs col0 s gr gr % arrowhead n 2040 669 m 2100 381 l 2160 669 l 2100 621 l 2040 669 l cp gs 0.00 setgray ef gr col0 s % Polyline gs clippath 4275 1401 m 4215 1689 l 4155 1401 l 4155 1815 l 4275 1815 l cp clip n 4215 345 m 4215 1770 l gs col0 s gr gr % arrowhead n 4275 1401 m 4215 1689 l 4155 1401 l 4215 1449 l 4275 1401 l cp gs 0.00 setgray ef gr col0 s % Polyline n 2880 1785 m 2880 1782 l 2880 1776 l 2879 1766 l 2879 1750 l 2878 1729 l 2878 1703 l 2877 1675 l 2876 1644 l 2876 1612 l 2875 1580 l 2875 1550 l 2875 1522 l 2875 1495 l 2876 1471 l 2877 1449 l 2878 1429 l 2880 1410 l 2883 1389 l 2886 1369 l 2889 1349 l 2892 1329 l 2896 1309 l 2899 1289 l 2903 1269 l 2907 1249 l 2911 1230 l 2915 1211 l 2920 1192 l 2926 1174 l 2932 1157 l 2938 1140 l 2946 1125 l 2955 1110 l 2965 1096 l 2976 1084 l 2989 1071 l 3002 1060 l 3017 1048 l 3032 1036 l 3048 1025 l 3064 1014 l 3080 1003 l 3096 993 l 3112 984 l 3127 976 l 3142 969 l 3155 964 l 3168 961 l 3180 960 l 3193 961 l 3205 966 l 3217 973 l 3229 982 l 3240 992 l 3251 1004 l 3262 1017 l 3273 1031 l 3283 1044 l 3293 1058 l 3303 1071 l 3313 1084 l 3322 1097 l 3330 1110 l 3338 1124 l 3345 1138 l 3351 1152 l 3358 1166 l 3363 1180 l 3369 1194 l 3375 1208 l 3380 1223 l 3385 1238 l 3390 1255 l 3394 1272 l 3398 1291 l 3402 1312 l 3405 1335 l 3407 1353 l 3408 1372 l 3409 1393 l 3410 1417 l 3410 1444 l 3410 1473 l 3410 1505 l 3410 1538 l 3409 1573 l 3409 1609 l 3408 1643 l 3407 1676 l 3407 1706 l 3406 1731 l 3406 1751 l 3405 1767 l 3405 1777 l 3405 1782 l 3405 1785 l gs col0 s gr $F2psEnd rs %%EndDocument @endspecial 1925 3322 a @beginspecial 0 @llx 0 @lly 102 @urx 68 @ury 1020 @rwi @setspecial %%BeginDocument: figures/ttb.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: ttb.eps %%Creator: fig2dev Version 3.2 Patchlevel 0-beta3 %%CreationDate: Mon Dec 14 12:32:30 1998 %%For: shurik@localhost.localdomain (Alexander Kirillov,,,) %%Orientation: Portrait %%BoundingBox: 0 0 102 68 %%Pages: 0 %%BeginSetup %%EndSetup %%Magnification: 0.3300 %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -44.0 156.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /reencdict 12 dict def /ReEncode { reencdict begin /newcodesandnames exch def /newfontname exch def /basefontname exch def /basefontdict basefontname findfont def /newfont basefontdict maxlength dict def basefontdict { exch dup /FID ne { dup /Encoding eq { exch dup length array copy newfont 3 1 roll put } { exch newfont 3 1 roll put } ifelse } { pop pop } ifelse } forall newfont /FontName newfontname put newcodesandnames aload pop 128 1 255 { newfont /Encoding get exch /.notdef put } for newcodesandnames length 2 idiv { newfont /Encoding get 3 1 roll put } repeat newfontname newfont definefont pop end } def /isovec [ 8#200 /grave 8#201 /acute 8#202 /circumflex 8#203 /tilde 8#204 /macron 8#205 /breve 8#206 /dotaccent 8#207 /dieresis 8#210 /ring 8#211 /cedilla 8#212 /hungarumlaut 8#213 /ogonek 8#214 /caron 8#220 /dotlessi 8#230 /oe 8#231 /OE 8#240 /space 8#241 /exclamdown 8#242 /cent 8#243 /sterling 8#244 /currency 8#245 /yen 8#246 /brokenbar 8#247 /section 8#250 /dieresis 8#251 /copyright 8#252 /ordfeminine 8#253 /guillemotleft 8#254 /logicalnot 8#255 /endash 8#256 /registered 8#257 /macron 8#260 /degree 8#261 /plusminus 8#262 /twosuperior 8#263 /threesuperior 8#264 /acute 8#265 /mu 8#266 /paragraph 8#267 /periodcentered 8#270 /cedilla 8#271 /onesuperior 8#272 /ordmasculine 8#273 /guillemotright 8#274 /onequarter 8#275 /onehalf 8#276 /threequarters 8#277 /questiondown 8#300 /Agrave 8#301 /Aacute 8#302 /Acircumflex 8#303 /Atilde 8#304 /Adieresis 8#305 /Aring 8#306 /AE 8#307 /Ccedilla 8#310 /Egrave 8#311 /Eacute 8#312 /Ecircumflex 8#313 /Edieresis 8#314 /Igrave 8#315 /Iacute 8#316 /Icircumflex 8#317 /Idieresis 8#320 /Eth 8#321 /Ntilde 8#322 /Ograve 8#323 /Oacute 8#324 /Ocircumflex 8#325 /Otilde 8#326 /Odieresis 8#327 /multiply 8#330 /Oslash 8#331 /Ugrave 8#332 /Uacute 8#333 /Ucircumflex 8#334 /Udieresis 8#335 /Yacute 8#336 /Thorn 8#337 /germandbls 8#340 /agrave 8#341 /aacute 8#342 /acircumflex 8#343 /atilde 8#344 /adieresis 8#345 /aring 8#346 /ae 8#347 /ccedilla 8#350 /egrave 8#351 /eacute 8#352 /ecircumflex 8#353 /edieresis 8#354 /igrave 8#355 /iacute 8#356 /icircumflex 8#357 /idieresis 8#360 /eth 8#361 /ntilde 8#362 /ograve 8#363 /oacute 8#364 /ocircumflex 8#365 /otilde 8#366 /odieresis 8#367 /divide 8#370 /oslash 8#371 /ugrave 8#372 /uacute 8#373 /ucircumflex 8#374 /udieresis 8#375 /yacute 8#376 /thorn 8#377 /ydieresis] def /Times-Roman /Times-Roman-iso isovec ReEncode /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n -1000 8851 m -1000 -1000 l 8340 -1000 l 8340 8851 l cp clip 0.01980 0.01980 sc /Times-Roman-iso ff 450.00 scf sf 2606 5505 m gs 1 -1 sc (W) col0 sh gr /Times-Roman-iso ff 330.00 scf sf 2966 5700 m gs 1 -1 sc (1) col0 sh gr /Times-Roman-iso ff 390.00 scf sf 3341 5475 m gs 1 -1 sc (+) col0 sh gr /Times-Roman-iso ff 450.00 scf sf 5981 5392 m gs 1 -1 sc (W) col0 sh gr /Times-Roman-iso ff 330.00 scf sf 6341 5587 m gs 1 -1 sc (2) col0 sh gr /Times-Roman-iso ff 450.00 scf sf 6716 5362 m gs 1 -1 sc (-) col0 sh gr % Arc 15.000 slw gs n 4152.5 5876.9 198.4 166.0 23.2 arcn gs col0 s gr gr % Arc gs n 5446.0 5881.6 151.6 174.9 10.8 arcn gs col0 s gr gr % Arc gs [45] 0 sd n 4152.1 6055.6 237.1 -150.8 -33.4 arc gs col0 s gr gr [] 0 sd % Arc gs [45] 0 sd n 5445.8 5919.0 151.1 -176.6 -9.1 arc gs col0 s gr gr [] 0 sd % Ellipse n 3405 5910 40 40 0 360 DrawEllipse gs 0.00 setgray ef gr gs col0 s gr % Ellipse n 6195 5895 40 40 0 360 DrawEllipse gs 0.00 setgray ef gr gs col0 s gr % Polyline 30.000 slw n 3600 7815 m 5775 7815 l gs col0 s gr % Polyline n 3225 6585 m 3225 7200 l 6390 7215 l 6390 6615 l 3210 6615 l gs col0 s gr % Polyline gs clippath 3345 6309 m 3405 6021 l 3465 6309 l 3465 5895 l 3345 5895 l cp clip n 3405 6645 m 3405 5940 l gs col0 s gr gr % arrowhead n 3345 6309 m 3405 6021 l 3465 6309 l 3405 6261 l 3345 6309 l cp gs 0.00 setgray ef gr col0 s % Polyline gs clippath 6255 6246 m 6195 6534 l 6135 6246 l 6135 6660 l 6255 6660 l cp clip n 6195 5940 m 6195 6615 l gs col0 s gr gr % arrowhead n 6255 6246 m 6195 6534 l 6135 6246 l 6195 6294 l 6255 6246 l cp gs 0.00 setgray ef gr col0 s % Polyline n 3915 7815 m 3913 7815 l 3910 7815 l 3903 7815 l 3892 7815 l 3877 7815 l 3857 7816 l 3833 7816 l 3803 7816 l 3769 7816 l 3731 7817 l 3690 7817 l 3645 7817 l 3599 7818 l 3551 7818 l 3503 7818 l 3454 7818 l 3406 7818 l 3360 7817 l 3316 7817 l 3273 7816 l 3233 7816 l 3195 7815 l 3160 7813 l 3128 7812 l 3098 7810 l 3070 7808 l 3045 7806 l 3022 7803 l 3000 7800 l 2967 7794 l 2937 7787 l 2910 7780 l 2886 7772 l 2865 7763 l 2846 7755 l 2829 7745 l 2813 7736 l 2798 7726 l 2783 7716 l 2769 7706 l 2754 7695 l 2739 7684 l 2724 7673 l 2707 7661 l 2690 7648 l 2673 7634 l 2655 7620 l 2639 7606 l 2624 7591 l 2609 7576 l 2593 7559 l 2578 7542 l 2563 7524 l 2547 7506 l 2532 7487 l 2517 7468 l 2501 7449 l 2486 7430 l 2471 7410 l 2457 7391 l 2442 7372 l 2429 7353 l 2416 7334 l 2403 7315 l 2391 7297 l 2380 7278 l 2370 7260 l 2360 7240 l 2350 7219 l 2342 7198 l 2334 7178 l 2327 7157 l 2320 7136 l 2313 7115 l 2307 7094 l 2301 7073 l 2296 7052 l 2290 7031 l 2285 7010 l 2281 6989 l 2276 6968 l 2273 6948 l 2269 6927 l 2267 6906 l 2265 6885 l 2264 6864 l 2264 6843 l 2265 6822 l 2267 6801 l 2269 6780 l 2271 6759 l 2274 6738 l 2277 6717 l 2281 6696 l 2285 6675 l 2289 6654 l 2293 6633 l 2297 6612 l 2302 6591 l 2307 6571 l 2312 6550 l 2318 6530 l 2325 6510 l 2332 6490 l 2341 6470 l 2350 6450 l 2359 6430 l 2369 6410 l 2379 6390 l 2389 6370 l 2400 6350 l 2411 6330 l 2422 6310 l 2434 6290 l 2445 6270 l 2457 6251 l 2469 6233 l 2481 6215 l 2494 6197 l 2507 6181 l 2520 6165 l 2534 6150 l 2549 6136 l 2564 6122 l 2579 6108 l 2595 6095 l 2612 6083 l 2628 6070 l 2645 6058 l 2662 6046 l 2679 6034 l 2696 6023 l 2713 6011 l 2730 6001 l 2748 5990 l 2765 5980 l 2783 5971 l 2801 5963 l 2820 5955 l 2839 5948 l 2858 5943 l 2877 5938 l 2896 5934 l 2914 5931 l 2932 5928 l 2950 5926 l 2968 5924 l 2986 5923 l 3005 5921 l 3024 5920 l 3044 5919 l 3065 5917 l 3087 5916 l 3111 5914 l 3137 5913 l 3165 5911 l 3195 5910 l 3217 5909 l 3241 5909 l 3267 5908 l 3295 5908 l 3326 5907 l 3359 5907 l 3395 5907 l 3433 5907 l 3474 5907 l 3516 5907 l 3561 5907 l 3606 5907 l 3651 5908 l 3696 5908 l 3739 5908 l 3779 5909 l 3816 5909 l 3849 5909 l 3877 5909 l 3900 5910 l 3918 5910 l 3930 5910 l 3939 5910 l 3943 5910 l 3945 5910 l gs col0 s gr % Polyline n 3945 5910 m 3945 5908 l 3945 5903 l 3945 5895 l 3945 5883 l 3944 5866 l 3944 5844 l 3944 5818 l 3943 5789 l 3943 5757 l 3943 5723 l 3942 5689 l 3942 5655 l 3942 5621 l 3942 5589 l 3942 5559 l 3942 5530 l 3942 5504 l 3943 5480 l 3943 5457 l 3944 5435 l 3945 5415 l 3946 5391 l 3948 5367 l 3949 5344 l 3951 5321 l 3952 5299 l 3953 5277 l 3954 5256 l 3955 5235 l 3956 5214 l 3957 5193 l 3958 5172 l 3960 5151 l 3963 5130 l 3966 5109 l 3971 5088 l 3976 5067 l 3982 5046 l 3990 5025 l 3998 5006 l 4007 4988 l 4017 4969 l 4028 4950 l 4039 4931 l 4052 4911 l 4065 4892 l 4078 4872 l 4092 4852 l 4106 4832 l 4120 4813 l 4134 4794 l 4148 4775 l 4162 4756 l 4176 4739 l 4190 4722 l 4204 4706 l 4218 4691 l 4231 4678 l 4245 4665 l 4263 4651 l 4280 4639 l 4299 4628 l 4317 4618 l 4337 4610 l 4356 4602 l 4375 4596 l 4395 4590 l 4415 4584 l 4434 4578 l 4453 4572 l 4473 4567 l 4491 4561 l 4510 4555 l 4527 4550 l 4545 4545 l 4562 4541 l 4580 4537 l 4598 4534 l 4618 4531 l 4639 4528 l 4662 4526 l 4685 4523 l 4709 4522 l 4731 4520 l 4752 4518 l 4769 4517 l 4783 4516 l 4792 4515 l 4798 4515 l 4800 4515 l gs col0 s gr % Polyline n 5656 7815 m 5658 7815 l 5661 7815 l 5668 7815 l 5679 7815 l 5694 7815 l 5714 7816 l 5738 7816 l 5768 7816 l 5802 7816 l 5840 7817 l 5881 7817 l 5926 7817 l 5972 7818 l 6020 7818 l 6068 7818 l 6117 7818 l 6165 7818 l 6211 7817 l 6255 7817 l 6298 7816 l 6338 7816 l 6376 7815 l 6411 7813 l 6443 7812 l 6473 7810 l 6501 7808 l 6526 7806 l 6549 7803 l 6571 7800 l 6604 7794 l 6634 7787 l 6661 7780 l 6685 7772 l 6706 7763 l 6725 7755 l 6742 7745 l 6758 7736 l 6773 7726 l 6788 7716 l 6802 7706 l 6817 7695 l 6832 7684 l 6847 7673 l 6864 7661 l 6881 7648 l 6898 7634 l 6916 7620 l 6932 7606 l 6947 7591 l 6962 7576 l 6978 7559 l 6993 7542 l 7008 7524 l 7024 7506 l 7039 7487 l 7054 7468 l 7070 7449 l 7085 7430 l 7100 7410 l 7114 7391 l 7129 7372 l 7142 7353 l 7155 7334 l 7168 7315 l 7180 7297 l 7191 7278 l 7201 7260 l 7211 7240 l 7221 7219 l 7229 7198 l 7237 7178 l 7244 7157 l 7251 7136 l 7258 7115 l 7264 7094 l 7270 7073 l 7275 7052 l 7281 7031 l 7286 7010 l 7290 6989 l 7295 6968 l 7298 6948 l 7302 6927 l 7304 6906 l 7306 6885 l 7307 6864 l 7307 6843 l 7306 6822 l 7304 6801 l 7302 6780 l 7300 6759 l 7297 6738 l 7294 6717 l 7290 6696 l 7286 6675 l 7282 6654 l 7278 6633 l 7274 6612 l 7269 6591 l 7264 6571 l 7259 6550 l 7253 6530 l 7246 6510 l 7239 6490 l 7230 6470 l 7221 6450 l 7212 6430 l 7202 6410 l 7192 6390 l 7182 6370 l 7171 6350 l 7160 6330 l 7149 6310 l 7137 6290 l 7126 6270 l 7114 6251 l 7102 6233 l 7090 6215 l 7077 6197 l 7064 6181 l 7051 6165 l 7037 6150 l 7022 6136 l 7007 6122 l 6992 6108 l 6976 6095 l 6959 6083 l 6943 6070 l 6926 6058 l 6909 6046 l 6892 6034 l 6875 6023 l 6858 6011 l 6841 6001 l 6823 5990 l 6806 5980 l 6788 5971 l 6770 5963 l 6751 5955 l 6732 5948 l 6713 5943 l 6694 5938 l 6675 5934 l 6657 5931 l 6639 5928 l 6621 5926 l 6603 5924 l 6585 5923 l 6566 5921 l 6547 5920 l 6527 5919 l 6506 5917 l 6484 5916 l 6460 5914 l 6434 5913 l 6406 5911 l 6376 5910 l 6354 5909 l 6330 5909 l 6304 5908 l 6276 5908 l 6245 5907 l 6212 5907 l 6176 5907 l 6138 5907 l 6097 5907 l 6055 5907 l 6010 5907 l 5965 5907 l 5920 5908 l 5875 5908 l 5832 5908 l 5792 5909 l 5755 5909 l 5722 5909 l 5694 5909 l 5671 5910 l 5653 5910 l 5641 5910 l 5632 5910 l 5628 5910 l 5626 5910 l gs col0 s gr % Polyline n 5611 5925 m 5611 5923 l 5611 5918 l 5611 5910 l 5611 5898 l 5612 5881 l 5612 5859 l 5612 5833 l 5613 5804 l 5613 5772 l 5613 5738 l 5614 5704 l 5614 5670 l 5614 5636 l 5614 5604 l 5614 5574 l 5614 5545 l 5614 5519 l 5613 5495 l 5613 5472 l 5612 5450 l 5611 5430 l 5610 5406 l 5608 5382 l 5607 5359 l 5605 5336 l 5604 5314 l 5602 5292 l 5601 5271 l 5599 5249 l 5598 5228 l 5596 5207 l 5594 5186 l 5592 5165 l 5589 5144 l 5586 5123 l 5582 5102 l 5578 5081 l 5572 5061 l 5566 5040 l 5559 5020 l 5551 4999 l 5542 4979 l 5533 4959 l 5523 4939 l 5512 4918 l 5501 4897 l 5490 4877 l 5479 4856 l 5467 4836 l 5455 4816 l 5443 4796 l 5431 4777 l 5419 4759 l 5407 4741 l 5395 4725 l 5383 4709 l 5370 4695 l 5355 4680 l 5340 4667 l 5324 4655 l 5308 4644 l 5291 4633 l 5275 4624 l 5258 4615 l 5241 4606 l 5223 4598 l 5206 4589 l 5189 4581 l 5171 4574 l 5154 4566 l 5136 4558 l 5118 4551 l 5100 4545 l 5081 4539 l 5062 4534 l 5040 4530 l 5016 4526 l 4991 4522 l 4963 4518 l 4933 4515 l 4903 4511 l 4874 4508 l 4848 4506 l 4826 4504 l 4808 4502 l 4796 4501 l 4789 4500 l 4786 4500 l gs col0 s gr % Polyline n 4350 5940 m 4350 5937 l 4350 5931 l 4350 5921 l 4350 5905 l 4350 5884 l 4350 5859 l 4351 5830 l 4351 5799 l 4351 5768 l 4351 5736 l 4351 5706 l 4351 5678 l 4351 5651 l 4351 5627 l 4351 5605 l 4350 5584 l 4350 5565 l 4349 5544 l 4349 5523 l 4348 5502 l 4346 5481 l 4344 5460 l 4342 5439 l 4340 5419 l 4338 5398 l 4335 5378 l 4333 5358 l 4332 5338 l 4331 5319 l 4331 5301 l 4331 5283 l 4333 5266 l 4335 5250 l 4339 5233 l 4344 5217 l 4349 5203 l 4356 5190 l 4363 5177 l 4370 5165 l 4378 5154 l 4386 5142 l 4394 5131 l 4402 5120 l 4411 5108 l 4420 5095 l 4430 5083 l 4440 5070 l 4450 5059 l 4460 5047 l 4471 5035 l 4482 5023 l 4494 5011 l 4506 4998 l 4518 4985 l 4530 4972 l 4543 4959 l 4556 4946 l 4568 4934 l 4581 4923 l 4594 4913 l 4608 4904 l 4621 4896 l 4635 4890 l 4651 4884 l 4668 4881 l 4686 4878 l 4704 4876 l 4723 4876 l 4741 4876 l 4760 4877 l 4779 4878 l 4798 4879 l 4817 4880 l 4836 4882 l 4854 4884 l 4872 4887 l 4890 4890 l 4905 4894 l 4921 4898 l 4936 4902 l 4952 4907 l 4968 4912 l 4984 4917 l 5000 4922 l 5016 4927 l 5032 4933 l 5048 4939 l 5063 4945 l 5078 4953 l 5092 4961 l 5106 4971 l 5118 4982 l 5130 4995 l 5140 5008 l 5149 5022 l 5157 5038 l 5165 5055 l 5173 5073 l 5180 5092 l 5187 5112 l 5194 5132 l 5201 5153 l 5207 5174 l 5213 5195 l 5219 5215 l 5225 5235 l 5231 5255 l 5236 5273 l 5241 5291 l 5246 5308 l 5250 5325 l 5254 5345 l 5258 5365 l 5260 5384 l 5262 5402 l 5262 5419 l 5263 5436 l 5263 5453 l 5263 5469 l 5263 5486 l 5263 5503 l 5263 5521 l 5264 5540 l 5264 5560 l 5265 5580 l 5265 5597 l 5266 5614 l 5266 5633 l 5266 5655 l 5266 5678 l 5266 5703 l 5266 5729 l 5266 5757 l 5266 5785 l 5266 5813 l 5265 5838 l 5265 5860 l 5265 5879 l 5265 5893 l 5265 5902 l 5265 5908 l 5265 5910 l gs col0 s gr % Polyline n 4365 5955 m 4367 5957 l 4371 5961 l 4378 5967 l 4388 5977 l 4401 5988 l 4415 6001 l 4431 6015 l 4446 6027 l 4462 6039 l 4478 6050 l 4495 6060 l 4512 6068 l 4530 6075 l 4546 6080 l 4563 6086 l 4581 6091 l 4600 6097 l 4620 6103 l 4641 6110 l 4663 6116 l 4686 6123 l 4708 6130 l 4731 6137 l 4754 6142 l 4777 6148 l 4799 6152 l 4821 6155 l 4843 6156 l 4864 6156 l 4885 6154 l 4905 6150 l 4923 6145 l 4942 6137 l 4962 6128 l 4983 6116 l 5005 6102 l 5029 6086 l 5054 6067 l 5080 6048 l 5107 6027 l 5134 6005 l 5160 5984 l 5184 5963 l 5206 5945 l 5225 5929 l 5240 5916 l 5252 5907 l 5259 5900 l 5263 5897 l 5265 5895 l gs col0 s gr % Polyline n 4080 6600 m 4080 6597 l 4081 6591 l 4082 6581 l 4083 6565 l 4085 6544 l 4088 6519 l 4090 6490 l 4093 6459 l 4096 6428 l 4099 6396 l 4101 6366 l 4104 6338 l 4106 6311 l 4107 6287 l 4109 6265 l 4109 6244 l 4110 6225 l 4110 6204 l 4110 6183 l 4110 6163 l 4109 6144 l 4108 6125 l 4106 6106 l 4105 6088 l 4103 6070 l 4102 6052 l 4100 6034 l 4098 6015 l 4097 5996 l 4096 5976 l 4096 5955 l 4095 5933 l 4095 5910 l 4095 5891 l 4095 5871 l 4095 5851 l 4096 5830 l 4096 5809 l 4096 5787 l 4096 5765 l 4096 5742 l 4097 5719 l 4097 5696 l 4097 5673 l 4098 5650 l 4098 5627 l 4099 5604 l 4100 5582 l 4101 5560 l 4103 5538 l 4105 5517 l 4107 5496 l 4110 5475 l 4113 5454 l 4117 5434 l 4121 5414 l 4125 5394 l 4129 5374 l 4134 5354 l 4139 5334 l 4144 5314 l 4149 5294 l 4154 5274 l 4159 5254 l 4165 5234 l 4170 5215 l 4176 5195 l 4182 5176 l 4188 5157 l 4194 5139 l 4201 5120 l 4208 5102 l 4215 5085 l 4224 5066 l 4233 5048 l 4242 5029 l 4251 5011 l 4261 4993 l 4270 4975 l 4280 4957 l 4289 4939 l 4299 4922 l 4309 4904 l 4320 4887 l 4330 4870 l 4342 4854 l 4354 4839 l 4366 4824 l 4380 4810 l 4394 4797 l 4410 4785 l 4425 4775 l 4441 4766 l 4458 4758 l 4476 4751 l 4495 4743 l 4514 4736 l 4534 4730 l 4554 4723 l 4575 4717 l 4596 4711 l 4617 4706 l 4638 4701 l 4659 4696 l 4680 4691 l 4701 4687 l 4721 4684 l 4741 4682 l 4761 4680 l 4780 4679 l 4800 4680 l 4820 4682 l 4839 4685 l 4859 4689 l 4879 4693 l 4899 4699 l 4920 4706 l 4941 4713 l 4962 4720 l 4982 4728 l 5003 4736 l 5024 4744 l 5045 4753 l 5065 4762 l 5085 4771 l 5104 4780 l 5123 4789 l 5141 4799 l 5158 4809 l 5175 4819 l 5190 4830 l 5206 4843 l 5221 4857 l 5236 4871 l 5250 4885 l 5263 4901 l 5276 4916 l 5288 4931 l 5300 4947 l 5312 4963 l 5323 4979 l 5335 4996 l 5346 5013 l 5356 5031 l 5366 5049 l 5376 5068 l 5385 5087 l 5393 5108 l 5400 5130 l 5405 5149 l 5409 5169 l 5413 5189 l 5416 5211 l 5419 5233 l 5421 5256 l 5422 5279 l 5424 5304 l 5424 5328 l 5425 5353 l 5426 5378 l 5426 5403 l 5426 5428 l 5426 5453 l 5427 5478 l 5427 5502 l 5428 5526 l 5428 5550 l 5429 5573 l 5429 5596 l 5430 5618 l 5430 5640 l 5430 5664 l 5430 5687 l 5430 5711 l 5430 5733 l 5429 5756 l 5429 5778 l 5428 5800 l 5427 5822 l 5426 5843 l 5425 5865 l 5423 5887 l 5422 5908 l 5421 5930 l 5420 5952 l 5419 5974 l 5418 5997 l 5417 6019 l 5417 6043 l 5416 6066 l 5415 6090 l 5414 6112 l 5414 6135 l 5413 6159 l 5412 6185 l 5411 6212 l 5410 6241 l 5410 6273 l 5409 6306 l 5408 6340 l 5407 6375 l 5405 6410 l 5405 6444 l 5404 6477 l 5403 6507 l 5402 6533 l 5401 6555 l 5401 6572 l 5400 6585 l 5400 6593 l 5400 6598 l 5400 6600 l gs col0 s gr $F2psEnd rs %%EndDocument @endspecial 1088 3522 a FP(Figure)k(4.7.)40 b FQ(The)28 b(tangle)f FJ(T)2059 3534 y FI(t)2116 3522 y FQ(and)g(the)h(surface)f (\006)2760 3534 y FI(t)2789 3522 y FQ(.)605 3725 y(Note)e(that)g(some)f (of)g(the)h(surfaces)f(\006)1786 3737 y FI(t)1839 3725 y FQ(are)g(homeomorphic.)35 b(What)25 b(is)f(more)g(imp)r(ortan)n(t)456 3825 y(is)g(that)g(ev)n(ery)f FL(C)5 b FQ(-mark)n(ed)22 b(surface)h(is)h(\(not)h(canonically\))e(isomorphic)g(to)h(at)g(least)f (one)h(of)g(\006)3392 3837 y FI(t)3421 3825 y FQ(.)605 3924 y(F)-7 b(or)28 b(a)g(t)n(yp)r(e)g FJ(t)p FQ(,)h(w)n(e)f(de\014ne)p 1458 3863 30 4 v 29 w FJ(t)g FQ(to)g(b)r(e)h(obtained)f(b)n(y)g(rev)n (ersing)e(the)j(order)e(of)h(terms)g(in)h(the)456 4024 y(sequence)21 b(and)h(replacing)e(ev)n(ery)h FJ(")1552 4036 y FI(i)1601 4024 y FQ(b)n(y)h FL(\000)p FJ(")1815 4036 y FI(i)1842 4024 y FQ(.)35 b(F)-7 b(or)21 b(example,)h(for)g FJ(t)h FQ(=)f(\(\()p FJ(W)2790 4036 y FM(1)2829 4024 y FJ(;)14 b FQ(+\))p FJ(;)g(H)r(;)g FQ(\()p FJ(W)3218 4036 y FM(2)3255 4024 y FJ(;)g FL(\000)p FQ(\)\),)456 4124 y(w)n(e)37 b(ha)n(v)n(e)p 791 4063 V 38 w FJ(t)j FQ(=)h(\(\()p FJ(W)1109 4136 y FM(2)1147 4124 y FJ(;)14 b FQ(+\))p FJ(;)g(H)r(;)g FQ(\()p FJ(W)1536 4136 y FM(1)1574 4124 y FJ(;)g FL(\000)p FQ(\)\).)69 b(Then)38 b(w)n(e)g(ha)n(v)n(e)f(a) h(canonical)f(homeomorphism)456 4230 y FJ(r)r(ev)574 4242 y FI(t)613 4230 y FQ(:)p 663 4164 90 4 v 27 w(\006)723 4242 y FI(t)804 4183 y FE(\030)776 4230 y FL(\000)-40 b(!)23 b FQ(\006)p 967 4207 30 3 v 22 x FI(t)1023 4230 y FQ(giv)n(en)i(b)n(y)h(re\015ection)g(in)h(the)g(v)n(ertical)e(plane)h FJ(x)d FQ(=)g(0,)j(and)g FJ(r)r(ev)2990 4242 y FI(t)3036 4230 y FL(\016)16 b FJ(r)r(ev)p 3212 4207 V 22 x FI(t)3265 4230 y FQ(=)22 b(id.)605 4330 y(In)27 b(order)e(to)i(construct)f(a)g (TQFT,)h(w)n(e)f(will)h(construct)f(\014rst)h(an)f(auxiliary)f(TQFT)i (with)456 4430 y(\\parameterized)h(manifolds".)45 b(The)31 b(2-manifolds)e(in)i(this)g(TQFT)f(will)h(b)r(e)g FL(C)5 b FQ(-mark)n(ed)28 b(sur-)456 4529 y(faces)f(\006)g(together)g(with)h (a)f(parameterization)f FJ(')p FQ(,)i(i.e.,)g(an)f(isomorphism)1516 4672 y FJ(')9 b FQ(:)28 b(\006)1742 4625 y FE(\030)1713 4672 y FL(\000)-39 b(!)23 b FQ(\006)1905 4684 y FI(t)1930 4692 y FF(1)1985 4672 y FL(t)c(\001)14 b(\001)g(\001)k(t)h FQ(\006)2308 4684 y FI(t)2333 4693 y FG(l)2361 4672 y FJ(:)-1928 b FQ(\(4.4.2\))456 4817 y(Homeomorphisms)25 b(are)g(homeomorphisms)g(preserving)g(these)h(parameterizations)e (\(whic)n(h)456 4917 y(essen)n(tially)k(kills)h(all)g(non-trivial)f (homeomorphisms:)39 b(the)30 b(only)f(automorphisms)f(of)h(a)g(pa-)456 5016 y(rameterized)20 b(surface)g(are)g(p)r(erm)n(utations)g(of)h(comp) r(onen)n(ts)g(of)g(the)g(same)g(t)n(yp)r(e\).)35 b(The)21 b(param-)456 5116 y(eterized)g(3-manifolds)g(will)i(b)r(e)f FL(C)5 b FQ(-mark)n(ed)20 b(3-manifolds)h(equipp)r(ed)i(with)g (parameterizations)456 5216 y(of)k(their)h(b)r(oundaries.)p eop %%Page: 85 15 85 88 bop 1538 226 a FM(4.4.)29 b(3D)g(TQFT)h(FR)n(OM)f(MTC)994 b(85)605 425 y FQ(W)-7 b(e)22 b(claim)g(that)g(if)h(w)n(e)e(construct)h (a)f(TQFT)h(for)f(the)h(parameterized)f(manifolds)g(then)i(w)n(e)456 525 y(automatically)g(get)i(a)g(TQFT)f(for)h(non-parameterized)e (manifolds.)35 b(Indeed,)26 b(let)f(us)g(assume)456 624 y(that)34 b(w)n(e)g(ha)n(v)n(e)e(constructed)i(a)g(\\parameterized")d (TQFT;)j(in)g(particular,)h(for)e(ev)n(ery)g(pair)456 727 y(\(\006)p FJ(;)14 b(')p FQ(\),)37 b(where)d(\006)h(is)g(a)f FL(C)5 b FQ(-mark)n(ed)33 b(surface)h(and)h FJ(')g FQ(is)g(a)f (homeomorphism)g(\006)3085 680 y FE(\030)3057 727 y FL(\000)-39 b(!)35 b FQ(\006)3261 739 y FI(t)3290 727 y FQ(,)i(w)n(e)456 833 y(ha)n(v)n(e)30 b(a)i(v)n(ector)f(space)g FJ(\034)9 b FQ(\(\006)p FJ(;)14 b(')p FQ(\).)52 b(Let)32 b FJ(f)41 b FQ(b)r(e)32 b(a)g(homeomorphism)e FJ(f)18 b FQ(:)29 b(\006)2764 845 y FI(t)2852 786 y FE(\030)2824 833 y FL(\000)-39 b(!)30 b FQ(\006)3023 845 y FI(t)3052 833 y FQ(.)50 b(Consider)456 933 y(the)33 b(cylinder)f FJ(M)41 b FQ(=)31 b(\006)22 b FL(\002)f FQ([0)p FJ(;)14 b FQ(1])32 b(with)h(the)h(parameterization)c(of)j(its)g(b)r(oundary)f(c)n(hosen)g (as)456 1033 y(follo)n(ws:)1393 1185 y FJ(@)5 b(M)31 b FQ(=)p 1642 1118 60 4 v 23 w(\006)18 b FL(t)h FQ(\006)1905 1130 y FI(')p FE(t)p FM(\()p FI(f)7 b FE(\016)p FI(')p FM(\))1877 1185 y FL(\000)-19 b(\000)g(\000)h(\000)f(\000)f(!)p 2214 1118 90 4 v 24 w FQ(\006)2274 1197 y FI(t)2321 1185 y FL(t)19 b FQ(\006)2455 1197 y FI(t)2484 1185 y FJ(:)456 1322 y FQ(This)27 b(giv)n(es)g(us)g(an)g(op)r(erator)1323 1462 y FJ(f)1364 1474 y FE(\003)1424 1462 y FQ(=)c FJ(\034)9 b FQ(\()p FJ(M)g FQ(\))g(:)29 b FJ(\034)9 b FQ(\(\006)p FJ(;)14 b(')p FQ(\))2085 1415 y FE(\030)2056 1462 y FL(\000)-39 b(!)23 b FJ(\034)9 b FQ(\(\006)p FJ(;)14 b(f)28 b FL(\016)18 b FJ(')p FQ(\))456 1604 y(and)24 b(it)g(follo)n(ws)f(from)h(the)h (gluing)f(axiom)f(that)h(\()p FJ(f)9 b(g)s FQ(\))2117 1616 y FE(\003)2178 1604 y FQ(=)23 b FJ(f)2307 1616 y FE(\003)2345 1604 y FJ(g)2385 1616 y FE(\003)2423 1604 y FQ(,)i(id)2540 1616 y FE(\003)2601 1604 y FQ(=)e(id)h(\(compare)f (with)i(the)456 1704 y(pro)r(of)g(of)h(Theorem)f(4.2.3\).)35 b(T)-7 b(aking)25 b(tensor)g(pro)r(duct,)h(w)n(e)g(can)g(de\014ne)g FJ(f)2782 1716 y FE(\003)2845 1704 y FQ(for)g(a)f(homeomor-)456 1804 y(phism)j(of)f(disjoin)n(t)h(union)f(of)h(\006)1476 1816 y FI(t)1505 1804 y FQ('s.)605 1906 y(This)i(allo)n(ws)f(us)i(to)f (construct)g(canonical)f(isomorphisms)g FJ(f)2558 1918 y FI('; )2680 1906 y FQ(:)g FJ(\034)9 b FQ(\(\006)p FJ(;)14 b( )s FQ(\))3052 1859 y FE(\030)3024 1906 y FL(\000)-40 b(!)28 b FJ(\034)9 b FQ(\(\006)p FJ(;)14 b(')p FQ(\),)456 2005 y(whic)n(h)34 b(satisfy)g(the)g(compatibilit)n(y)g(condition)h FJ(f)2042 2017 y FI(')2086 2025 y FF(1)2117 2017 y FI(;')2181 2025 y FF(2)2217 2005 y FJ(f)2258 2017 y FI(')2302 2025 y FF(2)2334 2017 y FI(;')2398 2025 y FF(3)2468 2005 y FQ(=)f FJ(f)2608 2017 y FI(')2652 2025 y FF(1)2684 2017 y FI(;')2748 2025 y FF(3)2784 2005 y FQ(.)57 b(In)34 b(this)h(case,)g(w)n(e)456 2105 y(can)j(iden)n(tify)h(all)g(these)f (spaces)g(with)h(eac)n(h)f(other,)j(th)n(us)e(forming)f(a)h(space)e FJ(\034)9 b FQ(\(\006\))41 b(whic)n(h)456 2205 y(is)f(canonically)f (isomorphic)g(to)h(eac)n(h)g(of)g FJ(\034)9 b FQ(\(\006)p FJ(;)14 b(')p FQ(\))42 b(\(compare)d(with)i(the)g(construction)e(in)456 2304 y(De\014nition)28 b(1.1.11\).)605 2404 y(No)n(w)38 b(let)g FJ(M)47 b FQ(b)r(e)39 b(a)f FL(C)5 b FQ(-mark)n(ed)36 b(3-manifold.)69 b(Cho)r(ose)37 b(a)h(parameterization)e FJ(')j FQ(of)f(its)456 2504 y(b)r(oundary)e(\006)j(=)g FJ(@)5 b(M)46 b FQ(\(see)37 b(\(4.4.2\))o(\).)67 b(Then)37 b FJ(\034)9 b FQ(\()p FJ(M)t(;)14 b(')p FQ(\))39 b(is)e(a)g(v)n(ector)f (in)i(the)f(v)n(ector)f(space)456 2603 y FJ(\034)9 b FQ(\()p FJ(@)c(M)t(;)14 b(')p FQ(\).)46 b(Iden)n(tifying)31 b FJ(\034)9 b FQ(\(\006\))28 b(=)g FJ(\034)9 b FQ(\(\006)p FJ(;)14 b(')p FQ(\),)32 b(w)n(e)e(get)g(a)g(v)n(ector)f FJ(\034)9 b FQ(\()p FJ(M)g FQ(\))29 b FL(2)f FJ(\034)9 b FQ(\(\006\);)33 b(it)e(is)f(easy)g(to)456 2703 y(see)d(that)h(this)g (v)n(ector)e(do)r(es)h(not)h(dep)r(end)g(on)f(the)h(c)n(hoice)f(of)h FJ(')p FQ(.)605 2802 y(It)h(is)f(straigh)n(tforw)n(ard)d(to)k(c)n(hec)n (k)e(all)h(the)h(axioms)e(of)i(a)f(3D)g(TQFT.)g(Th)n(us,)h(from)f(ev)n (ery)456 2902 y(\\parameterized")36 b(TQFT)j(one)g(can)f(automatically) g(construct)h(a)g(\\non-parameterized")456 3002 y(TQFT.)605 3101 y FK(Step)32 b(2.)42 b(Reducing)31 b(to)g(closed)g(manifolds.)605 3201 y FQ(No)n(w)23 b(w)n(e)g(are)f(going)g(to)h(construct)f(a)h(TQFT)g (based)g(on)f(parameterized)g(manifolds.)35 b(Let)456 3301 y(us)27 b(start)g(b)n(y)g(de\014ning)h(the)g(spaces)f FJ(\034)9 b FQ(\(\006)1725 3313 y FI(t)1755 3301 y FQ(\))23 b FL(\021)g FJ(\034)9 b FQ(\(\006)2035 3313 y FI(t)2065 3301 y FJ(;)14 b FQ(id\).)37 b(F)-7 b(or)27 b FJ(t)h FQ(giv)n(en)f(b)n(y)h(\(4.4.1\))o(,)g(let)1194 3438 y FJ(W)1272 3450 y FI(t)1325 3438 y FQ(=)22 b FJ(W)1502 3401 y FI(")1533 3409 y FF(1)1490 3460 y FM(1)1589 3438 y FL(\012)c FJ(W)1762 3401 y FI(")1793 3409 y FF(2)1750 3460 y FM(2)1848 3438 y FL(\012)g FJ(H)25 b FL(\012)18 b FJ(W)2198 3401 y FI(")2229 3409 y FF(3)2186 3460 y FM(3)2284 3438 y FL(\012)g FJ(H)26 b FL(\012)18 b(\001)c(\001)g(\001)27 b FJ(;)-2236 b FQ(\(4.4.3\))456 3580 y(where)27 b FJ(W)786 3550 y FI(")845 3580 y FQ(=)d FJ(W)40 b FQ(if)29 b FJ(")23 b FQ(=)h(+)j(and)h FJ(W)1624 3550 y FE(\003)1690 3580 y FQ(if)h FJ(")24 b FQ(=)f FL(\000)p FQ(,)28 b(and)g(as)f(b)r(efore,)h FJ(H)j FQ(=)2759 3518 y Fy(L)2851 3605 y FI(i)p FE(2)p FI(I)2972 3580 y FJ(V)3020 3592 y FI(i)3066 3580 y FL(\012)19 b FJ(V)3217 3550 y FE(\003)3198 3602 y FI(i)3255 3580 y FQ(|see)456 3680 y(\(2.4.9\))o(.)37 b(Then)28 b(w)n(e)f(de\014ne)1376 3817 y FJ(\034)9 b FQ(\(\006)1513 3829 y FI(t)1543 3817 y FQ(\))23 b(:=)g(Hom)1882 3829 y FE(C)1925 3817 y FQ(\()p FK(1)p FJ(;)14 b(W)2120 3829 y FI(t)2149 3817 y FQ(\))24 b(=:)e FL(h)p FJ(W)2425 3829 y FI(t)2455 3817 y FL(i)p FJ(;)-2054 b FQ(\(4.4.4\))456 3975 y(F)-7 b(or)29 b(a)g FL(C)5 b FQ(-mark)n(ed)28 b(surface)h(\006)g(along)g(with)h(a)f (parameterization)f(\006)2668 3928 y FE(\030)2640 3975 y FL(\000)-40 b(!)27 b FQ(\006)2835 3987 y FI(t)2860 3995 y FF(1)2916 3975 y FL(t)20 b(\001)14 b(\001)g(\001)20 b(t)g FQ(\006)3243 3987 y FI(t)3268 3996 y FG(l)3296 3975 y FQ(,)31 b(w)n(e)456 4075 y(let)d FJ(\034)9 b FQ(\(\006\))24 b(=)e FJ(\034)9 b FQ(\(\006)993 4087 y FI(t)1018 4095 y FF(1)1056 4075 y FQ(\))19 b FL(\012)f(\001)c(\001)g(\001)k(\012)g FJ(\034)9 b FQ(\(\006)1525 4087 y FI(t)1550 4096 y FG(l)1579 4075 y FQ(\).)605 4182 y(Next,)42 b(let)e(us)f(construct)g(an)f (isomorphism)g FJ(\034)9 b FQ(\(\006)2232 4194 y FI(t)2263 4182 y FQ(\))2295 4152 y FE(\003)2404 4135 y(\030)2375 4182 y FL(\000)-39 b(!)42 b FJ(\034)9 b FQ(\(\006)p 2663 4159 30 3 v 21 x FI(t)2693 4182 y FQ(\).)72 b(Let)39 b FJ(')9 b FQ(:)32 b FK(1)42 b FL(!)h FJ(W)3392 4194 y FI(t)3421 4182 y FQ(,)456 4281 y FJ( )12 b FQ(:)28 b FK(1)22 b FL(!)i FJ(W)p 828 4259 V 22 x FI(t)857 4281 y FQ(.)37 b(De\014ne)28 b(\()p FJ(';)14 b( )s FQ(\))24 b FL(2)g FJ(k)30 b FQ(b)n(y)1266 4448 y(\()p FJ(';)14 b( )s FQ(\))24 b(=)e FJ(D)1660 4414 y FE(\000)p FI(g)1751 4448 y FQ(\()p FK(1)1882 4397 y FI(')p FE(\012)p FI( )1854 4448 y FL(\000)-30 b(\000)-19 b(\000)-31 b(!)23 b FJ(W)2153 4460 y FI(t)2202 4448 y FL(\012)18 b FJ(W)p 2363 4425 V 22 x FI(t)2444 4400 y(e)2475 4408 y FG(t)2415 4448 y FL(\000)-32 b(!)23 b FK(1)p FQ(\))-2178 b(\(4.4.5\))456 4601 y(where)40 b FJ(e)748 4613 y FI(t)819 4601 y FQ(is)h(the)h(tensor) f(pro)r(duct)g(of)g(the)h(ev)-5 b(aluation)41 b(maps)g FJ(W)2661 4564 y FI(")2692 4572 y FG(i)2649 4624 y FI(i)2750 4601 y FL(\012)28 b FJ(W)2933 4564 y FE(\000)p FI(")3016 4572 y FG(i)2921 4624 y FI(i)3092 4601 y FL(!)46 b FK(1)c FQ(and)456 4701 y(renormalized)27 b(ev)-5 b(aluation)29 b(maps)f FJ(e)1609 4713 y FI(H)1672 4701 y FQ(\()p FJ(\021)23 b FL(\012)c FQ(id\))9 b(:)29 b FJ(H)d FL(\012)19 b FJ(H)32 b FL(!)26 b FK(1)p FQ(.)41 b(Here)29 b FJ(e)2752 4713 y FI(H)2844 4701 y FQ(is)g(the)g(ev)-5 b(aluation)456 4808 y(map)23 b(induced)g(b)n(y)g(the)h(iden)n(ti\014cation)f FJ(H)1813 4761 y FE(\030)1785 4808 y FL(\000)-40 b(!)24 b FJ(H)1993 4777 y FE(\003)2054 4808 y FQ(\(see)f(\(2.4.9\))o(\),)i (and)e FJ(\021)s FL(j)2755 4820 y FI(V)2794 4828 y FG(i)2821 4820 y FE(\012)p FI(V)2926 4800 y Fx(\003)2912 4839 y FG(i)2988 4808 y FQ(=)g FJ(d)3119 4772 y FE(\000)p FM(1)3119 4831 y FI(i)3222 4808 y FQ(id.)35 b(As)456 4910 y(b)r(efore,)25 b(w)n(e)g(denote)g(b)n(y)g FJ(d)1267 4922 y FI(i)1320 4910 y FQ(the)g(\(quan)n(tum\))h(dimension)f(of)g FJ(V)2403 4922 y FI(i)2431 4910 y FQ(,)h(and)f FJ(D)i FQ(is)e(giv)n(en)g(b)n(y)h (\(3.1.15\))n(.)605 5009 y(One)39 b(easily)f(c)n(hec)n(ks)h(that)g(the) h(pairing)f(\(4.4.5\))g(is)g(nondegenerate)f(and)h(symmetric.)456 5116 y(Th)n(us,)27 b(w)n(e)g(ha)n(v)n(e)f(iden)n(ti\014cations)h FJ(\034)9 b FQ(\()p 1612 5049 90 4 v(\006)1672 5128 y FI(t)1703 5116 y FQ(\))1786 5069 y FE(\030)1758 5116 y FL(\000)-40 b(!)24 b FJ(\034)9 b FQ(\(\006)2027 5128 y FI(t)2057 5116 y FQ(\))2089 5086 y FE(\003)2127 5116 y FQ(.)37 b(W)-7 b(e)28 b(extend)g(them)g(to)f(disjoin)n(t)h(unions)456 5216 y(of)f(\006)610 5228 y FI(t)667 5216 y FQ(in)h(an)f(ob)n(vious)f (w)n(a)n(y)-7 b(.)p eop %%Page: 86 16 86 89 bop 456 226 a FM(86)404 b(4.)29 b(3-DIMENSIONAL)g(TOPOLOGICAL)h (QUANTUM)f(FIELD)g(THEOR)-5 b(Y)605 425 y FQ(No)n(w,)24 b(let)g(us)f(construct)g(for)h(ev)n(ery)e(parameterized)g FL(C)5 b FQ(-mark)n(ed)22 b(3-manifold)g FJ(M)33 b FQ(a)23 b(v)n(ector)456 525 y FJ(\034)9 b FQ(\()p FJ(M)g FQ(\))26 b FL(2)f FJ(\034)9 b FQ(\()p FJ(@)c(M)k FQ(\).)42 b(The)29 b(main)g(idea)g(is,)g(of)g(course,)f(to)h(reduce)f(ev)n(erything)g(to)h (in)n(v)-5 b(arian)n(ts)28 b(of)456 624 y(closed)f(manifolds.)36 b(This)28 b(can)f(b)r(e)h(done)f(as)g(follo)n(ws.)605 724 y(Let)d(us)g(de\014ne)g(a)f FO(sp)l(e)l(cial)i FQ(link)f(to)g(b)r (e)g(a)g(ribb)r(on)f(link)h FJ(X)30 b FQ(\(whic)n(h)25 b(ma)n(y)e(con)n(tain)g(coup)r(ons\),)456 824 y(with)29 b(some)e(of)i(the)f(strands)g(and)g(coup)r(ons)g(colored)f(b)n(y)h(ob)5 b(jects,)28 b(resp)r(ectiv)n(ely)-7 b(,)28 b(morphisms)456 923 y(from)f FL(C)32 b FQ(and)c(suc)n(h)f(that)h(the)g(follo)n(wing)e (condition)i(holds:)605 1023 y(|)35 b(an)n(y)g(uncolored)f(strand)h(is) g(either)g(an)g(ann)n(ulus,)i(or)d(has)h(b)r(oth)h(ends)f(at)g(the)h (same)456 1123 y(uncolored)26 b(coup)r(on,)h(in)h(whic)n(h)g(case)f (these)g(ends)h(are)e(next)i(to)g(eac)n(h)e(other,)605 1222 y(|)i(all)f(uncolored)f(coup)r(ons)i(are)e(of)i(the)g(form)f FJ(T)2152 1234 y FI(t)2181 1222 y FQ(.)456 1322 y(Examples)f(of)i(sp)r (ecial)f(links)g(can)h(b)r(e)g(found)g(in)f(the)h(next)g(section.)605 1421 y(Let)37 b FJ(X)44 b FQ(b)r(e)37 b(a)f(sp)r(ecial)h(link,)j(with)d (uncolored)f(coup)r(ons)g(of)h(t)n(yp)r(es)g FJ(t)2834 1433 y FM(1)2871 1421 y FJ(;)14 b(:)g(:)g(:)g(;)g(t)3086 1433 y FI(k)3127 1421 y FQ(.)65 b(De\014ne)456 1528 y(its)40 b(Reshetikhin{T)-7 b(uraev)40 b(in)n(v)-5 b(arian)n(t)39 b FJ(F)1775 1498 y FE(\000)p FM(1)1864 1528 y FQ(\()p FJ(X)7 b FQ(\))45 b FL(2)g FQ(\()2181 1466 y Fy(N)2273 1486 y FI(k)2273 1553 y(i)p FM(=1)2385 1528 y FL(h)p FJ(W)2495 1540 y FI(t)2520 1548 y FG(i)2551 1528 y FL(i)p FQ(\))2615 1498 y FE(\003)2695 1528 y FQ(as)40 b(follo)n(ws.)74 b(F)-7 b(or)40 b(an)n(y)456 1628 y(collection)30 b FJ(')882 1640 y FI(i)939 1628 y FL(2)g(h)p FJ(W)1134 1640 y FI(t)1159 1648 y FG(i)1190 1628 y FL(i)p FQ(,)j(let)e(us)g(denote)h(b)n(y)f FJ(T)12 b FQ(\()p FJ(')2049 1640 y FM(1)2085 1628 y FJ(;)i(:)g(:)g(:)g (;)g(')2324 1640 y FI(k)2365 1628 y FQ(\))32 b(the)f(ribb)r(on)g(link)h (obtained)f(b)n(y)456 1727 y(coloring)25 b(eac)n(h)i(uncolored)g(coup)r (on)g(b)n(y)g(the)h(corresp)r(onding)e FJ(')p FQ(.)37 b(Then)28 b(w)n(e)f(write)1049 1887 y FJ(F)1114 1853 y FE(\000)p FM(1)1203 1887 y FQ(\()p FJ(X)7 b FQ(\)\()p FJ(')1429 1899 y FM(1)1466 1887 y FJ(;)14 b(:)g(:)g(:)g(;)g(')1705 1899 y FI(k)1746 1887 y FQ(\))23 b(=)1889 1808 y Fy(X)1934 1983 y FI(c)2023 1887 y FJ(d)2066 1899 y FI(c)2100 1887 y FJ(F)2165 1853 y FE(\000)p FM(1)2254 1887 y FQ(\()p FJ(T)12 b FQ(\()p FJ(')2433 1899 y FM(1)2470 1887 y FJ(;)i(:)g(:)g(:)g (;)g(')2709 1899 y FI(k)2750 1887 y FQ(\)\))p FJ(;)456 2105 y FQ(where)35 b(the)h(sum)f(is)h(tak)n(en)f(o)n(v)n(er)e(all)j (colorings)d FJ(c)j FQ(of)f(uncolored)f(strands)h FJ(c)9 b FQ(:)31 b FJ(U)45 b FL(!)36 b FJ(I)7 b FQ(,)38 b(and)456 2205 y FJ(d)499 2217 y FI(c)561 2205 y FQ(=)653 2143 y Fy(Q)732 2230 y FI(u)p FE(2)p FI(U)885 2205 y FJ(d)928 2220 y FI(c)p FM(\()p FI(u)p FM(\))1084 2205 y FQ(where)30 b FJ(U)39 b FQ(is)30 b(the)h(set)g(of)f(all)h(uncolored)e(strands.)45 b(This)30 b(generalizes)f(the)456 2305 y(con)n(v)n(en)n(tions)c(of)j (Chapter)f(3.)605 2404 y(The)40 b(crucial)f(observ)-5 b(ation)38 b(is)h(that)h(ev)n(ery)f(connected)g FL(C)5 b FQ(-mark)n(ed)38 b(parameterized)g(3-)456 2504 y(manifold)23 b FJ(M)32 b FQ(can)23 b(b)r(e)h(obtained)f(from)g FJ(S)1750 2474 y FM(3)1811 2504 y FQ(b)n(y)g(a)g(surgery)f(along)g(some)h(sp)r (ecial)g(link)g FJ(X)7 b FQ(.)35 b(More)456 2604 y(precisely)-7 b(,)39 b(let)f FJ(X)44 b FQ(b)r(e)38 b(a)g(sp)r(ecial)f(link)h(in)g FH(R)1885 2573 y FM(3)1968 2604 y FL(\032)i FJ(S)2129 2573 y FM(3)2166 2604 y FQ(,)g(with)e(uncolored)f(coup)r(ons)g(of)h(t)n (yp)r(es)456 2703 y FJ(t)486 2715 y FM(1)523 2703 y FJ(;)14 b(:)g(:)g(:)f(;)h(t)737 2715 y FI(k)778 2703 y FQ(.)36 b(Eac)n(h)22 b(suc)n(h)h(coup)r(on)h(determines)f(an)g(em)n(b)r(edding) h(of)g(the)g(standard)e(handleb)r(o)r(dy)456 2803 y FJ(M)537 2815 y FI(t)565 2803 y FQ(,)28 b(de\014ned)g(in)g(Step)g(1,)f(in)n(to)h FH(R)1503 2773 y FM(3)1546 2803 y FQ(.)37 b(De\014ne)1579 2963 y FJ(M)1660 2975 y FI(X)1746 2963 y FQ(=)22 b FJ(M)1914 2975 y FI(L)1982 2963 y FL(n)2042 2884 y Fy([)2148 2963 y FJ(M)2229 2975 y FI(t)2254 2983 y FG(i)2284 2963 y FJ(;)456 3123 y FQ(where)i FJ(L)h FQ(is)g(the)g(ribb)r(on)g(link)h (formed)f(b)n(y)f(all)h(uncolored)f(ann)n(uli)h(of)g FJ(X)7 b FQ(.)36 b(In)25 b(other)g(w)n(ords,)f(w)n(e)456 3223 y(\014rst)c(do)g(surgery)f(along)h(all)g(uncolored)f(ann)n(uli)i (and)f(then)i(remo)n(v)n(e)c(from)j(the)g(obtained)f(closed)456 3322 y(manifold)f(neigh)n(b)r(orho)r(o)r(ds)g(of)g(uncolored)g(coup)r (ons.)33 b(This)20 b(giv)n(es)e(a)i FL(C)5 b FQ(-mark)n(ed)17 b(manifold)j(with)456 3422 y(b)r(oundary)26 b(whic)n(h)i(is)f (canonically)g(iden)n(ti\014ed)h(with)g FL(t)p 2188 3355 60 4 v FQ(\006)2248 3434 y FI(t)2273 3442 y FG(i)2304 3422 y FQ(.)605 3521 y(W)-7 b(e)32 b(let)g FJ(\034)9 b FQ(\()p FJ(M)1034 3533 y FI(X)1097 3521 y FQ(\))30 b(=)g FJ(F)1319 3491 y FE(\000)p FM(1)1408 3521 y FQ(\()p FJ(X)7 b FQ(\))29 b FL(2)h FQ(\()1694 3459 y Fy(N)1787 3521 y FL(h)p FJ(W)1897 3533 y FI(t)1922 3541 y FG(i)1953 3521 y FL(i)p FQ(\))2017 3491 y FE(\003)2085 3521 y FL(')2180 3459 y Fy(N)2272 3521 y FL(h)p FJ(W)p 2382 3498 56 3 v 22 x FI(t)2407 3551 y FG(i)2438 3521 y FL(i)p FQ(,)j(where)e(w)n(e)g (use)h(the)f(pairing)456 3622 y(\(4.4.5\))d(to)h(iden)n(tify)g FL(h)p FJ(W)p 1236 3599 30 3 v 21 x FI(t)1266 3622 y FL(i)d(')f(h)p FJ(W)1524 3634 y FI(t)1554 3622 y FL(i)1586 3591 y FE(\003)1624 3622 y FQ(.)42 b(Theorem)28 b(4.1.15)f(implies)i (that)g(this)h(is)f(w)n(ell-de\014ned.)456 3721 y(This)34 b(completes)g(the)g(de\014nition)h(of)f(the)h(TQFT)f(based)f(on)h (parameterized)f FL(C)5 b FQ(-mark)n(ed)32 b(3-)456 3821 y(manifolds.)54 b(All)34 b(the)g(compatibilit)n(y)f(conditions)g(are)f (easy)h(to)g(pro)n(v)n(e)f(and)h(are)g(left)h(to)f(the)456 3920 y(reader)23 b(\(or)i(can)f(b)r(e)i(found)f(in)h([)p FK(T)p FQ(]\);)g(functorialit)n(y)f(is)g(also)f(ob)n(vious.)35 b(Therefore,)24 b(w)n(e)h(ha)n(v)n(e)f(to)456 4020 y(pro)n(v)n(e)i(the) i(gluing)f(and)g(the)h(normalization)e(axioms.)605 4120 y FK(Step)32 b(3.)42 b(Pro)m(ving)32 b(the)f(gluing)g(axiom.)605 4219 y FQ(No)n(w,)37 b(let)f(us)f(pro)n(v)n(e)f(the)i(gluing)f(axiom,)i (assuming)d(that)i FJ(p)2587 4189 y FM(+)2642 4219 y FJ(=p)2726 4189 y FE(\000)2817 4219 y FQ(=)g(1.)60 b(Lo)r(oking)35 b(at)456 4319 y(the)f(de\014nitions,)i(w)n(e)e(see)g(that)g(it)h(is)f (equiv)-5 b(alen)n(t)34 b(to)g(the)g(follo)n(wing)g(statemen)n(t:)50 b(if)34 b FJ(X)41 b FQ(is)34 b(a)456 4419 y(sp)r(ecial)e(link)g(whic)n (h)g(con)n(tains)g(t)n(w)n(o)f(uncolored)h(coup)r(ons)f FJ(T)7 b(;)14 b(T)2496 4388 y FE(0)2550 4419 y FQ(of)33 b(t)n(yp)r(es)f FJ(t;)p 2941 4358 30 4 v 14 w(t)g FQ(resp)r(ectiv)n (ely)-7 b(,)456 4518 y(and)20 b FJ(X)686 4488 y FE(0)731 4518 y FQ(=)j FL(t)874 4530 y FI(T)5 b(;T)986 4514 y Fx(0)1013 4518 y FQ(\()p FJ(X)i FQ(\))20 b(is)g(the)h(link)f(obtained)g (from)g FJ(X)26 b FQ(b)n(y)20 b(\\canceling")e(these)i(t)n(w)n(o)g (coup)r(ons)f(as)456 4618 y(sho)n(wn)g(in)h(Figure)f(4.8)g(b)r(elo)n (w,)i(then)f FJ(M)1683 4630 y FI(X)1769 4618 y FQ(=)i FJ(M)1937 4630 y FI(X)1996 4614 y Fx(0)2022 4618 y FQ(.)35 b(This)20 b(statemen)n(t)f(is)h(of)g(purely)f(top)r(ological)456 4717 y(nature,)27 b(and)g(w)n(e)g(omit)h(its)g(pro)r(of.)605 4817 y(Finally)-7 b(,)27 b(the)g(pro)r(of)e(of)i(the)f(normalization)f (axiom)h(will)g(b)r(e)h(giv)n(en)f(in)g(the)h(next)g(section,)456 4917 y(along)f(with)i(other)f(examples.)36 b(This)28 b(completes)f(the)h(pro)r(of)f(of)h(Theorem)e(4.4.3.)605 5016 y(In)34 b(the)f(case)g(where)g FJ(p)1333 4986 y FM(+)1388 5016 y FJ(=p)1472 4986 y FE(\000)1560 5016 y FL(6)p FQ(=)f(1,)i(the)g(theorem)f(ab)r(o)n(v)n(e)f(is)h(incorrect)f (as)h(stated.)54 b(F)-7 b(or)456 5116 y(example,)28 b(the)h(gluing)f (axiom)g(holds)g(only)g(up)h(to)f(a)g(m)n(ultiplicativ)n(e)h(factor,)f (and)g(instead)h(of)456 5216 y(the)h(action)g(of)g(the)h(mapping)f (class)f(group)g(in)i FJ(\034)9 b FQ(\(\006\),)32 b(one)e(w)n(ould)g (get)g(a)g(pro)5 b(jectiv)n(e)29 b(action.)p eop %%Page: 87 17 87 90 bop 1710 226 a FM(4.5.)29 b(EXAMPLES)1164 b(87)819 869 y @beginspecial 0 @llx 0 @lly 110 @urx 58 @ury 1100 @rwi @setspecial %%BeginDocument: figures/cancel.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: cancel.eps %%Creator: fig2dev Version 3.2 Patchlevel 0-beta3 %%CreationDate: Mon Dec 14 12:34:54 1998 %%For: shurik@localhost.localdomain (Alexander Kirillov,,,) %%Orientation: Portrait %%BoundingBox: 0 0 110 58 %%Pages: 0 %%BeginSetup %%EndSetup %%Magnification: 0.3300 %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -12.0 87.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n -1000 5349 m -1000 -1000 l 7153 -1000 l 7153 5349 l cp clip 0.01980 0.01980 sc % Polyline 30.000 slw n 2145 4316 m 2745 4316 l 2745 1601 l 2145 1601 l 2145 4316 l cp gs col0 s gr % Polyline gs clippath 1014 4076 m 726 4016 l 1014 3956 l 600 3956 l 600 4076 l cp clip n 2145 4016 m 645 4016 l gs col0 s gr gr % arrowhead n 1014 4076 m 726 4016 l 1014 3956 l 966 4016 l 1014 4076 l cp gs 0.00 setgray ef gr col0 s % Polyline gs clippath 1746 1841 m 2034 1901 l 1746 1961 l 2160 1961 l 2160 1841 l cp clip n 690 1901 m 2115 1901 l gs col0 s gr gr % arrowhead n 1746 1841 m 2034 1901 l 1746 1961 l 1794 1901 l 1746 1841 l cp gs 0.00 setgray ef gr col0 s % Polyline gs clippath 1014 3701 m 726 3641 l 1014 3581 l 600 3581 l 600 3701 l cp clip n 2145 3641 m 645 3641 l gs col0 s gr gr % arrowhead n 1014 3701 m 726 3641 l 1014 3581 l 966 3641 l 1014 3701 l cp gs 0.00 setgray ef gr col0 s % Polyline n 2130 3236 m 2127 3236 l 2121 3236 l 2111 3237 l 2095 3237 l 2074 3238 l 2048 3238 l 2020 3239 l 1989 3240 l 1957 3240 l 1925 3241 l 1895 3241 l 1867 3241 l 1840 3241 l 1816 3240 l 1794 3239 l 1774 3238 l 1755 3236 l 1734 3233 l 1714 3230 l 1694 3227 l 1674 3224 l 1654 3220 l 1634 3217 l 1614 3213 l 1594 3209 l 1575 3205 l 1556 3201 l 1537 3196 l 1519 3190 l 1502 3184 l 1485 3178 l 1470 3170 l 1455 3161 l 1441 3151 l 1429 3140 l 1416 3127 l 1405 3114 l 1393 3099 l 1381 3084 l 1370 3068 l 1359 3052 l 1348 3036 l 1338 3020 l 1329 3004 l 1321 2989 l 1314 2974 l 1309 2961 l 1306 2948 l 1305 2936 l 1306 2923 l 1311 2911 l 1318 2899 l 1327 2887 l 1337 2876 l 1349 2865 l 1362 2854 l 1376 2843 l 1389 2833 l 1403 2823 l 1416 2813 l 1429 2803 l 1442 2794 l 1455 2786 l 1469 2778 l 1483 2771 l 1497 2765 l 1511 2758 l 1525 2753 l 1539 2747 l 1553 2741 l 1568 2736 l 1583 2731 l 1600 2726 l 1617 2722 l 1636 2718 l 1657 2714 l 1680 2711 l 1698 2709 l 1717 2708 l 1738 2707 l 1762 2706 l 1789 2706 l 1818 2706 l 1850 2706 l 1883 2706 l 1918 2707 l 1954 2707 l 1988 2708 l 2021 2709 l 2051 2709 l 2076 2710 l 2096 2710 l 2112 2711 l 2122 2711 l 2127 2711 l 2130 2711 l gs col0 s gr % Polyline n 4665 4260 m 4065 4260 l 4065 1545 l 4665 1545 l 4665 4260 l cp gs col0 s gr % Polyline gs clippath 5064 4050 m 4776 3990 l 5064 3930 l 4650 3930 l 4650 4050 l cp clip n 6120 3990 m 4695 3990 l gs col0 s gr gr % arrowhead n 5064 4050 m 4776 3990 l 5064 3930 l 5016 3990 l 5064 4050 l cp gs 0.00 setgray ef gr col0 s % Polyline gs clippath 5064 3615 m 4776 3555 l 5064 3495 l 4650 3495 l 4650 3615 l cp clip n 6120 3555 m 4695 3555 l gs col0 s gr gr % arrowhead n 5064 3615 m 4776 3555 l 5064 3495 l 5016 3555 l 5064 3615 l cp gs 0.00 setgray ef gr col0 s % Polyline gs clippath 5751 1830 m 6039 1890 l 5751 1950 l 6165 1950 l 6165 1830 l cp clip n 4695 1890 m 6120 1890 l gs col0 s gr gr % arrowhead n 5751 1830 m 6039 1890 l 5751 1950 l 5799 1890 l 5751 1830 l cp gs 0.00 setgray ef gr col0 s % Polyline n 4680 3180 m 4683 3180 l 4689 3180 l 4699 3181 l 4715 3181 l 4736 3182 l 4762 3182 l 4790 3183 l 4821 3184 l 4853 3184 l 4885 3185 l 4915 3185 l 4943 3185 l 4970 3185 l 4994 3184 l 5016 3183 l 5036 3182 l 5055 3180 l 5076 3177 l 5096 3174 l 5116 3171 l 5136 3168 l 5156 3164 l 5176 3161 l 5196 3157 l 5216 3153 l 5235 3149 l 5254 3145 l 5273 3140 l 5291 3134 l 5308 3128 l 5325 3122 l 5340 3114 l 5355 3105 l 5369 3095 l 5381 3084 l 5394 3071 l 5405 3058 l 5417 3043 l 5429 3028 l 5440 3012 l 5451 2996 l 5462 2980 l 5472 2964 l 5481 2948 l 5489 2933 l 5496 2918 l 5501 2905 l 5504 2892 l 5505 2880 l 5504 2867 l 5499 2855 l 5492 2843 l 5483 2831 l 5473 2820 l 5461 2809 l 5448 2798 l 5434 2787 l 5421 2777 l 5407 2767 l 5394 2757 l 5381 2747 l 5368 2738 l 5355 2730 l 5341 2722 l 5327 2715 l 5313 2709 l 5299 2702 l 5285 2697 l 5271 2691 l 5257 2685 l 5242 2680 l 5227 2675 l 5210 2670 l 5193 2666 l 5174 2662 l 5153 2658 l 5130 2655 l 5112 2653 l 5093 2652 l 5072 2651 l 5048 2650 l 5021 2650 l 4992 2650 l 4960 2650 l 4927 2650 l 4892 2651 l 4856 2651 l 4822 2652 l 4789 2653 l 4759 2653 l 4734 2654 l 4714 2654 l 4698 2655 l 4688 2655 l 4683 2655 l 4680 2655 l gs col0 s gr $F2psEnd rs %%EndDocument @endspecial 2400 815 a @beginspecial 0 @llx 0 @lly 110 @urx 45 @ury 1100 @rwi @setspecial %%BeginDocument: figures/cancel2.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: cancel2.eps %%Creator: fig2dev Version 3.2 Patchlevel 0-beta3 %%CreationDate: Mon Dec 14 12:37:28 1998 %%For: shurik@localhost.localdomain (Alexander Kirillov,,,) %%Orientation: Portrait %%BoundingBox: 0 0 110 45 %%Pages: 0 %%BeginSetup %%EndSetup %%Magnification: 0.3300 %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -12.0 81.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n -1000 5049 m -1000 -1000 l 7153 -1000 l 7153 5049 l cp clip 0.01980 0.01980 sc % Polyline 30.000 slw gs clippath 1014 4076 m 726 4016 l 1014 3956 l 600 3956 l 600 4076 l cp clip n 2145 4016 m 645 4016 l gs col0 s gr gr % arrowhead n 1014 4076 m 726 4016 l 1014 3956 l 966 4016 l 1014 4076 l cp gs 0.00 setgray ef gr col0 s % Polyline gs clippath 1014 3701 m 726 3641 l 1014 3581 l 600 3581 l 600 3701 l cp clip n 2145 3641 m 645 3641 l gs col0 s gr gr % arrowhead n 1014 3701 m 726 3641 l 1014 3581 l 966 3641 l 1014 3701 l cp gs 0.00 setgray ef gr col0 s % Polyline gs clippath 5064 4050 m 4776 3990 l 5064 3930 l 4650 3930 l 4650 4050 l cp clip n 6120 3990 m 4695 3990 l gs col0 s gr gr % arrowhead n 5064 4050 m 4776 3990 l 5064 3930 l 5016 3990 l 5064 4050 l cp gs 0.00 setgray ef gr col0 s % Polyline gs clippath 5064 3615 m 4776 3555 l 5064 3495 l 4650 3495 l 4650 3615 l cp clip n 6120 3555 m 4695 3555 l gs col0 s gr gr % arrowhead n 5064 3615 m 4776 3555 l 5064 3495 l 5016 3555 l 5064 3615 l cp gs 0.00 setgray ef gr col0 s % Polyline gs clippath 5751 1830 m 6039 1890 l 5751 1950 l 6165 1950 l 6165 1830 l cp clip n 4695 1890 m 6120 1890 l gs col0 s gr gr % arrowhead n 5751 1830 m 6039 1890 l 5751 1950 l 5799 1890 l 5751 1830 l cp gs 0.00 setgray ef gr col0 s % Polyline gs clippath 1746 1841 m 2034 1901 l 1746 1961 l 2160 1961 l 2160 1841 l cp clip n 690 1901 m 2115 1901 l gs col0 s gr gr % arrowhead n 1746 1841 m 2034 1901 l 1746 1961 l 1794 1901 l 1746 1841 l cp gs 0.00 setgray ef gr col0 s % Polyline n 2055 1905 m 4710 1890 l gs col0 s gr % Polyline n 2085 2715 m 4702 2655 l gs col0 s gr % Polyline n 2092 3240 m 4740 3180 l gs col0 s gr % Polyline n 2047 3630 m 4792 3547 l gs col0 s gr % Polyline n 2085 4012 m 4800 3990 l gs col0 s gr % Polyline n 2130 3236 m 2127 3236 l 2121 3236 l 2111 3237 l 2095 3237 l 2074 3238 l 2048 3238 l 2020 3239 l 1989 3240 l 1957 3240 l 1925 3241 l 1895 3241 l 1867 3241 l 1840 3241 l 1816 3240 l 1794 3239 l 1774 3238 l 1755 3236 l 1734 3233 l 1714 3230 l 1694 3227 l 1674 3224 l 1654 3220 l 1634 3217 l 1614 3213 l 1594 3209 l 1575 3205 l 1556 3201 l 1537 3196 l 1519 3190 l 1502 3184 l 1485 3178 l 1470 3170 l 1455 3161 l 1441 3151 l 1429 3140 l 1416 3127 l 1405 3114 l 1393 3099 l 1381 3084 l 1370 3068 l 1359 3052 l 1348 3036 l 1338 3020 l 1329 3004 l 1321 2989 l 1314 2974 l 1309 2961 l 1306 2948 l 1305 2936 l 1306 2923 l 1311 2911 l 1318 2899 l 1327 2887 l 1337 2876 l 1349 2865 l 1362 2854 l 1376 2843 l 1389 2833 l 1403 2823 l 1416 2813 l 1429 2803 l 1442 2794 l 1455 2786 l 1469 2778 l 1483 2771 l 1497 2765 l 1511 2758 l 1525 2753 l 1539 2747 l 1553 2741 l 1568 2736 l 1583 2731 l 1600 2726 l 1617 2722 l 1636 2718 l 1657 2714 l 1680 2711 l 1698 2709 l 1717 2708 l 1738 2707 l 1762 2706 l 1789 2706 l 1818 2706 l 1850 2706 l 1883 2706 l 1918 2707 l 1954 2707 l 1988 2708 l 2021 2709 l 2051 2709 l 2076 2710 l 2096 2710 l 2112 2711 l 2122 2711 l 2127 2711 l 2130 2711 l gs col0 s gr % Polyline n 4680 3180 m 4683 3180 l 4689 3180 l 4699 3181 l 4715 3181 l 4736 3182 l 4762 3182 l 4790 3183 l 4821 3184 l 4853 3184 l 4885 3185 l 4915 3185 l 4943 3185 l 4970 3185 l 4994 3184 l 5016 3183 l 5036 3182 l 5055 3180 l 5076 3177 l 5096 3174 l 5116 3171 l 5136 3168 l 5156 3164 l 5176 3161 l 5196 3157 l 5216 3153 l 5235 3149 l 5254 3145 l 5273 3140 l 5291 3134 l 5308 3128 l 5325 3122 l 5340 3114 l 5355 3105 l 5369 3095 l 5381 3084 l 5394 3071 l 5405 3058 l 5417 3043 l 5429 3028 l 5440 3012 l 5451 2996 l 5462 2980 l 5472 2964 l 5481 2948 l 5489 2933 l 5496 2918 l 5501 2905 l 5504 2892 l 5505 2880 l 5504 2867 l 5499 2855 l 5492 2843 l 5483 2831 l 5473 2820 l 5461 2809 l 5448 2798 l 5434 2787 l 5421 2777 l 5407 2767 l 5394 2757 l 5381 2747 l 5368 2738 l 5355 2730 l 5341 2722 l 5327 2715 l 5313 2709 l 5299 2702 l 5285 2697 l 5271 2691 l 5257 2685 l 5242 2680 l 5227 2675 l 5210 2670 l 5193 2666 l 5174 2662 l 5153 2658 l 5130 2655 l 5112 2653 l 5093 2652 l 5072 2651 l 5048 2650 l 5021 2650 l 4992 2650 l 4960 2650 l 4927 2650 l 4892 2651 l 4856 2651 l 4822 2652 l 4789 2653 l 4759 2653 l 4734 2654 l 4714 2654 l 4698 2655 l 4688 2655 l 4683 2655 l 4680 2655 l gs col0 s gr $F2psEnd rs %%EndDocument @endspecial 1182 1069 a FP(Figure)32 b(4.8.)40 b FQ(\\Canceling")26 b(of)i(t)n(w)n(o)f(coup)r(ons.)456 1326 y(\(In)j(the)h(ph)n(ysics)f (language,)f(this)h(is)h(referred)e(to)h(as)f(\\anomalies",)g(so)h(for) f FJ(p)2940 1296 y FM(+)2995 1326 y FJ(=p)3079 1296 y FE(\000)3162 1326 y FL(6)p FQ(=)e(1,)k(w)n(e)456 1426 y(get)j(a)g(TQFT)g(with)i(anomalies.\))56 b(As)35 b(in)g(the)g(case)e (of)i(a)f(pro)5 b(jectiv)n(e)34 b(represen)n(tation)e(of)j(a)456 1525 y(group,)e(it)g(is)g(p)r(ossible)f(to)h(get)f(rid)h(of)g(these)f (factors)g(\(anomalies\))g(b)n(y)h(a)f(suitable)h(\\cen)n(tral)456 1625 y(extension")24 b(of)h(the)g(TQFT.)g(W)-7 b(e)26 b(will)f(discuss)g(this)g(generalization)e(later)i(\(see)g(Section)g (5.7\).)1652 1844 y FK(4.5.)46 b(Examples)605 1993 y FQ(In)28 b(this)g(section)f(w)n(e)h(giv)n(e)f(sev)n(eral)e(examples)j (of)f(the)h(calculation)f(of)h(the)g(v)n(ector)e(spaces)456 2093 y(and)32 b(op)r(erators)f(for)h(the)h(TQFT)f(de\014ned)h(in)g(the) g(previous)e(section.)52 b(As)32 b(b)r(efore,)i(w)n(e)e(\014x)h(a)456 2193 y(MTC)27 b FL(C)5 b FQ(.)605 2292 y(First)28 b(of)f(all,)g(let)h (us)g(get)f(some)g(w)n(orking)f(exp)r(erience)h(with)h(sp)r(ecial)g (links.)605 2452 y FP(Example)j FQ(4.5.1)p FP(.)40 b FQ(Let)g FJ(T)51 b FQ(b)r(e)41 b(a)e(ribb)r(on)h(tangle,)j(in)d(whic)n (h)h(all)e(the)i(strands)e(are)g FL(C)5 b FQ(-)456 2551 y(colored)31 b(except)i(for)f(some)h(ann)n(uli)g(\(suc)n(h)f(tangles)h (w)n(ere)f(discussed)g(in)h(Chapter)g(3\).)52 b(Suc)n(h)456 2651 y(a)29 b(tangle)f(de\014nes)i(t)n(w)n(o)f(t)n(yp)r(es)g FJ(t)1462 2663 y FM(top)1562 2651 y FJ(;)14 b(t)1629 2663 y FM(b)r(ot)1760 2651 y FQ(and)29 b(a)g(linear)g(map)g FJ(F)2478 2621 y FE(\000)p FM(1)2567 2651 y FQ(\()p FJ(T)12 b FQ(\))d(:)28 b FJ(W)2830 2663 y FI(t)2855 2672 y FF(b)q(ot)2973 2651 y FL(!)e FJ(W)3160 2663 y FI(t)3185 2671 y FF(top)3306 2651 y FQ(\(see)456 2751 y(Theorem)g(2.3.9\).)605 2850 y(Let)34 b(us)g(form)g(a)f(sp)r(ecial)h(link)g FJ(X)40 b FQ(b)n(y)34 b(adding)f(to)h FJ(T)45 b FQ(t)n(w)n(o)33 b(uncolored)g(coup)r(ons)g(of)h(t)n(yp)r(e)456 2950 y FJ(t)486 2962 y FM(b)r(ot)587 2950 y FJ(;)p 624 2889 130 4 v 14 w(t)654 2962 y FM(top)754 2950 y FQ(.)62 b(An)36 b(example)g(of)g(suc)n(h)f(ribb)r(on)h(tangle)f FJ(T)47 b FQ(and)36 b(the)g(corresp)r(onding)e(link)i FJ(X)43 b FQ(is)456 3049 y(sho)n(wn)26 b(in)i(Figure)f(4.9.)1014 3758 y @beginspecial 0 @llx 0 @lly 117 @urx 52 @ury 1170 @rwi @setspecial %%BeginDocument: figures/exoma.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: exoma.eps %%Creator: fig2dev Version 3.2 Patchlevel 0-beta3 %%CreationDate: Thu Nov 19 16:31:34 1998 %%For: shurik@localhost.localdomain (Alexander Kirillov,,,) %%Orientation: Portrait %%BoundingBox: 0 0 117 52 %%Pages: 0 %%BeginSetup %%EndSetup %%Magnification: 0.2000 %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -129.0 80.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n -1000 7644 m -1000 -1000 l 21444 -1000 l 21444 7644 l cp clip 0.01200 0.01200 sc /Times-Roman ff 375.00 scf sf 15000 3270 m gs 1 -1 sc (2) col-1 sh gr /Times-Italic ff 675.00 scf sf 14550 3120 m gs 1 -1 sc (W) col-1 sh gr /Times-Italic ff 675.00 scf sf 11670 3135 m gs 1 -1 sc (W) col-1 sh gr /Times-Roman ff 375.00 scf sf 12120 3285 m gs 1 -1 sc (1) col-1 sh gr /Times-Italic ff 675.00 scf sf 19785 3705 m gs 1 -1 sc (W) col-1 sh gr /Times-Roman ff 375.00 scf sf 20235 3855 m gs 1 -1 sc (3) col-1 sh gr % Arc 30.000 slw gs clippath 17804 4154 m 17470 3864 l 17892 3997 l 17405 3724 l 17317 3882 l cp clip n 18276.9 2720.8 1410.1 128.5 -13.1 arcn gs col-1 s gr gr % arrowhead n 17804 4154 m 17470 3864 l 17892 3997 l 17785 4040 l 17804 4154 l cp gs 0.00 setgray ef gr col-1 s % Arc gs n 17925.0 2737.5 1102.9 -162.2 144.7 arcn gs col-1 s gr gr % Polyline gs clippath 12567 2893 m 12404 2482 l 12717 2794 l 12410 2328 l 12260 2427 l cp clip n 12360 2415 m 13140 3600 l gs col0 s gr gr % arrowhead n 12567 2893 m 12404 2482 l 12717 2794 l 12602 2783 l 12567 2893 l cp gs 0.00 setgray ef gr col0 s % Polyline n 14730 5925 m 15210 6585 l gs col0 s gr % Polyline gs clippath 12090 6087 m 12000 6519 l 11910 6087 l 11910 6645 l 12090 6645 l cp clip n 12000 5400 m 12000 6600 l gs col-1 s gr gr % arrowhead n 12090 6087 m 12000 6519 l 11910 6087 l 12000 6159 l 12090 6087 l cp gs 0.00 setgray ef gr col-1 s % Polyline n 13335 3900 m 13830 4635 l gs col0 s gr % Polyline n 14040 4920 m 14565 5640 l gs col0 s gr % Polyline n 12000 4875 m 11999 4872 l 11998 4866 l 11995 4856 l 11992 4843 l 11989 4826 l 11986 4809 l 11985 4790 l 11985 4772 l 11987 4752 l 11992 4732 l 12000 4710 l 12006 4695 l 12013 4679 l 12021 4662 l 12029 4643 l 12038 4624 l 12047 4603 l 12056 4582 l 12066 4560 l 12076 4537 l 12086 4515 l 12096 4492 l 12107 4469 l 12119 4446 l 12131 4424 l 12144 4403 l 12158 4382 l 12172 4362 l 12188 4342 l 12206 4323 l 12225 4305 l 12242 4290 l 12260 4276 l 12280 4262 l 12300 4248 l 12321 4234 l 12343 4221 l 12366 4208 l 12390 4196 l 12413 4183 l 12438 4171 l 12462 4159 l 12488 4147 l 12513 4135 l 12538 4123 l 12564 4110 l 12589 4098 l 12615 4086 l 12640 4073 l 12666 4060 l 12691 4046 l 12717 4033 l 12743 4019 l 12769 4005 l 12795 3990 l 12818 3977 l 12841 3964 l 12865 3952 l 12889 3939 l 12914 3925 l 12938 3912 l 12964 3899 l 12989 3886 l 13015 3873 l 13041 3860 l 13067 3847 l 13094 3834 l 13120 3820 l 13147 3807 l 13173 3794 l 13200 3780 l 13226 3766 l 13253 3753 l 13279 3739 l 13305 3725 l 13330 3710 l 13356 3695 l 13381 3680 l 13405 3665 l 13429 3649 l 13453 3633 l 13477 3617 l 13500 3600 l 13523 3583 l 13545 3565 l 13568 3547 l 13590 3528 l 13611 3509 l 13633 3490 l 13654 3470 l 13675 3450 l 13695 3430 l 13716 3409 l 13736 3388 l 13756 3368 l 13776 3347 l 13796 3326 l 13816 3304 l 13836 3283 l 13856 3262 l 13876 3241 l 13896 3220 l 13917 3198 l 13937 3177 l 13958 3156 l 13978 3135 l 13999 3114 l 14021 3093 l 14042 3072 l 14063 3051 l 14085 3030 l 14107 3009 l 14129 2987 l 14152 2965 l 14176 2941 l 14201 2917 l 14228 2891 l 14255 2864 l 14285 2835 l 14315 2805 l 14347 2774 l 14380 2742 l 14414 2709 l 14448 2676 l 14482 2643 l 14515 2610 l 14547 2579 l 14577 2549 l 14605 2522 l 14630 2498 l 14652 2476 l 14671 2458 l 14686 2443 l 14697 2432 l 14706 2424 l 14711 2419 l 14714 2416 l 14715 2415 l gs col0 s gr % Polyline n 12450 6075 m 12451 6075 l 12454 6075 l 12459 6074 l 12468 6073 l 12479 6072 l 12496 6070 l 12516 6068 l 12541 6065 l 12571 6062 l 12606 6058 l 12645 6053 l 12688 6048 l 12735 6043 l 12786 6037 l 12839 6031 l 12895 6024 l 12953 6017 l 13012 6010 l 13072 6003 l 13133 5996 l 13194 5988 l 13255 5980 l 13316 5973 l 13376 5965 l 13436 5957 l 13494 5950 l 13553 5942 l 13610 5934 l 13667 5926 l 13723 5918 l 13779 5910 l 13835 5902 l 13890 5894 l 13946 5886 l 14001 5877 l 14057 5869 l 14114 5860 l 14171 5850 l 14230 5841 l 14289 5831 l 14350 5821 l 14412 5811 l 14475 5800 l 14524 5792 l 14574 5783 l 14625 5774 l 14676 5765 l 14729 5756 l 14783 5746 l 14838 5737 l 14893 5727 l 14950 5716 l 15008 5706 l 15067 5695 l 15127 5684 l 15188 5673 l 15249 5661 l 15312 5650 l 15375 5638 l 15440 5625 l 15505 5613 l 15571 5600 l 15637 5588 l 15705 5575 l 15772 5561 l 15840 5548 l 15909 5534 l 15978 5521 l 16047 5507 l 16116 5493 l 16185 5479 l 16254 5465 l 16323 5450 l 16392 5436 l 16460 5422 l 16528 5407 l 16596 5393 l 16663 5379 l 16729 5364 l 16795 5350 l 16860 5336 l 16924 5322 l 16987 5308 l 17049 5294 l 17110 5280 l 17170 5266 l 17228 5252 l 17286 5239 l 17343 5226 l 17398 5212 l 17452 5199 l 17505 5186 l 17556 5173 l 17607 5161 l 17656 5148 l 17703 5135 l 17750 5123 l 17796 5111 l 17840 5099 l 17883 5087 l 17925 5075 l 17990 5056 l 18053 5037 l 18114 5018 l 18173 5000 l 18229 4981 l 18283 4962 l 18336 4943 l 18387 4925 l 18435 4906 l 18482 4887 l 18527 4868 l 18571 4850 l 18612 4831 l 18652 4812 l 18689 4794 l 18725 4775 l 18759 4757 l 18791 4739 l 18821 4721 l 18849 4704 l 18875 4686 l 18899 4669 l 18922 4653 l 18943 4637 l 18962 4621 l 18979 4606 l 18995 4591 l 19010 4577 l 19023 4563 l 19035 4549 l 19046 4536 l 19056 4523 l 19065 4511 l 19073 4498 l 19081 4487 l 19088 4475 l 19100 4452 l 19110 4431 l 19119 4409 l 19126 4387 l 19131 4365 l 19135 4341 l 19137 4317 l 19138 4291 l 19138 4264 l 19137 4237 l 19135 4210 l 19133 4186 l 19131 4164 l 19128 4147 l 19127 4135 l 19126 4128 l 19125 4125 l gs col-1 s gr % Polyline n 18900 3750 m 18899 3747 l 18896 3740 l 18890 3728 l 18883 3712 l 18873 3693 l 18862 3671 l 18850 3650 l 18837 3629 l 18824 3609 l 18810 3591 l 18796 3574 l 18781 3558 l 18764 3542 l 18745 3527 l 18725 3513 l 18711 3503 l 18697 3494 l 18681 3484 l 18664 3475 l 18647 3465 l 18627 3455 l 18607 3446 l 18585 3436 l 18561 3427 l 18537 3418 l 18511 3410 l 18483 3402 l 18455 3394 l 18425 3387 l 18394 3381 l 18363 3376 l 18330 3371 l 18297 3368 l 18264 3365 l 18229 3363 l 18195 3362 l 18159 3363 l 18124 3364 l 18087 3367 l 18050 3370 l 18013 3375 l 17985 3379 l 17956 3384 l 17926 3389 l 17896 3395 l 17865 3402 l 17833 3409 l 17800 3417 l 17767 3426 l 17732 3436 l 17696 3446 l 17660 3456 l 17622 3468 l 17584 3480 l 17545 3492 l 17506 3505 l 17466 3519 l 17425 3533 l 17384 3548 l 17343 3562 l 17302 3578 l 17260 3593 l 17219 3609 l 17178 3625 l 17137 3641 l 17096 3658 l 17055 3674 l 17015 3691 l 16976 3707 l 16937 3724 l 16898 3740 l 16860 3756 l 16822 3773 l 16785 3789 l 16748 3805 l 16711 3821 l 16675 3838 l 16641 3853 l 16606 3868 l 16572 3884 l 16537 3900 l 16502 3916 l 16467 3932 l 16431 3948 l 16395 3965 l 16358 3981 l 16321 3998 l 16283 4015 l 16245 4033 l 16207 4050 l 16168 4068 l 16128 4085 l 16089 4103 l 16049 4120 l 16008 4138 l 15968 4156 l 15928 4173 l 15887 4190 l 15847 4207 l 15806 4224 l 15766 4241 l 15726 4257 l 15686 4273 l 15646 4289 l 15607 4304 l 15568 4319 l 15529 4334 l 15490 4348 l 15452 4362 l 15414 4375 l 15376 4388 l 15338 4401 l 15301 4413 l 15263 4426 l 15225 4438 l 15190 4448 l 15156 4458 l 15120 4469 l 15085 4479 l 15048 4489 l 15011 4499 l 14974 4509 l 14936 4519 l 14897 4529 l 14857 4538 l 14816 4548 l 14775 4558 l 14733 4568 l 14690 4578 l 14647 4587 l 14603 4597 l 14558 4607 l 14513 4616 l 14467 4626 l 14421 4635 l 14374 4645 l 14327 4654 l 14280 4663 l 14232 4673 l 14185 4682 l 14137 4691 l 14089 4700 l 14041 4709 l 13994 4718 l 13946 4726 l 13899 4735 l 13852 4743 l 13805 4752 l 13758 4760 l 13711 4768 l 13665 4776 l 13619 4784 l 13573 4793 l 13526 4801 l 13480 4809 l 13434 4817 l 13388 4825 l 13343 4833 l 13298 4841 l 13252 4849 l 13206 4857 l 13160 4865 l 13112 4874 l 13065 4882 l 13016 4891 l 12967 4900 l 12918 4909 l 12868 4918 l 12817 4928 l 12766 4937 l 12715 4947 l 12663 4957 l 12612 4967 l 12559 4977 l 12507 4988 l 12455 4998 l 12404 5009 l 12352 5019 l 12301 5030 l 12250 5041 l 12199 5052 l 12150 5063 l 12101 5074 l 12053 5084 l 12006 5095 l 11960 5106 l 11915 5117 l 11871 5128 l 11828 5139 l 11786 5149 l 11746 5160 l 11707 5170 l 11669 5181 l 11633 5191 l 11597 5201 l 11564 5212 l 11531 5222 l 11500 5232 l 11469 5242 l 11440 5252 l 11413 5263 l 11371 5279 l 11331 5295 l 11294 5311 l 11259 5328 l 11226 5345 l 11195 5362 l 11166 5380 l 11139 5398 l 11113 5416 l 11089 5434 l 11068 5453 l 11048 5472 l 11030 5490 l 11014 5509 l 11000 5528 l 10988 5546 l 10977 5564 l 10968 5582 l 10961 5600 l 10955 5617 l 10951 5634 l 10948 5650 l 10946 5665 l 10945 5681 l 10945 5696 l 10946 5710 l 10948 5724 l 10950 5738 l 10954 5756 l 10959 5775 l 10965 5793 l 10972 5811 l 10981 5828 l 10990 5846 l 11001 5863 l 11012 5880 l 11025 5897 l 11039 5913 l 11053 5928 l 11068 5943 l 11084 5956 l 11100 5969 l 11116 5981 l 11133 5991 l 11149 6001 l 11166 6010 l 11183 6018 l 11200 6025 l 11217 6032 l 11235 6037 l 11254 6043 l 11274 6047 l 11296 6051 l 11319 6055 l 11344 6058 l 11372 6061 l 11402 6064 l 11433 6066 l 11466 6068 l 11499 6070 l 11530 6072 l 11559 6073 l 11583 6074 l 11602 6074 l 11614 6075 l 11622 6075 l 11625 6075 l gs col-1 s gr % Polyline 45.000 slw n 10800 6600 m 20400 6600 l gs col-1 s gr % Polyline n 10800 2400 m 20400 2400 l gs col-1 s gr $F2psEnd rs %%EndDocument @endspecial 2155 3850 a @beginspecial 0 @llx 0 @lly 116 @urx 74 @ury 1160 @rwi @setspecial %%BeginDocument: figures/exomb.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: exomb.eps %%Creator: fig2dev Version 3.2 Patchlevel 0-beta3 %%CreationDate: Thu Nov 19 16:33:18 1998 %%For: shurik@localhost.localdomain (Alexander Kirillov,,,) %%Orientation: Portrait %%BoundingBox: 0 0 116 74 %%Pages: 0 %%BeginSetup %%EndSetup %%Magnification: 0.2000 %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -130.0 91.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n -1000 8544 m -1000 -1000 l 21419 -1000 l 21419 8544 l cp clip 0.01200 0.01200 sc /Times-Roman ff 375.00 scf sf 15000 3270 m gs 1 -1 sc (2) col-1 sh gr /Times-Italic ff 675.00 scf sf 14550 3120 m gs 1 -1 sc (W) col-1 sh gr /Times-Italic ff 675.00 scf sf 11670 3135 m gs 1 -1 sc (W) col-1 sh gr /Times-Roman ff 375.00 scf sf 12120 3285 m gs 1 -1 sc (1) col-1 sh gr /Times-Italic ff 675.00 scf sf 19785 3705 m gs 1 -1 sc (W) col-1 sh gr /Times-Roman ff 375.00 scf sf 20235 3855 m gs 1 -1 sc (3) col-1 sh gr % Arc 30.000 slw gs clippath 17804 4154 m 17470 3864 l 17892 3997 l 17405 3724 l 17317 3882 l cp clip n 18276.9 2720.8 1410.1 128.5 -13.1 arcn gs col-1 s gr gr % arrowhead n 17804 4154 m 17470 3864 l 17892 3997 l 17785 4040 l 17804 4154 l cp gs 0.00 setgray ef gr col-1 s % Arc gs n 17925.0 2737.5 1102.9 -162.2 144.7 arcn gs col-1 s gr gr % Polyline gs clippath 12567 2893 m 12404 2482 l 12717 2794 l 12410 2328 l 12260 2427 l cp clip n 12360 2415 m 13140 3600 l gs col0 s gr gr % arrowhead n 12567 2893 m 12404 2482 l 12717 2794 l 12602 2783 l 12567 2893 l cp gs 0.00 setgray ef gr col0 s % Polyline n 14730 5925 m 15210 6585 l gs col0 s gr % Polyline gs clippath 12090 6087 m 12000 6519 l 11910 6087 l 11910 6645 l 12090 6645 l cp clip n 12000 5400 m 12000 6600 l gs col-1 s gr gr % arrowhead n 12090 6087 m 12000 6519 l 11910 6087 l 12000 6159 l 12090 6087 l cp gs 0.00 setgray ef gr col-1 s % Polyline n 13335 3900 m 13830 4635 l gs col0 s gr % Polyline n 14040 4920 m 14565 5640 l gs col0 s gr % Polyline n 12000 4875 m 11999 4872 l 11998 4866 l 11995 4856 l 11992 4843 l 11989 4826 l 11986 4809 l 11985 4790 l 11985 4772 l 11987 4752 l 11992 4732 l 12000 4710 l 12006 4695 l 12013 4679 l 12021 4662 l 12029 4643 l 12038 4624 l 12047 4603 l 12056 4582 l 12066 4560 l 12076 4537 l 12086 4515 l 12096 4492 l 12107 4469 l 12119 4446 l 12131 4424 l 12144 4403 l 12158 4382 l 12172 4362 l 12188 4342 l 12206 4323 l 12225 4305 l 12242 4290 l 12260 4276 l 12280 4262 l 12300 4248 l 12321 4234 l 12343 4221 l 12366 4208 l 12390 4196 l 12413 4183 l 12438 4171 l 12462 4159 l 12488 4147 l 12513 4135 l 12538 4123 l 12564 4110 l 12589 4098 l 12615 4086 l 12640 4073 l 12666 4060 l 12691 4046 l 12717 4033 l 12743 4019 l 12769 4005 l 12795 3990 l 12818 3977 l 12841 3964 l 12865 3952 l 12889 3939 l 12914 3925 l 12938 3912 l 12964 3899 l 12989 3886 l 13015 3873 l 13041 3860 l 13067 3847 l 13094 3834 l 13120 3820 l 13147 3807 l 13173 3794 l 13200 3780 l 13226 3766 l 13253 3753 l 13279 3739 l 13305 3725 l 13330 3710 l 13356 3695 l 13381 3680 l 13405 3665 l 13429 3649 l 13453 3633 l 13477 3617 l 13500 3600 l 13523 3583 l 13545 3565 l 13568 3547 l 13590 3528 l 13611 3509 l 13633 3490 l 13654 3470 l 13675 3450 l 13695 3430 l 13716 3409 l 13736 3388 l 13756 3368 l 13776 3347 l 13796 3326 l 13816 3304 l 13836 3283 l 13856 3262 l 13876 3241 l 13896 3220 l 13917 3198 l 13937 3177 l 13958 3156 l 13978 3135 l 13999 3114 l 14021 3093 l 14042 3072 l 14063 3051 l 14085 3030 l 14107 3009 l 14129 2987 l 14152 2965 l 14176 2941 l 14201 2917 l 14228 2891 l 14255 2864 l 14285 2835 l 14315 2805 l 14347 2774 l 14380 2742 l 14414 2709 l 14448 2676 l 14482 2643 l 14515 2610 l 14547 2579 l 14577 2549 l 14605 2522 l 14630 2498 l 14652 2476 l 14671 2458 l 14686 2443 l 14697 2432 l 14706 2424 l 14711 2419 l 14714 2416 l 14715 2415 l gs col0 s gr % Polyline n 12450 6075 m 12451 6075 l 12454 6075 l 12459 6074 l 12468 6073 l 12479 6072 l 12496 6070 l 12516 6068 l 12541 6065 l 12571 6062 l 12606 6058 l 12645 6053 l 12688 6048 l 12735 6043 l 12786 6037 l 12839 6031 l 12895 6024 l 12953 6017 l 13012 6010 l 13072 6003 l 13133 5996 l 13194 5988 l 13255 5980 l 13316 5973 l 13376 5965 l 13436 5957 l 13494 5950 l 13553 5942 l 13610 5934 l 13667 5926 l 13723 5918 l 13779 5910 l 13835 5902 l 13890 5894 l 13946 5886 l 14001 5877 l 14057 5869 l 14114 5860 l 14171 5850 l 14230 5841 l 14289 5831 l 14350 5821 l 14412 5811 l 14475 5800 l 14524 5792 l 14574 5783 l 14625 5774 l 14676 5765 l 14729 5756 l 14783 5746 l 14838 5737 l 14893 5727 l 14950 5716 l 15008 5706 l 15067 5695 l 15127 5684 l 15188 5673 l 15249 5661 l 15312 5650 l 15375 5638 l 15440 5625 l 15505 5613 l 15571 5600 l 15637 5588 l 15705 5575 l 15772 5561 l 15840 5548 l 15909 5534 l 15978 5521 l 16047 5507 l 16116 5493 l 16185 5479 l 16254 5465 l 16323 5450 l 16392 5436 l 16460 5422 l 16528 5407 l 16596 5393 l 16663 5379 l 16729 5364 l 16795 5350 l 16860 5336 l 16924 5322 l 16987 5308 l 17049 5294 l 17110 5280 l 17170 5266 l 17228 5252 l 17286 5239 l 17343 5226 l 17398 5212 l 17452 5199 l 17505 5186 l 17556 5173 l 17607 5161 l 17656 5148 l 17703 5135 l 17750 5123 l 17796 5111 l 17840 5099 l 17883 5087 l 17925 5075 l 17990 5056 l 18053 5037 l 18114 5018 l 18173 5000 l 18229 4981 l 18283 4962 l 18336 4943 l 18387 4925 l 18435 4906 l 18482 4887 l 18527 4868 l 18571 4850 l 18612 4831 l 18652 4812 l 18689 4794 l 18725 4775 l 18759 4757 l 18791 4739 l 18821 4721 l 18849 4704 l 18875 4686 l 18899 4669 l 18922 4653 l 18943 4637 l 18962 4621 l 18979 4606 l 18995 4591 l 19010 4577 l 19023 4563 l 19035 4549 l 19046 4536 l 19056 4523 l 19065 4511 l 19073 4498 l 19081 4487 l 19088 4475 l 19100 4452 l 19110 4431 l 19119 4409 l 19126 4387 l 19131 4365 l 19135 4341 l 19137 4317 l 19138 4291 l 19138 4264 l 19137 4237 l 19135 4210 l 19133 4186 l 19131 4164 l 19128 4147 l 19127 4135 l 19126 4128 l 19125 4125 l gs col-1 s gr % Polyline n 18900 3750 m 18899 3747 l 18896 3740 l 18890 3728 l 18883 3712 l 18873 3693 l 18862 3671 l 18850 3650 l 18837 3629 l 18824 3609 l 18810 3591 l 18796 3574 l 18781 3558 l 18764 3542 l 18745 3527 l 18725 3513 l 18711 3503 l 18697 3494 l 18681 3484 l 18664 3475 l 18647 3465 l 18627 3455 l 18607 3446 l 18585 3436 l 18561 3427 l 18537 3418 l 18511 3410 l 18483 3402 l 18455 3394 l 18425 3387 l 18394 3381 l 18363 3376 l 18330 3371 l 18297 3368 l 18264 3365 l 18229 3363 l 18195 3362 l 18159 3363 l 18124 3364 l 18087 3367 l 18050 3370 l 18013 3375 l 17985 3379 l 17956 3384 l 17926 3389 l 17896 3395 l 17865 3402 l 17833 3409 l 17800 3417 l 17767 3426 l 17732 3436 l 17696 3446 l 17660 3456 l 17622 3468 l 17584 3480 l 17545 3492 l 17506 3505 l 17466 3519 l 17425 3533 l 17384 3548 l 17343 3562 l 17302 3578 l 17260 3593 l 17219 3609 l 17178 3625 l 17137 3641 l 17096 3658 l 17055 3674 l 17015 3691 l 16976 3707 l 16937 3724 l 16898 3740 l 16860 3756 l 16822 3773 l 16785 3789 l 16748 3805 l 16711 3821 l 16675 3838 l 16641 3853 l 16606 3868 l 16572 3884 l 16537 3900 l 16502 3916 l 16467 3932 l 16431 3948 l 16395 3965 l 16358 3981 l 16321 3998 l 16283 4015 l 16245 4033 l 16207 4050 l 16168 4068 l 16128 4085 l 16089 4103 l 16049 4120 l 16008 4138 l 15968 4156 l 15928 4173 l 15887 4190 l 15847 4207 l 15806 4224 l 15766 4241 l 15726 4257 l 15686 4273 l 15646 4289 l 15607 4304 l 15568 4319 l 15529 4334 l 15490 4348 l 15452 4362 l 15414 4375 l 15376 4388 l 15338 4401 l 15301 4413 l 15263 4426 l 15225 4438 l 15190 4448 l 15156 4458 l 15120 4469 l 15085 4479 l 15048 4489 l 15011 4499 l 14974 4509 l 14936 4519 l 14897 4529 l 14857 4538 l 14816 4548 l 14775 4558 l 14733 4568 l 14690 4578 l 14647 4587 l 14603 4597 l 14558 4607 l 14513 4616 l 14467 4626 l 14421 4635 l 14374 4645 l 14327 4654 l 14280 4663 l 14232 4673 l 14185 4682 l 14137 4691 l 14089 4700 l 14041 4709 l 13994 4718 l 13946 4726 l 13899 4735 l 13852 4743 l 13805 4752 l 13758 4760 l 13711 4768 l 13665 4776 l 13619 4784 l 13573 4793 l 13526 4801 l 13480 4809 l 13434 4817 l 13388 4825 l 13343 4833 l 13298 4841 l 13252 4849 l 13206 4857 l 13160 4865 l 13112 4874 l 13065 4882 l 13016 4891 l 12967 4900 l 12918 4909 l 12868 4918 l 12817 4928 l 12766 4937 l 12715 4947 l 12663 4957 l 12612 4967 l 12559 4977 l 12507 4988 l 12455 4998 l 12404 5009 l 12352 5019 l 12301 5030 l 12250 5041 l 12199 5052 l 12150 5063 l 12101 5074 l 12053 5084 l 12006 5095 l 11960 5106 l 11915 5117 l 11871 5128 l 11828 5139 l 11786 5149 l 11746 5160 l 11707 5170 l 11669 5181 l 11633 5191 l 11597 5201 l 11564 5212 l 11531 5222 l 11500 5232 l 11469 5242 l 11440 5252 l 11413 5263 l 11371 5279 l 11331 5295 l 11294 5311 l 11259 5328 l 11226 5345 l 11195 5362 l 11166 5380 l 11139 5398 l 11113 5416 l 11089 5434 l 11068 5453 l 11048 5472 l 11030 5490 l 11014 5509 l 11000 5528 l 10988 5546 l 10977 5564 l 10968 5582 l 10961 5600 l 10955 5617 l 10951 5634 l 10948 5650 l 10946 5665 l 10945 5681 l 10945 5696 l 10946 5710 l 10948 5724 l 10950 5738 l 10954 5756 l 10959 5775 l 10965 5793 l 10972 5811 l 10981 5828 l 10990 5846 l 11001 5863 l 11012 5880 l 11025 5897 l 11039 5913 l 11053 5928 l 11068 5943 l 11084 5956 l 11100 5969 l 11116 5981 l 11133 5991 l 11149 6001 l 11166 6010 l 11183 6018 l 11200 6025 l 11217 6032 l 11235 6037 l 11254 6043 l 11274 6047 l 11296 6051 l 11319 6055 l 11344 6058 l 11372 6061 l 11402 6064 l 11433 6066 l 11466 6068 l 11499 6070 l 11530 6072 l 11559 6073 l 11583 6074 l 11602 6074 l 11614 6075 l 11622 6075 l 11625 6075 l gs col-1 s gr % Polyline 45.000 slw n 11400 2400 m 20100 2400 l 20100 1500 l 11400 1500 l cp gs col0 s gr % Polyline n 11400 6600 m 15600 6600 l 15600 7500 l 11400 7500 l cp gs col0 s gr $F2psEnd rs %%EndDocument @endspecial 763 4050 a FP(Figure)32 b(4.9.)40 b FQ(A)28 b(ribb)r(on)g(tangle)f(and)g(the)h(corresp)r(onding)e(sp)r(ecial)h (link.)605 4274 y(Then)19 b(the)f(de\014nition)h(of)f(the)h(previous)e (section)h(giv)n(es)g FJ(F)2374 4244 y FE(\000)p FM(1)2463 4274 y FQ(\()p FJ(X)7 b FQ(\))23 b FL(2)g(h)p FJ(W)2814 4286 y FI(t)2839 4295 y FF(b)q(ot)2931 4274 y FL(i)2963 4244 y FE(\003)3002 4274 y FL(\012h)p FJ(W)p 3177 4252 116 3 v 22 x FI(t)3202 4304 y FF(top)3292 4274 y FL(i)3324 4244 y FE(\003)3386 4274 y FL(')456 4388 y FQ(Hom\()p FL(h)p FJ(W)771 4400 y FI(t)796 4409 y FF(b)q(ot)888 4388 y FL(i)p FJ(;)14 b FL(h)p FJ(W)1067 4400 y FI(t)1092 4408 y FF(top)1183 4388 y FL(i)p FQ(\).)37 b(W)-7 b(e)27 b(claim)f(that)h(this)f(op)r(erator)f(is)h(giv)n(en)f(b)n(y)h(\010)d FL(7!)g FJ(F)3007 4358 y FE(\000)p FM(1)3097 4388 y FQ(\()p FJ(T)12 b FQ(\)\010.)36 b(In-)456 4488 y(deed,)27 b(it)h(su\016ces)g (to)f(pro)n(v)n(e)f(that)i(for)f(\010)c FL(2)g(h)p FJ(W)1941 4500 y FI(t)1966 4509 y FF(b)q(ot)2059 4488 y FL(i)p FJ(;)14 b FQ(\011)23 b FL(2)g(h)p FJ(W)p 2404 4465 V 21 x FI(t)2429 4517 y FF(top)2520 4488 y FL(i)p FQ(,)28 b(w)n(e)f(ha)n(v)n(e)584 4801 y FJ(F)649 4766 y FE(\000)p FM(1)738 4801 y FQ(\()p FJ(X)7 b FQ(\)\(\010)p FJ(;)14 b FQ(\011\))23 b(=)f(\()p FK(1)1346 4754 y FM(\010)p FE(\012)p FM(\011)1318 4801 y FL(\000)-26 b(\000)-19 b(\000)-27 b(!)24 b FJ(W)1626 4813 y FI(t)1651 4822 y FF(b)q(ot)1761 4801 y FL(\012)18 b FJ(W)p 1922 4778 V 21 x FI(t)1947 4830 y FF(top)2089 4746 y FI(F)2140 4721 y Fx(\000)p FF(1)2218 4746 y FM(\()p FI(T)9 b FM(\))p FE(\012)p FM(id)2061 4801 y FL(\000)-26 b(\000)-18 b(\000)f(\000)g (\000)g(\000)g(\000)-26 b(!)23 b FJ(W)2554 4813 y FI(t)2579 4821 y FF(top)2689 4801 y FL(\012)18 b FJ(W)p 2850 4778 V 21 x FI(t)2875 4830 y FF(top)3017 4733 y FI(e)3048 4741 y FG(t)3071 4752 y FF(top)2988 4801 y FL(\000)-28 b(\000)-19 b(\000)-29 b(!)23 b FK(1)p FQ(\))p FJ(:)456 4957 y FQ(This)k(is)h(immediate)g(from)f(the)h(de\014nition.)605 5116 y(The)d(same)g(statemen)n(t)g(holds)g(if)h(w)n(e)e(allo)n(w)g FJ(T)37 b FQ(to)25 b(b)r(e)g(a)g(partially)f(colored)g(ribb)r(on)h (tangle)456 5216 y(whic)n(h)h(is)f(allo)n(w)n(ed)g(to)h(ha)n(v)n(e)f (uncolored)g(strands)g(ending)h(at)f(the)i(top)f(or)f(b)r(ottom,)i(as)e (long)g(as)p eop %%Page: 88 18 88 91 bop 456 226 a FM(88)404 b(4.)29 b(3-DIMENSIONAL)g(TOPOLOGICAL)h (QUANTUM)f(FIELD)g(THEOR)-5 b(Y)456 425 y FQ(the)28 b(t)n(w)n(o)e(ends) i(of)g(an)n(y)e(suc)n(h)i(strand)f(are)f(next)i(to)f(eac)n(h)g(other,)g (and)h(w)n(e)f(de\014ne)1166 572 y FJ(F)1231 537 y FE(\000)p FM(1)1320 572 y FQ(\()p FJ(T)12 b FQ(\))23 b(=)1556 493 y Fy(M)1604 667 y FI(c)1695 572 y FJ(d)1738 584 y FI(c)1772 572 y FJ(F)1837 537 y FE(\000)p FM(1)1926 572 y FQ(\()p FJ(T)7 b(;)14 b(c)p FQ(\))9 b(:)28 b FJ(W)2257 584 y FI(t)2282 593 y FF(b)q(ot)2397 572 y FL(!)23 b FJ(W)2581 584 y FI(t)2606 592 y FF(top)2697 572 y FJ(;)456 781 y FQ(where)37 b FJ(c)9 b FQ(:)32 b FJ(U)49 b FL(!)41 b FJ(I)k FQ(is)38 b(a)g(coloring)e(\(here)i FJ(U)47 b FQ(is)38 b(the)h(set)f(of)g(all)g(uncolored)f(strands\),)k(and)456 881 y FJ(d)499 893 y FI(c)569 881 y FQ(=)670 818 y Fy(Q)762 881 y FJ(d)805 896 y FI(c)p FM(\()p FI(u)p FM(\))966 881 y FQ(o)n(v)n(er)34 b(all)h(ann)n(uli)h(and)f(the)h(strands)f(whic)n (h)g(end)h(at)f(the)h(top)g(\(but)h(not)e(the)456 981 y(b)r(ottom!\).)51 b(In)32 b(this)h(case,)g(the)f(statemen)n(t)g(is)h (a)e(little)i(bit)g(less)f(ob)n(vious,)g(since)g(one)g(has)g(to)456 1080 y(c)n(hec)n(k)26 b(the)i(normalizations.)605 1180 y(Th)n(us,)40 b(w)n(e)d(see)f(that)i(as)f(a)g(sp)r(ecial)g(case,)h(the) g(op)r(erators)e FJ(F)2593 1150 y FE(\000)p FM(1)2682 1180 y FQ(\()p FJ(X)7 b FQ(\))37 b(for)g(sp)r(ecial)g(links)456 1279 y(con)n(tain)26 b(the)i(op)r(erators)e FJ(F)1324 1249 y FE(\000)p FM(1)1413 1279 y FQ(\()p FJ(T)12 b FQ(\))27 b(for)g(an)n(y)g(partially)g(colored)f(tangle)h FJ(T)12 b FQ(.)605 1379 y(Next,)28 b(let)g(us)g(see)f(ho)n(w)g(the)h(v)n (ectors)e FJ(\034)9 b FQ(\()p FJ(M)g FQ(\))28 b(lo)r(ok)f(in)h(the)g (simplest)g(examples.)605 1523 y FP(Example)j FQ(4.5.2)p FP(.)40 b FQ(Let)27 b FJ(T)39 b FQ(b)r(e)27 b(a)g FL(C)5 b FQ(-colored)25 b(ribb)r(on)i(tangle)g(suc)n(h)g(that)h FJ(bottom)p FQ(\()p FJ(T)12 b FQ(\))22 b(=)h FL(;)p FQ(,)456 1623 y FJ(top)p FQ(\()p FJ(T)12 b FQ(\))25 b(=)h FJ(t)p FQ(;)31 b(th)n(us,)f FJ(F)1166 1593 y FE(\000)p FM(1)1255 1623 y FQ(\()p FJ(T)12 b FQ(\))d(:)28 b FK(1)e FL(!)g FJ(W)1701 1635 y FI(t)1761 1623 y FQ(is)j(a)g(v)n(ector)f(in)i FL(h)p FJ(W)2377 1635 y FI(t)2407 1623 y FL(i)p FQ(.)43 b(Let)30 b FJ(M)38 b FQ(b)r(e)30 b(the)g(unit)g(ball)f(in)456 1723 y FH(R)510 1692 y FM(3)586 1723 y FQ(with)k(the)g(tangle)f FJ(T)44 b FQ(placed)32 b(inside)h(so)f(that)h(the)g(top)g(of)g FJ(T)44 b FQ(is)32 b(on)h(the)g(equator)e(of)i(the)456 1822 y(standard)f(sphere)h FJ(S)1129 1792 y FM(2)1200 1822 y FQ(=)g FJ(@)5 b(M)k FQ(.)54 b(Then)34 b(it)g(immediately)g (follo)n(ws)f(from)g(the)i(de\014nition)f(and)456 1922 y(the)28 b(previous)e(example)h(that)h FJ(\034)9 b FQ(\()p FJ(M)g FQ(\))24 b(=)f FJ(F)1810 1892 y FE(\000)p FM(1)1899 1922 y FQ(\()p FJ(T)12 b FQ(\))22 b FL(2)i(h)p FJ(W)2235 1934 y FI(t)2265 1922 y FL(i)p FQ(.)605 2021 y(More)35 b(generally)-7 b(,)37 b(let)f FJ(T)47 b FQ(b)r(e)36 b(an)n(y)f FL(C)5 b FQ(-colored)34 b(ribb)r(on)h(tangle,)j(with)e FJ(bottom)p FQ(\()p FJ(T)12 b FQ(\))37 b(=)f FJ(t)3384 2033 y FM(1)3421 2021 y FQ(,)456 2121 y FJ(top)p FQ(\()p FJ(T)12 b FQ(\))22 b(=)h FJ(t)833 2133 y FM(2)870 2121 y FQ(,)28 b(and)f(let)h FJ(M)36 b FQ(b)r(e)28 b(the)g(domain)1338 2257 y FL(f)p FK(x)23 b FL(2)g FH(R)1585 2222 y FM(3)1652 2257 y FL(j)g FQ(1)f FL(\024)h(k)p FK(x)p FL(k)f(\024)h FQ(2)p FL(g)f(')h FJ(S)2344 2222 y FM(2)2399 2257 y FL(\002)18 b FJ(I)7 b(;)456 2392 y FQ(with)31 b(the)g(tangle)f FJ(T)42 b FQ(placed)31 b(inside)g(so)f(that)h(the)g(b)r(ottom)g(of)g FJ(T)42 b FQ(is)31 b(placed)f(on)h(the)g(equator)456 2491 y(of)26 b(the)h(inner)f(sphere)g FL(k)p FK(x)p FL(k)c FQ(=)h(1,)j(and)g(the)h(top)g(of)f FJ(T)37 b FQ(is)27 b(placed)f(on)g(the)h(equator)e(of)h(the)h(outer)456 2591 y(sphere)g FL(k)p FK(x)p FL(k)22 b FQ(=)h(2.)36 b(Then)28 b FJ(F)1342 2561 y FE(\000)p FM(1)1431 2591 y FQ(\()p FJ(T)12 b FQ(\))d(:)28 b FL(h)p FJ(W)1726 2603 y FI(t)1751 2611 y FF(1)1788 2591 y FL(i)23 b(!)g(h)p FJ(W)2059 2603 y FI(t)2084 2611 y FF(2)2122 2591 y FL(i)28 b FQ(and)1128 2725 y FJ(\034)9 b FQ(\()p FJ(M)g FQ(\))24 b FL(2)f(h)p FJ(W)1539 2737 y FI(t)1564 2745 y FF(1)1601 2725 y FL(i)1633 2691 y FE(\003)1690 2725 y FL(\012)18 b(h)p FJ(W)1883 2737 y FI(t)1908 2745 y FF(2)1946 2725 y FL(i)23 b(')g FQ(Hom\()p FL(h)p FJ(W)2404 2737 y FI(t)2429 2745 y FF(1)2466 2725 y FL(i)p FJ(;)14 b FL(h)p FJ(W)2645 2737 y FI(t)2670 2745 y FF(2)2708 2725 y FL(i)p FQ(\))456 2870 y(is)27 b(giv)n(en)g(b)n(y)g(\010)c FL(7!)g FJ(F)1125 2840 y FE(\000)p FM(1)1214 2870 y FQ(\()p FJ(T)12 b FQ(\)\010)28 b(for)f(\010)9 b(:)28 b FK(1)22 b FL(!)h FJ(W)1928 2882 y FI(t)1953 2890 y FF(1)1991 2870 y FQ(.)605 3014 y(The)33 b(next)f(sev)n(eral)f(examples)h(deal)g(with)h(the)g(case)f(when)h FJ(g)s FQ(\()p FJ(t)p FQ(\))e(=)g(1,)j(so)e(that)h(\006)3253 3026 y FI(t)3314 3014 y FQ(is)g(a)456 3114 y(torus.)53 b(W)-7 b(e)34 b(will)g(mak)n(e)e(hea)n(vy)h(use)g(of)h(the)f(results)g (of)h(Examples)e(4.1.2,)i(4.1.10.)52 b(W)-7 b(e)34 b(will)456 3214 y(iden)n(tify)h(our)f(\\standard)f(torus")h(\006)1637 3226 y FI(t)1701 3214 y FQ(with)h(the)g(torus)f(considered)g(in)h (these)g(examples)f(so)456 3313 y(that)26 b(the)h(cycles)e FJ(\013;)14 b(\014)28 b FL(2)23 b FQ(H)1317 3325 y FM(1)1355 3313 y FQ(\(\006)1447 3325 y FI(t)1476 3313 y FQ(\))k(sho)n(wn)e(b)r (elo)n(w)h(corresp)r(ond)f(to)h FJ(\013;)14 b(\014)31 b FQ(sho)n(wn)25 b(in)i(Figure)e(4.1.)605 3457 y FP(Example)31 b FQ(4.5.3)p FP(.)40 b FQ(Let)27 b FJ(t)c FQ(=)g(\()p FJ(H)7 b FQ(\),)28 b(so)f(that)h(the)g(handleb)r(o)r(dy)g FJ(M)2672 3469 y FI(t)2728 3457 y FQ(is)f(the)h(solid)f(torus)g FJ(T)12 b FQ(,)456 3557 y(and)26 b FJ(@)5 b(T)34 b FQ(=)22 b(\006)895 3569 y FI(t)951 3557 y FQ(is)k(a)g(torus)g(with)h(no)f(mark) n(ed)f(p)r(oin)n(ts.)36 b(By)28 b(\(4.4.4\))o(,)f FJ(\034)9 b FQ(\(\006)2743 3569 y FI(t)2773 3557 y FQ(\))23 b(=)g(Hom)3089 3569 y FE(C)3132 3557 y FQ(\()p FK(1)p FJ(;)14 b(H)7 b FQ(\))23 b(=)456 3594 y Fy(L)548 3681 y FI(i)p FE(2)p FI(I)668 3657 y FQ(Hom)841 3669 y FE(C)884 3657 y FQ(\()p FK(1)p FJ(;)14 b(V)1049 3669 y FI(i)1101 3657 y FL(\012)23 b FJ(V)1256 3626 y FE(\003)1237 3678 y FI(i)1295 3657 y FQ(\).)61 b(W)-7 b(e)37 b(claim)e(that)h(the)h(v)n(ector)d FJ(\034)9 b FQ(\()p FJ(T)j FQ(\))37 b FL(2)g FJ(\034)9 b FQ(\()p FJ(@)c(T)12 b FQ(\))36 b(is)g(exactly)f(the)456 3756 y(image)26 b(of)i(the)g(iden)n(tit)n(y)g(morphism)f(id)9 b(:)28 b FK(1)23 b FL(!)g FK(1)18 b FL(\012)g FK(1)c FQ(\()p FL(2)23 b FQ(Hom)2428 3768 y FE(C)2471 3756 y FQ(\()p FK(1)p FJ(;)14 b(V)2636 3768 y FM(0)2692 3756 y FL(\012)k FJ(V)2842 3726 y FE(\003)2823 3777 y FM(0)2881 3756 y FQ(\)\))p FJ(:)605 3901 y FP(Pr)n(oof.)41 b FQ(The)22 b(pro)r(of)f(is)h(based)f(on)h(the)g(fact)g(that)g(the)h(standard)e (torus)g(can)g(b)r(e)i(obtained)456 4000 y(as)k(a)g(result)g(of)h (surgery)d(of)j FJ(S)1397 3970 y FM(3)1462 4000 y FQ(along)e(the)i(sp)r (ecial)f(link)h(sho)n(wn)f(in)h(Figure)f(4.10.)1611 4446 y FJ(X)j FQ(=)1797 4742 y @beginspecial 0 @llx 0 @lly 59 @urx 71 @ury 590 @rwi @setspecial %%BeginDocument: figures/link1.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: link1.eps %%Creator: fig2dev Version 3.2 Patchlevel 0-beta3 %%CreationDate: Thu Nov 19 16:03:19 1998 %%For: shurik@localhost.localdomain (Alexander Kirillov,,,) %%Orientation: Portrait %%BoundingBox: 0 0 59 71 %%Pages: 0 %%BeginSetup %%EndSetup %%Magnification: 0.2000 %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -158.0 83.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n -1000 7858 m -1000 -1000 l 19033 -1000 l 19033 7858 l cp clip 0.01200 0.01200 sc % Arc 30.000 slw gs n 15620.4 2862.7 1799.3 147.7 165.9 arcn gs col-1 s gr gr % Arc gs n 15562.5 4837.5 2062.8 -27.0 27.0 arc gs col-1 s gr gr % Arc gs n 15598.1 4870.0 2013.0 -44.9 153.3 arcn gs col-1 s gr gr % Polyline n 13200 5775 m 18000 5775 l 18000 6825 l 13200 6825 l cp gs col-1 s gr $F2psEnd rs %%EndDocument @endspecial 1710 4942 a FP(Figure)i(4.10)605 5116 y FQ(Indeed,)d(p)r(erforming)e(the)i(surgery)e(along)g(the)h(ann)n(ulus,) h(w)n(e)f(get)g FJ(S)2778 5086 y FM(2)2834 5116 y FL(\002)18 b FJ(S)2973 5086 y FM(1)3038 5116 y FQ(\(see)29 b(Exam-)456 5216 y(ple)23 b(4.1.10\(ii\)\);)h(after)g(this,)g(w)n(e)f(cut)h(a)f (neigh)n(b)r(orho)r(o)r(d)g(of)g(the)h(coup)r(on,)g(whic)n(h)f(is)h (isomorphic)p eop %%Page: 89 19 89 92 bop 1710 226 a FM(4.5.)29 b(EXAMPLES)1164 b(89)456 425 y FQ(to)25 b(a)g(solid)g(torus)g FJ(T)1074 437 y FM(0)1111 425 y FQ(.)36 b(But)26 b(b)n(y)g(Example)e(4.1.2\(i\),)i(the) g(complemen)n(t)f(of)h(a)f(torus)g(in)h FJ(S)3221 395 y FM(2)3272 425 y FL(\002)14 b FJ(S)3407 395 y FM(1)456 525 y FQ(is)30 b(again)e(a)i(torus)g(\(of)g(course,)f(one)h(also)f(has) h(to)g(c)n(hec)n(k)f(that)h(the)h(attac)n(hmen)n(t)f(maps)f(giv)n(en) 456 624 y(b)n(y)e(the)h(link)g FJ(X)34 b FQ(are)26 b(the)i(same)f(as)g (in)h(Example)f(4.1.2\(i\)|w)n(e)f(lea)n(v)n(e)h(it)h(to)f(the)h (reader\).)605 724 y(By)35 b(Example)g(4.5.1,)h(the)f(corresp)r(onding) f(R)-7 b(T)35 b(in)n(v)-5 b(arian)n(t)34 b FJ(F)2589 694 y FE(\000)p FM(1)2678 724 y FQ(\()p FJ(X)7 b FQ(\))36 b FL(2)g(h)p FJ(H)7 b FL(i)36 b FQ(coincides)456 824 y(with)27 b FJ(F)709 794 y FE(\000)p FM(1)798 824 y FQ(\()p FJ(L)p FQ(\),)g(where)g FJ(L)g FQ(is)f(obtained)h(from)g(the)g(tangle)g FJ(X)33 b FQ(b)n(y)27 b(remo)n(ving)e(the)i(coup)r(on.)37 b(By)456 923 y(\(3.1.19,)26 b(3.1.20\),)g FJ(F)1111 893 y FE(\000)p FM(1)1200 923 y FQ(\()p FJ(L)p FQ(\))i(is)f(equal)g(to)h (id)9 b(:)28 b FK(1)23 b FL(!)g FJ(V)2107 935 y FM(0)2163 923 y FL(\012)18 b FJ(V)2313 893 y FE(\003)2294 944 y FM(0)2374 923 y FL(\032)23 b FJ(H)7 b FQ(.)p 3384 923 4 57 v 3388 871 50 4 v 3388 923 V 3437 923 4 57 v 605 1076 a FP(Remark)32 b FQ(4.5.4)p FP(.)39 b FQ(In)30 b(the)g(same)g(w)n (a)n(y)e(one)h(can)h(pro)n(v)n(e)e(that)i(for)f(the)h(solid)f(handleb)r (o)r(dy)456 1176 y FJ(T)505 1188 y FI(g)570 1176 y FQ(of)f(gen)n(us)f FJ(g)j FQ(one)d(has)928 1315 y FJ(\034)9 b FQ(\()p FJ(T)1054 1327 y FI(g)1093 1315 y FQ(\))24 b(=)e(\(id)10 b(:)28 b FK(1)23 b FL(!)g FQ(\()p FK(1)18 b FL(\012)g FK(1)p FQ(\))1836 1281 y FE(\012)p FI(g)1927 1315 y FQ(\))23 b FL(2)g FJ(\034)9 b FQ(\()p FJ(@)c(T)2235 1327 y FI(g)2274 1315 y FQ(\))24 b(=)e(Hom)2590 1327 y FE(C)2633 1315 y FQ(\()p FK(1)p FJ(;)14 b(H)2826 1281 y FE(\012)p FI(g)2916 1315 y FQ(\))p FJ(:)-2515 b FQ(\(4.5.1\))605 1471 y FP(Example)31 b FQ(4.5.5)p FP(.)40 b FQ(Let)19 b FJ(t)k FQ(=)f(\(\()p FJ(W)n(;)14 b FL(\000)p FQ(\))p FJ(;)g(H)7 b FQ(\),)22 b(so)c(that)h(\006)2304 1483 y FI(t)2352 1471 y FQ(is)g(the)g (2-dimensional)f(torus)g(with)456 1570 y(one)30 b(mark)n(ed)f(p)r(oin)n (t,)i(and)f FJ(\034)9 b FQ(\(\006)1453 1582 y FI(t)1483 1570 y FQ(\))28 b(=)f FL(h)p FJ(W)1757 1540 y FE(\003)1796 1570 y FJ(;)14 b(H)7 b FL(i)27 b FQ(=)h(Hom)2234 1582 y FE(C)2277 1570 y FQ(\()p FJ(W)n(;)14 b(H)7 b FQ(\).)45 b(Let)31 b FJ(S)14 b FQ(:)28 b(\006)2926 1582 y FI(t)2983 1570 y FL(!)g FQ(\006)3154 1582 y FI(t)3213 1570 y FQ(b)r(e)j(the)456 1670 y(homeomorphism)20 b(corresp)r(onding)g(to)i(the)h(matrix)e FJ(S)28 b FL(2)23 b FQ(SL)2354 1682 y FM(2)2392 1670 y FQ(\()p FH(Z)o FQ(\))17 b(de\014ned)22 b(in)g(Theorem)g(4.1.4.)456 1770 y(Then)27 b(w)n(e)h(claim)f(that)h FJ(S)1247 1782 y FE(\003)1294 1770 y FQ(:)42 b(Hom)1532 1782 y FE(C)1575 1770 y FQ(\()p FJ(W)n(;)14 b(H)7 b FQ(\))23 b FL(!)g FQ(Hom)2130 1782 y FE(C)2173 1770 y FQ(\()p FJ(W)n(;)14 b(H)7 b FQ(\))28 b(coincides)f(with)h(the)g(op)r(erator)456 1869 y FJ(S)507 1881 y FI(W)610 1869 y FQ(de\014ned)g(in)g(Theorem)e (3.1.17.)605 2020 y FP(Pr)n(oof.)41 b FQ(Let)35 b(us)h(consider)e(the)i (manifold)f FJ(M)45 b FQ(=)35 b(\006)2323 2032 y FI(t)2376 2020 y FL(\002)23 b FJ(I)7 b FQ(,)38 b(so)d(that)g FJ(@)5 b(M)45 b FQ(=)35 b(\006)3200 2032 y FI(t)3253 2020 y FL(t)p 3332 1953 90 4 v 24 w FQ(\006)3392 2032 y FI(t)3421 2020 y FQ(,)456 2120 y(with)i(the)h(parameterization)d(of)i(the)h(b)r (oundaries)e(giv)n(en)h(b)n(y)g(id)14 b FL(t)p FJ(S)5 b FQ(.)66 b(W)-7 b(e)37 b(claim)g(that)h FJ(M)456 2219 y FQ(can)28 b(b)r(e)h(obtained)f(from)g FJ(S)1318 2189 y FM(3)1384 2219 y FQ(b)n(y)g(a)g(surgery)f(along)g(the)i(partially)f (colored)f(link)i FJ(X)34 b FQ(sho)n(wn)28 b(in)456 2319 y(Figure)f(4.11.)1551 2731 y FJ(X)i FQ(=)1783 2981 y @beginspecial 0 @llx 0 @lly 68 @urx 60 @ury 680 @rwi @setspecial %%BeginDocument: figures/omt2i2.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: omt2i2.eps %%Creator: fig2dev Version 3.2 Patchlevel 0-beta3 %%CreationDate: Thu Nov 19 16:11:52 1998 %%For: shurik@localhost.localdomain (Alexander Kirillov,,,) %%Orientation: Portrait %%BoundingBox: 0 0 68 60 %%Pages: 0 %%BeginSetup %%EndSetup %%Magnification: 0.2000 %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -127.0 77.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n -1000 7344 m -1000 -1000 l 17244 -1000 l 17244 7344 l cp clip 0.01200 0.01200 sc % Arc 30.000 slw gs n 14262.5 2662.5 1363.0 35.3 -11.1 arcn gs col-1 s gr gr % Arc gs n 14400.0 4837.5 2339.8 -158.4 173.6 arcn gs col-1 s gr gr % Arc gs n 13837.5 4812.5 1785.8 9.3 -133.9 arcn gs col-1 s gr gr % Arc gs n 13802.7 2610.9 1815.0 -173.3 48.7 arcn gs col-1 s gr gr % Polyline 45.000 slw n 10800 5100 m 16200 5100 l 16200 6300 l 10800 6300 l cp gs col0 s gr % Polyline n 10800 2400 m 16200 2400 l 16200 1500 l 10800 1500 l cp gs col0 s gr % Polyline 30.000 slw gs clippath 11340 2953 m 11400 2521 l 11460 2953 l 11460 2355 l 11340 2355 l cp clip n 11400 2400 m 11400 5100 l gs col0 s gr gr % arrowhead n 11340 2953 m 11400 2521 l 11460 2953 l 11400 2882 l 11340 2953 l cp gs 0.00 setgray ef gr col0 s /Times-Roman ff 750.00 scf sf 10650 4275 m gs 1 -1 sc (W) col0 sh gr $F2psEnd rs %%EndDocument @endspecial 1710 3180 a FP(Figure)j(4.11)605 3367 y FQ(Indeed,)27 b(in)f(this)h(case)e(w)n(e)h(do)g(not)g(ha)n(v)n(e)f(to)h (do)g(an)n(y)g(surgery)e(at)i(all)g(but)h(just)g(to)f(remo)n(v)n(e)456 3466 y(from)39 b FJ(S)720 3436 y FM(3)797 3466 y FQ(the)i(t)n(w)n(o)e (link)n(ed)h(solid)f(tori|the)h(neigh)n(b)r(orho)r(o)r(ds)f(of)h(the)g (t)n(w)n(o)f(coup)r(ons.)74 b(By)456 3566 y(Example)26 b(4.1.2\(ii\),)h(this)g(giv)n(es)f(a)g(cylinder)h(\006)1940 3578 y FI(t)1987 3566 y FL(\002)17 b FJ(I)7 b FQ(.)36 b(As)28 b(b)r(efore,)f(w)n(e)f(lea)n(v)n(e)g(it)i(to)e(the)i(reader)456 3666 y(to)22 b(c)n(hec)n(k)g(that)i(parameterization)d(of)h(the)i(b)r (oundaries)e(giv)n(en)g(b)n(y)h FJ(X)29 b FQ(coincides)22 b(with)i(the)f(one)456 3765 y(giv)n(en)j(in)i(Example)f(4.1.2\(ii\).)36 b(After)28 b(this,)g(the)g(result)g(follo)n(ws)e(form)h(Example)g (4.5.1.)p 3384 3765 4 57 v 3388 3713 50 4 v 3388 3765 V 3437 3765 4 57 v 605 3918 a(This)38 b(explains)g(wh)n(y)g(w)n(e)f (de\014ned)i(the)f(op)r(erator)f FJ(S)14 b FQ(:)31 b FJ(H)47 b FL(!)41 b FJ(H)k FQ(b)n(y)38 b(this)g(picture|cf.)456 4017 y(\(3.1.32\))n(.)605 4168 y FP(Exer)n(cise)32 b FQ(4.5.6)p FP(.)40 b FQ(In)18 b(a)g(similar)g(w)n(a)n(y)-7 b(,)19 b(pro)n(v)n(e)d(that)j FJ(T)2270 4180 y FE(\003)2317 4168 y FQ(:)42 b(Hom)2555 4180 y FE(C)2598 4168 y FQ(\()p FJ(W)n(;)14 b(H)7 b FQ(\))23 b FL(!)g FQ(Hom)3153 4180 y FE(C)3196 4168 y FQ(\()p FJ(W)n(;)14 b(H)7 b FQ(\))456 4268 y(coincides)27 b(with)h(the)g(op)r(erator)e FJ(T)1523 4280 y FI(W)1625 4268 y FQ(de\014ned)i(in)g(Theorem)f(3.1.17.)605 4419 y FP(Example)k FQ(4.5.7)p FP(.)40 b FQ(Let)31 b(us)g(c)n(hec)n(k)f (the)i(normalization)d(axiom.)47 b(F)-7 b(or)30 b(simplicit)n(y)-7 b(,)32 b(let)g(us)456 4518 y(consider)i FJ(t)i FQ(=)f(\(\()p FJ(W)n(;)14 b FL(\000)p FQ(\))p FJ(;)g(H)7 b FQ(\),)38 b(so)d(that)h(\006)1791 4530 y FI(t)1855 4518 y FQ(is)f(the)h(torus)f (with)h(1)f(mark)n(ed)f(p)r(oin)n(t,)j FJ(\034)9 b FQ(\(\006)3281 4530 y FI(t)3312 4518 y FQ(\))36 b(=)456 4618 y(Hom)629 4630 y FE(C)672 4618 y FQ(\()p FJ(W)n(;)14 b(H)7 b FQ(\).)38 b(Let)29 b FJ(M)36 b FQ(b)r(e)29 b(the)f(cylinder)g(\006)1887 4630 y FI(t)1935 4618 y FL(\002)18 b FJ(I)7 b FQ(,)29 b FJ(I)h FQ(=)24 b([0)p FJ(;)14 b FQ(1].)37 b(Let)29 b(us)f(c)n(hec)n(k)f(that)h FJ(\034)9 b FQ(\()p FJ(M)g FQ(\))25 b(=)456 4717 y(id)e FL(2)g FQ(Hom\()p FJ(\034)9 b FQ(\(\006)968 4729 y FI(t)999 4717 y FQ(\))p FJ(;)14 b(\034)9 b FQ(\(\006)1205 4729 y FI(t)1235 4717 y FQ(\)\).)605 4817 y(One)23 b(can)g(represen)n(t)f FJ(M)31 b FQ(as)23 b FJ(M)1569 4829 y FI(X)1655 4817 y FQ(with)g FJ(X)30 b FQ(from)23 b(Figure)f(4.12)g(b)r(elo)n(w.)35 b(Indeed,)25 b(a)d(surgery)456 4917 y(of)28 b FJ(S)607 4887 y FM(3)672 4917 y FQ(along)f FL(\015)h FQ(giv)n(es)f FJ(S)1265 4887 y FM(2)1320 4917 y FL(\002)19 b FJ(S)1460 4887 y FM(1)1497 4917 y FQ(,)28 b(as)f(w)n(e)h(already)f(discussed)g(in)i(Example)e (4.1.10\(ii\).)37 b(Then)456 5016 y(w)n(e)23 b(cut)i(t)n(w)n(o)f(solid) f(tori)h(from)g FJ(S)1461 4986 y FM(2)1510 5016 y FL(\002)12 b FJ(S)1643 4986 y FM(1)1679 5016 y FQ(.)36 b(But)25 b FJ(S)1956 4986 y FM(2)2004 5016 y FL(\002)12 b FJ(S)2137 4986 y FM(1)2198 5016 y FQ(can)24 b(b)r(e)g(also)g(obtained)g(b)n(y)g (gluing)f(t)n(w)n(o)456 5116 y(solid)33 b(tori)g(along)f(their)i(b)r (oundaries,)g(see)f(Example)g(4.1.2\(ii\).)54 b(No)n(w)33 b(remo)n(ving)f(t)n(w)n(o)h(solid)456 5216 y(tori)27 b(from)g FJ(S)865 5185 y FM(2)920 5216 y FL(\002)18 b FJ(S)1059 5185 y FM(1)1096 5216 y FQ(,)28 b(w)n(e)f(get)h FJ(T)1469 5185 y FM(2)1523 5216 y FL(\002)18 b FJ(I)7 b FQ(.)p eop %%Page: 90 20 90 93 bop 456 226 a FM(90)404 b(4.)29 b(3-DIMENSIONAL)g(TOPOLOGICAL)h (QUANTUM)f(FIELD)g(THEOR)-5 b(Y)1549 631 y FJ(X)29 b FQ(=)1735 877 y @beginspecial 0 @llx 0 @lly 74 @urx 59 @ury 740 @rwi @setspecial %%BeginDocument: figures/omt2i.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: omt2i.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Thu Apr 10 20:21:42 1997 %%For: bakalov@schauder (Bojko Bakalov) %Magnification: 0.20 %%Orientation: Portrait %%BoundingBox: 0 0 74 59 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -129.0 87.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.01200 0.01200 sc 30.000 slw % Arc gs n 13802.7 2610.9 1815.0 -173.3 48.7 arcn gs col-1 s gr gr % Arc gs clippath 15525 2915 m 15602 2480 l 15705 2910 l 15689 2352 l 15509 2358 l cp clip n 14262.5 2662.5 1363.0 35.3 -11.1 arcn gs col-1 s gr gr % arrowhead n 15525 2915 m 15602 2480 l 15705 2910 l 15613 2841 l 15525 2915 l cp gs 0.00 setgray ef gr col-1 s % Arc gs clippath 12075 6685 m 11997 7119 l 11895 6690 l 11911 7248 l 12091 7242 l cp clip n 13337.5 6937.5 1363.0 -144.7 168.9 arcn gs col-1 s gr gr % arrowhead n 12075 6685 m 11997 7119 l 11895 6690 l 11987 6759 l 12075 6685 l cp gs 0.00 setgray ef gr col-1 s % Arc gs n 13797.3 6989.1 1815.0 6.7 -131.3 arcn gs col-1 s gr gr % Arc gs n 13826.3 4788.0 1760.4 -134.2 28.4 arc gs col-1 s gr gr % Arc gs n 13824.2 4792.4 1796.0 -152.9 49.1 arcn gs col-1 s gr gr 45.000 slw % Polyline n 10800 2400 m 16800 2400 l gs col-1 s gr % Polyline n 10800 7200 m 16800 7200 l gs col-1 s gr $F2psEnd rs %%EndDocument @endspecial 1710 1077 a FP(Figure)j(4.12)605 1284 y FQ(Note)d(the)h(similarit)n(y)f(of)g(the)h(picture)f(for)g FJ(X)36 b FQ(and)29 b(the)h(one)f(whic)n(h)g(de\014nes)g(the)h(matrix) 456 1384 y FJ(S)512 1354 y FM(2)576 1384 y FQ(in)e FL(C)k FQ(\(cf.)d(the)f(pro)r(of)f(of)g(Theorem)g(3.1.16\).)605 1533 y FP(Example)k FQ(4.5.8)p FP(.)40 b FQ(Let)1045 1668 y FJ(t)23 b FQ(=)f(\(\()p FJ(W)1327 1680 y FM(1)1366 1668 y FJ(;)14 b FQ(+\))p FJ(;)g(:)g(:)g(:)f(;)h FQ(\()p FJ(W)1794 1680 y FI(n)1840 1668 y FJ(;)g FQ(+\)\))p FJ(;)1021 1801 y(t)1051 1767 y FE(0)1098 1801 y FQ(=)22 b(\(\()p FJ(W)1327 1813 y FM(1)1366 1801 y FJ(;)14 b FQ(+\))p FJ(;)g(:)g(:)g(:)f(;)h FQ(\()p FJ(W)1794 1813 y FI(i)p FM(+1)1906 1801 y FJ(;)g FQ(+\))p FJ(;)g FQ(\()p FJ(W)2187 1813 y FI(i)2215 1801 y FJ(;)g FQ(+\))p FJ(;)g(:)g(:)g(:)g(;)g FQ(\()p FJ(W)2644 1813 y FI(n)2689 1801 y FJ(;)g FQ(+\)\))p FJ(;)456 1936 y FQ(so)27 b(that)g(\006)797 1948 y FI(t)827 1936 y FJ(;)14 b FQ(\006)924 1948 y FI(t)949 1932 y Fx(0)1003 1936 y FQ(are)26 b(spheres)h(with)h FJ(n)g FQ(mark)n(ed)e(p)r(oin)n (ts,)i(and)1015 2071 y FJ(\034)9 b FQ(\(\006)1152 2083 y FI(t)1182 2071 y FQ(\))24 b(=)e FL(h)p FJ(W)1435 2083 y FI(t)1465 2071 y FL(i)i FQ(=)e(Hom\()p FK(1)p FJ(;)14 b(W)1976 2083 y FM(1)2032 2071 y FL(\012)k(\001)c(\001)g(\001)19 b(\012)f FJ(W)2392 2083 y FI(n)2437 2071 y FQ(\))p FJ(;)993 2200 y(\034)9 b FQ(\(\006)1130 2212 y FI(t)1155 2196 y Fx(0)1182 2200 y FQ(\))24 b(=)e(Hom\()p FK(1)p FJ(;)14 b(W)1693 2212 y FM(1)1749 2200 y FL(\012)k(\001)c(\001)g(\001)19 b(\012)f FJ(W)2109 2212 y FI(i)p FM(+1)2239 2200 y FL(\012)g FJ(W)2400 2212 y FI(i)2447 2200 y FL(\012)g(\001)c(\001)g(\001)k(\012)g FJ(W)2806 2212 y FI(n)2852 2200 y FQ(\))p FJ(:)456 2355 y FQ(Let)29 b FJ(b)642 2367 y FI(i)678 2355 y FQ(:)f(\006)789 2367 y FI(t)872 2308 y FE(\030)844 2355 y FL(\000)-40 b(!)26 b FQ(\006)1038 2367 y FI(t)1063 2351 y Fx(0)1118 2355 y FQ(b)r(e)k(the)f(homeomorphism)f(whic)n(h)h(exc)n(hanges)e FJ(i)p FQ(-th,)i(\()p FJ(i)19 b FQ(+)g(1\)-st)29 b(mark)n(ed)456 2455 y(p)r(oin)n(ts)38 b(as)f(sho)n(wn)g(in)i(Figure)e(4.13)g(b)r(elo)n (w)h(\(for)g(con)n(v)n(enience,)h(w)n(e)f(are)f(not)h(sho)n(wing)f(the) 456 2554 y(tangen)n(t)i(v)n(ectors\).)73 b(Then)40 b(w)n(e)f(claim)h (that)g(\()p FJ(b)2011 2566 y FI(i)2039 2554 y FQ(\))2071 2566 y FE(\003)2119 2554 y FQ(:)31 b FJ(\034)9 b FQ(\(\006)2310 2566 y FI(t)2341 2554 y FQ(\))44 b FL(!)f FJ(\034)9 b FQ(\(\006)2680 2566 y FI(t)2705 2550 y Fx(0)2733 2554 y FQ(\))40 b(is)g(giv)n(en)f(b)n(y)h(\010)j FL(7!)456 2654 y FJ(\033)503 2666 y FI(W)565 2674 y FG(i)592 2666 y FI(;W)674 2674 y FG(i)p FF(+1)775 2654 y FQ(\010.)1233 3350 y @beginspecial 0 @llx 0 @lly 172 @urx 63 @ury 1720 @rwi @setspecial %%BeginDocument: figures/braiding3.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: braiding3.fig %%Creator: fig2dev Version 3.1 Patchlevel 2 %%CreationDate: Wed Mar 22 12:54:00 2000 %%For: bakalov@severi (Bojko Bakalov) %Magnification: 1.00 %%Orientation: Portrait %%BoundingBox: 0 0 172 63 %%Pages: 0 %%BeginSetup %%IncludeFeature: *PageSize Letter %%EndSetup %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -27.0 86.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n 0 792 m 0 0 l 612 0 l 612 792 l cp clip 0.06000 0.06000 sc 7.500 slw % Ellipse n 975 902 510 510 0 360 DrawEllipse gs col-1 s gr % Ellipse n 2785 902 510 510 0 360 DrawEllipse gs col-1 s gr % Interp Spline gs n 2275 905 m 2344.9 1055.6 2383.6 1117.3 2430 1152 curveto 2507.1 1209.6 2662.5 1302.1 2780 1250 curveto 2834.2 1226.0 2846.8 1140.5 2855 1100 curveto 2862.9 1061.2 2824.8 982.9 2845 940 curveto 2853.6 921.8 2883.5 905.4 2900 900 curveto 2958.2 881.1 3084.3 909.0 3140 900 curveto 3151.0 898.2 3176.2 899.7 3185 885 curveto 3201.0 858.2 3183.8 819.8 3170 800 curveto 3141.4 759.0 3068.6 710.6 3015 710 curveto 2965.5 709.5 2899.0 759.8 2870 790 curveto 2827.0 834.8 2793.1 962.9 2760 1010 curveto 2740.5 1037.8 2698.6 1100.7 2660 1115 curveto 2606.5 1134.8 2507.7 1120.5 2460 1095 curveto 2424.6 1076.1 2365.0 1032.7 2365 980 curveto 2365.0 941.1 2407.1 908.2 2435 895 curveto 2490.8 868.7 2604.5 900.0 2655 895 curveto 2672.5 893.3 2712.7 894.2 2730 880 curveto 2750.8 862.9 2756.9 814.3 2765 795 curveto 2778.4 763.0 2784.5 681.7 2825 655 curveto 2895.5 608.5 3025.4 632.6 3090 655 curveto 3133.4 670.0 3203.0 731.4 3230 765 curveto 3247.0 786.2 3263.3 820.0 3295 900 curveto gs col-1 s gr gr 0.000 slw % Ellipse n 3010 900 30 30 0 360 DrawEllipse gs 0.00 setgray ef gr % Ellipse n 2535 900 30 30 0 360 DrawEllipse gs 0.00 setgray ef gr % Ellipse n 1200 900 30 30 0 360 DrawEllipse gs 0.00 setgray ef gr % Ellipse n 750 900 30 30 0 360 DrawEllipse gs 0.00 setgray ef gr 7.500 slw % Polyline gs clippath 1950 911 m 2022 925 l 1950 941 l 2064 940 l 2064 910 l cp clip n 1624 930 m 2049 925 l gs col-1 s gr gr % arrowhead n 1950 911 m 2022 925 l 1950 941 l 1962 926 l 1950 911 l cp gs 0.00 setgray ef gr col-1 s % Polyline n 465 900 m 1480 900 l gs 0.00 setgray ef gr gs col-1 s gr /Times-Roman ff 180.00 scf sf 1176 1109 m gs 1 -1 sc (2) col-1 sh gr /Times-Roman ff 180.00 scf sf 707 1104 m gs 1 -1 sc (1) col-1 sh gr /Times-Roman ff 180.00 scf sf 2982 1104 m gs 1 -1 sc (1) col-1 sh gr /Times-Roman ff 180.00 scf sf 2496 759 m gs 1 -1 sc (2) col-1 sh gr $F2psEnd rs %%EndDocument @endspecial 1196 3550 a FP(Figure)32 b(4.13.)41 b FQ(Braiding)26 b(homeomorphism.)605 3738 y(Indeed,)d(let)e FJ(M)29 b FQ(b)r(e)22 b(the)f(cylinder)f(\006)1728 3750 y FI(t)1763 3738 y FL(\002)5 b FJ(I)i FQ(,)22 b(with)f(the)g(parameterization)e(of) i(the)g(b)r(oundary)456 3837 y(giv)n(en)26 b(b)n(y)1336 3993 y FJ(')9 b FQ(:)29 b FJ(@)5 b(M)31 b FQ(=)p 1700 3927 90 4 v 23 w(\006)1760 4005 y FI(t)1807 3993 y FL(t)19 b FQ(\006)1941 4005 y FI(t)2022 3945 y FM(id)11 b FE(\002)p FI(b)2170 3953 y FG(i)1993 3993 y FL(\000)-37 b(\000)-18 b(\000)f(\000)-38 b(!)p 2247 3927 V 23 w FQ(\006)2307 4005 y FI(t)2355 3993 y FL(t)19 b FQ(\006)2489 4005 y FI(t)2514 3989 y Fx(0)2540 3993 y FJ(:)456 4133 y FQ(By)30 b(de\014nition,)j(\()p FJ(b)1054 4145 y FI(i)1081 4133 y FQ(\))1113 4145 y FE(\003)1183 4133 y FQ(coincides)e(with)g FJ(\034)9 b FQ(\()p FJ(M)g FQ(\))30 b FL(2)g FQ(Hom)o(\()p FL(h)p FJ(W)2358 4145 y FI(t)2389 4133 y FL(i)p FJ(;)14 b FL(h)p FJ(W)2568 4145 y FI(t)2593 4129 y Fx(0)2620 4133 y FL(i)p FQ(\).)48 b(T)-7 b(o)31 b(compute)g FJ(\034)9 b FQ(\()p FJ(M)g FQ(\),)456 4232 y(note)24 b(that)g FJ(M)33 b FQ(is)25 b(homeomorphic)e(\(as)h(a)g(parameterized)f(manifold\))h(to) g(the)h(cylinder)f FJ(S)3276 4202 y FM(2)3325 4232 y FL(\002)12 b FJ(I)456 4332 y FQ(with)37 b(the)g(trivial)g (parameterization)d(of)j(the)h(b)r(oundaries,)g(and)f(with)g(the)g (ribb)r(on)g(tangle)456 4432 y(sho)n(wn)18 b(in)h(Figure)f(4.14)g (placed)g(inside)h(\(cf.)h(Example)e(4.5.2\).)33 b(Therefore,)19 b(b)n(y)g(Example)f(4.5.2,)456 4531 y FJ(\034)9 b FQ(\()p FJ(M)g FQ(\))24 b(=)e FJ(\033)813 4543 y FI(W)875 4551 y FG(i)902 4543 y FI(;W)984 4551 y FG(i)p FF(+1)1086 4531 y FQ(.)37 b(\(This)28 b(example)f(w)n(as)f(used)i(without)g(pro)r (of)f(in)h(the)g(Preface.\))p eop %%Page: 91 21 91 94 bop 1710 226 a FM(4.5.)29 b(EXAMPLES)1164 b(91)1463 934 y @beginspecial 0 @llx 0 @lly 117 @urx 71 @ury 1170 @rwi @setspecial %%BeginDocument: figures/braids1.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: braids1.eps %%Creator: fig2dev Version 3.2 Patchlevel 0-beta3 %%CreationDate: Tue Dec 1 14:51:18 1998 %%For: shurik@localhost.localdomain (Alexander Kirillov,,,) %%Orientation: Portrait %%BoundingBox: 0 0 117 71 %%Pages: 0 %%BeginSetup %%EndSetup %%Magnification: 0.2000 %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save -42.0 98.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def %%EndProlog $F2psBegin 10 setmiterlimit n -1000 9100 m -1000 -1000 l 14244 -1000 l 14244 9100 l cp clip 0.01200 0.01200 sc 7.500 slw % Ellipse n 12000 7200 100 100 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr % Ellipse n 12000 2400 100 100 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr % Ellipse n 10800 7200 100 100 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr % Ellipse n 10800 2400 100 100 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr % Ellipse n 9600 7200 100 100 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr % Ellipse n 9600 2400 100 100 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr % Ellipse n 8400 7200 100 100 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr % Ellipse n 7200 7200 100 100 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr % Ellipse n 8400 2400 100 100 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr % Ellipse n 7200 2400 100 100 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr % Ellipse n 6000 2400 100 100 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr % Ellipse n 6071 7200 100 100 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr % Ellipse n 4800 7200 100 100 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr % Ellipse n 4800 2400 100 100 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr % Polyline 45.000 slw n 3600 7200 m 13200 7200 l gs col-1 s gr % Polyline n 3600 2400 m 13200 2400 l gs col-1 s gr % Polyline 15.000 slw n 4800 2400 m 4800 7200 l gs col-1 s gr % Polyline n 6000 2400 m 6000 7200 l gs col-1 s gr % Polyline n 7182 2400 m 7707 4500 l gs col-1 s gr % Polyline n 8382 2400 m 7182 7200 l gs col-1 s gr % Polyline n 8418 7200 m 7893 5100 l gs col-1 s gr % Polyline n 9600 2400 m 9600 7200 l gs col-1 s gr % Polyline n 10800 2400 m 10800 7200 l gs col-1 s gr % Polyline n 12000 2400 m 12000 7200 l gs col-1 s gr /Times-Italic ff 750.00 scf sf 8100 8100 m gs 1 -1 sc (i+) col-1 sh gr /Times-Roman ff 750.00 scf sf 8700 8100 m gs 1 -1 sc (1) col-1 sh gr /Times-Italic ff 750.00 scf sf 7050 8100 m gs 1 -1 sc (i) col-1 sh gr $F2psEnd rs %%EndDocument @endspecial 1710 1098 a FP(Figure)32 b(4.14)p eop %%Page: 92 22 92 95 bop 456 226 a FM(92)404 b(4.)29 b(3-DIMENSIONAL)g(TOPOLOGICAL)h (QUANTUM)f(FIELD)g(THEOR)-5 b(Y)p eop %%Trailer end userdict /end-hook known{end-hook}if %%EOF