%!PS-Adobe-2.0 %%Creator: dvips(k) 5.86 Copyright 1999 Radical Eye Software %%Title: 15.dvi %%Pages: 30 %%PageOrder: Ascend %%BoundingBox: 0 0 596 842 %%EndComments %DVIPSWebPage: (www.radicaleye.com) %DVIPSCommandLine: dvips 15.dvi %DVIPSParameters: dpi=600, compressed %DVIPSSource: TeX output 2005.11.23:1200 %%BeginProcSet: texc.pro %! /TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72 mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0 0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{ landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[ matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{ statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0] N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin /FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array /BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2 array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get }B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub} B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr 1 add N}if}B/id 0 N/rw 0 N/rc 0 N/gp 0 N/cp 0 N/G 0 N/CharBuilder{save 3 1 roll S A/base get 2 index get S/BitMaps get S get/Cd X pop/ctr 0 N Cdx 0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx sub Cy .1 sub]/id Ci N/rw Cw 7 add 8 idiv string N/rc 0 N/gp 0 N/cp 0 N{ rc 0 ne{rc 1 sub/rc X rw}{G}ifelse}imagemask restore}B/G{{id gp get/gp gp 1 add N A 18 mod S 18 idiv pl S get exec}loop}B/adv{cp add/cp X}B /chg{rw cp id gp 4 index getinterval putinterval A gp add/gp X adv}B/nd{ /cp 0 N rw exit}B/lsh{rw cp 2 copy get A 0 eq{pop 1}{A 255 eq{pop 254}{ A A add 255 and S 1 and or}ifelse}ifelse put 1 adv}B/rsh{rw cp 2 copy get A 0 eq{pop 128}{A 255 eq{pop 127}{A 2 idiv S 128 and or}ifelse} ifelse put 1 adv}B/clr{rw cp 2 index string putinterval adv}B/set{rw cp fillstr 0 4 index getinterval putinterval adv}B/fillstr 18 string 0 1 17 {2 copy 255 put pop}for N/pl[{adv 1 chg}{adv 1 chg nd}{1 add chg}{1 add chg nd}{adv lsh}{adv lsh nd}{adv rsh}{adv rsh nd}{1 add adv}{/rc X nd}{ 1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]A{bind pop} forall N/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn /BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put }if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{ bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{ SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{ userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X 1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4 index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N /p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{ /Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT) (LaserWriter 16/600)]{A length product length le{A length product exch 0 exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot} imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M} B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{ p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end %%EndProcSet TeXDict begin 39158280 55380996 1000 600 600 (15.dvi) @start %DVIPSBitmapFont: Fa msam10 10 1 /Fa 1 4 df<007FB812F8B912FCA300F0CA123CB3B3ACB912FCA36C17F836387BB741>3 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fb cmbx5 5 1 /Fb 1 113 df<38FF8FFC90B5FC15C0391FF01FE09038C007F0EB800315F81401A41403 15F0EBC0079038F01FE090B512C001BF1300EB8FF80180C7FCA5EAFFF0A31D1A7D9123> 112 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fc cmmib7 7 1 /Fc 1 28 df<0107B512FC013F14FE90B6FC5A000715FC4815F83A1FF807F800EBE003EA 3FC048486C7E13004A5A5A5AA214075D5A4A5A6C495AA2007FEB7F80263F81FEC7FC6CB4 5A000713E0000190C8FC271A7D992D>27 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fd cmbx7 7 5 /Fd 5 122 df97 D<39FFF07FC09038F3FFF890B512FE000F903880FF 809039FC007FC049EB3FE049131FED0FF0A216F81507A6150F16F0A2ED1FE06D133F01FE EB7FC09039FF01FF00ECFFFE01F313F89038F07FC091C8FCA8B5FCA325257E992A>112 D<90391FF007809038FFFE0F0003EBFF1F3907FC0FDF391FF003FF48487E497E4848137F A212FF90C7FCA67F127FA26C6C13FF6D5A6C6C5A380FF80F0003B5127FC613FCEB1FF090 C7FCA8913807FFF8A325257E9928>I<3AFFFE07FFC0A33A07F801F8006D485A6C6C485A 6C6C485A6CEB9F806DB4C7FC6D5A6D5A6D5A6D7E6D7E1307497E496C7E013E7F496C7E49 6C7E48486C7E48486C7E00076D7E3AFFF007FFE0A3231A7E9928>120 DI E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fe msbm7 7 2 /Fe 2 83 df78 D82 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Ff cmr5 5 9 /Ff 9 62 df<13301360EA01C0EA038013001206120E5AA25AA35AA312F0AB1270A37EA3 7EA27E12067E1380EA01C0EA006013300C297B9E16>40 D<12C0126012387E120C7E1207 EA0380A2EA01C0A3EA00E0A313F0AB13E0A3EA01C0A3EA0380A2EA070012065A121C5A12 605A0C297C9E16>I48 D<1360EA01E0120F12FF12F11201B3A3387FFF80A2111C7B9B1C>IIII54 D61 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fg cmsy5 5 3 /Fg 3 55 df0 D48 D54 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fh cmti10 10 61 /Fh 61 128 df<04FFEB03F003039038E00FFC923A0FC0F01F1E923A3F00783E0F923A7E 01F87C3FDB7C03EBFC7F03FC14F8DA01F813F905F1137EDC01E1133C913B03F00003F000 A314074B130760A3140F4B130F60A3010FB812C0A3903C001F80001F8000A3023F143F92 C790C7FCA44A5C027E147EA402FE14FE4A5CA413014A13015FA313034A13035FA313074A 495AA44948495AA44948495AA3001CD9038090C8FC007E90380FC03F013E143E00FE011F 5B133C017C5C3AF8780F01E0D878F0EB07C0273FE003FFC9FC390F8000FC404C82BA33> 11 DI< 130FEB1F80133F137FEBFF00485A5BEA03F0485A485A485A003EC7FC5A5A12E05A111064 B92A>19 D<150C151C153815F0EC01E0EC03C0EC0780EC0F00141E5C147C5C5C495A1303 495A5C130F49C7FCA2133EA25BA25BA2485AA212035B12075BA2120F5BA2121FA290C8FC A25AA2123EA2127EA2127CA412FC5AAD1278A57EA3121C121EA2120E7EA26C7E6C7EA212 001E5274BD22>40 D<140C140E80EC0380A2EC01C015E0A2140015F0A21578A4157C153C AB157CA715FCA215F8A21401A215F0A21403A215E0A21407A215C0140F1580A2141F1500 A2143EA25CA25CA2495AA2495A5C1307495A91C7FC5B133E133C5B5B485A12035B48C8FC 120E5A12785A12C01E527FBD22>I44 D<387FFFF8A2B5FCA214F0150579941E>I<120EEA3F80127F12FFA31300127E123C0909 778819>I<15181538157815F0140114031407EC0FE0141F147FEB03FF90383FEFC0148F EB1C1F13001580A2143FA21500A25CA2147EA214FEA25CA21301A25CA21303A25CA21307 A25CA2130FA25CA2131FA25CA2133FA291C7FC497EB61280A31D3877B72A>49 DII<16E0ED01F01503A3150716E0A3150F16C0A2151F 1680A2ED3F00A3157EA2157C15FC5D14015D14035D14075D140F5D141F92C7FC143EA25C ECF81C153E903801F07EEB03E014C090380780FE130F49485A133EEB7C01137801F05BEA 01E03803C003EA0FFE391FFFC3F04813FB267C01FF13403AF0003FFFE000601307C71400 EC0FE05DA3141F5DA3143F92C7FCA4143E141C24487DB72A>I<010314186E13F8903907 F007F091B512E016C01600495B15F8010E13E0020CC7FC011EC8FC131CA3133C1338A313 781370A2147F9038F3FFC09038EF83E09038FC01F0496C7E485A497F49137CC8FC157EA3 15FEA41401000C5C123F5A1403485C5A4A5A12F800E05C140F4A5A5D6C49C7FC0070137E 00785B387C01F8383E07F0381FFFC06C90C8FCEA01F8253A77B72A>I<157F913803FFC0 020F13E0EC3F8191387E00F002F81370903903F003F0903807E007EB0FC0EB1F80020013 E04914C0017E90C7FC13FE5B485AA21203485AA2380FE07E9038E1FF809038E783E0391F CE01F09038DC00F813F84848137C5B157E5B485AA390C712FE5A5AA214015D5AA214035D A348495A5D140F5D4A5A6C49C7FC127C147C6C485A6C485A6CB45A6C1380D801FCC8FC24 3A76B72A>I56 D65 D<0107B612FCEFFF8018C0903B000FF0001FF04BEB07F81703021F15FC17014B14FEA202 3F1400A24B1301A2147F18FC92C7120318F84A140718F04AEC0FE0EF1FC00101ED3F80EF 7F004AEB01FEEE07F849B612E05F9139F80007F0EE01FC01076E7E177F4AEC3F80A2010F 16C0171F5CA2131F173F5CA2133FEF7F805C1800017F5D4C5A91C7485A5F49140FEE1FE0 494A5A00014AB45AB748C7FC16F816C037397BB83A>II<0103B612FEEFFFC018F0903B0007F8 000FF84BEB03FCEF00FE020F157FF03F804B141F19C0021F150F19E05D1807143F19F05D A2147FA292C8FCA25C180F5CA2130119E04A151FA2130319C04A153FA201071780187F4A 1600A2010F16FEA24A4A5A60011F15034D5A4A5D4D5A013F4B5A173F4A4AC7FC17FC017F EC03F84C5A91C7EA1FC04949B45A007F90B548C8FCB712F016803C397CB83F>I<0107B8 FCA3903A000FF000034BEB007F183E141F181E5DA2143FA25D181C147FA29238000380A2 4A130718004A91C7FC5E13015E4A133E167E49B512FEA25EECF8000107147C163C4A1338 A2010F147818E04A13701701011F16C016004A14031880013F150718004A5CA2017F151E 173E91C8123C177C4915FC4C5A4914070001ED7FF0B8FCA25F38397BB838>I<0107B712 FEA3903A000FF000074B1300187C021F153CA25DA2143FA25D1838147FA292C8FCEE0380 4A130718004A91C7FCA201015CA24A131E163E010314FE91B5FC5EA2903807F800167C4A 1378A2130FA24A1370A2011F14F0A24A90C8FCA2133FA25CA2137FA291CAFCA25BA25B48 7EB6FCA337397BB836>II<0103B5D8F80FB512E0A390260007F8C7381FE0004B5D A2020F153F615DA2021F157F96C7FC5DA2023F5D605DA2027F14016092C7FCA24A140360 5CA249B7FC60A202FCC712070103150F605CA20107151F605CA2010F153F605CA2011F15 7F95C8FC5CA2013F5D5F5CA2017F14015F91C7FC491403007FD9FE01B512F8B55BA24339 7CB83E>I<0103B512F8A390390007F8005DA2140FA25DA2141FA25DA2143FA25DA2147F A292C7FCA25CA25CA21301A25CA21303A25CA21307A25CA2130FA25CA2131FA25CA2133F A25CA2137FA291C8FC497EB6FCA25C25397CB820>I<0207B512F0A391390007FC006F5A A215075EA3150F5EA3151F5EA3153F5EA3157F93C7FCA35D5DA314015DA314035DA31407 A25DA2140FA2003F5C5A141F485CA24A5A12FC00E049C8FC14FE00705B495A6C485A381E 0FC06CB4C9FCEA01F82C3B78B82C>I<0107B512FCA25E9026000FF8C7FC5D5D141FA25D A2143FA25DA2147FA292C8FCA25CA25CA21301A25CA21303A25CA21307A25CA2130F170C 4A141CA2011F153C17384A1478A2013F157017F04A14E01601017F140317C091C7120716 0F49EC1F80163F4914FF000102071300B8FCA25E2E397BB834>76 D<902607FFF8923807FFF0614F13E0D9000FEFF0004F5AA2021F167FF1EFC0141DDA1CFC EC01CF023C16DF9538039F800238ED071FA20278ED0E3F97C7FC0270151CA202F04B5AF0 707E14E0037E14E0010117FE4D485A02C0EC0380A20103ED0701610280140EA20107ED1C 0305385B14006F137049160705E05B010EEC01C0A2011E913803800F61011CEC0700A201 3C020E131F4C5C1338ED1FB80178163F04F091C8FC01705CA201F04A5B187E00015DD807 F816FEB500C09039007FFFFC151E150E4C397AB84A>I<902603FFF891B512E0A281D900 07923807F8006F6E5A61020F5E81DA0E7F5DA2021E6D1307033F92C7FC141C82DA3C1F5C 70130EEC380FA202786D131E0307141C147082DAF003143C70133814E0150101016E1378 030014705C8201036E13F0604A1480163F010715C1041F5B91C7FC17E149EC0FE360010E 15F31607011E15FF95C8FC011C80A2013C805F1338160013785F01F8157CEA03FC267FFF E0143CB51538A243397CB83E>II<0107B612F817FF1880903B000FF0003FE04BEB0FF0EF03F8 141FEF01FC5DA2023F15FEA25DA2147FEF03FC92C7FCA24A15F817074A15F0EF0FE01301 EF1FC04AEC3F80EFFE0001034A5AEE0FF091B612C04CC7FCD907F8C9FCA25CA2130FA25C A2131FA25CA2133FA25CA2137FA291CAFCA25BA25B1201B512FCA337397BB838>II<0103B612F017FEEFFF80903B0007F8003FC04BEB 0FF01707020FEC03F8EF01FC5DA2021F15FEA25DA2143FEF03FC5DA2027FEC07F818F092 C7120F18E04AEC1FC0EF3F004A14FEEE01F80101EC0FE091B6128004FCC7FC9138FC003F 0103EC0F80834A6D7E8301071403A25C83010F14075F5CA2011F140FA25CA2133F161F4A ECE007A2017F160F180E91C7FC49020F131C007F01FE153CB5913807F078040313F0CAEA FFE0EF3F80383B7CB83D>I<92383FC00E913901FFF01C020713FC91391FC07E3C91393F 001F7C027CEB0FF84A130749481303495A4948EB01F0A2495AA2011F15E091C7FCA34915 C0A36E90C7FCA2806D7E14FCECFF806D13F015FE6D6D7E6D14E0010080023F7F14079138 007FFC150F15031501A21500A2167C120EA3001E15FC5EA3003E4A5AA24B5AA2007F4A5A 4B5A6D49C7FC6D133ED8F9F013FC39F8FC03F839F07FFFE0D8E01F138026C003FCC8FC2F 3D7ABA2F>I<0007B812E0A25AD9F800EB001F01C049EB07C0485AD900011403121E001C 5C003C17801403123800785C00701607140700F01700485CA2140FC792C7FC5DA2141FA2 5DA2143FA25DA2147FA292C9FCA25CA25CA21301A25CA21303A25CA21307A25CA2130FA2 5CEB3FF0007FB512F8B6FCA2333971B83B>I86 D89 D<14F8EB07FE90381F871C90383E 03FE137CEBF801120148486C5A485A120FEBC001001F5CA2EA3F801403007F5C1300A214 07485C5AA2140F5D48ECC1C0A2141F15831680143F1587007C017F1300ECFF076C485B90 38038F8E391F0F079E3907FE03FC3901F000F0222677A42A>97 D<133FEA1FFFA3C67E13 7EA313FE5BA312015BA312035BA31207EBE0F8EBE7FE9038EF0F80390FFC07C013F89038 F003E013E0D81FC013F0A21380A2123F1300A214075A127EA2140F12FE4814E0A2141F15 C05AEC3F80A215005C147E5C387801F8007C5B383C03E0383E07C0381E1F80D80FFEC7FC EA01F01C3B77B926>I<147F903803FFC090380FC1E090381F0070017E13784913383901 F801F83803F003120713E0120FD81FC013F091C7FC485AA2127F90C8FCA35A5AA45AA315 3015381578007C14F0007EEB01E0003EEB03C0EC0F806CEB3E00380F81F83803FFE0C690 C7FC1D2677A426>II<147F903803FFC090380FC1E090383F00F0017E13785B485A 485A485A120F4913F8001F14F0383F8001EC07E0EC1F80397F81FF00EBFFF891C7FC90C8 FC5A5AA55AA21530007C14381578007E14F0003EEB01E0EC03C06CEB0F806CEB3E003807 81F83803FFE0C690C7FC1D2677A426>III II107 DIII<147F903803FFC09038 0FC1F090381F00F8017E137C5B4848137E4848133E0007143F5B120F485AA2485A157F12 7F90C7FCA215FF5A4814FEA2140115FC5AEC03F8A2EC07F015E0140F007C14C0007EEB1F 80003EEB3F00147E6C13F8380F83F03803FFC0C648C7FC202677A42A>I<9039078007C0 90391FE03FF090393CF0787C903938F8E03E9038787FC00170497EECFF00D9F0FE148013 E05CEA01E113C15CA2D80003143FA25CA20107147FA24A1400A2010F5C5E5C4B5A131F5E EC80035E013F495A6E485A5E6E48C7FC017F133EEC70FC90387E3FF0EC0F8001FEC9FCA2 5BA21201A25BA21203A25B1207B512C0A3293580A42A>II<3903C003F0390FF01FFC391E783C0F381C7C703A3C3EE03F8038383FC0 EB7F800078150000701300151CD8F07E90C7FCEAE0FE5BA2120012015BA312035BA31207 5BA3120F5BA3121F5BA3123F90C9FC120E212679A423>I<14FE903807FF8090380F83C0 90383E00E04913F00178137001F813F00001130313F0A215E00003EB01C06DC7FC7FEBFF C06C13F814FE6C7F6D13807F010F13C01300143F141F140F123E127E00FE1480A348EB1F 0012E06C133E00705B6C5B381E03E06CB45AD801FEC7FC1C267AA422>II<13F8D803FEEB01C0D8078FEB03E0390E 0F8007121E121C0038140F131F007815C01270013F131F00F0130000E015805BD8007E13 3FA201FE14005B5D120149137EA215FE120349EBFC0EA20201131E161C15F813E0163CD9 F003133814070001ECF07091381EF8F03A00F83C78E090393FF03FC090390FC00F002726 79A42D>I<01F0130ED803FC133FD8071EEB7F80EA0E1F121C123C0038143F49131F0070 140FA25BD8F07E140000E08013FEC6485B150E12015B151E0003141C5BA2153C00071438 5B5DA35DA24A5A140300035C6D48C7FC0001130E3800F83CEB7FF8EB0FC0212679A426> I<01F01507D803FC903903801F80D8071E903907C03FC0D80E1F130F121C123C0038021F 131F49EC800F00701607A249133FD8F07E168000E0ED000313FEC6484913071800000114 7E5B03FE5B0003160E495BA2171E00070101141C01E05B173C1738A217781770020314F0 5F0003010713016D486C485A000190391E7C07802800FC3C3E0FC7FC90393FF81FFE9039 0FE003F0322679A437>I<903907E007C090391FF81FF89039787C383C9038F03E703A01 E01EE0FE3803C01F018013C0D8070014FC481480000E1570023F1300001E91C7FC121CA2 C75AA2147EA214FEA25CA21301A24A1370A2010314F016E0001C5B007E1401010714C000 FEEC0380010F1307010EEB0F0039781CF81E9038387C3C393FF03FF03907C00FC027267C A427>I<13F0D803FCEB01C0D8071EEB03E0D80E1F1307121C123C0038140F4914C01270 A249131FD8F07E148012E013FEC648133F160012015B5D0003147E5BA215FE00075C5BA2 14015DA314035D14070003130FEBF01F3901F87FE038007FF7EB1FC7EB000F5DA2141F00 3F5C48133F92C7FC147E147C007E13FC387001F8EB03E06C485A383C1F80D80FFEC8FCEA 03F0233679A428>I<001E1338007F13FEEAFF811383A3EB03FC00FE13F8383800F01709 6AB72A>127 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fi cmsy7 7 12 /Fi 12 113 df0 D<1338A50060130C00F8133E00FC137E00FE 13FE383FBBF83807FFC000011300EA007C48B4FC000713C0383FBBF838FE38FE00FC137E 00F8133E0060130C00001300A517197B9A22>3 D<12E012F812FEEA3F80EA0FE0EA03F8 EA00FEEB3F80EB0FE0EB03F8EB00FEEC3F80EC0FE0EC03F8EC00FEED3F80ED0FE0ED03F8 ED00FE163E16FEED03F8ED0FE0ED3F80EDFE00EC03F8EC0FE0EC3F8002FEC7FCEB03F8EB 0FE0EB3F8001FEC8FCEA03F8EA0FE0EA3F80007EC9FC12F812E0CAFCAB007FB612FCB712 FEA227357AA734>21 D<176017F01770A217781738173C171C171E83717E717E717EEF00 F8BAFC19801900CB12F8EF01E04D5A4D5A4DC7FC171E171C173C173817781770A217F017 60391F7C9D42>33 D<13E0EA01F0EA03F8A3EA07F0A313E0A2120F13C0A3EA1F80A21300 A25A123EA35AA3127812F8A25A12100D1E7D9F13>48 D<017F157F2601FFE0903803FFC0 000701F890380FF1F0260F83FC90381F0038261E00FF013C7F001890263F8078130C4890 261FC0E07F007090260FE1C07F0060EB07E3913803F780486DB4C7EA01806E5A157E157F 81824B7E0060DAF7E0EB0300913801E3F0DBC3F85B6C90260381FC13066C90260F00FE5B 001C011E90387F803C6C017C90381FE0F82607C7F86DB45A2601FFE0010313C06C6CC86C C7FC391B7C9942>I<49B5FC130F133F01FFC7FCEA01F8EA03E0EA078048C8FC121E121C 123C123812781270A212F05AA2B7FCA300E0C8FCA27E1270A212781238123C121C121E7E 6C7EEA03E0EA01F86CB4FC013FB5FC130F130120277AA12D>I<91383807F89138F03FFF D903E0B5128090260781E013C0903A0E07801FE090393C0F000FD9781EEB07F049481303 3801E07C2603C078EB01F800075B1381D80F011400001F5B381E03C0003EC9FC123C127C A217F00078150112F8A217E0160317C0160717806CED0F005E161E007E5D5E007F5D6C6C 495A6DEB03806C6C010FC7FCD80FF8133E3907FF01F86CEBFFE0C691C8FCEB1FF82D2A7B A835>79 D<0103B512E0013F14FC90B7FC2703F0780313C03B0F80F8007FE0D81E00EC1F F0481507007CED03F80078150112F800E01500C75A130117F0160117E04A1303010315C0 EE0780EE0F00161E4A5B010714F0ED03E09138801F8090260F8FFEC7FCEC9FF0ECBF8091 C9FC5BA2131E133EA2133C137C137813F8A25B120113C090CAFC2D2B7EA72F>I<12E0B3 B3B3A5033B78AB14>106 D<38C00180EAE003B3B3B3A3EAC001113B78AB22>I<186018E0 170118C0170318801707EF0F00170E171E171C173C17381778177017F05F16014C5A5F16 0794C7FC5E160E161E161C163C1638486C147800075DD81FC05C003F1401D8F7E05C00C3 1403D803F05C000114076D91C8FC00005C6D130E017C131E017E5B013E1338013F13786D 1370EC80F0010F5B14C101075B14E301035B14F76DB4C9FC5C13005C147C14781438333A 7B8237>112 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fj cmmi5 5 16 /Fj 16 121 df<137F3801FFC0390781E060380E00F048EB78C0123C48EB7D80143D48EB 3F00143EA2143CA20070137C387801FC393C0F9E30391FFE0FE03907F007C01C127C9126 >11 D<1318A3EB1FE0EB7FF0EA01FF3803C7E03807800048C7FCA3121EA27E137F3807FF 80A2000E130048C7FC5A12301270A212F0A3127CEA7F80EA3FF86CB4FC00071380C613C0 131F1303EBC38013FFEB3E0014257D9C1C>24 D<127012F812FCA2127C120CA31218A212 3012601240060D7A8413>59 D<0003B512F815FE3A003E001F80ED0FC0150715035B1507 A2ED0F8049EB1F00157E90B512F85D3901F001F8EC007E153E81485AA3151E4848133E5D 5DEC07F0B612C04AC7FC221C7C9B2B>66 D<0003B612E0A239003E0007ED01C01500A25B 15C0A2140101F8EB8000140390B5FCA22601F007C7FC80A216C03A03E00601801400ED03 00A248481306150E5D15FCB6FC5D231C7C9B2A>69 D78 D<0003B512E015FC39003E003FED0F80ED07C0A25BA3ED0F8049EB1F00153E 15F890B512E05A9038F003F0EC00F8A2485AA44848485AA2163016603AFFFC00F8E0ED7F C0C8EA1F00241D7C9B2B>82 D<137013F8A213F013E01300A6EA0F80EA1FC0EA31E01261 A2EAC3C01203EA0780A3EA0F001308EA1E18A213301370EA0FE0EA07800D1D7D9C16> 105 DIII<3A 0F01F807E03A3F87FE1FF83A33CE1F387C3A63D80F603CD8C3F013C001E01380D803C013 00A22607801E5BA3EEF04048484814C0ED01E0EEE18016E3001E90397800FF00000C0130 137C2A127D9133>I<3803C0F8380FE3FE380CFF0F3918FC07803830F80313F01200A238 01E007A3EC0F00EA03C0141E6D5A6D5A3807BFE0EB8F800180C7FCA248C8FCA4EA7FE012 FF191A7F911F>112 DI<13C0EA01E0A3EA03C0A4EAFFFCA2EA0780A2EA0F00A4121EA31304EA3C0CA2131813 70EA1FE0EA0F800E1A7D9917>116 D<3807E0F0381FF3F838383F1CEA703E38603C3C00 C0137C12001438EB7800A212380078130438F8F00CA200F013183861F870387F3FE0381E 0F8016127C9121>120 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fk cmbx10 10 7 /Fk 7 123 df97 D<903803FF80011F13F0017F13FC3901FF83FE3A03FE00 7F804848133F484814C0001FEC1FE05B003FEC0FF0A2485A16F8150712FFA290B6FCA301 E0C8FCA4127FA36C7E1678121F6C6C14F86D14F000071403D801FFEB0FE06C9038C07FC0 6DB51200010F13FC010113E025257DA42C>101 D<9039FF01FF80B5000F13F0023F13FC 9138FE07FFDAF00113800007496C13C06C0180EB7FE091C713F0EE3FF8A2EE1FFCA3EE0F FEAA17FC161FA217F8163F17F06E137F6E14E06EEBFFC0DAF00313809139FC07FE009138 3FFFF8020F13E0020390C7FC91C9FCACB512FCA42F357EA435>112 D<49B4EB0780010FEBE00F013FEBF81F9039FFC07C3F0003EB803E3A07FE000F7F4848EB 07FF121F497F123F497F127FA25B12FFAA6C7EA36C7E5D6C7E000F5C6C6C5B6C6C133F6C EBC0FD39007FFFF1011F13C10101130190C7FCAC037F13FEA42F357DA432>I120 DI<003FB612C0A3D9F0031380EB800749481300003E5C003C495A007C133F5D0078 495A14FF5D495B5BC6485B92C7FC495A131F5C495A017FEB03C0EBFFF014E04813C05AEC 80074813005A49EB0F80485A003F141F4848133F9038F001FFB7FCA322257DA42A>I E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fl cmmib10 10 3 /Fl 3 28 df11 D<15E01401A6EDFFF04A13FC021F13FE 91387FF01ED901FF133E49EBFFFE903907FE7FF890390FFC1FE0011F90C7FC495A495AA2 495AA25A5CA86CEBCFFE91B512807F90383FF807131F017FB5FC01FD14003901F81FF848 48C8FC485A485A5B121F48C9FCA25A127EA3B4FC7F7F7FEA7FF813FF14E06C13FC6CEBFF 8015E0000714FC6C14FFC615C0013F14E013071300141F1403EC007F151F150F16C0EB03 C09138F81F800100B51200EC3FFCEC07F0274C7FBA2A>24 D<021FB612C091B712E00103 16F0130F013F16E05B90B812C0481780489026C01FFCC7FC3907FE000748488049130348 5AA2485AA2485AA2150700FF5D5BA2150F5E90C7FC4B5AA25E153F4B5A6C5D6D49C8FC00 3F495A391FC007F8390FF01FF06CB512C0000191C9FC38003FF034267DA439>27 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fm cmex10 10 24 /Fm 24 115 df<1538EC01F8EC07E0EC1F80EC7E005CEB03F85C495AA2495AB3AB131F5C A249C7FC137E5BEA03F8EA07E0EA3F8000FCC8FCA2EA3F80EA07E0EA03F8C67E137E7F6D 7EA280130FB3AB6D7EA26D7E80EB00FC147EEC1F80EC07E0EC01F8EC00381D62778230> 8 D<12E012FCEA3F80EA07E0EA03F8C67E137E7F6D7EA280130FB3AB6D7EA26D7E80EB00 FC147EEC1F80EC07E0EC01F8A2EC07E0EC1F80EC7E005CEB03F85C495AA2495AB3AB131F 5CA249C7FC137E5BEA03F8EA07E0EA3F8000FCC8FC12E01D62778230>I<12F0B3B3B204 3674811C>12 D<151E153E157C15F8EC01F0EC03E01407EC0FC0EC1F8015005C147E5CA2 495A495AA2495AA2495AA2495AA249C7FCA2137EA213FE5B12015BA212035BA21207A25B 120FA35B121FA45B123FA548C8FCA912FEB3A8127FA96C7EA5121F7FA4120F7FA312077F A21203A27F1201A27F12007F137EA27FA26D7EA26D7EA26D7EA26D7EA26D7E6D7EA2147E 80801580EC0FC0EC07E01403EC01F0EC00F8157C153E151E1F94718232>16 D<12F07E127C7E7E6C7E7F6C7E6C7E12017F6C7E137EA27F6D7EA26D7EA26D7EA26D7EA2 6D7EA26D7EA280147E147F80A21580141FA215C0A2140F15E0A3140715F0A4140315F8A5 EC01FCA9EC00FEB3A8EC01FCA9EC03F8A515F01407A415E0140FA315C0141FA21580A214 3F1500A25C147E14FE5CA2495AA2495AA2495AA2495AA2495AA249C7FC137EA25B485A5B 1203485A485A5B48C8FC123E5A5A5A1F947D8232>I<160F161F163E167C16F8ED01F0ED 03E0ED07C0150FED1F801600153E157E5D4A5A5D14034A5A5D140F4A5AA24AC7FC143E14 7E5CA2495AA2495AA2495AA2130F5CA2495AA2133F91C8FCA25B137E13FEA25B1201A25B 1203A35B1207A35B120FA35BA2121FA45B123FA690C9FC5AAA12FEB3AC127FAA7E7FA612 1F7FA4120FA27FA312077FA312037FA312017FA212007FA2137E137F7FA280131FA26D7E A2801307A26D7EA26D7EA26D7EA2147E143E143F6E7EA26E7E1407816E7E1401816E7E15 7E153E811680ED0FC01507ED03E0ED01F0ED00F8167C163E161F160F28C66E823D>I<12 F07E127C7E7E6C7E6C7E6C7E7F6C7E1200137C137E7F6D7E130F806D7E1303806D7EA26D 7E147C147E80A26E7EA26E7EA26E7EA2811403A26E7EA2811400A281157E157FA2811680 A2151F16C0A3150F16E0A3150716F0A31503A216F8A4150116FCA6150016FEAA167FB3AC 16FEAA16FC1501A616F81503A416F0A21507A316E0150FA316C0151FA31680153FA21600 5DA2157E15FE5DA214015DA24A5AA214075DA24A5AA24A5AA24AC7FCA2147E147C14FC49 5AA2495A5C1307495A5C131F49C8FC137E137C5B1201485A5B485A485A48C9FC123E5A5A 5A28C67E823D>I<161E167EED01FE1507ED0FF8ED3FE0ED7FC0EDFF80913801FE004A5A 4A5A5D140F4A5A5D143F5D147F92C7FCA25C5CB3B3B3A313015CA3495AA213075C495AA2 495A495A137F49C8FC485A485AEA07F0EA1FE0485AB4C9FC12FCA2B4FCEA3FC06C7EEA07 F0EA03FC6C7E6C7E6D7E133F6D7E6D7EA26D7E801303A26D7EA3801300B3B3B3A38080A2 81143F81141F816E7E1407816E7E6E7E913800FF80ED7FC0ED3FE0ED0FF8ED07FE1501ED 007E161E27C675823E>26 D<12F012FCB4FC13C0EA3FE0EA0FF86C7E6C7EC67E6D7E6D7E 131F806D7E1307801303801301A2801300B3B3B3A38080A36E7EA281141F6E7EA26E7E6E 7E816E7E6E7EED7F80ED1FC0ED0FF0ED07F8ED01FEED007EA2ED01FEED07F8ED0FF0ED1F C0ED7F80EDFF004A5A4A5A5D4A5A4A5AA24A5A143F5DA24AC7FCA35C5CB3B3B3A313015C A213035C13075C130F495A5C133F495A49C8FCEA03FE485A485AEA3FE0B45A90C9FC12FC 12F027C675823E>I32 D<12F07E127C7E123F7E6C7E6C7E6C7E7F12016C 7E7F137E133E133F6D7E130F806D7EA26D7E80130180130080147E147F8081141F81140F 81140781A2140381140181A2140081A2157FA36F7EA382151FA282150FA3821507A382A2 1503A282A31501A282A31500A382A482A21780A7163F17C0AC161F17E0B3B3A217C0163F AC1780167FA71700A25EA45EA31501A35EA21503A35EA21507A25EA3150F5EA3151F5EA2 153F5EA34BC7FCA315FEA25D1401A25D14035D1407A25D140F5D141F5D143F92C8FC5C14 7E14FE5C13015C13035C495AA2495A5C131F49C9FC133E137E5B5B485A12035B485A485A 48CAFC5A123E5A5A5A2BF87E8242>I78 D80 D<167F923801FFC0923803C0F0923807803892380F007892381F01FC15 1E153EA2157E92387C0070170015FCA44A5AA81403A45DA41407A94A5AAA4A5AA95DA414 3FA492C8FCA7143E147EA4147C123800FE13FC5CA2495A5CEA7803387007C0383C0F80D8 0FFEC9FCEA03F82E5C7C7F27>82 D88 DII104 DI110 D<12F012FE6C7E13E0EA3FF0EA0FFCEA03 FE6C7E6C6C7E6D7E6D7EA26D7E1307A2801303B3B3A76D7EA28013008080816E7E6E7E6E 7E6E7EEC01FC6EB4FCED3FC0150FA2153FEDFF00EC01FCEC07F84A5A4A5A4A5A4A5A92C7 FC5C5C13015CA2495AB3B3A713075CA2130F495AA2495A495A4848C8FC485AEA0FFCEA3F F0B45A138048C9FC12F02294768237>I<1B301B781BF8A2F201F0A2F203E0A2F207C0A2 F20F80A2F21F00A21A3EA262A262A24F5AA24F5AA24F5AA262190FA24FC7FCA2193EA261 A261A24E5AA24E5AA24E5AA24E5AA24EC8FCA2183EA260131001305E13F800014C5A1203 D80FFC4B5A121DD838FE4B5A12F0D8407F4B5A12004DC9FC6D7E173E6D7E5F6D7E5FA26D 6C495AA26D6C495AA26D6C5C1607A26D6C495AA2027F49CAFCA291383F803EA25EEC1FC0 5EEC0FE0EDE1F0EC07F1EDF3E0A26EB45AA26E5BA26E90CBFCA25D157E157C15384D6478 8353>I<1B301B78A21BF8A21BF01A01A21BE01A03A21BC01A07A21B801A0FA21B0062A2 1A1E1A3EA21A3C1A7CA21A781AF8A262A21901A2621903A2621907A262190FA297C7FC61 A2191E193EA2193C197CA2197819F8A2611801A2611803A261A21807A261180FA296C8FC 60A2181E183EA2183C187C131001301678017016F813F860000116011203486C5E000F16 03121DD838FE5E00701607126000C05FEA407F0000160FA26D6C92C9FC5FA2171E6D6C14 3EA2173C6D6C147CA2177817F86D7E5F16016D7E5F1603A26D6C5C1607A26D6C5C160FA2 94CAFC027F5BA2161EEC3F80163EA2163C91381FC07CA2167891380FE0F8A25E15E1EC07 F15E15F3EC03FB5E15FFA26E5BA36E90CBFCA35D157EA2157C153C15384D96788353>I< 1B301B78A21BF8A21BF0A21A01A21BE0A21A03A21BC0A31A07A21B80A21A0FA21B00A262 A21A1EA21A3EA21A3CA21A7CA21A78A21AF8A262A31901A262A21903A262A21907A262A2 190FA297C7FCA261A2191EA2193EA2193CA3197CA21978A219F8A261A21801A261A21803 A261A21807A261A2180FA296C8FCA360A2181EA2183EA2183CA2187C1310187813300170 16F8A201F85E120117011203486C5EA2120D001D16031219D830FE5E12700060160712C0 00405FEA007F170FA295C9FC6D7E5FA2171EA26D6C143EA2173CA2177C6D7E1778A36D6C 14F8A25FA216016D7E5FA21603A26D6C5CA21607A26D6C5CA2160FA294CAFC147F5EA216 1EEC3F80A2163EA2163CEC1FC0167CA21678A291380FE0F8A25EA2EC07F1A25EA215F3EC 03FB5EA215FFA26E5BA48093CBFCA4157EA4157C153C15384DC8788353>I E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fn cmmi7 7 41 /Fn 41 123 df11 D<137E48B4EB0180000713C0489038E00300481406383E01F0393800700C4813380060EB 181848131CEC0C305AC75B14065DA3EC0780A292C7FCA31406A3140EA2140C141CA45CA3 1430A2142021267E9923>13 D15 D21 D<137001F81338157CA248485BA44848485AA44848485AA44848485AEDC180A3001F9038 0F8300A2141F9038C03786393FE0E7CC9038FFC3FC393E7F00F090C9FC5AA45AA45A5A21 267D9928>I<497EA414FF01071380131F90387C7F0049C7FC485A485A5B1207A2485AA4 6C7EA23803EFF06CB47E7E3803DFF0D80780C7FC000EC8FC121E5A12381278127012F0A3 7E7E7EEA7FC013F8EA3FFE380FFFC0000313F8C67F131FEB03FEEB007E143E141CEB203C EB7838EB3FF0EB07C019347EA71E>24 D<48B61280000715C0481580481500263C0C06C7 FC127012C0EB1C0EEA0018A21338A2EB701EA313F013E01201141F120313C0000780A238 0F800FA26C486CC7FC221A7D9827>I<010FB5FC013F148049140048B6FC2603F07EC7FC 3807C01FEA0F80497E5A123EA2003C5B127CA30078133E12F8143C0078137C14785C6C48 5A495A381E0F80D80FFEC8FCEA03F8211A7D9826>27 D<15185DA45DA45DA44A5AD803E0 1438D807F01478D80C7814FC39187C03000030157C163C1260D9F806131C00C01518A2EA 01F05C1630EA03E0A24A1360EA07C016C0ED0180EC30030003EC070001E0130E00015C90 38F8607039007E61E090383FFF80D907FEC7FCEB00C0A4495AA449C8FCA326347DA72C> 32 D<157E000349B4FC0006491380484913C048EB0F0391381C01E048EB18005C4A1360 5A5CA248484813C0A291C7FC49EB018000E01403ED0700D87006130E5D003C143CD83F0E 13F8391FEE07E06CB55A00035CC649C7FCEB1FF0013CC8FCA35BA313F8A35B5B23267C99 2C>39 D<1238127C12FEA3127C123807077A8614>58 D<1238127C12FE12FFA2127F123B 1203A31206A3120C121812381270122008127A8614>I61 D<12E012F812FEEA3F80EA0FE0EA03F8 EA00FEEB3F80EB0FE0EB03F8EB00FEEC3F80EC0FE0EC03F8EC00FEED3F80ED0FE0ED03F8 ED00FE163E16FEED03F8ED0FE0ED3F80EDFE00EC03F8EC0FE0EC3F8002FEC7FCEB03F8EB 0FE0EB3F8001FEC8FCEA03F8EA0FE0EA3F8000FEC9FC12F812E027277AA134>I<013FB5 12F816FF903A01FC001FC04AEB07E0EE03F001031401A24A14F8A2130717F04A130317E0 010F1407EE0FC04AEB1F80EE7E00011F495A91B512F0A291388001FC013FEB007E8291C7 EA1F80160F4915C0A2137EA213FEEE1F805BEE3F000001153E16FE49EB01F84B5A0003EC 1FC0B7C7FC15F82D287DA732>66 D<4AB41308020FEBE01891397F80F038903A01F80018 70D903E0EB0CF0D90F80130749C71203013E15E05B491401485A484815C0485A120F5B00 1F168090C8FC4892C7FCA2127EA4127C12FCA21606007C5DA35E007E5D123E5E6C5D6C6C 495A00074AC7FCD803E0130E6C6C13383900FE01F090383FFFC0D907FCC8FC2D2A7DA830 >I<013FB612FCA2903901FC00014AEB007C173C0103153817185CA21307A24A13C0A201 0F010113005E14C01503011F130F91B5C7FCA2EC800F013F7F15061400A249010E13E003 0C13C0017E90C7FC160101FEEC0380A249EC0700A20001150E161E495C16FC0003EC07F8 B7FC5E2E287DA731>69 D<90263FFFF0EB7FF8A2D901FCC7EA1FC04AEC1E005F01031570 4C5A4AEB03804CC7FC0107141C5E4A13E04B5A010FEB0780030EC8FC4A5A157C011F13FE 14C3EC877F149E90393FB83F8014F09138C01FC0148049486C7EA2017E6D7EA201FE6D7E A2496D7EA200016E7EA249147FA2000382B539C007FFF8A235287DA738>75 D78 D<013FB512E016FC903901FC007F4AEB0F80EE07C0010315E016035C17F01307EE07E05C A2010FEC0FC017804AEB1F00163E011F14F8ED07F091B51280A290393F800FE0ED03F002 007F15015BA2137EA201FE1303A2495CA20001160817184914E017380003EDF070B5D8C0 0113E0923800FFC0C9EA3F002D297DA732>82 D97 DII<15F8141FA2EC01F0A21403A215E0A21407A215C0A2140FEB1F8F90387FCF80EB F0EF3803C03FEA0780390F001F00A2001E5B123E003C133E127C147E5A147CA214FC5AEC F830A3903801F060A2EA7803010E13C0393C1CF980381FF07F3907C01E001D297CA723> III<130E131F5BA2133E 131C90C7FCA7EA03E0487EEA0C78EA187C1230A212605B12C0A2EA01F0A3485AA2485AA2 EBC180EA0F81A2381F0300A213066C5A131CEA07F06C5A11287DA617>105 D<1407EC0F80141FA21500140E91C7FCA7EB03E0EB07F8EB0C3C1318EB303E136013C0A2 48485AA2C7FCA25CA4495AA4495AA4495AA4495AA21238D87C1FC7FC12FC133E485AEA70 F8EA7FE0EA1F80193380A61B>I<133EEA07FEA2EA007CA213FCA25BA21201A25BA21203 EC07809038E01FC0EC38600007EB61E014C3EBC187EBC307D80FC613C09038CC038001B8 C7FC13E0487E13FEEB3F80EB0FC0486C7E1303003E1460A2127EECC0C0127CECC18012FC 903801E30038F800FE0070137C1B297CA723>I<137CEA0FFCA2EA00F8A21201A213F0A2 1203A213E0A21207A213C0A2120FA21380A2121FA21300A25AA2123EA2127EA2EA7C18A3 EAF830A21320EA786013C0EA3F80EA0F000E297EA715>I<3B07801FC007E03B0FE07FF0 1FF83B18F0E0F8783C3B30F1807CE03E903AFB007D801ED860FEEB3F005B49133E00C14A 133E5B1201A24848495BA35F4848485A1830EE01F0A23C0F8003E003E060A218C0933801 E180271F0007C013E3933800FF00000E6D48137C341B7D993B>I<3907801FC0390FE07F F03918F0E0F83930F1807CEBFB00D860FE133C5B5B00C1147C5B1201A248485BA34A5AEA 07C01660EC03E0A23A0F8007C0C0A2EDC180913803C300D81F0013C7EC01FE000EEB00F8 231B7D9929>I<9038F007C03901FC1FF039031E78780006EBE03C90381FC01C000CEB80 1E14005B0018141F133E1200137E153E137CA213FC157C5B1578000114F0A2EC01E0EC03 C03903FC07809038FE1F00EBE7FCEBE1F0D807E0C7FCA25BA2120FA25B121FEAFFF8A220 25809922>112 DI115 D<131C133EA25BA45BA4485AB512E0A23801F000485AA4485AA4485AA4 48C7FC1460A214C0123EEB0180EB0300EA1E06EA1F1CEA0FF8EA03E013267EA419>I<39 03E001C03907F003E0380C7807EA187C0030130314011260EBF80000C014C0A2EA01F0A2 EC0180EA03E0A2EC0300EA07C0A21406A25CA200035B6D5A3801F0E06CB45A013FC7FC1B 1B7D9921>118 DI<90387C03C03901FF0FF03907079C30390E03B078000CEBF0F8001813 E1123015F0396007C0E015001200A2495AA449C7FC15301238007C1460EAFC3E15C0EAF8 7E39F06F03803970C70700383F83FE381F01F81D1B7D9926>II<013E13C0137F9038FF818048 EBC3004813FF380701FE3806000C00045BC75A5C5CEB03800106C7FC5B5B5B5B9038C001 80EA038039060003005C380FF81E381FFFFE38383FFC38601FF86D5A38C007C01A1B7D99 20>I E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fo msbm10 10 5 /Fo 5 127 df67 D<007FB612E0B712FE6C6F7E2703C01E0313E0000190393C 00F3F00238EB70F8EE783CEE381E83EE3C07161C18801703A617071800EE3C0FEE380E17 3EEE78FCEEF7F892380FFFE0023FB5128004FCC7FC16B8913838F03CED701CED781EED38 0EED3C0FED1C07031E7FED0E03030F7FED0701EE81E0ED0380707E030113701778EEE038 0300133C707EEE700EEE780F9338380780EE3C03041C13C093381E01E00003013C90380E 00F0007FB539F00FFFFEB67F6C8137397DB836>82 D91 DI126 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fp cmr7 7 15 /Fp 15 127 df<0207131CA34A133C020E1338A3021E1378021C1370A4023C13F002385B A3EC7801B812F8A33B0001E007800002C090C7FCA201035BEC800EA30107131EEC001CA2 49133CB812F8A327003C00F0C7FC01385BA3EB780101705BA4EBF00301E05BA300011307 01C090C8FCA32D337CA737>35 D<1306130C13181330136013E0EA01C0EA0380A2EA0700 5A120E121EA2121C123CA35AA512F85AAB7E1278A57EA3121C121EA2120E120F7EEA0380 A2EA01C0EA00E0136013301318130C13060F3B7AAB1A>40 D<12C012607E7E7E120E7EEA 0380A2EA01C013E0120013F0A213701378A3133CA5133E131EAB133E133CA51378A31370 13F0A213E0120113C0EA0380A2EA0700120E120C5A5A5A5A0F3B7DAB1A>I<140EB3A2B8 12E0A3C7000EC8FCB3A22B2B7DA333>43 D48 D<13381378EA01F8121F12FE 12E01200B3AB487EB512F8A215267BA521>I<13FF000313E0380E03F0381800F848137C 48137E00787F12FC6CEB1F80A4127CC7FC15005C143E147E147C5C495A495A5C495A010E C7FC5B5B903870018013E0EA0180390300030012065A001FB5FC5A485BB5FCA219267DA5 21>I<13FF000313E0380F01F8381C007C0030137E003C133E007E133FA4123CC7123E14 7E147C5C495AEB07E03801FF8091C7FC380001E06D7E147C80143F801580A21238127C12 FEA21500485B0078133E00705B6C5B381F01F03807FFC0C690C7FC19277DA521>I<1438 A2147814F81301A2130313071306130C131C131813301370136013C012011380EA03005A 120E120C121C5A12305A12E0B612E0A2C7EAF800A7497E90383FFFE0A21B277EA621>I< EB0FE0EB3FF8EBF81C3801E0063803C01F48485AEA0F005A121E003E131E91C7FC5AA213 04EB3FC038FCFFF038FDC078EB003CB4133E48131E141FA2481480A4127CA4003C140012 3E001E131E143E6C133C6C6C5A3803C1F03801FFC06C6CC7FC19277DA521>54 D<137F3801FFC03807C1E0380F0070001E1378003E7F003C133E007C131EA200FC131FA4 1580A4007C133FA2123C003E137F001E135F380F01DF3807FF9F3801FE1FD80010130013 00A2143E123C007E133CA25C5C007C5B383003C0381C0780D80FFFC7FCEA03F819277DA5 21>57 D61 D91 D93 D<380F8010381FF038383FFFF04813E038E07FC038400F8015067BA621>126 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fq cmsy10 10 29 /Fq 29 121 df<007FB81280B912C0A26C17803204799641>0 D<121C127FEAFF80A5EA 7F00121C0909799917>I<0060150600F8150F6C151F007E153F6C157E6C6C14FC6C6CEB 01F86C6CEB03F06C6CEB07E06C6CEB0FC06C6CEB1F80017EEB3F006D137E6D6C5A90380F C1F8903807E3F0903803F7E06DB45A6D5B6EC7FCA24A7E497F903803F7E0903807E3F090 380FC1F890381F80FC90383F007E017E7F49EB1F804848EB0FC04848EB07E04848EB03F0 4848EB01F84848EB00FC48C8127E007E153F48151F48150F00601506282874A841>I10 D<020FB6128091B712C01303010F 1680D91FF8C9FCEB7F8001FECAFCEA01F8485A485A485A5B48CBFCA2123EA25AA2127812 F8A25AA87EA21278127CA27EA27EA26C7E7F6C7E6C7E6C7EEA00FEEB7F80EB1FF86DB712 80010316C01300020F158091CAFCAE001FB812804817C0A26C1780324479B441>18 D20 D<126012F812FEEA7F80EA3FE0EA0FF8EA03FEC66C7EEB3FE0EB0FF8EB03FE90 3800FF80EC3FE0EC0FF8EC03FE913800FF80ED3FE0ED0FF8ED03FE923800FF80EE3FE0EE 0FF8EE03FE933800FF80EF3FC0171FEF7F80933801FF00EE07FCEE1FF0EE7FC04B48C7FC ED07FCED1FF0ED7FC04A48C8FCEC07FCEC1FF0EC7FC04948C9FCEB07FCEB1FF0EB7FC048 48CAFCEA07FCEA1FF0EA7FC048CBFC12FC1270CCFCAE007FB81280B912C0A26C17803244 79B441>I24 DI<020FB6128091B712C01303010F1680D91FF8C9FCEB7F8001FECAFCEA01 F8485A485A485A5B48CBFCA2123EA25AA2127812F8A25AA87EA21278127CA27EA27EA26C 7E7F6C7E6C7E6C7EEA00FEEB7F80EB1FF86DB71280010316C01300020F1580323279AD41 >I<181EA4181F84A285180785727EA2727E727E85197E85F11F80F10FC0F107F0007FBA 12FCBCFCA26C19FCCCEA07F0F10FC0F11F80F13F00197E61614E5A4E5AA24E5A61180F96 C7FCA260181EA4482C7BAA53>33 D49 D<91381FFFFE91B6FC1303010F14FED91FF0C7FCEB7F8001FEC8FCEA01F8485A485A485A 5B48C9FCA2123EA25AA2127812F8A25AA2B712FE16FFA216FE00F0C9FCA27EA21278127C A27EA27EA26C7E7F6C7E6C7E6C7EEA00FEEB7F80EB1FF06DB512FE010314FF1300021F13 FE283279AD37>I54 D<0060161800F0163C6C16 7CA200781678007C16F8A2003C16F0003E1501A26CED03E0A26C16C06D1407A200071680 6D140FA26C6CEC1F00A26CB612FEA36C5D01F8C7127CA2017C5CA2013C5C013E1301A201 1E5C011F1303A26D6C485AA201075CECC00FA2010391C7FC6E5AA2903801F03EA2010013 3CECF87CA2EC7878EC7CF8A2EC3FF0A26E5AA36E5AA36E5A6EC8FC2E3C80B92F>56 D<007FB612F0B712F8A27EC91278B3A5003FB612F85AA27EC91278B3A5007FB612F8B7FC A26C15F0253A7CB92E>I<18F017011707A3170FA2171F60173F1737177F176F17EF17CF 04017F178F1603170FEE0707160EA2161C161816381630167016E0A2ED01C016801503ED 0700A2150E5DA25D157815705D02018103CFB5FCEC03BF4AB6FCA2020EC71203141E5C14 3802788100205B386001E0EAF0036C4848140126FE1F8081B5C8FC190C49EEFF3C496F13 F06C4817E06C4817806C48EE7E00D8078093C7FC3E407DBB42>65 D<0370EBFF80912601E00713E0912603C01F13F891260F007F7F021E9038F03FFE913A78 03C00FFF9139F0078003494848486C1380902603C01E7F902607803EEC7FC049485A011E 49143F013E17E0494848141FEBF8035D2601F007150F00035CEBE00F00075CD9C01EC8FC 000F131C49C9FC121FA248CA13C0A348171F1980127EA2183F00FE1800A2183E187E187C 18FC6017016C5F4D5A6017076C6C4B5A4DC7FC171E6D5D6C6C5D5F6D4A5A6C6CEC03806C 6C020FC8FC01FF143E6C01C013F86C9038F807E06C90B512806C6C49C9FC011F13F00103 13803B3D7BBA42>79 D<0203B512F8027FECFF8049B712F0010F8290273FC3F00313FED9 78039038003FFF2601E00702071380D803C06F13C0D807801500000F177FD81F00EE3FE0 484A141F123E5A0078010F150F12C0C7FC4B15C0A3021FED1F80A24B1500183EA2023F5D 6092C85A4D5A4D5A4A4A5A027E020EC7FC173C17F84AEB03E0EE3F80DB1FFEC8FC0101EB 7FF89138F8FFC0DAF9FCC9FC02F8CAFC495AA3495AA3495AA3495AA291CBFC5BA2137EA3 5B13F013C03B3D7FB83A>I83 D92 D102 D<12FCEAFFC0EA07F0EA 01FCEA007E7F80131F80130FB3A7801307806D7E6D7EEB007EEC1FF0EC07F8EC1FF0EC7E 00495A495A495A5C130F5CB3A7131F5C133F91C7FC137E485AEA07F0EAFFC000FCC8FC1D 537ABD2A>I<126012F0B3B3B3B3A91260045377BD17>106 D<0070131C00F0131EB3B3B3 B3A80070131C175277BD2A>I<126012F07EA21278127CA2123C123EA2121E121FA27E7F A212077FA212037FA212017FA212007FA21378137CA2133C133EA2131E131FA27F80A213 0780A26D7EA2130180A2130080A21478147CA2143C143EA2141E141FA2801580A2140715 C0A2140315E0A2140115F0A2140015F8A21578157CA2153C153EA2151E150C1F537BBD2A >110 D112 D114 D<137E3801FFC03807C1E0380F0070001E1338003E13 1C48130C141E147E5AA3143C1400A3127CA37E121E7E6C7E6C7EEA00F013FCEA03FF380F 8780381F01E0003E13F0EB00F848137CA200FC133E5A141FA6127C143F6C133EA26C137C EA0F80000713F83801E1F03800FFC0EB3F00130FEB03C0EB01E0EB00F01478147C143EA3 141FA3123C127EA3143E127812300038137C6C13786C13F0380783E03803FF8038007E00 184C7ABA25>120 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fr cmr8 8 30 /Fr 30 123 df<123C127EB4FCA21380A2127F123D1201A312031300A25A1206120E5A5A 5A126009157A8714>44 D48 D<130C133C137CEA03FC12FFEA FC7C1200B3B113FE387FFFFEA2172C7AAB23>II<140EA2141E143EA2147E14 FEA2EB01BE1303143E1306130E130C131813381330136013E013C0EA0180120313001206 120E120C5A123812305A12E0B612FCA2C7EA3E00A9147F90381FFFFCA21E2D7EAC23>52 D<000CEB0180380FC01F90B512005C5C14F014C0D80C7EC7FC90C8FCA8EB1FC0EB7FF838 0DE07C380F801F01001380000E130F000CEB07C0C713E0A2140315F0A4127812FCA448EB 07E012E0006014C00070130F6C14806CEB1F006C133E380780F83801FFE038007F801C2D 7DAB23>I<123C127E12FFA4127E123C1200AD123C127E12FFA4127E123C081D7A9C14> 58 D67 D72 D78 DI82 D<90383F80303901FFF0703807C07C390F000EF0001E13074813034813011400127000F0 1470A315307EA26C1400127E127FEA3FE013FE381FFFE06C13FC6C13FF00011480D8003F 13E013039038003FF0EC07F81401140015FC157C12C0153CA37EA215787E6C14706C14F0 6CEB01E039F78003C039E3F00F0038E07FFE38C00FF01E2F7CAD27>I<13FF000713C038 0F01F0381C00F8003F137C80A2143F001E7FC7FCA4EB07FF137F3801FE1FEA07F0EA1FC0 EA3F80EA7F00127E00FE14065AA3143F7E007E137F007FEBEF8C391F83C7FC390FFF03F8 3901FC01E01F207D9E23>97 DII<15F8141FA214011400ACEB0FE0EB7FF83801F81E3803E0073807C00338 0F8001EA1F00481300123E127EA25AA9127C127EA2003E13017EEB8003000F13073903E0 0EFC3A01F03CFFC038007FF090391FC0F800222F7EAD27>II105 D<2607C07FEB07F03BFFC3FFC03FFC903AC783F0 783F3C0FCE01F8E01F803B07DC00F9C00F01F8D9FF8013C04990387F000749137EA24913 7CB2486C01FEEB0FE03CFFFE0FFFE0FFFEA2371E7E9D3C>109 D<3807C0FE39FFC3FF80 9038C703E0390FDE01F0EA07F8496C7EA25BA25BB2486C487E3AFFFE1FFFC0A2221E7E9D 27>II<3807C0FE39FFC7FF809038CF03E0390FDC01 F03907F800FC49137E49133E49133FED1F80A3ED0FC0A8151F1680A2ED3F00A26D137E6D 137C5D9038FC01F09038CE07E09038C7FF80D9C1FCC7FC01C0C8FCA9487EEAFFFEA2222B 7E9D27>I<380781F838FF87FEEB8E3FEA0F9CEA07B813B0EBF01EEBE000A45BB0487EB5 FCA2181E7E9D1C>114 D<3801FE183807FFB8381E01F8EA3C00481378481338A21418A2 7E7EB41300EA7FF06CB4FC6C13C06C13F0000113F838001FFC130138C0007E143EA26C13 1EA27EA26C133CA26C137838FF01F038E3FFC000C0130017207E9E1C>I<1360A413E0A3 12011203A21207121FB512F0A23803E000AF1418A714383801F03014703800F860EB3FE0 EB0F80152A7FA81B>II<3AFFFC01FFC0A23A 0FE0007E000007147C15380003143015706C6C1360A26C6C5BA390387C0180A26D48C7FC A2EB3F07EB1F06A2EB0F8CA214DCEB07D8A2EB03F0A36D5AA26D5A221E7F9C25>I<3AFF FC01FFC0A23A0FE0007E000007147C1538000314306D137000011460A26C6C5BA2EBFC01 017C5BEB7E03013E90C7FCA2EB1F06A2148EEB0F8CA2EB07D8A2EB03F0A36D5AA26D5AA2 495AA2130391C8FC1278EAFC06A25B131CEA7838EA7070EA3FE0EA0F80222B7F9C25> 121 D<003FB51280A2EB003F003C14000038137E00305BEA700100605B495A495A130F00 005B495A49C7FC5B137E9038FC0180EA01F8120313F03807E003EA0FC0001F1400138048 485A007E5B00FE133FB6FCA2191D7E9C1F>I E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fs cmcsc10 10 50 /Fs 50 121 df<1430147014E0EB03C0EB0780EB0F00130E131E5B5B13F85B485AA2485A A212075B120F90C7FC5AA2121E123EA3123C127CA5127812F8B01278127CA5123C123EA3 121E121FA27E7F12077F1203A26C7EA26C7E7F13787F7F130E130FEB0780EB03C0EB00E0 14701430145277BD24>40 D<12C07E1270123C7E7E7E7F6C7E6C7E7F12001378A27FA213 3E131E131F7F1480A2130714C0A3130314E0A5130114F0B014E01303A514C01307A31480 130FA214005B131E133E133CA25BA25B12015B485A485A90C7FC5A121E5A12705A5A1452 7ABD24>I45 D<121C127FEAFF80A5EA7F00121C090977881B>I< EB03FE90381FFFC090383E03E09038F800F84848137C48487F48487F497F000F1580001F 15C090C71207A24815E0A3007EEC03F0A500FE15F8B2007E15F0A4007F14076C15E0A46C 15C06D130F000F15806C6CEB1F00A26C6C133E6C6C5B6C6C5B90383E03E06DB45AD903FE C7FC253A7CB72E>48 DIII<151C153CA2157C15FCA214011403A21407140F141D14191431147114 6114C11301EB038114011307130E130C131813381330136013E0EA01C01380EA03005A12 065A121C5A123012705AB712FEA3C73801FC00AB4A7E49B512FCA327397DB82E>I<0006 1406D80780131E9038F801FC90B5FC5D5D15C05D4AC7FC38067FF090C9FCABEB03FC9038 1FFF8090387C07E09038E001F03907C000F8497F90C7127E0006147FC8EA3F80A216C015 1FA216E0A4123E127F487EA490C713C048143F126016800070147F6C150015FE6C5C000F 495A39078007F03903F01FE06CB512806C6C48C7FCEB0FF0233A7BB72E>II<12301238123E003FB612F8A316F05A16E016C00070C7EA018000 601403ED0700150E00E0140C48141C5D5DC8126015E04A5A4A5A92C7FC5C140EA25C143C 14381478147014F0A213015C1303A21307A3130F5CA2131FA5133FA96D5A6DC8FC253B7A B82E>III<150EA3151F A24B7EA34B7EA3EDDFE0A202017F158FA29138030FF81507A202067F1503020E7FEC0C01 A2021C7FEC1800A24A80167FA24A6D7EA202E0804A131FA2494880160FA249B67EA24981 0106C71203A249811601A2498182A2496F7EA20170820160153F13E06D821203D80FFCED 7FF8B56C010FB512E0A33B3C7CBB44>65 DI68 DI< B6D8C07FB512E0A3C601C0C7387FE0006D486E5AB3A491B7FCA30280C7123FB3A6496C4A 7EB6D8C07FB512E0A33B397CB844>72 DI<011FB512F0A39039000FFE00EC03FCB3B3A3123FEA7F80EAFFC0A44A5A 1380D87F005B0070130F6C495A6C5C6C49C7FC3807C0FE3801FFF838003FC0243B7CB82F >I76 DI80 D82 D<003FB812FCA3D9C001EB800390C7 90C7FC007C173E0078171E0070170EA300601706A400E01707481703A4C81500B3B00203 13C0010FB612F0A338397CB841>84 D86 D<003FB712E0A301FCC7EA7FC013E00180EC FF8090C7481300123E003C4A5A00384A5A127800704A5A4B5AA24B5A0060147F5E4B5A5C C791C7FC4A5AA24A5A4A5AA24A5A4A5AA24A5A4A5AA24990C8FC495AA2495A49481430A2 495A133F5C495A01FF15705C4890C8FCA2484815F0484815E0A248481401484814031607 4848140F4848143FED01FFB8FCA32C397AB838>90 D<1407A24A7EA34A7EA3EC37E0A2EC 77F01463A2ECC1F8A201017F1480A2903803007EA301067FA2010E80010C131FA2496D7E A2013FB57EA29038300007496D7EA3496D7EA200018149130012036D801207D81FE09038 01FF80D8FFF8010F13F8A22D2C7DAB33>97 DI<91383FC006903901FFF80E90390FE03E1E90 381F0007017EEB03BE01F8EB01FE484813004848147E0007153E485A001F151E5B003F15 0E90C8FC5A1606A212FE1600AA007F1506A37E6D140E001F150C7F000F151C6C6C141800 0315386C6C14706C6C14E0017EEB01C0011FEB078090390FE03E00903801FFF89038003F C0272D7BAB31>IIII<91383FE003903901FFF807903907E01E0F90 391F00078F017EEB01DF496DB4FC484880484880484880485A001F815B003F8190C8FC5A 82A212FE93C7FCA892383FFFF8A2007F02001380EE3F00A27E7F121F7F120F6C7E6C7E6C 6C5C6C7E017E5C011FEB01CF903907E00F87903901FFFE039026003FF0C7FC2D2D7BAB35 >II I107 DIIIII114 D<017F13603901FFE0E0380780F9380E001F48130748130312780070130100F0 1300A315607EA26C14007E127F13C0EA3FFEEBFFE06C13F8000713FE6C7FC61480010F13 C01300EC0FE01407EC03F01401A212C01400A37E15E06C1301A26CEB03C06CEB0780B4EB 0F0038F3E01E38E0FFF838C01FE01C2D7BAB26>I<007FB712C0A23A7E003FC00F007890 381F8003007015011600126000E016E0A2481660A5C71500B3A8EC7FE0011FB57EA22B2B 7DAA31>IIII<3B7FFF800FFFC0A2000790390003FE006C48EB01F8 00015D000015C0017F13036D5C6E48C7FC90381FC0066D6C5A151C6D6C5A903803F83001 015BECFCE06D6C5AEC7F80A2143F6E7E140F4A7E4A7E1433EC63F8ECE1FCECC0FE903801 807E0103137F49486C7E0106131F4980011C6D7E496D7E0130130301708001F06D7E0001 81000781D81FF8491380B46C4913F8A22D2B7DAA33>I E %EndDVIPSBitmapFont %DVIPSBitmapFont: Ft cmmi10 10 62 /Ft 62 123 df11 DII15 D17 D<133F14C0EB07F06D7E801301A26D7EA3147FA36E7EA36E7EA36E7EA36E7EA36E 7EA36E7EA26E7EA214014A7E5C4A7E91381E3F80143C14784A6C7E1301EB03E049486C7E EB0F80EB1F00496D7E137E5B48486D7E485A485A000F6E7E485A485A48C87E12FE167F48 16800070151F293B7CB930>21 DI<1406A6913807FFC04A13E091383F80609138FD FFE0903903F87F804948C7FC495A495A495A137F91C8FC5B5B1201A25BA512007F137E90 383F3FF090381FFFFC90380FC01C90381FFFF890383C7FE001F0C8FC485A485A485AA248 C9FC121EA25AA2127C1278A312F87EA2127E127F7FEA3FE013FC6CB4FC6C13E06C13F800 0113FF6C6C13C0010F13F001037FEB007F140F14031400A4010C5BEB0E0190380783E090 3801FF80D9007EC7FC234B7EB924>24 D<013FB612E090B712F05A120717E0270F807006 C7FC391E00600E48140C003813E04813C048141CEAC0011200148001035BA213071400A2 5B1578011E137CA3133E133C137C157E13FC5B1201157F1203497FA3D801C0131C2C257E A32F>I<027FB512C00103B612E0130F5B017F15C09026FF81FEC7FC3901FC007E48487F 485A497F484880485AA248C7FCA2127EA2153F00FE92C7FC5AA25D157E5A5DA24A5AA24A 5A007C495A5D003C495A003E013FC8FC6C137C380F81F83803FFE0C66CC9FC2B257DA32F >27 D<1503A35DA21506A2150EA2150CA2151CA21518A21538A21530A21570A2EC07FE91 383FFFC0903901FCE3F0903907E0E0F890391F80C03ED93E007FEB7C01D801F8EC0F80D8 03F0018013C0D807E014071403D80FC015E0D81F801300A248485AA2007E1306A2020E13 0F12FE48010C14C0A2021CEB1F80A20218EB3F00A20238137E007C5D1430007E4A5A003E 90387003F06CEC07C09138600F80D80F80013FC7FC3903E0E0FC3901F8E7F039007FFF80 D90FFCC8FCEB01C0A25CA21303A291C9FCA25BA21306A2130EA2130CA22B4B7CB931>30 DI<160C161C1618A316381630 A316701660A316E05EA315015EA301F80103130FD803FE9138001F80D8070F153F000E01 8015C0001C5C001814060038161F0030160FD8701F010E13070060140C1703D8E03F1680 00C0EB001C491318EA007E180001FE13384913305F000116064913700360130E5F000316 184901E013384B133017705F0201495AD801F849485A4CC7FC160E2600FC035B017EEB00 78013FEB01E090390FE30F80902603FFFEC8FC9038003FF00206C9FCA2140E140CA3141C 1418A314381430A314701460324B7EB936>I39 D<181EA3181F8485180785 727EA2727E851800197C85193FF11F80F10FC0F107F0F103F8007FBA12FCBCFCA27E4818 7BAA53>42 D<121C127FEAFF80A5EA7F00121C0909798817>58 D<121C127FEAFF80A213 C0A3127F121C1200A412011380A2120313005A1206120E5A5A5A12600A19798817>II<150C151E153EA2153C 157CA2157815F8A215F01401A215E01403A215C01407A21580140FA215005CA2141E143E A2143C147CA2147814F8A25C1301A25C1303A2495AA25C130FA291C7FC5BA2131E133EA2 133C137CA2137813F8A25B1201A25B1203A25B1207A25B120FA290C8FC5AA2121E123EA2 123C127CA2127812F8A25A12601F537BBD2A>I<126012FCB4FCEA7FC0EA1FF0EA07FCEA 01FF38007FC0EB1FF0EB07FCEB01FF9038007FC0EC1FF0EC07FCEC01FF9138007FC0ED1F F0ED07FCED01FF9238007FC0EE1FF0EE07FCEE01FF9338007F80EF1FC0A2EF7F80933801 FF00EE07FCEE1FF0EE7FC04B48C7FCED07FCED1FF0ED7FC04A48C8FCEC07FCEC1FF0EC7F C04948C9FCEB07FCEB1FF0EB7FC04848CAFCEA07FCEA3FF0EA7FC048CBFC12FC12703232 79AD41>I<1760177017F01601A21603A21607160FA24C7EA216331673166316C3A2ED01 83A2ED0303150683150C160115181530A21560A215C014011580DA03007FA20206130014 0E140C5C021FB5FC5CA20260C7FC5C83495A8349C8FC1306A25BA25B13385B01F0168048 7E000716FFB56C013F13FF5EA2383C7DBB3E>65 D<0103B77E4916F018FC903B0007F800 03FE4BEB00FFF07F80020FED3FC0181F4B15E0A2141FA25DA2143F19C04B143F1980027F 157F190092C812FE4D5A4A4A5AEF0FF04AEC1FC005FFC7FC49B612FC5F02FCC7B4FCEF3F C00103ED0FE0717E5C717E1307844A1401A2130F17035CA2131F4D5A5C4D5A133F4D5A4A 4A5A4D5A017F4BC7FC4C5A91C7EA07FC49EC3FF0B812C094C8FC16F83B397DB83F>I<93 39FF8001C0030F13E0037F9038F80380913A01FF807E07913A07F8000F0FDA1FE0EB079F DA3F80903803BF0002FFC76CB4FCD901FC80495A4948157E495A495A4948153E017F163C 49C9FC5B1201484816385B1207485A1830121F4993C7FCA2485AA3127F5BA312FF90CCFC A41703A25F1706A26C160E170C171C5F6C7E5F001F5E6D4A5A6C6C4A5A16076C6C020EC8 FC6C6C143C6C6C5C6CB4495A90393FE00FC0010FB5C9FC010313FC9038007FC03A3D7CBA 3B>I<0103B7FC4916E018F8903B0007F80007FE4BEB00FFF03F80020FED1FC0180F4B15 E0F007F0021F1503A24B15F81801143F19FC5DA2147FA292C8FCA25C18035CA2130119F8 4A1507A2130319F04A150FA2010717E0181F4A16C0A2010FEE3F80A24AED7F00187E011F 16FE4D5A4A5D4D5A013F4B5A4D5A4A4A5A057FC7FC017F15FEEE03FC91C7EA0FF049EC7F C0B8C8FC16FC16C03E397DB845>I<0103B812F05BA290260007F8C7123F4B1407F003E0 020F150118005DA2141FA25D19C0143FA24B1330A2027F1470190092C7126017E05C1601 4A495A160F49B6FCA25F9138FC000F01031407A24A6DC8FCA201075C18034A130660010F 160693C7FC4A150E180C011F161C18184A1538A2013F5E18F04A4A5AA2017F15074D5A91 C8123F49913803FF80B9FCA295C7FC3C397DB83D>I<0103B812E05BA290260007F8C712 3F4B140FF003C0140F18015DA2141FA25D1980143FA25D1760027F14E095C7FC92C75AA2 4A1301A24A495A16070101141F91B6FC94C8FCA2903903FC001F824A130EA21307A24A13 0CA2010F141CA24A90C9FCA2131FA25CA2133FA25CA2137FA291CBFC497EB612C0A33B39 7DB835>II<0103B5D8F803B512F8495DA2902600 07F8C73807F8004B5DA2020F150F615DA2021F151F615DA2023F153F615DA2027F157F96 C7FC92C8FCA24A5D605CA249B7FC60A202FCC7120101031503605CA201071507605CA201 0F150F605CA2011F151F605CA2013F153F605CA2017F157F95C8FC91C8FC496C4A7EB690 B6FCA345397DB845>I<0107B512FCA216F890390007F8005DA2140FA25DA2141FA25DA2 143FA25DA2147FA292C7FCA25CA25CA21301A25CA21303A25CA21307A25CA2130FA25CA2 131FA25CA2133FA25CA2137FA291C8FC497EB6FCA326397DB824>I<0203B512FCA3DA00 0113006F5AA215015EA315035EA315075EA3150F5EA3151F5EA3153F5EA3157F93C7FCA3 5D5DA31401A25DA21403120FD83F805B127FEBC007D8FF805BA24A5AEB001F00FC5C00E0 495A006049C8FC007013FE383801F8381E07F03807FFC0D801FEC9FC2E3B7AB82E>I<01 03B500F8903807FFFC5BA290260007F8C813804BEDFC0019F0020F4B5AF003804B4AC7FC 180E021F1538604B5CEF0380023F4AC8FC170E4B133C1770027F5C4C5ADB0007C9FC160E 4A5B167E4A13FE4B7E01015B92380E7F80ECFC1CED383F010301E07FECFDC04A486C7EEC FF00D907FC6D7E5C4A130783130F707E5C1601011F81A24A6D7EA2013F6F7EA24A143F84 137F717E91C8123F496C81B60107B512C0A26146397DB847>I<0103B6FC5B5E90260007 FCC8FC5D5D140FA25DA2141FA25DA2143FA25DA2147FA292C9FCA25CA25CA21301A25CA2 1303A25CA2130718404A15C0A2010F150118804A1403A2011F16005F4A1406170E013F15 1E171C4A143C177C017F5D160391C7120F49EC7FF0B8FCA25F32397DB839>I<902603FF F891381FFFF8496D5CA2D90007030113006FEC007C02061678DA0EFF157081020C6D1460 A2DA1C3F15E0705CEC181F82023815016F6C5C1430150702706D1303030392C7FC02607F A2DAE0015C701306ECC0008201016E130EEF800C5C163F0103EDC01C041F131891C713E0 160F49EDF03818300106140717F8010E02031370EFFC60130CEE01FE011C16E004005B01 1815FF177F1338600130153FA20170151F95C8FC01F081EA07FCB512E01706A245397DB8 43>78 D<4BB4FC031F13F09238FE01FC913903F0007EDA07C0EB1F80DA1F80EB0FC0023E C7EA07E002FCEC03F0495A4948EC01F8495A4948EC00FC495A49C912FE49167E13FE4916 7F1201485AA2485AA2120F5B001F17FFA2485AA34848ED01FEA400FFEE03FC90C9FCA2EF 07F8A2EF0FF0A218E0171F18C0EF3F806C167F180017FE4C5A6C6C5D1603001F4B5A6D4A 5A000FED1F806C6C4AC7FC6D147E0003EC01F8D801FC495AD8007EEB0FC090263F807FC8 FC903807FFF801001380383D7CBA3F>I<0103B612F849EDFF8018E0903B0007F8001FF8 4BEB03FCEF00FE020F157FA24BEC3F80A2021F16C0A25DA2143FF07F805DA2027FEDFF00 6092C7485A4D5A4A4A5A4D5A4AEC1F80057FC7FC0101EC07F891B612E094C8FC9139FC00 0FC00103EC03F0707E4A6D7E831307177E5C177F010F5D5F5CA2011F1401A25CA2133F16 034A4A1360A2017F17E019C091C71401496C01011480B61503933900FE0700EF7E0ECAEA 1FFCEF07F03B3B7DB83F>82 D<92391FE00380DBFFFC130002036D5A91390FE01F8F9139 3F0007DF027EEB01FE02F81300495A4948147E177C4948143C495AA2011F153891C8FCA3 491530A28094C7FC80806D7E14FEECFFE06D13FE6DEBFFC06D14F06D806D80021F7F0203 7FEC003F03037F1500167F163F161FA3120C160FA2001C151F94C7FCA3003C153EA25E00 3E5D127E007F4A5A6D495A6DEB0FC0D8F9F0495AD8F0FE01FEC8FC39E03FFFF8010F13E0 D8C00190C9FC313D7CBA33>I<0003B812FEA25A903AF8003FC00101C0913880007E4848 163C90C7007F141C121E001C92C7FCA2485CA200305C007017180060130112E0485CA214 03C716005DA21407A25DA2140FA25DA2141FA25DA2143FA25DA2147FA292C9FCA25CA25C A21301A25CA21303A25CEB0FFC003FB6FC5AA237397EB831>I<267FFFFC91383FFFC0B5 5DA2000390C83807FC006C48ED03E06060000094C7FC5F17065FA25F6D5DA26D5D17E05F 4C5AA24CC8FC6E1306A2013F5C161C16185EA25E6E5BA2011F495A150393C9FC1506A25D 6E5AA2010F5B157015605DA2ECE18002E3CAFC14F3EB07F614FE5C5CA25C5CA26D5AA25C 91CBFC3A3B7CB830>86 D<277FFFFC01B500F890B51280B5FC60000390C7D807FCC7380F F80001FC4BEC03E000016204035E98C7FC621A0604075DA2040F5DA2041B5D6216336D02 735D1663000003C34A5A83DB01834AC8FC04815CDB0301140603075D1506030C5DA20318 5D1970033015606115606D01E04A5A15C090267F01804AC9FC17FEDA030014060400130E 0206150C020E5D140C4A5DA24A5D18E04A5D715A5C4A92CAFCA26DC85AA2013E157C1778 133C1770133801301560513B7CB84E>I<91B712FCA25B9239E00007F84AC7EA0FF0D903 F8EC1FE04AEC3FC04AEC7F804A150049485C91C7485A4C5A010E4A5A4C5A010C4A5A011C 4A5A01185D167F4CC7FC90C7485A4B5A4B5A4B5A5E151F4B5A4B5A4BC8FC4A5A4A5A4A5A 5D140F4A5A4A5A4A48130C4AC7FC495A4A141C01031518495A4948143849481430494814 70495A49C812F0495D000115014848140348484A5A4848140F4848141F4848EC7F804848 EB07FF90B7FCB8FC94C7FC36397BB839>90 D<147E903803FF8090390FC1C38090391F00 EFC0017E137F49133F485A4848EB1F8012075B000F143F48481400A2485A5D007F147E90 C7FCA215FE485C5AA214015D48150CA21403EDF01C16181407007C1538007E010F133000 3E131F027B13706C01E113E03A0F83C0F9C03A03FF007F80D800FCEB1F0026267DA42C> 97 D<133FEA1FFFA3C67E137EA313FE5BA312015BA312035BA31207EBE0FCEBE3FF9038 E707C0390FFE03E09038F801F001F013F8EBE000485A15FC5BA2123F90C7FCA214015A12 7EA2140312FE4814F8A2140715F05AEC0FE0A215C0EC1F80143F00781400007C137E5C38 3C01F86C485A380F07C06CB4C7FCEA01FC1E3B7CB924>II<163FED1FFFA3ED007F167E A216FEA216FCA21501A216F8A21503A216F0A21507A2027E13E0903803FF8790380FC1CF 90381F00EF017EEB7FC049133F485A4848131F000715805B000F143F485A1600485A5D12 7F90C7127EA215FE5A485CA21401A248ECF80CA21403161CEDF0181407007C1538007E01 0F1330003E131F027B13706C01E113E03A0F83C0F9C03A03FF007F80D800FCEB1F00283B 7DB92B>II<16F8ED03FEED0F8792381F0F80ED3E3F167F157CA215FC1700161C 4A48C7FCA414035DA414075DA20107B512F0A39026000FE0C7FC5DA4141F5DA4143F92C8 FCA45C147EA514FE5CA413015CA4495AA45C1307A25C121E123F387F8F80A200FF90C9FC 131E12FEEA7C3CEA7878EA1FF0EA07C0294C7CBA29>III<14E0EB03F8A21307A314F0EB01C090C7FCAB13F8EA03FEEA070F000E1380121C12 1812381230EA701F1260133F00E0130012C05BEA007EA213FE5B1201A25B12035BA20007 131813E01438000F133013C01470EB806014E014C01381EB838038078700EA03FEEA00F8 15397EB71D>I<150FED3F80A2157FA31600151C92C7FCABEC0F80EC3FE0ECF0F0903801 C0F849487E14005B130E130C131CEB1801133801305BA2EB0003A25DA21407A25DA2140F A25DA2141FA25DA2143FA292C7FCA25CA2147EA214FEA25CA21301001E5B123F387F83F0 A238FF87E0495A00FE5BD87C1FC8FCEA707EEA3FF8EA0FC0214981B722>IIIII<90390F80 03F090391FE00FFC903939F03C1F903A70F8700F80903AE0FDE007C09038C0FF80030013 E00001491303018015F05CEA038113015CA2D800031407A25CA20107140FA24A14E0A201 0F141F17C05CEE3F80131FEE7F004A137E16FE013F5C6E485A4B5A6E485A90397F700F80 DA383FC7FC90387E1FFCEC07E001FEC9FCA25BA21201A25BA21203A25B1207B512C0A32C 3583A42A>112 D<02FC13C0903803FF0190380F838390383F01C790397E00EF8049137F 485A4848133F000715005B485A001F5C157E485AA2007F14FE90C75AA3481301485CA314 03485CA314075D140F127C141F007E495A003E137F381F01EF380F839F3903FF1F80EA00 FC1300143F92C7FCA35C147EA314FE5C130190387FFFF0A322357DA425>I<3903E001F8 3907F807FE390E3C1E07391C3E381F3A183F703F800038EBE07F0030EBC0FF00705B0060 1500EC007E153CD8E07F90C7FCEAC07EA2120013FE5BA312015BA312035BA312075BA312 0F5BA3121F5B0007C9FC21267EA425>I116 D<01F8EB03C0D803FEEB07E0D8070F130F000E018013F0121C121800 38140700301403D8701F130112601500D8E03F14E000C090C7FC5BEA007E16C013FE5B15 01000115805B150316001203495B1506150E150C151C151815385D00015C6D485A6C6C48 5AD97E0FC7FCEB1FFEEB07F024267EA428>118 D<903907E001F090391FF807FC903978 3E0E0F9039E01F1C1FD801C09038383F803A03800FF07F0100EBE0FF5A000E4A1300000C 157E021F133C001C4AC7FC1218A2C7123FA292C8FCA25CA2147EA214FEA24A130CA20101 141C001E1518003F5BD87F81143801835C00FF1560010714E03AFE0E7C01C0D87C1C495A 2778383E0FC7FC391FF00FFC3907C003F029267EA42F>120 D<13F8D803FE1470D8070F 14F8000EEB8001121C121800381403003015F0EA701F1260013F130700E0010013E012C0 5BD8007E130F16C013FE5B151F000115805BA2153F000315005BA25D157EA315FE5D1401 000113033800F80790387C1FF8EB3FF9EB0FE1EB00035DA2000E1307D83F805B007F495A A24A5A92C7FCEB003E007C5B00705B6C485A381E07C06CB4C8FCEA01FC25367EA429>I< D901E01360D90FF813E0496C13C090383FFE0190397FFF038090B5EA07009038F81FFF39 01E003FE9038C0001C495B5DC85A4A5A4A5A4AC7FC140E5C5C14F0495AEB038049C8FC13 0E5B4913035B495B484813064848130E48C75AD80FFC137C391FFF81F8381E0FFFD83807 5B486C5B00605CD8E00190C7FC38C0007C23267DA427>I E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fu cmcsc10 12 25 /Fu 25 123 df45 D<1638167CA316FEA34B7EA24B7FA34B7F16 7FA2030E7F163FA24B6C7EA2033C7FED380FA203787FED7007A203E07F1603A24A486C7E A20203814B7EA202078192C7127FA2020E81173FA24A6E7EA2023C810238140FA2027FB6 7EA302E0C7EA07FE17030101824A80A20103834A80A249C97F187FA2010E707EA2011E83 181F133E85137E48B483000701C0ED7FFFB500FC021FB512FEA347477CC651>65 D69 D73 D76 D82 D<49B46C13C0010FEBF001013FEBFC039038FF007FD8 01F8EB0F874848EB03E7D807C0EB01FF48487F001F157F90C8123F003E151FA2007E150F 127C160712FC1603A37E16017EA27F6C6C91C7FC7F7FEA3FFCEBFFC06C13FC6CEBFFC015 FC6CECFF806C15E0C615F86D80011F80010380D9003F1480020314C0EC003F030313E015 00EE7FF0161FA2EE0FF8160712E01603A21601A37EA217F07E16037E17E06C15076C16C0 6DEC0F806D141F6DEC3F00D8F8F8147E017F5C3AF01FE007F00107B55AD8E00191C7FC39 C0001FFC2D4879C53D>I<157015F8A34A7EA24A7EA34A7E81A291380E3F80A2021E7FEC 1C1FA24A6C7EA34A6C7EA202F07FECE003A249486C7EA349486C7EA201078091C77EA249 B67EA24981011CC7121FA2013C810138140FA2496E7EA201F081491403120183486C1401 00074B7ED81FF84A7EB5027F13F8A335357CB43D>97 D<4AB4EB0180021FEBF00391B5EA FC0701039038007E0FD907F8EB0F9FD91FE0EB03DF4948EB01FF01FFC8FC4848157F4848 153FA24848151F4848150F121F491507123F5BA2007F1603A3484892C7FCAB6C7EEF0380 A2123FA27F001F16076D1600000F5E6C6C150E6C6C151E171C6C6C153C6C6C5DD93FC05C 6D6CEB03E0D907F8495A902703FF807FC7FC0100EBFFFC021F13F00201138031357BB33B >99 DIII104 DI108 DIIII114 D<90390FF0018090387FFE0348B512873907F00FEF390FC001FF48C7FC003E143F151F5A 150F5A1507A36C1403A27E6C91C7FC6C7E7FEA3FF8EBFF806C13FC6CEBFFC06C14F06C80 C614FE011F7F01031480D9001F13C014019138003FE0151F150FED07F0150312E01501A3 7EA216E06C1403A26CEC07C06CEC0F806C6CEB1F0001E0133ED8FBFE13FC00F0B55AD8E0 1F13E0D8C00390C7FC24357BB32E>I<007FB812C0A3903A8007FC003F277E0003F8130F 007C16070078160300701601A200F017E0A2481600A6C71600B3AA4A7E4A7E010FB512FE A333327CB13B>III<003FB7FCA39039FC0001FE01E013030180 14FC90C7EA07F8003E140F003C15F0007CEC1FE00078EC3FC0A2ED7F800070ECFF00A24A 5A4A5AC712075D4A5A141F5D4A5A4A5AA24AC7FC495AA2495A495A130F4A1307495A133F 5C495A49C7FC160F485A485AA24848141E485A001F153E49147E484814FE007F14034913 1FB7FCA328337BB232>122 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fv cmr10 10 88 /Fv 88 128 df<15E0A34A7EA34A7EA34A7EA34A7EA2140DEC1DFF14191418A24A7F157F A202607F153FA202C07F151FA2D901807F150FA2D903007F1507A20106801503A2010E80 130C1501011C80131881A24981167FA24981163FA24981161FA20001821203486C81D81F F84A7EB50107B512E0A3333C7DBB3A>3 D6 D10 DII14 D<6C130800E0133800F813F8383E03E0381F07C0380FDF803803FE006C5A6C5A1320 150A76B42A>20 D<14FF010713C090381F83F090383F00FC017E137E49137F4848EB3F80 A24848131F16C0A7ED3F80A2ED7F00157E5D4A5AEC07E000FFEB7F80A2EC07E00003EB01 F0EC00FC157E811680151FED0FC0A216E0150716F0A3ED03F8AA16F0ECF007EBF1F816E0 ED0FC0A200079038F01F803AFFF0E03F00EC707CEC3FF0C7EA0FC0253C7EBA2A>25 D<030C1303031E497EA2033E130FA2033C91C7FCA2037C5BA20378131EA303F8133EA24B 133CA20201147CA24B1378A2020314F8A24B5BA302071301007FB91280BA12C0A26C1880 C7271F0007C0C7FC021E5CA3023E130FA2023C91C8FCA2027C5BA20278131EA302F8133E 007FB91280BA12C0A26C1880280003E000F8C8FC4A5BA301071301A202805BA2010F1303 A202005BA2491307A2011E5CA3013E130FA2013C91C9FCA2017C5BA20178131EA2013013 0C3A4A7BB945>35 D<121C127FEAFF80A213C0A3127F121C1200A412011380A212031300 5A1206120E5A5A5A12600A1979B917>39 D<146014E0EB01C0EB0380EB0700130E131E5B 5BA25B485AA2485AA212075B120F90C7FCA25A121EA2123EA35AA65AB2127CA67EA3121E A2121F7EA27F12077F1203A26C7EA26C7E1378A27F7F130E7FEB0380EB01C0EB00E01460 135278BD20>I<12C07E12707E7E7E120F6C7E6C7EA26C7E6C7EA21378A2137C133C133E 131EA2131F7FA21480A3EB07C0A6EB03E0B2EB07C0A6EB0F80A31400A25B131EA2133E13 3C137C1378A25BA2485A485AA2485A48C7FC120E5A5A5A5A5A13527CBD20>I<15301578 B3A6007FB812F8B912FCA26C17F8C80078C8FCB3A6153036367BAF41>43 D<121C127FEAFF80A213C0A3127F121C1200A412011380A2120313005A1206120E5A5A5A 12600A19798817>II<121C127FEAFF80A5EA7F00121C09097988 17>I<150C151E153EA2153C157CA2157815F8A215F01401A215E01403A215C01407A215 80140FA215005CA2141E143EA2143C147CA2147814F8A25C1301A25C1303A2495AA25C13 0FA291C7FC5BA2131E133EA2133C137CA2137813F8A25B1201A25B1203A25B1207A25B12 0FA290C8FC5AA2121E123EA2123C127CA2127812F8A25A12601F537BBD2A>IIIII<1538A2157815F8A2140114 031407A2140F141F141B14331473146314C313011483EB030313071306130C131C131813 301370136013C01201EA038013005A120E120C5A123812305A12E0B712F8A3C73803F800 AB4A7E0103B512F8A325397EB82A>I<0006140CD80780133C9038F003F890B5FC5D5D15 8092C7FC14FC38067FE090C9FCABEB07F8EB3FFE9038780F803907E007E090388003F049 6C7E12066E7EC87EA28181A21680A4123E127F487EA490C71300485C12E000605C127000 30495A00385C6C1303001E495A6C6C485A3907E03F800001B5C7FC38007FFCEB1FE0213A 7CB72A>II<12301238123E003FB612E0A316C05A16 8016000070C712060060140E5D151800E01438485C5D5DC712014A5A92C7FC5C140E140C 141C5CA25CA214F0495AA21303A25C1307A2130FA3495AA3133FA5137FA96DC8FC131E23 3B7BB82A>III<121C127FEAFF80 A5EA7F00121CC7FCB2121C127FEAFF80A5EA7F00121C092479A317>I<121C127FEAFF80 A5EA7F00121CC7FCB2121C127F5A1380A4127F121D1201A412031300A25A1206A2120E5A 121812385A1260093479A317>I<007FB812F8B912FCA26C17F8CCFCAE007FB812F8B912 FCA26C17F836167B9F41>61 D64 D<1538A3157CA315FEA34A7EA34A6C7EA2 02077FEC063FA2020E7FEC0C1FA2021C7FEC180FA202387FEC3007A202707FEC6003A202 C07F1501A2D901807F81A249C77F167FA20106810107B6FCA24981010CC7121FA2496E7E A3496E7EA3496E7EA213E0707E1201486C81D80FFC02071380B56C90B512FEA3373C7DBB 3E>II<913A01FF800180020FEBE003027F13F8903A01FF807E0790 3A03FC000F0FD90FF0EB039F4948EB01DFD93F80EB00FF49C8127F01FE153F1201484815 1F4848150FA248481507A2485A1703123F5B007F1601A35B00FF93C7FCAD127F6DED0180 A3123F7F001F160318006C7E5F6C7E17066C6C150E6C6C5D00001618017F15386D6C5CD9 1FE05C6D6CEB03C0D903FCEB0F80902701FF803FC7FC9039007FFFFC020F13F002011380 313D7BBA3C>IIII III<013FB512E0A39039001FFC00EC07F8B3B3A3123FEA7F80EAFFC0A44A5A1380D8 7F005B0070131F6C5C6C495A6C49C7FC380781FC3801FFF038007F80233B7DB82B>IIIIIII III<003FB812E0A3D9C003EB001F273E0001FE13 0348EE01F00078160000701770A300601730A400E01738481718A4C71600B3B0913807FF 80011FB612E0A335397DB83C>III< B5D8FC07B5D8F001B5FCA30007902780001FFEC7EA1FF86C48C7D80FF8EC07E000010307 ED03C01B807F6C6F6C1500A26E5F017F6E6C1406A280013F4A6C5CA280011F4A6D5BEE06 7FA26D6C010E6D5BEE0C3FA26D6C011C6D5BEE181FA26D6C6F5BEE300FA26D6C6F485AEE 6007A26D6C4CC7FC9338C003FCA203805D913B7F818001FE06A203C1150EDA3FC3C7EAFF 0CA203E3151CDA1FE6EC7F98A215F6DA0FFCEC3FF0A302075E4B141FA202035E4B140FA2 02015E4B1407A2020093C8FC4B80503B7EB855>I<007FB590383FFFFCA3C601F8010713 80D97FE0D903FCC7FC013FEC01F06D6C5C5F6D6C5C6D6C13034CC8FC6D6C1306160E6D6C 5B6DEB8018163891387FC0306E6C5A16E06E6C5A91380FF18015FB6EB4C9FC5D14036E7E A26E7F6F7EA24B7E15DF9138019FF09138038FF8150F91380607FC91380E03FE140C4A6C 7EEC38000230804A6D7E14E04A6D7E49486D7E130391C76C7E01066E7E130E010C6E7E01 1C1401013C8101FE822607FF80010713E0B500E0013FEBFF80A339397EB83E>II<003FB7FCA39039FC0001FE01C0130349495A 003EC7FC003C4A5A5E0038141F00784A5A12704B5A5E006014FF4A90C7FCA24A5A5DC712 074A5AA24A5A5D143F4A5AA24A5A92C8FC5B495AA2495A5C130F4948EB0180A2495A5C13 7F495A16034890C7FC5B1203485AEE0700485A495C001F5D48485C5E4848495A49130FB8 FCA329397BB833>II93 D<13101338137C13FE487E3803C780380783 C0380F01E0381E00F04813780070131C48130E00401304170D77B92A>I 97 DIIII<147E903803FF8090380FC1E0EB1F8790383F0FF0137E A213FCA23901F803C091C7FCADB512FCA3D801F8C7FCB3AB487E387FFFF8A31C3B7FBA19 >IIIIIII<2703F00FF0EB1FE000FFD93FFCEB7FF8913AF03F01E07E903BF1C01F 83803F3D0FF3800FC7001F802603F70013CE01FE14DC49D907F8EB0FC0A2495CA3495CB3 A3486C496CEB1FE0B500C1B50083B5FCA340257EA445>I<3903F00FF000FFEB3FFCECF0 3F9039F1C01F803A0FF3800FC03803F70013FE496D7EA25BA35BB3A3486C497EB500C1B5 1280A329257EA42E>II<3903F01FE000FFEB7FF89038F1E07E9039F3 801F803A0FF7000FC0D803FEEB07E049EB03F04914F849130116FC150016FEA3167FAA16 FEA3ED01FCA26DEB03F816F06D13076DEB0FE001F614C09039F7803F009038F1E07E9038 F0FFF8EC1FC091C8FCAB487EB512C0A328357EA42E>II<3807E01F00FFEB7FC09038 E1E3E09038E387F0380FE707EA03E613EE9038EC03E09038FC0080491300A45BB3A2487E B512F0A31C257EA421>II<1318A51338A31378A313F8120112031207001FB5FCB6FCA2D801F8C7FC B215C0A93800FC011580EB7C03017E13006D5AEB0FFEEB01F81A347FB220>IIIIII<00 3FB512FCA2EB8003D83E0013F8003CEB07F00038EB0FE012300070EB1FC0EC3F80006013 7F150014FE495AA2C6485A495AA2495A495A495AA290387F000613FEA2485A485A000714 0E5B4848130C4848131CA24848133C48C7127C48EB03FC90B5FCA21F247EA325>I126 D<001C131C007F137F39FF80FF80A5397F007F00001C131C190978B72A> I E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fw cmcsc8 8 23 /Fw 23 124 df40 D<12C07E12787E7E120E7E7F6C7E12 017F6C7EA21378A27FA37FA3131F7FA41480A21307AB130FA21400A45B131EA35BA35BA2 5BA2485A5B1203485A90C7FC120E121E5A5A12E05A11437BB11E>I<123C127E12FFA412 7E123C0808798716>46 D48 D<130E131E137EEA01FEEAFFBEEAFE3E1200B3B1137F007FB5FCA2182C78AB 27>II52 D<000C14C0380FC00F90B5128015005C14F814E0D80C7FC7FC90C8FCA8EB1FE0EB7FF838 0DE03E380F801F390E000F80000CEB07C0EC03E0C7FC15F0140115F8A4127812FCA315F0 48130312E0006014E00070EB07C06C130F6CEB1F806CEB3E00380780FC3801FFF038007F 801D2D7BAB27>I<1230123C003FB6FCA215FE4814FCA20070C712380060147015E000E0 14C0481301EC0380C7EA0700140E140C141C5C5CA25C495AA213035C1307A249C7FCA25B A35B133EA4137EA8133C202E7BAC27>55 D57 D68 D77 D<14E0A2497EA3497EA3EB067CA2EB0E3E130CA2497EA201 387FEB300FA2496C7EA3496C7E90B5FC4880EB8001A248C77EA248800006147C120E001F 147E48147F3AFFC003FFE0A223237DA22A>97 D<903803FC0390381FFF0790387E03CF90 38F800EFD803E0137F4848133F4848131F001F140F90C7FC481407123E127E15035AA215 00A71503127EA2123E003F14076C14066D130E000F140C6C6C131C6C6C1338D800F813F0 90387E03C090381FFF80903803FC0020247CA229>99 D101 D<3AFFF80FFF80A23A1FC001FC00 6C486C5AAC90B5FCA2EB8000AE486C487E3AFFF80FFF80A221227CA12A>104 DI109 D<3AFF8001FF8013C0000F9038007E006D133C6D1318120DEA0CF87F 137E133E133FEB1F80130FEB07C014E0EB03F0130114F8EB00FC147C143E143FEC1F9814 0FEC07D815F814031401A21400001E1478003F1438EAFFC0151821227CA12A>II<007F B61280A2397C01F00F0070140300601401A200E015C000C01400A400001500B3A2497E90 387FFFC0A222227DA129>116 D<3AFFF801FF80A23A1FC0007E006C48133C1518B3A46C 6C1338153015706C6C5B6C6C5B3800F803D97C0FC7FCEB1FFEEB03F021237CA12A>I123 D E %EndDVIPSBitmapFont end %%EndProlog %%BeginSetup %%Feature: *Resolution 600dpi TeXDict begin %%PaperSize: A4 %%EndSetup %%Page: 497 1 497 0 bop 451 518 a Fw(Document)l(a)26 b(Ma)l(th.)2077 b Fv(497)839 858 y Fu(Localiza)-7 b(tion)39 b(of)f(the)f(Essential)g (Spectr)n(um)728 1024 y(f)n(or)h(Rela)-7 b(tivistic)38 b Ft(N)9 b Fu(-Electr)n(on)36 b(Ions)i(and)g(A)-9 b(toms)1304 1334 y Fs(D.)30 b(H.)h(Jakubassa-Amundsen)1444 1644 y Fr(Receiv)n(ed:)h(Octob)r(er)25 b(12,)e(2005)1447 1743 y(Revised:)32 b(No)n(v)n(em)n(b)r(er)23 b(4,)h(2005)1327 1948 y(Comm)n(unicated)f(b)n(y)h(Heinz)g(Sieden)n(top)617 2310 y Fs(Abstra)n(ct.)39 b Fv(The)22 b(HVZ)g(theorem)g(is)f(pro)n(v)n (en)g(for)g(the)i(pseudorelativistic)d Ft(N)9 b Fv(-)617 2410 y(electron)27 b(Jansen-Hess)g(op)r(erator)f(\(2)e Fq(\024)f Ft(N)32 b Fq(\024)23 b Ft(Z)6 b Fv(\))28 b(whic)n(h)g(acts)g (on)f(the)i(spinor)617 2510 y(Hilb)r(ert)c(space)f Fq(A)p Fv(\()p Ft(H)1286 2522 y Fp(1)1324 2510 y Fv(\()p Fo(R)1410 2480 y Fp(3)1454 2510 y Fv(\))12 b Fq(\012)g Fo(C)1629 2480 y Fp(4)1673 2510 y Fv(\))1705 2480 y Fn(N)1793 2510 y Fv(where)24 b Fq(A)h Fv(denotes)f(an)n(tisymmetrization)617 2609 y(with)f(resp)r(ect)f(to)g(particle)g(exc)n(hange.)34 b(This)22 b('no)g(pair')g(op)r(erator)e(results)i(from)617 2709 y(the)29 b(decoupling)f(of)h(the)g(electron)e(and)i(p)r(ositron)e (degrees)h(of)g(freedom)g(up)h(to)617 2809 y(second)e(order)f(in)i(the) g(cen)n(tral)f(p)r(oten)n(tial)g(strength)h Ft(\015)f Fv(=)c Ft(Z)6 b(e)2556 2778 y Fp(2)2592 2809 y Fv(.)617 3015 y(2000)26 b(Mathematics)h(Sub)5 b(ject)28 b(Classi\014cation:)36 b(81Q10,)25 b(81V45)451 3352 y Fs(Intr)n(oduction)451 3536 y Fv(W)-7 b(e)34 b(consider)e Ft(N)42 b Fv(in)n(teracting)32 b(electrons)g(in)h(a)g(cen)n(tral)f(Coulom)n(b)h(\014eld)g(generated)f (b)n(y)451 3636 y(a)h(p)r(oin)n(t)h(n)n(ucleus)f(of)h(c)n(harge)e(n)n (um)n(b)r(er)h Ft(Z)39 b Fv(whic)n(h)33 b(is)h(in\014nitely)g(hea)n(vy) e(and)i(lo)r(cated)f(at)451 3735 y(the)27 b(origin.)36 b(F)-7 b(or)26 b(stationary)f(electrons)h(where)g(the)i(radiation)d (\014eld)i(and)g(pair)f(creation)451 3835 y(can)f(b)r(e)g(neglected,)g (the)g Ft(N)c Fv(+)13 b(1)24 b(particle)g(system)h(is)f(describ)r(ed)h (b)n(y)f(the)i(Coulom)n(b-Dirac)451 3935 y(op)r(erator,)38 b(in)n(tro)r(duced)e(b)n(y)h(Suc)n(her)f([23)o(].)65 b(The)37 b(Jansen-Hess)e(op)r(erator)h(used)g(in)i(the)451 4034 y(presen)n(t)26 b(w)n(ork,)f(whic)n(h)i(acts)f(on)g(the)h(p)r (ositiv)n(e)f(sp)r(ectral)g(subspace)g(of)g Ft(N)36 b Fv(free)26 b(electrons,)451 4134 y(is)f(deriv)n(ed)e(from)h(the)h (Coulom)n(b-Dirac)e(op)r(erator)g(b)n(y)h(applying)g(a)g(unitary)g (transforma-)451 4234 y(tion)34 b(sc)n(heme)f([12)o(,)h(13)o(])g(whic)n (h)g(is)f(equiv)-5 b(alen)n(t)34 b(to)f(the)h(Douglas-Kroll)e (transformation)451 4333 y(sc)n(heme)37 b([6)o(].)65 b(The)37 b(transformed)e(op)r(erator)h(is)g(represen)n(ted)g(as)g(an)h (in\014nite)g(series)f(of)451 4433 y(op)r(erators)c(whic)n(h)h(do)h (not)g(couple)f(the)h(electron)f(and)g(p)r(ositron)g(degrees)g(of)g (freedom.)451 4532 y(F)-7 b(or)37 b Ft(N)48 b Fv(=)39 b(1,)g(eac)n(h)d(successiv)n(e)g(term)i(in)f(this)h(series)e(is)h(of)g (increasing)f(order)g(in)i(the)451 4632 y(strength)d Ft(\015)40 b Fv(of)35 b(the)h(cen)n(tral)e(\014eld.)61 b(The)35 b(series)f(has)h(b)r(een)h(sho)n(wn)e(to)h(b)r(e)h(con)n(v)n (ergen)n(t)451 4732 y(for)c(sub)r(critical)f(p)r(oten)n(tial)h (strength)f(\()p Ft(\015)k(<)30 b(\015)1926 4744 y Fn(c)1990 4732 y Fv(=)g(0)p Ft(:)p Fv(3775,)h(corresp)r(onding)f(to)h Ft(Z)36 b(<)30 b Fv(52)451 4831 y([21)o(]\).)50 b(F)-7 b(or)30 b Ft(N)39 b(>)29 b Fv(1)i(the)h(expansion)f(parameter)f(is)h Ft(e)2174 4801 y Fp(2)2211 4831 y Fv(,)i(whic)n(h)f(comprises)e(the)i (cen)n(tral)451 4931 y(\014eld)g(strength)e Ft(Z)6 b(e)1068 4901 y Fp(2)1136 4931 y Fv(and)31 b(the)h(strength)f Ft(e)1819 4901 y Fp(2)1887 4931 y Fv(of)g(the)g(electron-electron)f(in) n(teraction.)47 b(A)451 5031 y(n)n(umerical)31 b(in)n(v)n(estigation)f (of)i(the)g(cases)f Ft(N)39 b Fv(=)29 b(1)p Ft(;)44 b(Z)27 b Fq(\000)21 b Fv(1)31 b(and)h Ft(Z)37 b Fv(across)30 b(the)i(p)r(erio)r(dic)451 5130 y(table)25 b(has)f(rev)n(ealed)g([27)o (])h(that)g(the)g(ground-state)f(energy)f(of)i(an)g Ft(N)9 b Fv(-electron)23 b(system)i(is)1108 5338 y Fw(Document)l(a)g(Ma)l (thema)l(tica)h(10)f(\(2005\))g(497{525)p eop %%Page: 498 2 498 1 bop 451 518 a Fv(498)727 b Fs(D.)30 b(H.)h(Jakubassa-Amundsen)451 725 y Fv(already)d(quite)i(w)n(ell)f(represen)n(ted)g(if)h(the)g (series)e(is)i(truncated)f(after)g(the)h(second-order)451 825 y(term.)37 b(This)28 b(appro)n(ximation)d(de\014nes)j(the)g (Jansen-Hess)e(op)r(erator)g(\(see)h(\(3.1\))h(b)r(elo)n(w\).)451 928 y(In)23 b(the)g(presen)n(t)f(w)n(ork)f(w)n(e)h(pro)n(vide)g(the)h (lo)r(calization)e(of)i(the)g(essen)n(tial)e(sp)r(ectrum)i(of)g(this) 451 1028 y(op)r(erator.)50 b(Recen)n(tly)32 b([14)o(])h(w)n(e)f(ha)n(v) n(e)f(pro)n(v)n(en)g(the)h(HVZ)h(theorem)f(\(whic)n(h)h(dates)f(bac)n (k)451 1127 y(to)h(Hunzik)n(er)f([10)o(],)i(v)-5 b(an)33 b(Win)n(ter)g([26)o(])g(and)f(Zhislin)h([28)o(])g(for)f(the)h(Sc)n (hr\177)-42 b(odinger)31 b(op)r(era-)451 1227 y(tor)d(and)g(to)h (Lewis,)f(Sieden)n(top)h(and)f(V)-7 b(ugalter)28 b([16)o(])g(for)g(the) h(scalar)e(pseudorelativistic)451 1327 y(Hamiltonian\))35 b(for)e(the)i(t)n(w)n(o-particle)e(Bro)n(wn-Ra)n(v)n(enhall)e(op)r (erator)i([2)o(])i(whic)n(h)f(is)h(the)451 1426 y(\014rst-order)e(term) i(in)h(the)f(ab)r(o)n(v)n(e)f(men)n(tioned)h(series)g(of)g(op)r (erators.)57 b(No)n(w)35 b(w)n(e)g(extend)451 1526 y(this)28 b(pro)r(of)f(successiv)n(ely)g(to)g(the)i(m)n(ultiparticle)e(Bro)n (wn-Ra)n(v)n(enhall)e(op)r(erator)h(\(section)451 1625 y(1\),)k(to)f(the)h(t)n(w)n(o-electron)e(Jansen-Hess)g(op)r(erator)f (\(section)j(2\))f(and)g(\014nally)g(to)h(the)f Ft(N)9 b Fv(-)451 1725 y(electron)33 b(Jansen-Hess)f(op)r(erator.)52 b(W)-7 b(e)34 b(closely)e(follo)n(w)h(the)h(earlier)e(w)n(ork)g([14)o (])h(where)451 1825 y(the)e(details)f(can)h(b)r(e)g(found.)46 b(A)31 b(quite)f(di\013eren)n(t)h(pro)r(of)f(of)h(the)g(HVZ)f(theorem)g (for)h(the)451 1924 y(m)n(ultiparticle)d(Bro)n(wn-Ra)n(v)n(enhall)c(op) r(erator)i(is)i(presen)n(tly)e(under)i(in)n(v)n(estigation)e([18)o(].) 451 2169 y Fs(1)92 b(Mul)-6 b(tip)g(ar)g(ticle)33 b(Br)n(o)n(wn-Ra)-7 b(venhall)31 b(case)451 2358 y Fv(F)-7 b(or)38 b Ft(N)46 b Fv(electrons)37 b(of)h(mass)f Ft(m)h Fv(in)h(a)e(cen)n(tral)g (\014eld,)k(generated)c(b)n(y)g(a)h(p)r(oin)n(t)g(n)n(ucleus)451 2458 y(whic)n(h)24 b(is)g(in\014nitely)h(hea)n(vy)e(and)h(\014xed)g(at) g(the)g(origin,)g(the)h(Bro)n(wn-Ra)n(v)n(enhall)c(op)r(erator)451 2557 y(is)28 b(giv)n(en)e(b)n(y)i(\(in)g(relativistic)f(units,)h Fo(~)23 b Fv(=)f Ft(c)h Fv(=)g(1\))883 2829 y Ft(H)959 2794 y Fn(B)s(R)1113 2829 y Fv(=)45 b(\003)1281 2841 y Fp(+)p Fn(;N)1428 2829 y Fv(\()1492 2725 y Fn(N)1460 2750 y Fm(X)1460 2929 y Fn(k)q Fp(=1)1581 2829 y Fv(\()p Ft(D)1684 2786 y Fp(\()p Fn(k)q Fp(\))1682 2851 y(0)1810 2829 y Fv(+)32 b Ft(V)1973 2794 y Fp(\()p Fn(k)q Fp(\))2066 2829 y Fv(\))h(+)2295 2725 y Fn(N)2265 2750 y Fm(X)2228 2929 y Fn(k)q(>l)p Fp(=1)2435 2829 y Ft(V)2502 2794 y Fp(\()p Fn(k)q(l)p Fp(\))2616 2829 y Fv(\))14 b(\003)2720 2841 y Fp(+)p Fn(;N)3115 2829 y Fv(\(1.1\))451 3127 y(where)27 b Ft(D)762 3084 y Fp(\()p Fn(k)q Fp(\))760 3149 y(0)878 3127 y Fv(=)22 b Fl(\013)1028 3097 y Fp(\()p Fn(k)q Fp(\))1121 3127 y Fk(p)1174 3147 y Fn(k)1233 3127 y Fv(+)17 b Ft(\014)1366 3097 y Fp(\()p Fn(k)q Fp(\))1459 3127 y Ft(m)27 b Fv(is)g(the)g(free)g (Dirac)g(op)r(erator)e(of)i(electron)g Ft(k)s(;)60 b(V)3105 3097 y Fp(\()p Fn(k)q Fp(\))3221 3127 y Fv(=)451 3227 y Fq(\000)p Ft(\015)5 b(=x)653 3239 y Fn(k)718 3227 y Fv(is)25 b(the)g(cen)n(tral)f(p)r(oten)n(tial)g(with)h(strength)g Ft(\015)i Fv(=)c Ft(Z)6 b(e)2330 3196 y Fp(2)2367 3227 y Fv(,)25 b(and)g Ft(V)2640 3196 y Fp(\()p Fn(k)q(l)p Fp(\))2778 3227 y Fv(=)d Ft(e)2904 3196 y Fp(2)2941 3227 y Ft(=)p Fq(j)p Fk(x)3056 3239 y Fn(k)3110 3227 y Fq(\000)13 b Fk(x)3238 3239 y Fn(l)3263 3227 y Fq(j)451 3326 y Fv(is)41 b(the)h(electron-electron)e(in)n(teraction,)k Ft(e)1844 3296 y Fp(2)1927 3326 y Fq(\031)h Fv(1)p Ft(=)p Fv(137)p Ft(:)p Fv(04)39 b(b)r(eing)i(the)h(\014ne)f(structure)451 3426 y(constan)n(t)35 b(and)f Ft(x)1009 3438 y Fn(k)1086 3426 y Fv(=)h Fq(j)p Fk(x)1259 3438 y Fn(k)1301 3426 y Fq(j)g Fv(the)g(distance)g(of)g(electron)g Ft(k)j Fv(from)c(the)i (origin.)58 b(F)-7 b(urther,)451 3582 y(\003)509 3594 y Fp(+)p Fn(;N)672 3582 y Fv(=)29 b(\003)824 3539 y Fp(\(1\))824 3602 y(+)927 3582 y Fq(\001)14 b(\001)g(\001)f Fv(\003)1095 3552 y Fn(N)1095 3602 y Fp(+)1190 3582 y Fv(\(as)31 b(shorthand)f(for) 1886 3503 y Fn(N)1870 3519 y Fm(N)1855 3657 y Fn(k)q Fp(=1)1990 3582 y Fv(\003)2048 3539 y Fp(\()p Fn(k)q Fp(\))2048 3602 y(+)2140 3582 y Fv(\))i(is)g(the)f(\(tensor\))h(pro)r (duct)f(of)h(the)451 3760 y(single-particle)k(pro)5 b(jectors)35 b(\003)1450 3717 y Fp(\()p Fn(k)q Fp(\))1450 3781 y(+)1581 3760 y Fv(=)1694 3727 y Fp(1)p 1694 3741 34 4 v 1694 3789 a(2)1738 3760 y Fv(\(1)24 b(+)g Ft(D)1996 3717 y Fp(\()p Fn(k)q Fp(\))1994 3782 y(0)2089 3760 y Ft(=E)2192 3772 y Fn(p)2226 3781 y Fj(k)2267 3760 y Fv(\))37 b(on)n(to)f(the)i(p)r (ositiv)n(e)e(sp)r(ectral)451 3884 y(subspace)f(of)g Ft(D)979 3840 y Fp(\()p Fn(k)q Fp(\))977 3906 y(0)1072 3884 y Ft(:)71 b(H)1242 3853 y Fn(B)s(R)1385 3884 y Fv(acts)35 b(in)g(the)h(Hilb)r(ert)g(space)e Fq(A)p Fv(\()p Ft(L)2497 3896 y Fp(2)2535 3884 y Fv(\()p Fo(R)2621 3853 y Fp(3)2664 3884 y Fv(\))24 b Fq(\012)f Fo(C)2862 3853 y Fp(4)2905 3884 y Fv(\))2937 3853 y Fn(N)3001 3884 y Fv(,)37 b(and)e(is)451 3983 y(w)n(ell-de\014ned)i(in)h(the)g(form)f(sense)h(and)f(p)r(ositiv)n (e)g(on)g Fq(A)p Fv(\()p Ft(H)2385 3998 y Fp(1)p Fn(=)p Fp(2)2490 3983 y Fv(\()p Fo(R)2577 3953 y Fp(3)2620 3983 y Fv(\))25 b Fq(\012)g Fo(C)2821 3953 y Fp(4)2864 3983 y Fv(\))2896 3953 y Fn(N)2997 3983 y Fv(for)37 b Ft(\015)44 b(<)451 4091 y(\015)494 4103 y Fn(B)s(R)640 4091 y Fv(=)871 4059 y Fp(2)p 754 4073 268 4 v 754 4120 a Fn(\031)r(=)p Fp(2+2)p Fn(=\031)1070 4091 y Fq(\031)38 b Fv(0)p Ft(:)p Fv(906)d(\(see)i(\(1.10\))f(b)r(elo)n(w\).)66 b(F)-7 b(or)36 b(the)h(m)n(ulti-n)n(ucleus)g(case)g(the)451 4205 y(Bro)n(wn-Ra)n(v)n(enhall)25 b(op)r(erator)h(w)n(as)g(sho)n(wn)h (to)h(b)r(e)g(p)r(ositiv)n(e)f(if)h Ft(\015)f(<)c Fv(0)p Ft(:)p Fv(65)j([9].)451 4308 y(An)32 b(equiv)-5 b(alen)n(t)32 b(op)r(erator,)f(whic)n(h)h(is)f(de\014ned)h(in)g(a)g(reduced)f(spinor) g(space)g(b)n(y)g(means)451 4408 y(of)37 b(\()p Ft( )641 4420 y Fp(+)696 4408 y Ft(;)14 b(H)809 4378 y Fn(B)s(R)930 4408 y Ft( )984 4420 y Fp(+)1039 4408 y Fv(\))53 b(=)37 b(\()p Ft(';)14 b(h)1397 4378 y Fn(B)s(R)1519 4408 y Ft(')p Fv(\))76 b(with)37 b Ft( )1933 4420 y Fp(+)2026 4408 y Fq(2)i Fv(\003)2178 4420 y Fp(+)p Fn(;N)2311 4408 y Fv(\()p Fq(A)p Fv(\()p Ft(H)2510 4423 y Fp(1)p Fn(=)p Fp(2)2615 4408 y Fv(\()p Fo(R)2701 4378 y Fp(3)2745 4408 y Fv(\))25 b Fq(\012)f Fo(C)2945 4378 y Fp(4)2988 4408 y Fv(\))3020 4378 y Fn(N)3083 4408 y Fv(\))37 b(and)451 4508 y Ft(')24 b Fq(2)f(A)p Fv(\()p Ft(H)774 4523 y Fp(1)p Fn(=)p Fp(2)879 4508 y Fv(\()p Fo(R)965 4477 y Fp(3)1008 4508 y Fv(\))c Fq(\012)f Fo(C)1196 4477 y Fp(2)1239 4508 y Fv(\))1271 4477 y Fn(N)1335 4508 y Fv(,)27 b(is)h([7)o(])1145 4788 y Ft(h)1193 4754 y Fn(B)s(R)1346 4788 y Fv(=)1488 4684 y Fn(N)1458 4709 y Fm(X)1457 4888 y Fn(k)q Fp(=1)1578 4788 y Fv(\()p Ft(T)1671 4754 y Fp(\()p Fn(k)q Fp(\))1795 4788 y Fv(+)k Ft(b)1928 4745 y Fp(\()p Fn(k)q Fp(\))1928 4810 y(1)p Fn(m)2024 4788 y Fv(\))42 b(+)2271 4684 y Fn(N)2241 4709 y Fm(X)2204 4888 y Fn(k)q(>l)p Fp(=1)2412 4788 y Ft(v)2455 4754 y Fp(\()p Fn(k)q(l)p Fp(\))2569 4788 y Ft(:)523 b Fv(\(1.2\))451 5118 y(Explicitly)-7 b(,)28 b(with)g Ft(A)1098 5130 y Fn(k)1162 5118 y Fv(:=)23 b Ft(A)p Fv(\()p Ft(p)1409 5130 y Fn(k)1450 5118 y Fv(\))g(=)1593 5026 y Fm(\020)1652 5069 y Fn(E)1701 5077 y Fj(p)1732 5092 y(k)1772 5069 y Fp(+)p Fn(m)p 1652 5099 230 4 v 1691 5146 a Fp(2)p Fn(E)1773 5154 y Fj(p)1804 5169 y(k)1892 5026 y Fm(\021)1942 5043 y Fp(1)p Fn(=)p Fp(2)2074 5118 y Fv(and)k Ft(G)2300 5130 y Fn(k)2364 5118 y Fv(:=)c Fl(\033)2535 5088 y Fp(\()p Fn(k)q Fp(\))2628 5118 y Fk(p)2681 5130 y Fn(k)2722 5118 y Ft(g)s Fv(\()p Ft(p)2839 5130 y Fn(k)2879 5118 y Fv(\))p Ft(;)1108 5338 y Fw(Document)l(a)i(Ma)l (thema)l(tica)h(10)f(\(2005\))g(497{525)p eop %%Page: 499 3 499 2 bop 1301 518 a Ft(N)9 b Fs(-Electr)n(on)31 b(HVZ)f(Theorem)726 b Fv(499)451 725 y Ft(g)s Fv(\()p Ft(p)568 737 y Fn(k)609 725 y Fv(\))23 b(=)g(\(2)p Ft(E)887 737 y Fn(p)921 746 y Fj(k)961 725 y Fv(\()p Ft(E)1054 737 y Fn(p)1088 746 y Fj(k)1148 725 y Fv(+)18 b Ft(m)p Fv(\)\))1368 695 y Fi(\000)p Fp(1)p Fn(=)p Fp(2)1525 725 y Ft(;)51 b Fv(one)27 b(has)g([14)o(])619 933 y Ft(T)680 899 y Fp(\()p Fn(k)q Fp(\))795 933 y Fv(:=)45 b Ft(E)989 945 y Fn(p)1023 954 y Fj(k)1110 933 y Fv(=)1221 833 y Fm(q)p 1304 833 295 4 v 100 x Ft(p)1346 904 y Fp(2)1346 958 y Fn(k)1405 933 y Fv(+)18 b Ft(m)1561 909 y Fp(2)1598 933 y Ft(;)180 b(b)1837 890 y Fp(\()p Fn(k)q Fp(\))1837 955 y(1)p Fn(m)1970 933 y Fv(=)46 b Fq(\000)p Ft(\015)27 b Fv(\()p Ft(A)2310 945 y Fn(k)2398 877 y Fv(1)p 2375 914 89 4 v 2375 990 a Ft(x)2422 1002 y Fn(k)2487 933 y Ft(A)2549 945 y Fn(k)2632 933 y Fv(+)41 b Ft(G)2803 945 y Fn(k)2891 877 y Fv(1)p 2868 914 V 2868 990 a Ft(x)2915 1002 y Fn(k)2980 933 y Ft(G)3045 945 y Fn(k)3086 933 y Fv(\))900 1200 y Ft(v)943 1166 y Fp(\()p Fn(k)q(l)p Fp(\))1103 1200 y Fv(=)46 b Ft(A)1276 1212 y Fn(k)1317 1200 y Ft(A)1379 1212 y Fn(l)1548 1144 y Ft(e)1587 1114 y Fp(2)p 1429 1181 315 4 v 1429 1257 a Fq(j)p Fk(x)1502 1269 y Fn(k)1561 1257 y Fq(\000)18 b Fk(x)1694 1269 y Fn(l)1720 1257 y Fq(j)1767 1200 y Ft(A)1829 1212 y Fn(k)1870 1200 y Ft(A)1932 1212 y Fn(l)1990 1200 y Fv(+)32 b Ft(A)2149 1212 y Fn(k)2190 1200 y Ft(G)2255 1212 y Fn(l)2424 1144 y Ft(e)2463 1114 y Fp(2)p 2305 1181 V 2305 1257 a Fq(j)p Fk(x)2378 1269 y Fn(k)2438 1257 y Fq(\000)18 b Fk(x)2571 1269 y Fn(l)2596 1257 y Fq(j)2643 1200 y Ft(A)2705 1212 y Fn(k)2746 1200 y Ft(G)2811 1212 y Fn(l)3115 1200 y Fv(\(1.3\))996 1450 y(+)k Ft(G)1148 1462 y Fn(k)1189 1450 y Ft(A)1251 1462 y Fn(l)1420 1394 y Ft(e)1459 1363 y Fp(2)p 1301 1431 V 1301 1507 a Fq(j)p Fk(x)1374 1519 y Fn(k)1434 1507 y Fq(\000)c Fk(x)1567 1519 y Fn(l)1592 1507 y Fq(j)1639 1450 y Ft(G)1704 1462 y Fn(k)1745 1450 y Ft(A)1807 1462 y Fn(l)1865 1450 y Fv(+)32 b Ft(G)2027 1462 y Fn(k)2068 1450 y Ft(G)2133 1462 y Fn(l)2302 1394 y Ft(e)2341 1363 y Fp(2)p 2183 1431 V 2183 1507 a Fq(j)p Fk(x)2256 1519 y Fn(k)2316 1507 y Fq(\000)18 b Fk(x)2449 1519 y Fn(l)2475 1507 y Fq(j)2522 1450 y Ft(G)2587 1462 y Fn(k)2628 1450 y Ft(G)2693 1462 y Fn(l)2718 1450 y Ft(:)451 1638 y Fv(Let)37 b(us)f(consider)f (the)i(t)n(w)n(o-cluster)e(decomp)r(ositions)g Fq(f)p Ft(C)2331 1650 y Fp(1)p Fn(j)2399 1638 y Ft(;)14 b(C)2495 1650 y Fp(2)p Fn(j)2563 1638 y Fq(g)36 b Fv(of)h(the)f Ft(N)9 b Fv(-electron)451 1737 y(atom,)27 b(obtained)g(b)n(y)g(mo)n (ving)f(electron)g Ft(j)33 b Fv(far)26 b(a)n(w)n(a)n(y)f(from)i(the)h (atom)e(or)h(b)n(y)g(separating)451 1837 y(the)21 b(n)n(ucleus)g(from)g (all)f(electrons.)34 b(Denote)21 b(b)n(y)g Ft(C)1995 1849 y Fp(1)p Fn(j)2084 1837 y Fv(the)h(cluster)e(lo)r(cated)h(near)f (the)h(origin)451 1937 y(\(con)n(taining)30 b(the)g(n)n(ucleus\),)h (while)g Ft(C)1666 1949 y Fp(2)p Fn(j)1765 1937 y Fv(con)n(tains)e (either)h(one)g(electron)f(\()p Ft(j)k Fv(=)27 b(1)p Ft(;)14 b(:::;)g(N)9 b Fv(\))451 2036 y(or)27 b(all)g(electrons)g(\()p Ft(j)h Fv(=)23 b(0\))p Ft(:)50 b Fv(Corresp)r(ondingly)-7 b(,)26 b Ft(h)2032 2006 y Fn(B)s(R)2167 2036 y Fv(is)i(split)f(in)n(to) 1104 2202 y Ft(h)1152 2168 y Fn(B)s(R)1306 2202 y Fv(=)45 b Ft(T)53 b Fv(+)41 b Ft(a)1668 2214 y Fn(j)1744 2202 y Fv(+)h Ft(r)1888 2214 y Fn(j)1923 2202 y Ft(;)180 b(j)28 b Fv(=)23 b(0)p Ft(;)14 b Fv(1)p Ft(;)g(:::;)g(N)t(;)481 b Fv(\(1.4\))451 2427 y(with)25 b Ft(T)34 b Fv(:=)861 2348 y Fn(N)847 2365 y Fm(P)830 2502 y Fn(k)q Fp(=1)965 2427 y Ft(T)1026 2397 y Fp(\()p Fn(k)q Fp(\))1118 2427 y Ft(;)47 b Fv(while)24 b Ft(a)1445 2439 y Fn(j)1504 2427 y Fv(denotes)g(the)g(in)n(teraction)f(of)h(the)g(particles)g(lo)r (cated)f(all)451 2576 y(in)k(cluster)e Ft(C)872 2588 y Fp(1)p Fn(j)967 2576 y Fv(or)g(all)h(in)h Ft(C)1336 2588 y Fp(2)p Fn(j)1404 2576 y Ft(:)g Fv(The)f(remainder)f Ft(r)2051 2588 y Fn(j)2113 2576 y Fv(collects)g(the)i(in)n(teractions)e (b)r(et)n(w)n(een)451 2676 y(particles)38 b(sitting)g(in)h(di\013eren)n (t)f(clusters)g(and)g(is)g(supp)r(osed)g(to)h(v)-5 b(anish)38 b(when)g Ft(C)3123 2688 y Fp(2)p Fn(j)3230 2676 y Fv(is)451 2775 y(mo)n(v)n(ed)27 b(to)g(in\014nit)n(y)-7 b(.)451 2875 y(De\014ne)28 b(for)f Ft(j)h Fq(2)c(f)p Fv(0)p Ft(;)14 b Fv(1)p Ft(;)g(:::;)g(N)9 b Fq(g)1412 3041 y Fv(\006)1472 3053 y Fp(0)1532 3041 y Fv(:=)46 b(min)1720 3093 y Fn(j)1818 3041 y Fv(inf)35 b Ft(\033)s Fv(\()p Ft(T)30 b Fv(+)18 b Ft(a)2235 3053 y Fn(j)2270 3041 y Fv(\))p Ft(:)790 b Fv(\(1.5\))451 3245 y(Then)28 b(w)n(e)f(ha)n(v)n(e)451 3397 y Fs(Theorem)k Fv(1)f Fs(\(HVZ)f(theorem)h(f)n(or)h(the)f(mul)-6 b(tip)g(ar)g(ticle)32 b(Br)n(o)n(wn-Ra)-7 b(venhall)451 3497 y(opera)h(tor\).)451 3596 y Fh(L)l(et)27 b Ft(h)640 3566 y Fn(B)s(R)774 3596 y Fh(b)l(e)g(the)g(Br)l(own-R)l(avenhal)t(l)i (op)l(er)l(ator)f(for)g Ft(N)k(>)22 b Fv(2)27 b Fh(ele)l(ctr)l(ons)g (in)g(a)g(c)l(entr)l(al)g(\014eld)451 3696 y(of)h(str)l(ength)e Ft(\015)h(<)c(\015)1059 3708 y Fn(B)s(R)1190 3696 y Fv(=)1404 3663 y Fp(2)p 1287 3677 268 4 v 1287 3725 a Fn(\031)r(=)p Fp(2+2)p Fn(=\031)1564 3696 y Ft(;)k Fh(and)g(let)g(\(1.4\))h(b)l(e)f (its)f(two-cluster)h(de)l(c)l(omp)l(ositions.)451 3817 y(Then)k(the)e(essential)i(sp)l(e)l(ctrum)e(of)h Ft(h)1637 3787 y Fn(B)s(R)1774 3817 y Fh(is)h(given)f(by)1476 3983 y Ft(\033)1523 3995 y Fn(ess)1621 3983 y Fv(\()p Ft(h)1701 3949 y Fn(B)s(R)1809 3983 y Fv(\))37 b(=)23 b([\006)2049 3995 y Fp(0)2086 3983 y Ft(;)14 b Fq(1)p Fv(\))p Ft(:)854 b Fv(\(1.6\))451 4149 y(In)39 b(fact,)i(the)e(assertion)e(\(1.6\))i (holds)f(ev)n(en)g(in)h(a)f(more)g(general)f(case.)69 b(F)-7 b(or)38 b Ft(K)46 b Fq(\025)41 b Fv(2)451 4248 y(in)n(tro)r(duce)32 b Ft(K)6 b Fv(-cluster)30 b(decomp)r(ositions)i Ft(d)e Fv(:=)g Fq(f)p Ft(C)2078 4260 y Fp(1)2115 4248 y Ft(;)14 b(:::;)g(C)2317 4260 y Fn(K)2381 4248 y Fq(g)32 b Fv(of)g(the)g Ft(N)e Fv(+)21 b(1)32 b(particles,)451 4348 y(and)26 b(split)h Ft(h)843 4318 y Fn(B)s(R)973 4348 y Fv(=)c Ft(T)j Fv(+)15 b Ft(a)1260 4360 y Fn(d)1314 4348 y Fv(+)g Ft(r)1431 4360 y Fn(d)1497 4348 y Fv(accordingly)24 b(\(where)i Ft(T)g Fv(+)15 b Ft(a)2406 4360 y Fn(d)2471 4348 y Fv(describ)r(es)26 b(the)g(in\014nitely)451 4448 y(separated)i(clusters)f(while)i Ft(r)1383 4460 y Fn(d)1451 4448 y Fv(comprises)f(all)g(in)n(teractions)f(b)r(et)n(w)n(een)i (particles)f(sitting)451 4547 y(in)g(t)n(w)n(o)f(di\013eren)n(t)h (clusters\).)36 b(Let)1392 4713 y(\006)1452 4725 y Fp(1)1512 4713 y Fv(:=)64 b(min)1646 4767 y Fp(#)p Fn(d)p Fi(\025)p Fp(2)1834 4713 y Fv(inf)35 b Ft(\033)s Fv(\()p Ft(T)30 b Fv(+)18 b Ft(a)2251 4725 y Fn(d)2290 4713 y Fv(\))p Ft(:)770 b Fv(\(1.7\))451 4931 y(Then)40 b Ft(\033)727 4943 y Fn(ess)826 4931 y Fv(\()p Ft(h)906 4901 y Fn(B)s(R)1013 4931 y Fv(\))57 b(=)43 b([\006)1293 4943 y Fp(1)1330 4931 y Ft(;)14 b Fq(1)p Fv(\))83 b(with)40 b(\006)1826 4943 y Fp(1)1906 4931 y Fv(=)j(\006)2074 4943 y Fp(0)2111 4931 y Ft(:)83 b Fv(This)39 b(result,)j(kno)n(wn)d(from)h(the)451 5031 y(Sc)n(hr\177)-42 b(odinger)26 b(case)g([20)o(,)i(p.122],)e (relies)h(on)g(the)h(fact)g(that)f(the)h(electron-electron)e(in)n(ter-) 451 5130 y(action)20 b(is)g(repulsiv)n(e)f(\()p Ft(V)1207 5100 y Fp(\()p Fn(k)q(l)p Fp(\))1344 5130 y Fq(\025)k Fv(0)c(resp)r(ectiv)n(e)h Ft(v)1915 5100 y Fp(\()p Fn(k)q(l)p Fp(\))2052 5130 y Fq(\025)j Fv(0\))43 b(and)20 b(can)f(b)r(e)i(pro)n(v) n(ed)d(as)i(follo)n(ws.)1108 5338 y Fw(Document)l(a)25 b(Ma)l(thema)l(tica)h(10)f(\(2005\))g(497{525)p eop %%Page: 500 4 500 3 bop 451 518 a Fv(500)727 b Fs(D.)30 b(H.)h(Jakubassa-Amundsen)451 725 y Fv(First)g(consider)e Ft(K)6 b Fv(-cluster)29 b(decomp)r (ositions)h(of)h(the)f(form)h(#)p Ft(C)2512 737 y Fp(1)2577 725 y Fv(=)d Ft(N)h Fv(+)20 b(1)g Fq(\000)g Fv(\()p Ft(K)26 b Fq(\000)20 b Fv(1\))451 825 y(and)37 b(#)p Ft(C)750 837 y Fn(i)816 825 y Fv(=)h(1)p Ft(;)89 b(i)38 b Fv(=)g(2)p Ft(;)14 b(:::;)g(K)80 b Fv(\(i.e.)64 b(one)36 b(ion)h(and)f Ft(K)30 b Fq(\000)24 b Fv(1)36 b(separated)g(electrons\).)451 924 y(F)-7 b(or)28 b(an)n(y)f Ft(j)i Fq(2)24 b(f)p Fv(1)p Ft(;)14 b(:::;)g(N)9 b Fq(g)50 b Fv(w)n(e)28 b(use)f(for)h(the)g(t)n(w) n(o-cluster)f(decomp)r(ositions)g(the)h(notation)451 1024 y Ft(T)34 b Fv(+)22 b Ft(a)665 1036 y Fn(j)747 1024 y Fv(=)33 b Ft(h)893 994 y Fn(B)s(R)893 1047 y(N)6 b Fi(\000)p Fp(1)1063 1024 y Fv(+)22 b Ft(T)1211 994 y Fp(\()p Fn(j)s Fp(\))1297 1024 y Ft(;)67 b Fv(where)33 b(the)h(subscript)g(on)f Ft(h)2314 994 y Fn(B)s(R)2455 1024 y Fv(denotes)g(the)i(n)n(um)n(b)r(er)e(of)451 1124 y(electrons)27 b(in)h(the)g(cen)n(tral)e(\014eld,)i(and)g(assume)f (\(1.6\))g(to)g(hold.)37 b(Then)942 1309 y(inf)21 b Ft(\033)s Fv(\()p Ft(h)1187 1275 y Fn(B)s(R)1187 1330 y(N)1295 1309 y Fv(\))46 b Fq(\024)g Fv(inf)21 b Ft(\033)1646 1321 y Fn(ess)1744 1309 y Fv(\()p Ft(h)1824 1275 y Fn(B)s(R)1824 1330 y(N)1932 1309 y Fv(\))46 b Fq(\024)g Fv(inf)21 b Ft(\033)s Fv(\()p Ft(h)2366 1275 y Fn(B)s(R)2366 1330 y(N)6 b Fi(\000)p Fp(1)2533 1309 y Fv(+)18 b Ft(T)2677 1275 y Fp(\()p Fn(j)s Fp(\))2763 1309 y Fv(\))1488 1510 y(=)45 b(inf)21 b Ft(\033)s Fv(\()p Ft(h)1843 1476 y Fn(B)s(R)1843 1530 y(N)6 b Fi(\000)p Fp(1)1992 1510 y Fv(\))32 b(+)g Ft(m:)866 b Fv(\(1.8\))451 1664 y(By)27 b(induction)h(\(corresp)r(onding)e(to)i(successiv)n(e)e(remo)n(v)-5 b(al)26 b(of)i(an)f(electron\))g(w)n(e)h(get)649 1850 y(inf)21 b Ft(\033)s Fv(\()p Ft(h)894 1815 y Fn(B)s(R)894 1870 y(N)6 b Fi(\000)p Fp(1)1043 1850 y Fv(\))46 b Fq(\024)g Fv(inf)21 b Ft(\033)s Fv(\()p Ft(h)1477 1815 y Fn(B)s(R)1477 1870 y(N)6 b Fi(\000)p Fp(1)p Fi(\000)p Fn(N)1732 1854 y Fg(0)1758 1850 y Fv(\))42 b(+)f Ft(N)2014 1815 y Fi(0)2037 1850 y Ft(m;)180 b Fv(0)23 b Fq(\024)f Ft(N)2541 1815 y Fi(0)2587 1850 y Ft(<)h(N)k Fq(\000)18 b Fv(1)p Ft(:)198 b Fv(\(1.9\))451 2035 y(Since)37 b(for)f(a)h Ft(K)6 b Fv(-cluster)35 b(decomp)r(osition)i(of)f(this)h(sp)r(eci\014c)g(form)g (one)f(has)g Ft(T)g Fv(+)24 b Ft(a)3144 2047 y Fn(d)3221 2035 y Fv(=)451 2135 y Ft(h)499 2105 y Fn(B)s(R)499 2162 y(N)6 b Fi(\000)p Fp(\()p Fn(K)t Fi(\000)p Fp(1\))811 2135 y Fv(+)p Ft(T)937 2105 y Fp(\(1\))1025 2135 y Fv(+)p Ft(:::)p Fv(+)p Ft(T)1285 2105 y Fp(\()p Fn(K)t Fi(\000)p Fp(1\))1484 2135 y Ft(;)42 b Fv(it)18 b(follo)n(ws)g(that)g(inf)j Ft(\033)s Fv(\()p Ft(T)12 b Fv(+)p Ft(a)2423 2147 y Fn(d)2461 2135 y Fv(\))37 b(=)23 b(inf)e Ft(\033)s Fv(\()p Ft(h)2863 2105 y Fn(B)s(R)2863 2162 y(N)6 b Fi(\000)p Fp(\()p Fn(K)t Fi(\000)p Fp(1\))3175 2135 y Fv(\))14 b(+)451 2254 y(\()p Ft(K)24 b Fq(\000)18 b Fv(1\))p Ft(m)37 b Fq(\025)23 b Fv(inf)d Ft(\033)s Fv(\()p Ft(h)1177 2224 y Fn(B)s(R)1177 2277 y(N)6 b Fi(\000)p Fp(1)1326 2254 y Fv(\))19 b(+)f Ft(m)36 b Fq(\025)23 b Fv(\006)1717 2266 y Fp(0)1754 2254 y Ft(:)451 2356 y Fv(Assume)39 b(no)n(w)g(cluster)f(decomp)r (ositions)h Ft(d)g Fv(with)h(#)p Ft(C)2237 2368 y Fp(1)2317 2356 y Fv(=)i Ft(N)34 b Fv(+)26 b(1)g Fq(\000)f Fv(\()p Ft(K)32 b Fq(\000)26 b Fv(1\))39 b(\014xed)451 2455 y(\()p Ft(K)29 b Fq(2)23 b(f)p Fv(3)p Ft(;)14 b(:::;)g(N)9 b Fq(g)p Fv(\))48 b(but)26 b(where)g(#)p Ft(C)1603 2467 y Fn(i)1654 2455 y Ft(>)c Fv(1)k(for)f(at)h(least)f(one)h Ft(i)c(>)h Fv(1)p Ft(:)48 b Fv(Then)26 b Ft(T)g Fv(+)15 b Ft(a)3043 2467 y Fn(d)3107 2455 y Fv(is)26 b(in-)451 2555 y(creased)f(b)n(y)h(\(nonnegativ)n(e\))f(electron-electron)f(in)n (teraction)h(terms)h Ft(v)2694 2525 y Fp(\()p Fn(k)q(l)p Fp(\))2835 2555 y Fv(as)f(compared)451 2654 y(to)32 b(the)h Ft(K)6 b Fv(-cluster)31 b(decomp)r(ositions)g(considered)g(ab)r(o)n(v)n (e,)h(suc)n(h)g(that)h(inf)21 b Ft(\033)s Fv(\()p Ft(T)33 b Fv(+)21 b Ft(a)3127 2666 y Fn(d)3165 2654 y Fv(\))33 b(is)451 2754 y(higher)d(\(or)f(equal\))h(than)h(for)e(the)i(case)e(#)p Ft(C)1876 2766 y Fn(i)1932 2754 y Fv(=)e(1)p Ft(;)68 b(i)27 b Fv(=)g(2)p Ft(;)14 b(:::;)g(K)q(:)58 b Fv(Therefore,)29 b(cluster)451 2854 y(decomp)r(ositions)h(with)h(#)p Ft(C)1354 2866 y Fn(i)1410 2854 y Ft(>)c Fv(1)j(\(for)g(some)g Ft(i)d(>)h Fv(1\))i(do)g(not)g(con)n(tribute)g(to)h(\006)3035 2866 y Fp(1)3072 2854 y Fv(,)g(suc)n(h)451 2953 y(that,)d(together)f (with)h(\(1.9\),)f(\006)1452 2965 y Fp(1)1513 2953 y Fv(=)22 b(\006)1660 2965 y Fp(0)1725 2953 y Fv(is)28 b(pro)n(v)n(en.)451 3173 y(Let)d(us)g(em)n(bark)f(on)h(the)g(pro)r(of)f (of)h(Theorem)g(1.)35 b(The)25 b(required)f(lemmata)h(will)g(b)r(ear)g (the)451 3272 y(same)i(n)n(um)n(b)r(ers)g(as)g(in)h([14)o(].)451 3373 y(W)-7 b(e)36 b(sa)n(y)f(that)h(an)g(op)r(erator)e Fq(O)k Fv(is)1624 3341 y Fp(1)p 1615 3355 51 4 v 1615 3402 a Fn(R)1675 3373 y Fv(-b)r(ounded)e(if)h Fq(O)h Fv(is)e(b)r(ounded)g(b)n(y)2822 3341 y Fn(c)p 2812 3355 V 2812 3402 a(R)2908 3373 y Fv(with)g(some)451 3473 y(constan)n(t)27 b Ft(c)c(>)g Fv(0.)451 3621 y(\()p Ft(a)p Fv(\))123 b(In)40 b(order)e(to)i(pro)n(v)n(e)d(the)j('hard)f(part')g(of)h(the)g(HVZ)g (theorem,)i Ft(\033)2860 3633 y Fn(ess)2958 3621 y Fv(\()p Ft(h)3038 3591 y Fn(B)s(R)3146 3621 y Fv(\))h Fq(\032)451 3721 y Fv([\006)534 3733 y Fp(0)571 3721 y Ft(;)14 b Fq(1)p Fv(\),)28 b(w)n(e)f(start)g(b)n(y)g(noting)g(that)h(the)g(p)r (oten)n(tial)f(of)h Ft(h)2284 3691 y Fn(B)s(R)2418 3721 y Fv(is)g Ft(T)12 b Fv(-form)26 b(b)r(ounded)h(with)451 3821 y(form)21 b(b)r(ound)h Ft(c)h(<)g Fv(1)e(if)h Ft(\015)28 b(<)23 b(\015)1373 3833 y Fn(B)s(R)1480 3821 y Ft(:)f Fv(With)g Ft( )1787 3833 y Fp(+)1866 3821 y Fq(2)h Fv(\003)2002 3833 y Fp(+)p Fn(;N)2135 3821 y Fq(A)p Fv(\()p Ft(H)2302 3836 y Fp(1)p Fn(=)p Fp(2)2407 3821 y Fv(\()p Fo(R)2494 3791 y Fp(3)2537 3821 y Fv(\))6 b Fq(\012)g Fo(C)2701 3791 y Fp(4)2744 3821 y Fv(\))2776 3791 y Fn(N)2839 3821 y Fv(,)23 b(this)f(follo)n(ws)451 3932 y(from)27 b(the)h(estimates)g ([4)o(,)g(25)o(,)g(13)o(])g(\(using)f(that)h Ft(V)2035 3902 y Fp(\()p Fn(k)q Fp(\))2151 3932 y Fq(\024)22 b Fv(0)27 b(and)h Ft(V)2536 3902 y Fp(\()p Fn(k)q(l)p Fp(\))2673 3932 y Fq(\025)23 b Fv(0\),)720 4199 y(\()p Ft( )806 4211 y Fp(+)862 4199 y Ft(;)899 4057 y Fm( )995 4095 y Fn(N)965 4120 y Fm(X)964 4299 y Fn(k)q Fp(=1)1099 4199 y Ft(V)1166 4165 y Fp(\()p Fn(k)q Fp(\))1277 4199 y Fv(+)1428 4095 y Fn(N)1397 4120 y Fm(X)1360 4299 y Fn(k)q(>l)p Fp(=1)1568 4199 y Ft(V)1635 4165 y Fp(\()p Fn(k)q(l)p Fp(\))1749 4057 y Fm(!)1828 4199 y Ft( )1882 4211 y Fp(+)1938 4199 y Fv(\))46 b Fq(\024)2194 4095 y Fn(N)2164 4120 y Fm(X)2127 4299 y Fn(k)q(>l)p Fp(=1)2382 4143 y Ft(e)2421 4113 y Fp(2)p 2344 4180 151 4 v 2344 4256 a Ft(\015)2387 4268 y Fn(B)s(R)2528 4199 y Fv(\()p Ft( )2614 4211 y Fp(+)2669 4199 y Ft(;)14 b(E)2767 4211 y Fn(p)2801 4219 y Ff(1)2852 4199 y Ft( )2906 4211 y Fp(+)2961 4199 y Fv(\))1389 4535 y(=)1509 4478 y Ft(N)28 b Fq(\000)18 b Fv(1)p 1509 4515 219 4 v 1598 4591 a(2)1808 4478 y Ft(e)1847 4448 y Fp(2)p 1771 4515 151 4 v 1771 4591 a Ft(\015)1814 4603 y Fn(B)s(R)1955 4535 y Fv(\()p Ft( )2041 4547 y Fp(+)2096 4535 y Ft(;)c(T)25 b( )2261 4547 y Fp(+)2316 4535 y Fv(\))630 4827 y(\()p Ft( )716 4839 y Fp(+)772 4827 y Ft(;)809 4685 y Fm( )905 4723 y Fn(N)875 4748 y Fm(X)874 4927 y Fn(k)q Fp(=1)1009 4827 y Ft(V)1076 4793 y Fp(\()p Fn(k)q Fp(\))1187 4827 y Fv(+)1337 4723 y Fn(N)1307 4748 y Fm(X)1270 4927 y Fn(k)q(>l)p Fp(=1)1478 4827 y Ft(V)1545 4793 y Fp(\()p Fn(k)q(l)p Fp(\))1659 4685 y Fm(!)1738 4827 y Ft( )1792 4839 y Fp(+)1847 4827 y Fv(\))47 b Fq(\025)e(\000)2162 4771 y Ft(\015)p 2111 4808 V 2111 4884 a(\015)2154 4896 y Fn(B)s(R)2339 4723 y(N)2309 4748 y Fm(X)2308 4927 y Fn(k)q Fp(=1)2429 4827 y Fv(\()p Ft( )2515 4839 y Fp(+)2571 4827 y Ft(;)14 b(E)2669 4839 y Fn(p)2703 4847 y Ff(1)2753 4827 y Ft( )2807 4839 y Fp(+)2863 4827 y Fv(\))179 b(\(1.10\))1487 5099 y(=)46 b Fq(\000)1724 5042 y Ft(\015)p 1673 5080 V 1673 5156 a(\015)1716 5168 y Fn(B)s(R)1856 5099 y Fv(\()p Ft( )1942 5111 y Fp(+)1997 5099 y Ft(;)14 b(T)25 b( )2162 5111 y Fp(+)2217 5099 y Fv(\))1108 5338 y Fw(Document)l(a)g(Ma)l(thema)l (tica)h(10)f(\(2005\))g(497{525)p eop %%Page: 501 5 501 4 bop 1301 518 a Ft(N)9 b Fs(-Electr)n(on)31 b(HVZ)f(Theorem)726 b Fv(501)451 727 y(suc)n(h)30 b(that)h Ft(c)d Fv(:=)f(max)p Fq(f)1253 689 y Fn(\015)p 1209 707 127 4 v 1209 755 a(\015)1244 763 y Fj(B)r(R)1346 727 y Ft(;)1393 694 y Fn(N)6 b Fi(\000)p Fp(1)p 1393 708 144 4 v 1448 755 a(2)1602 694 y Fn(e)1633 669 y Ff(2)p 1570 708 127 4 v 1570 755 a Fn(\015)1605 763 y Fj(B)r(R)1707 727 y Fq(g)p Ft(:)55 b(c)28 b(<)f Fv(1)58 b(requires)29 b Ft(\015)j(<)c(\015)2609 739 y Fn(B)s(R)2747 727 y Fv(for)i(all)g(ph)n(ysical)451 845 y(v)-5 b(alues)27 b(of)h Ft(N)55 b Fv(\()p Ft(N)32 b(<)23 b Fv(250\))p Ft(:)49 b Fv(F)-7 b(rom)27 b(\(1.10\),)g Ft(h)1893 814 y Fn(B)s(R)2024 845 y Fq(\025)22 b Fv(0)27 b(for)g Ft(\015)h Fq(\024)23 b Ft(\015)2509 857 y Fn(B)s(R)2616 845 y Ft(:)451 944 y Fv(In)g(order)f(to)h(establish)g(P)n(ersson's)e (theorem)h(\(pro)n(v)n(en)g(in)h([5])g(for)g(Sc)n(hr\177)-42 b(odinger)21 b(op)r(erators)451 1044 y(and)28 b(termed)f(Lemma)h(2)f (in)h([14)o(]\),)1164 1220 y(inf)21 b Ft(\033)1326 1232 y Fn(ess)1425 1220 y Fv(\()p Ft(h)1505 1186 y Fn(B)s(R)1612 1220 y Fv(\))47 b(=)79 b(lim)1801 1273 y Fn(R)p Fi(!1)2045 1220 y Fv(inf)1998 1277 y Fi(k)p Fn(')p Fi(k)p Fp(=1)2194 1220 y Fv(\()p Ft(';)14 b(h)2365 1186 y Fn(B)s(R)2486 1220 y Ft(')p Fv(\))502 b(\(1.11\))451 1455 y(if)33 b Ft(')f Fq(2)g(A)p Fv(\()p Ft(C)868 1425 y Fi(1)862 1475 y Fp(0)939 1455 y Fv(\()p Fo(R)1025 1425 y Fp(3)p Fn(N)1127 1455 y Fq(n)p Ft(B)1232 1467 y Fn(R)1286 1455 y Fv(\(0\)\))22 b Fq(\012)g Fo(C)1587 1425 y Fp(2)p Fn(N)1689 1455 y Fv(\))33 b(where)f Ft(B)2062 1467 y Fn(R)2116 1455 y Fv(\(0\))g Fq(\032)f Fo(R)2404 1425 y Fp(3)p Fn(N)2539 1455 y Fv(is)h(a)g(ball)h(of)f(radius)g Ft(R)451 1554 y Fv(cen)n(tered)d(at)h(the)g(origin,)f(w)n(e)g(need)h(the)g(fact)g (that)g(the)g(W)-7 b(eyl)30 b(sequence)f Ft(')2863 1566 y Fn(n)2938 1554 y Fv(for)g(a)g Ft(\025)i Fv(in)451 1654 y(the)e(essen)n(tial)e(sp)r(ectrum)h(of)g Ft(h)1432 1624 y Fn(B)s(R)1568 1654 y Fv(can)g(b)r(e)g(c)n(hosen)f(suc)n(h)h(that)h (it)f(is)g(supp)r(orted)g(outside)451 1754 y(a)f(ball)h Ft(B)745 1766 y Fn(n)790 1754 y Fv(\(0\):)451 1914 y Fs(Lemma)34 b Fv(1)p Fs(.)42 b Fh(L)l(et)31 b Ft(h)1067 1884 y Fn(B)s(R)1201 1914 y Fv(=)26 b Ft(T)31 b Fv(+)19 b Ft(V)5 b(;)32 b Fh(let)g Ft(V)50 b Fh(b)l(e)32 b(r)l(elatively)h (form)g(b)l(ounde)l(d)f(with)g(r)l(esp)l(e)l(ct)g(to)451 2014 y Ft(T)12 b Fh(.)38 b(Then)30 b Ft(\025)24 b Fq(2)f Ft(\033)988 2026 y Fn(ess)1087 2014 y Fv(\()p Ft(h)1167 1984 y Fn(B)s(R)1275 2014 y Fv(\))30 b Fh(i\013)g(ther)l(e)f(exists)h (a)g(se)l(quenc)l(e)f(of)i(functions)451 2114 y Ft(')505 2126 y Fn(n)574 2114 y Fq(2)23 b(A)p Fv(\()p Ft(C)815 2083 y Fi(1)809 2134 y Fp(0)886 2114 y Fv(\()p Fo(R)973 2083 y Fp(3)p Fn(N)1075 2114 y Fq(n)p Ft(B)1180 2126 y Fn(n)1224 2114 y Fv(\(0\)\))c Fq(\012)f Fo(C)1518 2083 y Fp(2)p Fn(N)1620 2114 y Fv(\))30 b Fh(with)h Fq(k)p Ft(')1959 2126 y Fn(n)2004 2114 y Fq(k)22 b Fv(=)h(1)29 b Fh(such)h(that)1140 2290 y Fq(k)p Fv(\()p Ft(h)1262 2255 y Fn(B)s(R)1388 2290 y Fq(\000)18 b Ft(\025)p Fv(\))24 b Ft(')1629 2302 y Fn(n)1674 2290 y Fq(k)46 b(\000)-15 b(!)47 b Fv(0)199 b Fh(as)53 b Ft(n)23 b Fq(!)g(1)p Ft(:)477 b Fv(\(1.12\))451 2466 y(If)24 b(suc)n(h)e Ft(')766 2478 y Fn(n)835 2466 y Fv(exist)h(they)g(form)g(a)g(W)-7 b(eyl)23 b(sequence)g(b)r(ecause)g Ft(')2368 2478 y Fn(n)2436 2466 y Fv(con)n(v)n(erge)e(w)n(eakly)h(to)h(zero)451 2565 y([14)o(].)35 b(F)-7 b(or)22 b(the)h(pro)r(of)e(of)h(the)h(con)n (v)n(erse)d(direction,)j(let)g Ft(\025)g Fq(2)g Ft(\033)2359 2577 y Fn(ess)2458 2565 y Fv(\()p Ft(h)2538 2535 y Fn(B)s(R)2646 2565 y Fv(\))f(b)r(e)h(c)n(haracterized)451 2675 y(b)n(y)32 b(a)f(W)-7 b(eyl)32 b(sequence)f Ft( )1260 2687 y Fn(n)1335 2675 y Fq(2)f(A)p Fv(\()p Ft(C)1583 2645 y Fi(1)1577 2695 y Fp(0)1654 2675 y Fv(\()p Fo(R)1740 2645 y Fp(3)1784 2675 y Fv(\))21 b Fq(\012)g Fo(C)1977 2645 y Fp(2)2020 2675 y Fv(\))2052 2645 y Fn(N)2115 2675 y Ft(;)74 b Fq(k)p Ft( )2308 2687 y Fn(n)2352 2675 y Fq(k)30 b Fv(=)f(1)p Ft(;)61 b Fv(with)32 b Ft( )2891 2687 y Fn(n)2983 2628 y(w)2966 2675 y Ft(*)e Fv(0)h(and)451 2774 y Fq(k)p Fv(\()p Ft(h)573 2744 y Fn(B)s(R)691 2774 y Fq(\000)11 b Ft(\025)p Fv(\))p Ft( )901 2786 y Fn(n)947 2774 y Fq(k)36 b(!)24 b Fv(0)f(as)g Ft(n)g Fq(!)g(1)p Ft(:)47 b Fv(Let)25 b Fk(x)e Fv(=)g(\()p Fk(x)2016 2786 y Fp(1)2054 2774 y Ft(;)14 b(:::;)g Fk(x)2247 2786 y Fn(N)2310 2774 y Fv(\))23 b Fq(2)h Fo(R)2498 2744 y Fp(3)p Fn(N)2624 2774 y Fv(b)r(e)g(the)g(co)r (ordinates)451 2874 y(of)39 b(the)g Ft(N)47 b Fv(electrons)38 b(and)g(de\014ne)h(a)g(smo)r(oth)f(symmetric)g(auxiliary)g(function)h Ft(\037)3152 2886 y Fp(0)3230 2874 y Fq(2)451 2974 y Ft(C)516 2943 y Fi(1)510 2994 y Fp(0)587 2974 y Fv(\()p Fo(R)673 2943 y Fp(3)p Fn(N)775 2974 y Fv(\))28 b(mapping)f(to)h([0)p Ft(;)14 b Fv(1])27 b(b)n(y)g(means)g(of)1402 3199 y Ft(\037)1454 3211 y Fp(0)1491 3199 y Fv(\()1533 3143 y Fk(x)p 1533 3180 51 4 v 1533 3256 a Ft(n)1594 3199 y Fv(\))46 b(=)1783 3082 y Fm(\032)1887 3149 y Fv(1)p Ft(;)103 b(x)23 b Fq(\024)g Ft(n)1887 3248 y Fv(0)p Ft(;)82 b(x)24 b(>)e Fv(2)p Ft(n)3074 3199 y Fv(\(1.13\))451 3441 y(where)h Ft(x)h Fv(=)e Fq(j)p Fk(x)p Fq(j)i Fv(=)1053 3370 y Fm(p)p 1136 3370 468 4 v 71 x Ft(x)1183 3412 y Fp(2)1183 3463 y(1)1239 3441 y Fv(+)18 b Ft(:::)g Fv(+)g Ft(x)1539 3412 y Fp(2)1539 3465 y Fn(N)1617 3441 y Ft(:)46 b Fv(Then)24 b(w)n(e)f(set)h Ft(\037)2195 3453 y Fn(n)2240 3441 y Fv(\()p Fk(x)p Fv(\))g(:=)f(1)10 b Fq(\000)g Ft(\037)2668 3453 y Fp(0)2705 3441 y Fv(\()p Fk(x)p Ft(=n)p Fv(\))24 b(and)f(claim)451 3540 y(that)28 b(a)g(subsequence)f(of)h(the)g(sequence)f Ft(')1806 3552 y Fn(n)1875 3540 y Fv(:=)c Ft( )2040 3552 y Fn(n)2086 3540 y Ft(\037)2138 3552 y Fn(n)2206 3540 y Fq(2)h(A)p Fv(\()p Ft(C)2448 3510 y Fi(1)2442 3561 y Fp(0)2519 3540 y Fv(\()p Fo(R)2606 3510 y Fp(3)p Fn(N)2708 3540 y Fq(n)p Ft(B)2813 3552 y Fn(n)2857 3540 y Fv(\(0\)\))19 b Fq(\012)g Fo(C)3151 3510 y Fp(2)q Fn(N)3254 3540 y Fv(\))451 3640 y(satis\014es)27 b(the)h(requiremen)n(ts)e(of)i(Lemma)f(1.)451 3739 y(In)f(order)f(to)h(sho)n(w)f(that)i Fq(k)p Fv(\()p Ft(h)1374 3709 y Fn(B)s(R)1496 3739 y Fq(\000)15 b Ft(\025)p Fv(\))p Ft(')1710 3751 y Fn(n)1756 3739 y Fq(k)37 b Fv(=)22 b Fq(k)p Ft(\037)2016 3751 y Fn(n)2061 3739 y Fv(\()p Ft(h)2141 3709 y Fn(B)s(R)2264 3739 y Fq(\000)15 b Ft(\025)p Fv(\))p Ft( )2478 3751 y Fn(n)2553 3739 y Fv(+)g([)p Ft(h)2704 3709 y Fn(B)s(R)2811 3739 y Ft(;)f(\037)2900 3751 y Fp(0)2937 3739 y Fv(])p Ft( )3014 3751 y Fn(n)3060 3739 y Fq(k)36 b(!)23 b Fv(0)451 3839 y(for)g Ft(n)g Fq(!)g(1)p Fv(,)h(w)n(e)f(ha)n(v)n(e)e(to)i(estimate)g(the)h (single-particle)d(con)n(tributions)i Fq(k)p Fv([)p Ft(T)2905 3809 y Fp(\()p Fn(k)q Fp(\))2996 3839 y Ft(;)14 b(\037)3085 3851 y Fp(0)3122 3839 y Fv(])p Ft( )3199 3851 y Fn(n)3244 3839 y Fq(k)451 3955 y Fv(and)35 b Fq(k)p Fv([)p Ft(b)721 3912 y Fp(\()p Fn(k)q Fp(\))721 3977 y(1)p Fn(m)817 3955 y Ft(;)14 b(\037)906 3967 y Fp(0)943 3955 y Fv(])p Ft( )1020 3967 y Fn(n)1065 3955 y Fq(k)p Ft(:)72 b Fv(With)36 b Ft(b)1460 3912 y Fp(\()p Fn(k)q Fp(\))1460 3977 y(1)p Fn(m)1591 3955 y Fv(of)g(the)g(form)f Ft(B)2112 3967 y Fn(k)2183 3922 y Fp(1)p 2163 3936 74 4 v 2163 3984 a Fn(x)2201 3993 y Fj(k)2246 3955 y Ft(B)2309 3967 y Fn(k)2386 3955 y Fv(where)g Ft(B)2697 3967 y Fn(k)2774 3955 y Fq(2)h(f)p Ft(A)2969 3967 y Fn(k)3010 3955 y Ft(;)14 b(G)3112 3967 y Fn(k)3153 3955 y Fq(g)35 b Fv(is)451 4055 y(a)f(b)r(ounded)h(m)n(ultiplication)g(op)r(erator)d(in)j(momen)n (tum)g(space,)g(w)n(e)f(ha)n(v)n(e)g(to)g(consider)451 4154 y(comm)n(utators)20 b(of)h(the)g(t)n(yp)r(e)h Ft(p)1393 4166 y Fn(k)1433 4154 y Fv([)p Ft(B)1519 4166 y Fn(k)1560 4154 y Ft(;)14 b(\037)1649 4166 y Fp(0)1686 4154 y Fv(])22 b(whic)n(h)f(are)f(m)n(ultiplied)i(b)n(y)e(b)r(ounded)i(op)r(erators.) 451 4254 y(These)31 b(comm)n(utators)f(are)g(sho)n(wn)g(to)h(b)r(e)1833 4221 y Fp(1)p 1829 4235 42 4 v 1829 4282 a Fn(n)1880 4254 y Fv(-b)r(ounded)g(in)g(the)h(same)f(w)n(a)n(y)e(as)i(for)g Ft(N)37 b Fv(=)451 4353 y(2)i([14)o(],)k(b)n(y)c(w)n(orking)f(in)i (momen)n(tum)f(space)g(and)g(in)n(tro)r(ducing)g(the)h Ft(N)9 b Fv(-dimensional)451 4453 y(F)-7 b(ourier)27 b(transform)f(\(mark)n(ed)h(b)n(y)g(a)g(hat\))h(of)g(the)g(Sc)n(h)n(w)n (artz)e(function)i Ft(\037)2780 4465 y Fp(0)2817 4453 y Ft(;)527 4565 y Fm(\022)603 4627 y Fo(\\)588 4682 y Ft(\037)640 4694 y Fp(0)678 4682 y Fv(\()733 4625 y Fq(\001)p 720 4662 50 4 v 720 4739 a Ft(n)780 4682 y Fv(\))812 4565 y Fm(\023)887 4682 y Fv(\()p Fk(p)p Fv(\))47 b(=)1308 4625 y(1)p 1171 4662 315 4 v 1171 4740 a(\(2)p Ft(\031)s Fv(\))1327 4716 y Fp(3)p Fn(N)q(=)p Fp(2)1509 4569 y Fm(Z)1555 4757 y Fe(R)1602 4741 y Ff(3)p Fj(N)1697 4682 y Ft(d)p Fk(x)24 b Ft(e)1853 4647 y Fi(\000)p Fn(i)p Fd(p)n(x)2034 4682 y Ft(\037)2086 4694 y Fp(0)2123 4682 y Fv(\()2165 4625 y Fk(x)p 2165 4662 51 4 v 2165 4739 a Ft(n)2226 4682 y Fv(\))46 b(=)g Ft(n)2465 4647 y Fp(3)p Fn(N)2594 4682 y Fv(^)-52 b Ft(\037)2636 4694 y Fp(0)2673 4682 y Fv(\()p Fk(p)2758 4694 y Fp(1)2796 4682 y Ft(n;)14 b(:::;)g Fk(p)3042 4694 y Fn(N)3105 4682 y Ft(n)p Fv(\))p Ft(;)3074 4831 y Fv(\(1.14\))451 4931 y(where)40 b Fk(p)j Fv(=)g(\()p Fk(p)993 4943 y Fp(1)1031 4931 y Ft(;)14 b(:::;)g Fk(p)1227 4943 y Fn(N)1290 4931 y Fv(\))p Ft(;)40 b Fv(and)g(b)n(y)g(using)f(the)h(mean)g(v)-5 b(alue)40 b(theorem)f(to)h(estimate)451 5031 y(the)30 b(di\013erence)f Fq(j)p Ft(B)1055 5043 y Fn(k)1096 5031 y Fv(\()p Fk(p)1181 5043 y Fn(k)1222 5031 y Fv(\))20 b Fq(\000)f Ft(B)1421 5043 y Fn(k)1462 5031 y Fv(\()p Fk(p)1547 5043 y Fn(k)1583 5026 y Fg(0)1611 5031 y Fv(\))p Fq(j)30 b Fv(resp)r(ectiv)n(e)e Fq(j)p Ft(T)2167 5000 y Fp(\()p Fn(k)q Fp(\))2259 5031 y Fv(\()p Fk(p)2344 5043 y Fn(k)2385 5031 y Fv(\))20 b Fq(\000)f Ft(T)2582 5000 y Fp(\()p Fn(k)q Fp(\))2674 5031 y Fv(\()p Fk(p)2759 5043 y Fn(k)2795 5026 y Fg(0)2823 5031 y Fv(\))p Fq(j)p Ft(:)56 b Fv(The)29 b(t)n(w)n(o-)451 5130 y(particle)23 b(con)n(tributions)g Fq(k)p Fv([)p Ft(v)1357 5100 y Fp(\()p Fn(k)q(l)p Fp(\))1471 5130 y Ft(;)14 b(\037)1560 5142 y Fp(0)1597 5130 y Fv(])g Ft( )1688 5142 y Fn(n)1733 5130 y Fq(k)23 b Fv(can,)h(according)e(to)h(the)h (represen)n(tation)e(\(1.3\))1108 5338 y Fw(Document)l(a)j(Ma)l(thema)l (tica)h(10)f(\(2005\))g(497{525)p eop %%Page: 502 6 502 5 bop 451 518 a Fv(502)727 b Fs(D.)30 b(H.)h(Jakubassa-Amundsen)451 725 y Fv(of)d Ft(v)589 695 y Fp(\()p Fn(k)q(l)p Fp(\))703 725 y Ft(;)g Fv(also)e(b)r(e)i(split)g(in)n(to)f(single-particle)f (comm)n(utators)g Ft(p)2460 737 y Fn(k)2500 725 y Fv([)p Ft(B)2586 737 y Fn(k)2627 725 y Ft(;)14 b(\037)2716 737 y Fp(0)2753 725 y Fv(])28 b(m)n(ultiplied)g(b)n(y)451 825 y(b)r(ounded)g(op)r(erators.)34 b(Their)27 b(estimate)g(as)g(w)n (ell)f(as)h(the)g(remaining)g(parts)f(of)h(the)g(pro)r(of)451 924 y(of)j(Lemma)f(1)g(for)g Ft(N)34 b(>)26 b Fv(2)j(\(in)h(particular) e(the)i(normalizabilit)n(y)e(of)h Ft(')2694 936 y Fn(n)2769 924 y Fv(for)g(su\016cien)n(tly)451 1024 y(large)k Ft(n)g Fv(whic)n(h)h(relies)f(on)h(the)g(relativ)n(e)f(form)g(b)r(oundedness)h (of)g(the)g(total)g(p)r(oten)n(tial\))451 1124 y(can)27 b(b)r(e)h(mimic)n(k)n(ed)g(from)f(the)h(case)f(of)g Ft(N)32 b Fv(=)23 b(2)p Ft(:)451 1223 y Fv(Our)33 b(aim)h(is)g(a)g (generalization)e(of)i(the)g(lo)r(calization)f(form)n(ula)g(of)h(Lewis) g(et)g(al)g([16)o(])g(to)451 1323 y(the)43 b(op)r(erator)e Ft(h)1007 1293 y Fn(B)s(R)1115 1323 y Ft(:)91 b Fv(W)-7 b(e)43 b(in)n(tro)r(duce)g(the)g(Ruelle-Simon)g([22)o(])g(partition)f (of)h(unit)n(y)451 1422 y(\()p Ft(\036)532 1434 y Fn(j)568 1422 y Fv(\))600 1434 y Fn(j)s Fp(=0)p Fn(;:::;N)912 1422 y Fq(2)35 b Ft(C)1067 1392 y Fi(1)1138 1422 y Fv(\()p Fo(R)1224 1392 y Fp(3)p Fn(N)1326 1422 y Fv(\))g(whic)n(h)g(is)g(sub)r (ordinate)f(to)g(the)i(t)n(w)n(o-cluster)d(decomp)r(osi-)451 1522 y(tions)40 b(\(1.4\).)72 b(It)40 b(is)g(de\014ned)g(on)f(the)h (unit)h(sphere)e(in)h Fo(R)2333 1492 y Fp(3)p Fn(N)2474 1522 y Fv(and)g(has)f(the)h(follo)n(wing)451 1622 y(prop)r(erties)27 b(\(see)g(e.g.)37 b([5)o(,)28 b(p.33],)f([24)o(]\))850 1759 y Fn(N)819 1784 y Fm(X)821 1961 y Fn(j)s Fp(=0)953 1863 y Ft(\036)1002 1829 y Fp(2)1002 1884 y Fn(j)1086 1863 y Fv(=)45 b(1)p Ft(;)180 b(\036)1490 1875 y Fn(j)1525 1863 y Fv(\()p Ft(\025)p Fk(x)p Fv(\))48 b(=)d Ft(\036)1894 1875 y Fn(j)1930 1863 y Fv(\()p Fk(x)p Fv(\))111 b(for)28 b Ft(x)23 b Fv(=)g(1)50 b(and)27 b Ft(\025)d Fq(\025)e Fv(1)p Ft(;)487 2124 y Fv(supp)14 b Ft(\036)721 2136 y Fn(j)788 2124 y Fq(\\)33 b Fo(R)930 2089 y Fp(3)p Fn(N)1032 2124 y Fq(n)p Ft(B)1137 2136 y Fp(1)1174 2124 y Fv(\(0\))k Fq(\022)22 b(f)p Fk(x)h Fq(2)h Fo(R)1652 2089 y Fp(3)p Fn(N)1754 2124 y Fq(n)p Ft(B)1859 2136 y Fp(1)1895 2124 y Fv(\(0\))g(:)37 b Fq(j)p Fk(x)2158 2136 y Fn(k)2217 2124 y Fq(\000)18 b Fk(x)2350 2136 y Fn(l)2376 2124 y Fq(j)23 b(\025)g Ft(C)6 b(x)28 b Fv(for)f(all)h Ft(k)e Fq(2)d Ft(C)3099 2136 y Fp(1)p Fn(j)3074 2223 y Fv(\(1.15\))789 2323 y(and)28 b Ft(l)c Fq(2)g Ft(C)1138 2335 y Fp(2)p Fn(j)1206 2323 y Ft(;)65 b Fv(and)27 b Ft(x)1502 2335 y Fn(k)1567 2323 y Fq(\025)22 b Ft(C)6 b(x)52 b Fv(for)27 b(all)g Ft(k)f Fq(2)d Ft(C)2266 2335 y Fp(2)p Fn(j)2335 2323 y Fq(g)p Ft(;)59 b(j)28 b Fv(=)23 b(0)p Ft(;)14 b Fv(1)p Ft(;)g(:::;)g(N)451 2459 y Fv(where)38 b Ft(C)44 b Fv(is)38 b(a)f(constan)n(t)g(and)h(it)g(is)g(again)e(assumed)i(that)g (the)g(n)n(ucleus)g(b)r(elongs)f(to)451 2559 y(cluster)27 b Ft(C)778 2571 y Fp(1)p Fn(j)847 2559 y Ft(:)h Fv(Then)f(w)n(e)h(ha)n (v)n(e)451 2707 y Fs(Lemma)j Fv(3)p Fs(.)40 b Fh(L)l(et)28 b Ft(h)1059 2677 y Fn(B)s(R)1189 2707 y Fv(=)23 b Ft(T)28 b Fv(+)17 b Ft(a)1480 2719 y Fn(j)1531 2707 y Fv(+)g Ft(r)1650 2719 y Fn(j)1685 2707 y Ft(;)60 b Fv(\()p Ft(\036)1849 2719 y Fn(j)1885 2707 y Fv(\))1917 2719 y Fn(j)s Fp(=0)p Fn(;:::;N)2223 2707 y Fh(b)l(e)29 b(the)g(R)n(uel)t(le-Simon)g(p)l (artition)451 2806 y(of)36 b(unity)e(and)h Ft(')d Fq(2)g(A)p Fv(\()p Ft(C)1275 2776 y Fi(1)1269 2827 y Fp(0)1346 2806 y Fv(\()p Fo(R)1432 2776 y Fp(3)p Fn(N)1534 2806 y Fq(n)p Ft(B)1639 2818 y Fn(R)1693 2806 y Fv(\(0\)\))23 b Fq(\012)e Fo(C)1994 2776 y Fp(2)p Fn(N)2096 2806 y Fv(\))35 b Fh(with)g Ft(R)d(>)g Fv(1)p Ft(:)65 b Fh(Then,)37 b(with)e(some)451 2906 y(c)l(onstant)29 b Ft(c)p Fh(,)1045 3022 y Fq(j)p Fv(\()p Ft(\036)1149 3034 y Fn(j)1185 3022 y Ft(';)14 b(r)1313 3034 y Fn(j)1363 3022 y Ft(\036)1412 3034 y Fn(j)1447 3022 y Ft(')p Fv(\))p Fq(j)47 b(\024)1737 2966 y Ft(c)p 1724 3003 64 4 v 1724 3079 a(R)1820 3022 y Fq(k)p Ft(')p Fq(k)1958 2988 y Fp(2)1995 3022 y Ft(;)268 b(j)28 b Fv(=)23 b(0)p Ft(;)14 b(::;)g(N)t(:)382 b Fv(\(1.16\))451 3223 y(There)28 b(are)f(t)n(w)n(o)h(p)r(ossibilities.)39 b Ft(r)1507 3235 y Fn(j)1571 3223 y Fv(ma)n(y)27 b(\()p Ft(a)p Fv(\))i(consist)f(of)g(terms)g Ft(b)2525 3180 y Fp(\()p Fn(k)q Fp(\))2525 3245 y(1)p Fn(m)2649 3223 y Fv(for)g(some)g Ft(k)f Fq(2)d Ft(C)3194 3235 y Fp(2)p Fn(j)3263 3223 y Fv(,)451 3322 y(or)d(\()p Ft(b)p Fv(\))g(of)h(terms)f Ft(v)1025 3292 y Fp(\()p Fn(k)q(l)p Fp(\))1160 3322 y Fv(with)h(particles)f Ft(k)j Fv(and)d Ft(l)i Fv(in)f(di\013eren)n(t)f (clusters.)35 b(F)-7 b(or)20 b(the)i(pro)r(of,)g(all)451 3422 y(summands)27 b(of)f Ft(r)992 3434 y Fn(j)1055 3422 y Fv(are)g(estimated)g(separately)-7 b(.)36 b(F)-7 b(or)26 b(eac)n(h)g(summand)g(of)h Ft(r)2833 3434 y Fn(j)2895 3422 y Fv(\(to)g(a)g(giv)n(en)451 3522 y(cluster)35 b(decomp)r(osition) g Ft(j)5 b Fv(\),)38 b(a)d(sp)r(eci\014c)g(smo)r(oth)g(auxiliary)f (function)i Ft(\037)g Fv(mapping)f(to)451 3621 y([0)p Ft(;)14 b Fv(1])21 b(is)h(in)n(tro)r(duced)f(whic)n(h)h(is)f(unit)n(y)h (on)f(the)h(supp)r(ort)g(of)g Ft(\036)2332 3633 y Fn(j)2367 3621 y Ft(')p Fv(,)h(suc)n(h)f(that)g Ft(\036)2872 3633 y Fn(j)2907 3621 y Ft('\037)h Fv(=)g Ft(\036)3173 3633 y Fn(j)3208 3621 y Ft(')p Fv(.)451 3721 y(In)37 b(case)f(\()p Ft(a)p Fv(\))i(w)n(e)f(ha)n(v)n(e)e(supp)14 b Ft(\036)1461 3733 y Fn(j)1497 3721 y Ft(')39 b Fq(\032)f Fo(R)1747 3691 y Fp(3)p Fn(N)1849 3721 y Fq(n)p Ft(B)1954 3733 y Fn(R)2008 3721 y Fv(\(0\))h Fq(\\)f(f)p Ft(x)2335 3733 y Fn(k)2415 3721 y Fq(\025)g Ft(C)6 b(x)p Fq(g)p Ft(;)37 b Fv(i.e.)66 b Ft(x)2951 3733 y Fn(k)3031 3721 y Fq(\025)38 b Ft(C)6 b(R)q(:)451 3820 y Fv(Therefore)27 b(w)n(e)g(de\014ne)h(the)g (\(single-particle\))e(function)1280 4031 y Ft(\037)1332 4043 y Fn(k)1373 4031 y Fv(\()1415 3974 y Fk(x)1465 3986 y Fn(k)p 1416 4011 92 4 v 1429 4087 a Ft(R)1517 4031 y Fv(\))d(:=)1706 3913 y Fm(\032)1810 3980 y Fv(0)p Ft(;)82 b(x)2004 3992 y Fn(k)2069 3980 y Ft(<)22 b(C)6 b(R)q(=)p Fv(2)1810 4080 y(1)p Ft(;)124 b(x)2046 4092 y Fn(k)2110 4080 y Fq(\025)23 b Ft(C)6 b(R)2433 4031 y(:)618 b Fv(\(1.17\))451 4265 y(With)29 b Ft(b)702 4222 y Fp(\()p Fn(k)q Fp(\))702 4287 y(1)p Fn(m)825 4265 y Fv(of)f(the)g(form)f Ft(B)1322 4277 y Fn(k)1393 4232 y Fp(1)p 1373 4246 74 4 v 1373 4294 a Fn(x)1411 4303 y Fj(k)1457 4265 y Ft(B)1520 4277 y Fn(k)1588 4265 y Fv(w)n(e)g(ha)n(v)n(e)g(to)g(consider)451 4381 y(\()p Ft(\036)532 4393 y Fn(j)568 4381 y Ft(';)14 b(B)722 4393 y Fn(k)793 4348 y Fp(1)p 773 4362 V 773 4410 a Fn(x)811 4419 y Fj(k)857 4381 y Ft(B)920 4393 y Fn(k)974 4381 y Ft(\037)1026 4393 y Fn(k)1067 4381 y Ft(\036)1116 4393 y Fn(j)1152 4381 y Ft(')p Fv(\))37 b(=)23 b(\()p Ft(\036)1444 4393 y Fn(j)1480 4381 y Ft(';)14 b(B)1634 4393 y Fn(k)1705 4348 y Fp(1)p 1685 4362 V 1685 4410 a Fn(x)1723 4419 y Fj(k)1768 4381 y Ft(\037)1820 4393 y Fn(k)1861 4381 y Ft(B)1924 4393 y Fn(k)1979 4381 y Ft(\036)2028 4393 y Fn(j)2063 4381 y Ft(')p Fv(\))20 b(+)5 b(\()p Ft(\036)2320 4393 y Fn(j)2356 4381 y Ft(';)14 b(B)2510 4393 y Fn(k)2581 4348 y Fp(1)p 2561 4362 V 2561 4410 a Fn(x)2599 4419 y Fj(k)2658 4381 y Fv([)p Ft(B)2744 4393 y Fn(k)2785 4381 y Ft(;)g Fv(1)5 b Fq(\000)g Ft(\037)2991 4393 y Fn(k)3032 4381 y Fv(])14 b Ft(\036)3118 4393 y Fn(j)3153 4381 y Ft(')p Fv(\))p Ft(:)451 4489 y Fv(The)32 b(\014rst)f(term)h(is)f(uniformly)h(2)p Ft(=R)q Fv(-b)r(ounded)e(b)n(y) h(the)h(c)n(hoice)f(\(1.17\))g(of)h Ft(\037)2903 4501 y Fn(k)2943 4489 y Fv(,)h(whereas)451 4589 y(the)f(second)e(term)h(can) g(b)r(e)g(estimated)h(in)f(momen)n(tum)g(space)g(as)f(in)h(the)h(t)n(w) n(o-electron)451 4688 y(case)27 b(\(resp)r(ectiv)n(e)g(in)h(the)g(pro)r (of)f(of)g(Lemma)h(1\).)451 4788 y(In)22 b(case)g(\()p Ft(b)p Fv(\))g(w)n(e)g(ha)n(v)n(e)e(supp)14 b Ft(\036)1378 4800 y Fn(j)1414 4788 y Ft(')23 b Fq(\032)g Fo(R)1633 4758 y Fp(3)p Fn(N)1735 4788 y Fq(n)p Ft(B)1840 4800 y Fn(R)1894 4788 y Fv(\(0\))e Fq(\\)h(fj)p Fk(x)2213 4800 y Fn(k)2261 4788 y Fq(\000)7 b Fk(x)2383 4800 y Fn(l)2408 4788 y Fq(j)24 b(\025)e Ft(C)6 b(x)p Fq(g)p Ft(;)46 b Fv(i.e.)35 b Fq(j)p Fk(x)2979 4800 y Fn(k)3027 4788 y Fq(\000)7 b Fk(x)3149 4800 y Fn(l)3175 4788 y Fq(j)23 b(\025)451 4887 y Ft(C)6 b(R)q(:)51 b Fv(Accordingly)-7 b(,)27 b(w)n(e)g(tak)n(e)1045 5093 y Ft(\037)1097 5105 y Fn(k)q(l)1159 5093 y Fv(\()1201 5037 y Fk(x)1251 5049 y Fn(k)1311 5037 y Fq(\000)18 b Fk(x)1444 5049 y Fn(l)p 1201 5074 269 4 v 1304 5150 a Ft(R)1480 5093 y Fv(\))23 b(:=)1669 4976 y Fm(\032)1773 5042 y Fv(0)p Ft(;)82 b Fq(j)p Fk(x)1993 5054 y Fn(k)2053 5042 y Fq(\000)18 b Fk(x)2186 5054 y Fn(l)2212 5042 y Fq(j)46 b Ft(<)g(C)6 b(R)q(=)p Fv(2)1773 5142 y(1)p Ft(;)124 b Fq(j)p Fk(x)2035 5154 y Fn(k)2095 5142 y Fq(\000)18 b Fk(x)2228 5154 y Fn(l)2253 5142 y Fq(j)47 b(\025)e Ft(C)6 b(R)2669 5093 y(:)382 b Fv(\(1.18\))1108 5338 y Fw(Document)l(a)25 b(Ma)l(thema)l(tica)h(10)f(\(2005\))g(497{525)p eop %%Page: 503 7 503 6 bop 1301 518 a Ft(N)9 b Fs(-Electr)n(on)31 b(HVZ)f(Theorem)726 b Fv(503)451 725 y(With)27 b(the)e(represen)n(tation)f(\(1.3\))h(of)h Ft(v)1677 695 y Fp(\()p Fn(k)q(l)p Fp(\))1791 725 y Fv(,)g(w)n(e)f(ha)n (v)n(e)f(to)i(estimate)f(comm)n(utators)f(of)i(the)451 825 y(t)n(yp)r(e)32 b Ft(p)684 837 y Fn(k)725 825 y Fv([)p Ft(B)811 837 y Fn(k)866 825 y Ft(B)929 837 y Fn(l)954 825 y Ft(;)14 b Fv(1)21 b Fq(\000)g Ft(\037)1192 837 y Fn(k)q(l)1254 825 y Fv(])p Ft(:)63 b Fv(The)32 b(pro)r(of)f(of)h (their)g(uniform)g(1)p Ft(=R)q Fv(-b)r(oundedness)f(can)g(b)r(e)451 924 y(copied)c(from)h(the)g(t)n(w)n(o-electron)d(case.)451 1024 y(The)32 b(second)f(ingredien)n(t)f(of)i(the)g(lo)r(calization)e (form)n(ula)h(is)g(an)g(estimate)h(for)f(the)h(com-)451 1124 y(m)n(utator)27 b(of)h Ft(\036)916 1136 y Fn(j)979 1124 y Fv(with)g Ft(h)1216 1093 y Fn(B)s(R)1323 1124 y Fv(:)451 1287 y Fs(Lemma)k Fv(4)p Fs(.)40 b Fh(L)l(et)30 b Ft(h)1062 1257 y Fn(B)s(R)1199 1287 y Fh(fr)l(om)g(\(1.2\))h(and)g Fv(\()p Ft(\036)1846 1299 y Fn(j)1882 1287 y Fv(\))1914 1299 y Fn(j)s Fp(=0)p Fn(;:::;N)2220 1287 y Fh(b)l(e)f(the)g(R)n(uel)t (le-Simon)g(p)l(artition)451 1387 y(of)h(unity.)38 b(Then)30 b(for)h Ft(')23 b Fq(2)h(A)p Fv(\()p Ft(C)1465 1356 y Fi(1)1459 1407 y Fp(0)1536 1387 y Fv(\()p Fo(R)1622 1356 y Fp(3)p Fn(N)1724 1387 y Fq(n)p Ft(B)1829 1399 y Fn(R)1883 1387 y Fv(\(0\)\))19 b Fq(\012)f Fo(C)2177 1356 y Fp(2)p Fn(N)2279 1387 y Fv(\))30 b Fh(and)g Ft(R)24 b(>)f Fv(2)29 b Fh(one)h(has)1079 1622 y Fv(\()p Ft(a)p Fv(\))253 b Fq(j)1505 1543 y Fn(N)1490 1560 y Fm(P)1477 1695 y Fn(j)s Fp(=0)1592 1622 y Fv(\()p Ft(\036)1673 1634 y Fn(j)1708 1622 y Ft(';)14 b Fv([)p Ft(T)7 b(;)14 b(\036)1964 1634 y Fn(j)2000 1622 y Fv(])g Ft(')p Fv(\))p Fq(j)83 b(\024)2382 1566 y Ft(c)p 2350 1603 101 4 v 2350 1679 a(R)2414 1655 y Fp(2)2484 1622 y Fq(k)p Ft(')p Fq(k)2622 1588 y Fp(2)1087 1840 y Fv(\()p Ft(b)p Fv(\))279 b Fq(j)p Fv(\()p Ft(\036)1570 1852 y Fn(j)1606 1840 y Ft(';)14 b Fv([)p Ft(b)1756 1797 y Fp(\()p Fn(k)q Fp(\))1756 1862 y(1)p Fn(m)1852 1840 y Ft(;)g(\036)1938 1852 y Fn(j)1973 1840 y Fv(])g Ft(')p Fv(\))p Fq(j)110 b(\024)2364 1784 y Ft(c)p 2350 1821 64 4 v 2350 1897 a(R)2446 1840 y Fq(k)p Ft(')p Fq(k)2584 1806 y Fp(2)3074 1840 y Fv(\(1.19\))1087 2022 y(\()p Ft(c)p Fv(\))266 b Fq(j)p Fv(\()p Ft(\036)1557 2034 y Fn(j)1593 2022 y Ft(';)14 b Fv([)p Ft(v)1750 1992 y Fp(\()p Fn(k)q(l)p Fp(\))1865 2022 y Ft(;)g(\036)1951 2034 y Fn(j)1986 2022 y Fv(])g Ft(')p Fv(\))p Fq(j)97 b(\024)2364 1966 y Ft(c)p 2350 2003 V 2350 2079 a(R)2446 2022 y Fq(k)p Ft(')p Fq(k)2584 1988 y Fp(2)451 2225 y Fh(wher)l(e)31 b Ft(c)e Fh(is)h(a)h(generic)f(c)l(onstant.)451 2388 y Fv(Item)25 b(\()p Ft(a)p Fv(\))g(is)g(pro)n(v)n(en)e(in)i([16)o(].)36 b(F)-7 b(or)24 b(items)h(\()p Ft(b)p Fv(\))g(and)f(\()p Ft(c)p Fv(\))i(w)n(e)e(de\014ne)h(the)g(smo)r(oth)f(auxiliary)451 2488 y Ft(N)9 b Fv(-particle)27 b(function)h Ft(\037)f Fv(mapping)h(to)f([0)p Ft(;)14 b Fv(1],)1368 2717 y Ft(\037)p Fv(\()1469 2661 y Fk(x)p 1462 2698 V 1462 2774 a Ft(R)1536 2717 y Fv(\))23 b(:=)1725 2600 y Fm(\032)1828 2666 y Fv(0)p Ft(;)83 b(x)24 b(<)e(R)q(=)p Fv(2)1828 2766 y(1)p Ft(;)125 b(x)23 b Fq(\025)g Ft(R)2346 2717 y(:)705 b Fv(\(1.20\))451 2970 y(Then)77 b Ft(\036)766 2982 y Fn(j)801 2970 y Ft(')106 b Fv(=)e Ft(\036)1179 2982 y Fn(j)1214 2970 y Ft('\037)77 b Fv(on)g(supp)14 b Ft(';)77 b Fv(and)f(therefore)g (\()p Ft(\036)2590 2982 y Fn(j)2626 2970 y Ft(';)14 b Fv([)p Ft(b)2776 2927 y Fp(\()p Fn(k)q Fp(\))2776 2992 y(1)p Fn(m)2872 2970 y Ft(;)g(\036)2958 2982 y Fn(j)2993 2970 y Fv(])g Ft(')p Fv(\))105 b(=)451 3089 y(\()p Ft(\036)532 3101 y Fn(j)568 3089 y Ft(';)14 b Fv([)p Ft(b)718 3046 y Fp(\()p Fn(k)q Fp(\))718 3111 y(1)p Fn(m)814 3089 y Ft(;)g(\036)900 3101 y Fn(j)935 3089 y Ft(\037)p Fv(])g Ft(')p Fv(\))p Ft(:)95 b Fv(The)1433 3056 y Fp(1)p 1424 3070 51 4 v 1424 3118 a Fn(R)1485 3089 y Fv(-estimate,)47 b(claimed)c(in)h(\(1.19\),)j(relies)c(on)h(the)g(scal-)451 3189 y(ing)31 b(prop)r(ert)n(y)f Ft(\036)985 3201 y Fn(j)1020 3189 y Fv(\()p Fk(x)p Fv(\))p Ft(\037)p Fv(\()1235 3156 y Fd(x)p 1230 3170 V 1230 3217 a Fn(R)1290 3189 y Fv(\))43 b(=)28 b Ft(\036)1507 3201 y Fn(j)1543 3189 y Fv(\()1624 3156 y Fd(x)p 1585 3170 118 4 v 1585 3217 a Fn(R=)p Fp(2)1712 3189 y Fv(\))p Ft(\037)p Fv(\()1844 3156 y Fd(x)p 1839 3170 51 4 v 1839 3217 a Fn(R)1899 3189 y Fv(\))j(whic)n(h)g(holds)g (for)g Ft(R)e(>)g Fv(2)h(since)h(supp)14 b Ft(\037)451 3302 y Fv(\(and)32 b(hence)g(supp)14 b Ft(\036)1118 3314 y Fn(j)1153 3302 y Ft(\037)p Fv(\))32 b(is)f(outside)h Ft(B)1710 3317 y Fn(R=)p Fp(2)1831 3302 y Fv(\(0\))p Ft(:)62 b Fv(Th)n(us,)32 b(w)n(orking)e(in)i(co)r(ordinate)f(space)451 3402 y(and)d(using)f(the)h(mean)f(v)-5 b(alue)28 b(theorem,)f(w)n(e)g (get)g(the)h(estimate)530 3598 y Fq(j)p Fv(\()p Ft(\036)634 3610 y Fn(j)669 3598 y Ft(\037)p Fv(\)\()p Fk(x)835 3610 y Fp(1)873 3598 y Ft(;)14 b(:::;)g Fk(x)1066 3610 y Fn(k)1108 3598 y Ft(;)g(:::;)g Fk(x)1301 3610 y Fn(N)1364 3598 y Fv(\))33 b Fq(\000)e Fv(\()p Ft(\036)1606 3610 y Fn(j)1642 3598 y Ft(\037)p Fv(\)\()p Fk(x)1808 3610 y Fp(1)1846 3598 y Ft(;)14 b(:::;)g Fk(x)2039 3564 y Fi(0)2039 3619 y Fn(k)2081 3598 y Ft(;)g(:::;)g Fk(x)2274 3610 y Fn(N)2337 3598 y Fv(\))p Fq(j)46 b(\024)g(j)p Fk(x)2622 3610 y Fn(k)2682 3598 y Fq(\000)18 b Fk(x)2815 3564 y Fi(0)2815 3619 y Fn(k)2856 3598 y Fq(j)2912 3542 y Ft(c)2948 3554 y Fp(0)p 2912 3579 74 4 v 2917 3655 a Ft(R)3074 3598 y Fv(\(1.21\))451 3805 y(\(only)34 b(the)f Ft(k)s Fv(-th)h(co)r (ordinate)e(in)i(the)g(second)f(en)n(try)g(of)g(the)h(l.h.s.)55 b(is)33 b(primed\).)55 b(Since)451 3905 y(\(1.21\))25 b(holds)f(for)h(arbitrary)e Ft(k)j Fq(2)e(f)p Fv(1)p Ft(;)14 b(:::;)g(N)9 b Fq(g)p Ft(;)23 b Fv(the)j(pro)r(of)e(of)i(\()p Ft(b)p Fv(\))f(and)g(\()p Ft(c)p Fv(\))h(can)f(b)r(e)g(carried)451 4005 y(out)h(in)h(the)f(same)g(w)n(a)n(y)f(as)g(done)h(in)g(the)h(t)n (w)n(o-electron)d(case,)i(b)n(y)f(estimating)h(the)h(k)n(ernel)451 4104 y(of)e Ft(B)606 4116 y Fn(k)670 4104 y Fq(2)e(f)p Ft(A)852 4116 y Fn(k)893 4104 y Ft(;)14 b(G)995 4116 y Fn(k)1036 4104 y Fq(g)24 b Fv(in)h(co)r(ordinate)f(space)g(b)n(y)g Ft(c=)p Fq(j)p Fk(x)2084 4116 y Fn(k)2138 4104 y Fq(\000)13 b Fk(x)2266 4074 y Fi(0)2266 4128 y Fn(k)2306 4104 y Fq(j)2329 4074 y Fp(3)2391 4104 y Fv(\(using)25 b(asymptotic)f(analy-) 451 4204 y(sis)29 b([19)o(]\))g(and)f(subsequen)n(tly)h(pro)n(ving)e (the)i(uniform)2191 4171 y Fp(1)p 2183 4185 51 4 v 2183 4232 a Fn(R)2243 4204 y Fv(-b)r(oundedness)f(of)h([)p Ft(B)2941 4216 y Fn(k)2982 4204 y Ft(;)14 b(\036)3068 4216 y Fn(j)3103 4204 y Ft(\037)p Fv(])3222 4171 y Fp(1)p 3202 4185 74 4 v 3202 4232 a Fn(x)3240 4241 y Fj(k)451 4320 y Fv(resp)r(ectiv)n(e)27 b([)p Ft(B)923 4332 y Fn(k)964 4320 y Ft(;)14 b(\036)1050 4332 y Fn(j)1085 4320 y Ft(\037)p Fv(])1283 4287 y Fp(1)p 1184 4301 232 4 v 1184 4348 a Fi(j)p Fd(x)1244 4357 y Fj(k)1280 4348 y Fi(\000)p Fd(x)1372 4357 y Fj(l)1395 4348 y Fi(j)1425 4320 y Ft(:)451 4441 y Fv(With)29 b(Lemmata)e(3)g(and)g(4)h(w)n(e)f(obtain)g(the)h(desired)f (lo)r(calization)g(form)n(ula)f(for)h Ft(h)3061 4411 y Fn(B)s(R)3169 4441 y Fv(,)1182 4697 y(\()p Ft(';)14 b(h)1353 4663 y Fn(B)s(R)1461 4697 y Ft(')p Fv(\))47 b(=)1735 4593 y Fn(N)1705 4618 y Fm(X)1707 4795 y Fn(j)s Fp(=0)1825 4697 y Fv(\()p Ft(\036)1906 4709 y Fn(j)1941 4697 y Ft(';)14 b Fv(\()p Ft(T)30 b Fv(+)18 b Ft(a)2270 4709 y Fn(j)2305 4697 y Fv(\))23 b Ft(\036)2409 4709 y Fn(j)2445 4697 y Ft(')p Fv(\))1067 5054 y(+)1199 4950 y Fn(N)1168 4975 y Fm(X)1171 5152 y Fn(j)s Fp(=0)1288 5054 y Fv(\()p Ft(\036)1369 5066 y Fn(j)1405 5054 y Ft(';)14 b(r)1533 5066 y Fn(j)1591 5054 y Ft(\036)1640 5066 y Fn(j)1676 5054 y Ft(')p Fv(\))42 b Fq(\000)1941 4950 y Fn(N)1910 4975 y Fm(X)1913 5152 y Fn(j)s Fp(=0)2030 5054 y Fv(\()p Ft(\036)2111 5066 y Fn(j)2147 5054 y Ft(';)14 b Fv([)p Ft(h)2309 5020 y Fn(B)s(R)2416 5054 y Ft(;)g(\036)2502 5066 y Fn(j)2538 5054 y Fv(])23 b Ft(')p Fv(\))404 b(\(1.22\))1108 5338 y Fw(Document)l(a)25 b(Ma)l(thema)l(tica)h(10)f(\(2005\))g (497{525)p eop %%Page: 504 8 504 7 bop 451 518 a Fv(504)727 b Fs(D.)30 b(H.)h(Jakubassa-Amundsen) 1125 794 y Fv(=)1266 690 y Fn(N)1235 715 y Fm(X)1238 892 y Fn(j)s Fp(=0)1355 794 y Fv(\()p Ft(\036)1436 806 y Fn(j)1472 794 y Ft(';)14 b Fv(\()p Ft(T)30 b Fv(+)18 b Ft(a)1801 806 y Fn(j)1836 794 y Fv(\))c Ft(\036)1931 806 y Fn(j)1967 794 y Ft(')p Fv(\))42 b(+)f Ft(O)r Fv(\()2320 738 y(1)p 2308 775 64 4 v 2308 851 a Ft(R)2382 794 y Fv(\))24 b Fq(k)p Ft(')p Fq(k)2576 760 y Fp(2)451 1039 y Fv(for)33 b Ft(R)f(>)g Fv(2)p Ft(:)64 b Fv(F)-7 b(rom)33 b(P)n(ersson's)d(theorem)j(\(1.11\))f(and)h(the)g(de\014nition)g (\(1.5\))g(of)g(\006)3121 1051 y Fp(0)3191 1039 y Fv(w)n(e)451 1138 y(therefore)27 b(get)917 1402 y(inf)35 b Ft(\033)1093 1414 y Fn(ess)1192 1402 y Fv(\()p Ft(h)1272 1368 y Fn(B)s(R)1379 1402 y Fv(\))47 b(=)79 b(lim)1568 1456 y Fn(R)p Fi(!1)1826 1402 y Fv(inf)1779 1459 y Fi(k)p Fn(')p Fi(k)p Fp(=1)2033 1298 y Fn(N)2002 1323 y Fm(X)2005 1500 y Fn(j)s Fp(=0)2122 1402 y Fv(\()p Ft(\036)2203 1414 y Fn(j)2239 1402 y Ft(';)14 b Fv(\()p Ft(T)30 b Fv(+)18 b Ft(a)2568 1414 y Fn(j)2603 1402 y Fv(\))c Ft(\036)2698 1414 y Fn(j)2733 1402 y Ft(')p Fv(\))1381 1774 y Fq(\025)46 b Fv(\006)1552 1786 y Fp(0)1633 1670 y Fn(N)1603 1695 y Fm(X)1605 1872 y Fn(j)s Fp(=0)1723 1774 y Fv(\()p Ft(\036)1804 1786 y Fn(j)1840 1774 y Ft(';)14 b(\036)1980 1786 y Fn(j)2015 1774 y Ft(')p Fv(\))47 b(=)f(\006)2319 1786 y Fp(0)3074 1774 y Fv(\(1.23\))451 2027 y(whic)n(h)28 b(pro)n(v)n(es)d(the)j(inclusion)g Ft(\033)1482 2039 y Fn(ess)1581 2027 y Fv(\()p Ft(h)1661 1996 y Fn(B)s(R)1768 2027 y Fv(\))37 b Fq(\032)23 b Fv([\006)2008 2039 y Fp(0)2045 2027 y Ft(;)14 b Fq(1)p Fv(\))p Ft(:)451 2247 y Fv(\()p Ft(b)p Fv(\))122 b(W)-7 b(e)38 b(no)n(w)f(turn)i(to)f(the)g('easy)f (part')h(of)g(the)g(pro)r(of)g(where)f(w)n(e)h(ha)n(v)n(e)f(to)h(v)n (erify)451 2346 y([\006)534 2358 y Fp(0)571 2346 y Ft(;)14 b Fq(1)p Fv(\))24 b Fq(\032)e Ft(\033)881 2358 y Fn(ess)980 2346 y Fv(\()p Ft(h)1060 2316 y Fn(B)s(R)1168 2346 y Fv(\))p Ft(:)451 2448 y Fv(W)-7 b(e)29 b(start)f(b)n(y)g(sho)n(wing)f (that)h(for)g(ev)n(ery)f Ft(j)i Fq(2)c(f)p Fv(0)p Ft(;)14 b Fv(1)p Ft(;)g(:::;)g(N)9 b Fq(g)p Ft(;)60 b(\033)s Fv(\()p Ft(T)31 b Fv(+)18 b Ft(a)2695 2460 y Fn(j)2730 2448 y Fv(\))29 b(is)f(con)n(tin)n(uous,)451 2548 y(i.e.)48 b(for)31 b(an)n(y)f Ft(\025)g Fq(2)f Fv([inf)21 b Ft(\033)s Fv(\()p Ft(T)33 b Fv(+)20 b Ft(a)1489 2560 y Fn(j)1524 2548 y Fv(\))p Ft(;)14 b Fq(1)p Fv(\))32 b(one)f(has)g Ft(\025)e Fq(2)h Ft(\033)s Fv(\()p Ft(T)i Fv(+)21 b Ft(a)2503 2560 y Fn(j)2537 2548 y Fv(\))p Ft(:)61 b Fv(If)32 b(the)g(cluster)e Ft(C)3217 2560 y Fp(2)p Fn(j)451 2647 y Fv(consists)i(of)h(a)f(single)g (electron)g Ft(j)5 b Fv(,)34 b(then)f Ft(T)g Fv(+)21 b Ft(a)1993 2659 y Fn(j)2059 2647 y Fv(=)45 b Ft(T)2230 2617 y Fp(\()p Fn(j)s Fp(\))2338 2647 y Fv(+)21 b Ft(h)2472 2617 y Fn(B)s(R)2472 2670 y(N)6 b Fi(\000)p Fp(1)2653 2647 y Fv(where)32 b Ft(h)2946 2617 y Fn(B)s(R)2946 2670 y(N)6 b Fi(\000)p Fp(1)3126 2647 y Fv(do)r(es)451 2759 y(not)28 b(con)n(tain)f(an)n(y)g(in)n(teraction)g(with)h(electron)f Ft(j)5 b Fv(.)37 b(The)28 b(con)n(tin)n(uit)n(y)f(of)h Ft(\033)s Fv(\()p Ft(T)2870 2729 y Fp(\()p Fn(j)s Fp(\))2975 2759 y Fv(+)18 b Ft(h)3106 2729 y Fn(B)s(R)3106 2782 y(N)6 b Fi(\000)p Fp(1)3254 2759 y Fv(\))451 2871 y(then)28 b(follo)n(ws)f(from)g(the)h(con)n(tin)n(uit)n(y)f(of)h Ft(\033)s Fv(\()p Ft(T)1882 2841 y Fp(\()p Fn(j)s Fp(\))1968 2871 y Fv(\))g(in)g(the)g(same)f(w)n(a)n(y)g(as)f(for)i Ft(N)j Fv(=)23 b(2)p Ft(:)451 2973 y Fv(In)30 b(the)g(case)f Ft(j)j Fv(=)27 b(0)i(where)g Ft(C)1410 2985 y Fp(2)p Fn(j)1509 2973 y Fv(con)n(tains)g Ft(N)38 b Fv(electrons,)30 b(the)g(total)g(momen)n(tum)g Fk(p)3152 2985 y Fp(0)3219 2973 y Fv(of)451 3132 y Ft(C)510 3144 y Fp(2)p Fn(j)603 3132 y Fv(is)24 b(w)n(ell-de\014ned)g(and)g(comm)n(utes)g(with)h(its)g (Hamiltonian)f Ft(h)2500 3144 y Fp(0)2560 3132 y Fv(:=)f Ft(T)g Fv(+)2887 3053 y Fn(N)2872 3070 y Fm(P)2820 3207 y Fn(k)q(>l)p Fp(=1)3027 3132 y Ft(v)3070 3102 y Fp(\()p Fn(k)q(l)p Fp(\))3221 3132 y Fv(=)451 3285 y Ft(T)29 b Fv(+)18 b Ft(a)656 3297 y Fp(0)693 3285 y Ft(:)50 b Fv(This)28 b(follo)n(ws)e(from)h(the)h(absence)e(of)i(an)n(y)e(cen)n (tral)h(p)r(oten)n(tial)g(in)h Ft(h)2892 3297 y Fp(0)2956 3285 y Fv(and)f(from)451 3385 y(the)h(symmetry)f(of)h Ft(v)1120 3355 y Fp(\()p Fn(k)q(l)p Fp(\))1234 3385 y Ft(;)451 3607 y Fv([\()p Fq(\000)p Ft(i)p Fq(r)669 3619 y Fd(x)709 3628 y Fj(k)739 3607 y Fq(\000)t Ft(i)p Fq(r)906 3619 y Fd(x)946 3628 y Fj(l)974 3607 y Fv(\))p Ft(;)1176 3551 y Fv(1)p 1053 3588 288 4 v 1053 3664 a Fq(j)p Fk(x)1126 3676 y Fn(k)1172 3664 y Fq(\000)5 b Fk(x)1292 3676 y Fn(l)1317 3664 y Fq(j)1350 3607 y Fv(])p Ft( )s Fv(\()p Fk(x)p Fv(\))24 b(=)f(\()p Fq(\000)p Ft(i)p Fq(r)1851 3619 y Fd(x)1891 3628 y Fj(k)1921 3607 y Fq(\000)t Ft(i)p Fq(r)2088 3619 y Fd(x)2128 3628 y Fj(l)2156 3607 y Fv(\)\()2353 3551 y(1)p 2230 3588 V 2230 3664 a Fq(j)p Fk(x)2303 3676 y Fn(k)2349 3664 y Fq(\000)5 b Fk(x)2469 3676 y Fn(l)2494 3664 y Fq(j)2527 3607 y Fv(\))24 b Ft( )s Fv(\()p Fk(x)p Fv(\))g(=)e(0)t Fq(\001)t Ft( )s Fv(\()p Fk(x)p Fv(\))j(=)d(0)p Ft(:)3074 3755 y Fv(\(1.24\))451 3855 y(Th)n(us)f(the)h(eigenfunctions) g(to)f Ft(h)1472 3867 y Fp(0)1531 3855 y Fv(can)g(b)r(e)g(c)n(hosen)g (as)g(eigenfunctions)g(of)h Fk(p)2817 3867 y Fp(0)2854 3855 y Fv(.)35 b(F)-7 b(or)21 b Ft(p)3097 3867 y Fp(0)3157 3855 y Fq(\025)h Fv(0)451 3954 y(the)27 b(asso)r(ciated)f(cen)n(ter)g (of)g(mass)g(energy)f(of)i Ft(C)1947 3966 y Fp(2)p Fn(j)2042 3954 y Fv(is)g(con)n(tin)n(uous.)35 b(Therefore,)26 b(inf)21 b Ft(\033)s Fv(\()p Ft(h)3216 3966 y Fp(0)3254 3954 y Fv(\))451 4054 y(is)28 b(attained)f(for)g Ft(p)1031 4066 y Fp(0)1091 4054 y Fv(=)c(0)k(and)h Ft(\033)s Fv(\()p Ft(h)1540 4066 y Fp(0)1577 4054 y Fv(\))g(is)g(con)n(tin)n(uous.)451 4156 y(Let)22 b Ft(\025)h Fq(2)h Fv([\006)827 4168 y Fp(0)864 4156 y Ft(;)14 b Fq(1)p Fv(\))p Ft(:)44 b Fv(W)-7 b(e)22 b(ha)n(v)n(e)e(\006)1465 4168 y Fp(0)1526 4156 y Fv(=)i(inf)f Ft(\033)s Fv(\()p Ft(T)d Fv(+)6 b Ft(a)1992 4168 y Fn(j)2026 4156 y Fv(\))21 b(for)g(a)g(sp)r(eci\014c)h Ft(j)28 b Fq(2)23 b(f)p Fv(0)p Ft(;)14 b(:::;)g(N)9 b Fq(g)p Ft(:)43 b Fv(Then)451 4255 y Ft(\025)27 b Fq(2)g Ft(\033)s Fv(\()p Ft(T)k Fv(+)20 b Ft(a)899 4267 y Fn(j)934 4255 y Fv(\),)30 b(i.e.)43 b(there)30 b(exists)f(a)g(de\014ning)h (sequence)f Ft(')2401 4267 y Fn(n)2446 4255 y Fv(\()p Fk(x)p Fv(\))f Fq(2)e Ft(C)2734 4225 y Fi(1)2728 4276 y Fp(0)2805 4255 y Fv(\()p Fo(R)2891 4225 y Fp(3)p Fn(N)2993 4255 y Fv(\))20 b Fq(\012)g Fo(C)3184 4225 y Fp(2)p Fn(N)451 4355 y Fv(with)28 b Fq(k)p Ft(')736 4367 y Fn(n)781 4355 y Fq(k)23 b Fv(=)g(1)k(and)g Fq(k)p Fv(\()p Ft(T)i Fv(+)18 b Ft(a)1443 4367 y Fn(j)1497 4355 y Fq(\000)g Ft(\025)p Fv(\))24 b Ft(')1738 4367 y Fn(n)1783 4355 y Fq(k)36 b(!)24 b Fv(0)j(for)g Ft(n)c Fq(!)g(1)p Ft(:)451 4457 y Fv(Assume)40 b(that)g Ft(l)i Fv(electrons)d(b)r(elong)g(to)h(cluster) g Ft(C)2120 4469 y Fp(2)p Fn(j)2228 4457 y Fv(whic)n(h)g(w)n(e)g(will)g (en)n(umerate)f(b)n(y)451 4557 y Ft(N)28 b Fq(\000)19 b Ft(l)i Fv(+)e(1)p Ft(;)14 b(:::;)g(N)t(;)29 b Fv(and)g(follo)n(w)f ([10)o(])h(to)g(de\014ne)g(the)h(unitary)e(translation)g(op)r(erator)f Ft(T)3220 4569 y Fd(a)451 4656 y Fv(b)n(y)g(means)h(of)696 4843 y Ft(T)745 4855 y Fd(a)808 4843 y Ft( )s Fv(\()p Fk(x)947 4855 y Fp(1)985 4843 y Ft(;)14 b(:::;)g Fk(x)1178 4855 y Fn(N)1241 4843 y Fv(\))47 b(=)f Ft( )s Fv(\()p Fk(x)1570 4855 y Fp(1)1608 4843 y Ft(;)14 b(:::;)g Fk(x)1801 4855 y Fn(N)6 b Fi(\000)p Fn(l)1937 4843 y Ft(;)14 b Fk(x)2024 4855 y Fn(N)6 b Fi(\000)p Fn(l)p Fp(+1)2263 4843 y Fq(\000)18 b Fk(a)p Ft(;)c(:::;)g Fk(x)2585 4855 y Fn(N)2667 4843 y Fq(\000)k Fk(a)p Fv(\))246 b(\(1.25\))451 5031 y(with)29 b Fq(j)p Fk(a)p Fq(j)24 b Fv(=)g Ft(a)k Fv(and)g(let)h Fk(a)1247 5043 y Fn(l)1297 5031 y Fv(:=)23 b(\()p Fk(a)p Ft(;)14 b(:::;)g Fk(a)p Fv(\))26 b Fq(2)e Fo(R)1866 5000 y Fp(3)p Fn(l)1931 5031 y Ft(:)52 b Fv(Hence)28 b(cluster)g Ft(C)2581 5043 y Fp(2)p Fn(j)2678 5031 y Fv(mo)n(v)n(es)e(to)j(in\014nit)n(y)451 5130 y(as)e Ft(a)c Fq(!)g(1)p Ft(:)1108 5338 y Fw(Document)l(a)i(Ma)l(thema)l(tica)h(10)f (\(2005\))g(497{525)p eop %%Page: 505 9 505 8 bop 1301 518 a Ft(N)9 b Fs(-Electr)n(on)31 b(HVZ)f(Theorem)726 b Fv(505)451 729 y(Let)31 b Ft( )660 686 y Fp(\()p Fn(a)p Fp(\))657 738 y Fn(n)781 729 y Fv(:=)d Ft(T)946 741 y Fd(a)986 729 y Ft(')1040 741 y Fn(n)1116 729 y Fv(and)j Fq(A)p Ft( )1404 686 y Fp(\()p Fn(a)p Fp(\))1401 738 y Fn(n)1527 729 y Fv(b)r(e)g(the)g(an)n(tisymmetric)g(function)g (constructed)f(from)451 840 y Ft( )508 797 y Fp(\()p Fn(a)p Fp(\))505 850 y Fn(n)600 840 y Ft(:)86 b Fv(W)-7 b(e)42 b(claim)e(that)h Fq(A)p Ft( )1416 797 y Fp(\()p Fn(a)p Fp(\))1413 850 y Fn(n)1550 840 y Fv(is)f(a)h(de\014ning)g (sequence)f(for)g Ft(\025)46 b Fq(2)f Ft(\033)s Fv(\()p Ft(h)2877 810 y Fn(B)s(R)2985 840 y Fv(\))p Ft(:)87 b Fv(It)41 b(is)451 956 y(su\016cien)n(t)f(\(as)f(sho)n(wn)g(b)r(elo)n (w\))h(to)f(pro)n(v)n(e)f(that)i Ft( )2100 913 y Fp(\()p Fn(a)p Fp(\))2097 965 y Fn(n)2232 956 y Fv(has)f(this)h(prop)r(ert)n(y) -7 b(.)72 b(W)-7 b(e)40 b(ha)n(v)n(e)451 1071 y(trivially)29 b Fq(k)p Ft( )866 1028 y Fp(\()p Fn(a)p Fp(\))863 1081 y Fn(n)957 1071 y Fq(k)39 b Fv(=)26 b Fq(k)p Ft(')1225 1083 y Fn(n)1270 1071 y Fq(k)54 b Fv(and)29 b(w)n(e)g(ha)n(v)n(e)f(to)h (sho)n(w)f(that)i Fq(k)p Fv(\()p Ft(h)2460 1041 y Fn(B)s(R)2586 1071 y Fq(\000)19 b Ft(\025)p Fv(\))14 b Ft( )2821 1028 y Fp(\()p Fn(a)p Fp(\))2818 1081 y Fn(n)2914 1071 y Fq(k)25 b(!)h Fv(0)54 b(for)451 1171 y Ft(n)23 b Fq(!)g(1)28 b Fv(and)f(a)g(suitably)h(large)e Ft(a)p Fv(.)37 b(W)-7 b(e)28 b(ha)n(v)n(e)767 1334 y Fq(k)p Fv(\()p Ft(h)889 1300 y Fn(B)s(R)1015 1334 y Fq(\000)18 b Ft(\025)p Fv(\))24 b Ft( )1259 1300 y Fp(\()p Fn(a)p Fp(\))1256 1354 y Fn(n)1351 1334 y Fq(k)45 b(\024)h(k)p Fv(\()p Ft(T)29 b Fv(+)18 b Ft(a)1828 1346 y Fn(j)1882 1334 y Fq(\000)g Ft(\025)p Fv(\))24 b Ft( )2126 1300 y Fp(\()p Fn(a)p Fp(\))2123 1354 y Fn(n)2218 1334 y Fq(k)41 b Fv(+)g Fq(k)p Ft(r)2486 1346 y Fn(j)2544 1334 y Ft( )2601 1300 y Fp(\()p Fn(a)p Fp(\))2598 1354 y Fn(n)2693 1334 y Fq(k)p Ft(:)316 b Fv(\(1.26\))451 1496 y Ft(T)51 b Fv(comm)n(utes)39 b(with)h Ft(T)1203 1508 y Fd(a)1283 1496 y Fv(b)r(ecause)f Ft(T)50 b Fv(is)40 b(a)f(m)n(ultiplication)g(op)r(erator)f(in)i(momen)n(tum)451 1596 y(space.)68 b(Since)38 b(the)g(cen)n(tral)f(p)r(oten)n(tials)h (con)n(tained)f(in)h Ft(a)2333 1608 y Fn(j)2406 1596 y Fv(are)f(not)h(a\013ected)g(b)n(y)g Ft(T)3205 1608 y Fd(a)451 1696 y Fv(\(b)r(ecause)33 b Ft(T)845 1708 y Fd(a)918 1696 y Fv(do)r(es)g(not)g(act)g(on)f(the)i(particle)e(co)r (ordinates)g(of)h(cluster)f Ft(C)2861 1708 y Fp(1)p Fn(j)2930 1696 y Fv(\),)i(w)n(e)f(also)451 1795 y(ha)n(v)n(e)d([)p Ft(T)718 1807 y Fd(a)758 1795 y Ft(;)14 b(a)839 1807 y Fn(j)874 1795 y Fv(])28 b(=)g(0)p Ft(:)58 b Fv(In)31 b(fact,)h(assuming)d(e.g.)46 b(that)31 b(electrons)f Ft(k)j Fv(and)e Ft(l)h Fv(are)d(in)i(cluster)451 1895 y Ft(C)510 1907 y Fp(2)p Fn(j)613 1895 y Fv(and)j(using)g(the)g (represen)n(tation)f(\(1.3\))h(for)f Ft(v)2085 1865 y Fp(\()p Fn(k)q(l)p Fp(\))2234 1895 y Fv(w)n(e)h(ha)n(v)n(e)f(with)h Ft(T)2817 1865 y Fi(\003)2805 1916 y Fd(a)2854 1895 y Ft(T)2903 1907 y Fd(a)2978 1895 y Fv(=)f(1)h(and)451 2003 y Ft(B)514 2015 y Fn(k)555 2003 y Ft(;)612 1983 y Fv(~)592 2003 y Ft(B)655 2015 y Fn(k)719 2003 y Fq(2)23 b(f)p Ft(A)901 2015 y Fn(k)942 2003 y Ft(;)14 b(G)1044 2015 y Fn(k)1085 2003 y Fq(g)p Ft(;)833 2205 y(T)894 2171 y Fi(\003)882 2226 y Fd(a)931 2205 y Ft(B)994 2217 y Fn(k)1054 2184 y Fv(~)1035 2205 y Ft(B)1098 2217 y Fn(l)1293 2149 y Fv(1)p 1156 2186 315 4 v 1156 2262 a Fq(j)p Fk(x)1229 2274 y Fn(k)1289 2262 y Fq(\000)k Fk(x)1422 2274 y Fn(l)1448 2262 y Fq(j)1504 2205 y Ft(B)1567 2217 y Fn(k)1628 2184 y Fv(~)1608 2205 y Ft(B)1671 2217 y Fn(l)1710 2205 y Ft(T)1759 2217 y Fd(a)1845 2205 y Fv(=)46 b Ft(B)2019 2217 y Fn(k)2080 2184 y Fv(~)2060 2205 y Ft(B)2123 2217 y Fn(l)2148 2205 y Ft(T)2209 2171 y Fi(\003)2197 2226 y Fd(a)2407 2149 y Fv(1)p 2270 2186 V 2270 2262 a Fq(j)p Fk(x)2343 2274 y Fn(k)2403 2262 y Fq(\000)18 b Fk(x)2536 2274 y Fn(l)2562 2262 y Fq(j)2609 2205 y Ft(T)2658 2217 y Fd(a)2712 2205 y Ft(B)2775 2217 y Fn(k)2836 2184 y Fv(~)2816 2205 y Ft(B)2879 2217 y Fn(l)702 2464 y Fv(=)45 b Ft(B)875 2476 y Fn(k)936 2443 y Fv(~)916 2464 y Ft(B)979 2476 y Fn(l)1345 2408 y Fv(1)p 1028 2445 676 4 v 1028 2521 a Fq(j)p Fk(x)1101 2533 y Fn(k)1161 2521 y Fv(+)18 b Fk(a)h Fq(\000)f Fv(\()p Fk(x)1474 2533 y Fn(l)1519 2521 y Fv(+)g Fk(a)p Fv(\))p Fq(j)1727 2464 y Ft(B)1790 2476 y Fn(k)1851 2443 y Fv(~)1831 2464 y Ft(B)1894 2476 y Fn(l)1966 2464 y Fv(=)45 b Ft(B)2139 2476 y Fn(k)2200 2443 y Fv(~)2180 2464 y Ft(B)2243 2476 y Fn(l)2429 2408 y Fv(1)p 2292 2445 315 4 v 2292 2521 a Fq(j)p Fk(x)2365 2533 y Fn(k)2425 2521 y Fq(\000)18 b Fk(x)2558 2533 y Fn(l)2584 2521 y Fq(j)2631 2464 y Ft(B)2694 2476 y Fn(k)2754 2443 y Fv(~)2735 2464 y Ft(B)2798 2476 y Fn(l)3074 2464 y Fv(\(1.27\))451 2662 y(suc)n(h)j(that)f([)p Ft(T)876 2674 y Fd(a)917 2662 y Ft(;)14 b(v)997 2632 y Fp(\()p Fn(k)q(l)p Fp(\))1111 2662 y Fv(])23 b(=)g(0)p Ft(:)d Fv(Then,)i(giv)n(en)e(some)g Ft(\017)j(>)g Fv(0)p Ft(;)d Fv(the)h(\014rst)f(term)h(of)g(\(1.26\))f(reduces)451 2761 y(to)451 2924 y Fq(k)p Fv(\()p Ft(T)f Fv(+)8 b Ft(a)710 2936 y Fn(j)753 2924 y Fq(\000)g Ft(\025)p Fv(\))24 b Ft(T)979 2936 y Fd(a)1019 2924 y Ft(')1073 2936 y Fn(n)1119 2924 y Fq(k)45 b Fv(=)h Fq(k)p Ft(T)1408 2936 y Fd(a)1462 2924 y Fv(\()p Ft(T)19 b Fv(+)8 b Ft(a)1679 2936 y Fn(j)1723 2924 y Fq(\000)g Ft(\025)p Fv(\))23 b Ft(')1953 2936 y Fn(n)1999 2924 y Fq(k)45 b(\024)h(k)p Ft(T)2288 2936 y Fd(a)2328 2924 y Fq(k)22 b(k)p Fv(\()p Ft(T)e Fv(+)8 b Ft(a)2652 2936 y Fn(j)2695 2924 y Fq(\000)g Ft(\025)p Fv(\))23 b Ft(')2925 2936 y Fn(n)2971 2924 y Fq(k)45 b Ft(<)h(\017=)p Fv(2)3074 3024 y(\(1.28\))451 3123 y(if)28 b Ft(n)23 b(>)g(N)755 3135 y Fp(0)819 3123 y Fv(for)28 b Ft(N)1014 3135 y Fp(0)1078 3123 y Fv(su\016cien)n(tly)g(large.)451 3234 y(F)-7 b(or)20 b(the)i(second)e(term)g(in)h(\(1.26\))f(w)n(e)h (note)g(that)g Ft(r)2009 3246 y Fn(j)2065 3234 y Fv(consists)f(of)h (terms)f Ft(b)2712 3191 y Fp(\()p Fn(k)q Fp(\))2712 3257 y(1)p Fn(m)2829 3234 y Fv(with)h Ft(k)35 b(=)-51 b Fq(2)23 b Ft(C)3217 3246 y Fp(1)p Fn(j)451 3345 y Fv(and)31 b(terms)f Ft(v)893 3315 y Fp(\()p Fn(k)q(k)991 3290 y Fg(0)1015 3315 y Fp(\))1075 3345 y Fv(with)h Ft(k)g Fq(2)d Ft(C)1483 3357 y Fn(i)1511 3345 y Ft(;)70 b(k)1650 3315 y Fi(0)1701 3345 y Fq(2)28 b Ft(C)1843 3357 y Fn(i)1866 3341 y Fg(0)1894 3345 y Ft(;)69 b(i)28 b Fq(6)p Fv(=)f Ft(i)2164 3315 y Fi(0)2187 3345 y Ft(:)59 b Fv(Moreo)n(v)n(er,)28 b(since)i Ft(a)2910 3357 y Fn(j)2976 3345 y Fv(do)r(es)g(not)451 3463 y(con)n(tain)18 b(an)n(y)h(in)n(tercluster)f(in)n(teractions,)h(w) n(e)g(can)g(c)n(ho)r(ose)e Ft(')2344 3475 y Fn(n)2413 3463 y Fv(=)23 b Ft(')2555 3420 y Fp(\()p Fn(n)p Fp(\))2555 3486 y(1)2653 3463 y Fq(\001)q Ft(')2731 3420 y Fp(\()p Fn(n)p Fp(\))2731 3486 y(2)2848 3463 y Fv(as)18 b(a)h(pro)r(duct)451 3581 y(of)30 b(functions)h(\()p Ft(')995 3537 y Fp(\()p Fn(n)p Fp(\))995 3603 y(1)1120 3581 y Fq(2)d Ft(C)1268 3550 y Fi(1)1262 3601 y Fp(0)1339 3581 y Fv(\()p Fo(R)1425 3550 y Fp(3\()p Fn(N)6 b Fi(\000)p Fn(l)p Fp(\))1672 3581 y Fq(\012)20 b Fo(C)1811 3550 y Fp(2\()p Fn(N)6 b Fi(\000)p Fn(l)p Fp(\))2038 3581 y Fv(\))p Ft(;)42 b(')2189 3537 y Fp(\()p Fn(n)p Fp(\))2189 3603 y(2)2314 3581 y Fq(2)28 b Ft(C)2462 3550 y Fi(1)2456 3601 y Fp(0)2533 3581 y Fv(\()p Fo(R)2619 3550 y Fp(3)p Fn(l)2704 3581 y Fq(\012)19 b Fo(C)2842 3550 y Fp(2)p Fn(l)2907 3581 y Fv(\)\))58 b(eac)n(h)30 b(of)451 3698 y(whic)n(h)h(describing)g(the)g (electrons)f(in)i(cluster)f Ft(C)2017 3710 y Fp(1)p Fn(j)2116 3698 y Fv(resp)r(ectiv)n(e)g Ft(C)2565 3710 y Fp(2)p Fn(j)2633 3698 y Fv(.)48 b(Let)31 b(supp)14 b Ft(')3095 3655 y Fp(\()p Fn(n)p Fp(\))3095 3721 y Fn(i)3221 3698 y Fq(\032)451 3797 y Ft(B)514 3809 y Fn(R)564 3817 y Fj(i)595 3797 y Fv(\(0\))27 b(for)g(a)h(suitable)f Ft(R)1297 3809 y Fn(i)1325 3797 y Ft(:)451 3913 y Fv(Consider)k Fq(k)p Ft(b)880 3870 y Fp(\()p Fn(k)q Fp(\))880 3935 y(1)p Fn(m)976 3913 y Ft( )1033 3870 y Fp(\()p Fn(a)p Fp(\))1030 3923 y Fn(n)1125 3913 y Fq(k)h Fv(with)g Ft(k)i Fq(2)d Ft(C)1614 3925 y Fp(2)p Fn(j)1683 3913 y Fv(.)50 b(W)-7 b(e)33 b(ha)n(v)n(e)e(supp)14 b Ft(T)2334 3925 y Fd(a)2374 3913 y Ft(')2428 3870 y Fp(\()p Fn(n)p Fp(\))2428 3935 y(2)2556 3913 y Fq(\032)31 b Ft(B)2715 3925 y Fn(R)2765 3933 y Ff(2)2801 3913 y Fv(\()p Fk(a)2879 3925 y Fn(l)2906 3913 y Fv(\))p Ft(:)h Fv(Let)h Ft(a)d(>)451 4032 y Fv(2)p Ft(R)556 4044 y Fp(2)593 4032 y Ft(:)43 b Fv(F)-7 b(or)19 b(all)g Ft(k)953 4002 y Fi(0)1000 4032 y Fq(2)k Ft(C)1137 4044 y Fp(2)p Fn(j)1205 4032 y Ft(;)d Fv(on)g(the)g(supp)r(ort)f(of)h Ft(T)1926 4044 y Fd(a)1966 4032 y Ft(')2020 3989 y Fp(\()p Fn(n)p Fp(\))2020 4054 y(2)2138 4032 y Fv(w)n(e)f(ha)n(v)n(e)g Ft(R)2499 4044 y Fp(2)2559 4032 y Ft(>)36 b Fq(j)p Fk(x)2733 4044 y Fn(k)2769 4028 y Fg(0)2800 4032 y Fq(\000)s Fk(a)p Fq(j)h(\025)22 b Ft(a)s Fq(\000)s Ft(x)3223 4044 y Fn(k)3259 4028 y Fg(0)451 4151 y Fv(and)e(th)n(us)f Ft(x)826 4163 y Fn(k)862 4147 y Fg(0)913 4151 y Ft(>)k(a)r Fq(\000)r Ft(R)1177 4163 y Fp(2)1214 4151 y Ft(:)43 b Fv(Therefore)18 b(w)n(e)h(can)g(write)g(supp)14 b Ft(T)2344 4163 y Fd(a)2385 4151 y Ft(')2439 4108 y Fp(\()p Fn(n)p Fp(\))2439 4173 y(2)2559 4151 y Fq(\032)23 b Fo(R)2701 4121 y Fp(3)p Fn(l)2765 4151 y Fq(n)p Ft(B)2870 4166 y Fi(j)p Fd(a)2927 4175 y Fj(l)2950 4166 y Fi(j\000)p Fn(R)3072 4174 y Ff(2)3108 4151 y Fv(\(0\))16 b Fq(\\)451 4250 y(f)p Ft(x)540 4262 y Fn(k)576 4246 y Fg(0)627 4250 y Ft(>)22 b(a)c Fq(\000)g Ft(R)922 4262 y Fp(2)997 4250 y Fq(8)k Ft(k)1112 4220 y Fi(0)1158 4250 y Fq(2)h Ft(C)1295 4262 y Fp(2)p Fn(j)1364 4250 y Fq(g)p Ft(:)50 b Fv(Assume)28 b(w)n(e)f(can)g(pro)n(v)n(e)451 4400 y Fs(Lemma)39 b Fv(5)p Fs(.)45 b Fh(L)l(et)36 b Ft(')f Fq(2)g Ft(C)1276 4370 y Fi(1)1270 4421 y Fp(0)1347 4400 y Fv(\(\012\))24 b Fq(\012)e Fo(C)1636 4370 y Fp(2)q Fn(l)1737 4400 y Fh(with)37 b Fv(\012)e(:=)g Fq(f)p Fk(x)g Fv(=)f(\()p Fk(x)2450 4412 y Fp(1)2488 4400 y Ft(;)14 b(:::;)g Fk(x)2681 4412 y Fn(l)2707 4400 y Fv(\))35 b Fq(2)h Fo(R)2919 4370 y Fp(3)p Fn(l)3018 4400 y Fv(:)70 b Ft(x)3158 4412 y Fn(i)3221 4400 y Ft(>)451 4500 y(R)38 b Fq(8)22 b Ft(i)h Fv(=)f(1)p Ft(;)14 b(:::;)g(l)r Fq(g)28 b Fh(and)j Ft(R)23 b(>)g Fv(1)p Ft(:)52 b Fh(Then)31 b(for)f Ft(k)c Fq(2)e(f)p Fv(1)p Ft(;)14 b(:::;)g(l)r Fq(g)27 b Fh(and)k(some)f(c)l(onstant)f Ft(c)p Fh(,)1515 4684 y Fq(k)p Ft(b)1593 4641 y Fp(\()p Fn(k)q Fp(\))1593 4706 y(1)p Fn(m)1702 4684 y Ft(')p Fq(k)46 b(\024)1979 4628 y Ft(c)p 1965 4665 64 4 v 1965 4741 a(R)2062 4684 y Fq(k)p Ft(')p Fq(k)p Ft(:)851 b Fv(\(1.29\))451 4899 y(Since)28 b Ft(b)704 4856 y Fp(\()p Fn(k)q Fp(\))704 4921 y(1)p Fn(m)827 4899 y Fv(acts)g(only)f(on)g Ft(T)1345 4911 y Fd(a)1385 4899 y Ft(')1439 4856 y Fp(\()p Fn(n)p Fp(\))1439 4921 y(2)1564 4899 y Fv(w)n(e)h(obtain)607 5102 y Fq(k)p Ft(b)685 5059 y Fp(\()p Fn(k)q Fp(\))685 5124 y(1)p Fn(m)804 5102 y Ft(T)853 5114 y Fd(a)893 5102 y Ft(')947 5114 y Fn(n)992 5102 y Fq(k)37 b Fv(=)f Fq(k)p Ft(')1268 5059 y Fp(\()p Fn(n)p Fp(\))1268 5124 y(1)1365 5102 y Fq(k)23 b(k)p Ft(b)1508 5059 y Fp(\()p Fn(k)q Fp(\))1508 5124 y(1)p Fn(m)1617 5102 y Ft(T)1666 5114 y Fd(a)1706 5102 y Ft(')1760 5059 y Fp(\()p Fn(n)p Fp(\))1760 5124 y(2)1857 5102 y Fq(k)46 b(\024)2171 5046 y Ft(c)p 2066 5083 246 4 v 2066 5159 a(a)18 b Fq(\000)g Ft(R)2274 5171 y Fp(2)2344 5102 y Fq(k)p Ft(T)2435 5114 y Fd(a)2489 5102 y Ft(')2543 5059 y Fp(\()p Fn(n)p Fp(\))2543 5124 y(2)2640 5102 y Fq(k)37 b Ft(<)2830 5046 y Fv(2)p Ft(c)p 2830 5083 78 4 v 2847 5159 a(a)3074 5102 y Fv(\(1.30\))1108 5338 y Fw(Document)l(a)25 b(Ma)l(thema)l(tica)h(10)f(\(2005\))g (497{525)p eop %%Page: 506 10 506 9 bop 451 518 a Fv(506)727 b Fs(D.)30 b(H.)h(Jakubassa-Amundsen)451 729 y Fv(b)r(ecause)d(the)g Ft(')956 686 y Fp(\()p Fn(n)p Fp(\))956 752 y Fn(i)1081 729 y Fv(are)f(normalized.)36 b(As)28 b(a)f(consequence,)g(for)g(an)n(y)g Ft(k)g Fq(2)c Ft(C)2852 741 y Fp(2)p Fn(j)2921 729 y Ft(;)28 b Fv(the)g(l.h.s.)451 828 y(of)g(\(1.30\))f(can)g(b)r(e)h(made)f(smaller)g(than)h Ft(\017=)p Fv(4)p Ft(l)f Fv(for)g(su\016cien)n(tly)h(large)e Ft(a)p Fv(.)451 946 y(F)-7 b(or)36 b(the)i(pro)r(of)e(of)h(Lemma)f(5)h (or,)h(equiv)-5 b(alen)n(tly)e(,)39 b(of)e Fq(j)p Fv(\()p Ft(\036;)14 b(b)2382 903 y Fp(\()p Fn(k)q Fp(\))2382 969 y(1)p Fn(m)2478 946 y Ft(')p Fv(\))p Fq(j)53 b(\024)2764 914 y Fn(c)p 2753 928 51 4 v 2753 975 a(R)2827 946 y Fq(k)p Ft(')p Fq(k)14 b(k)p Ft(\036)p Fq(k)74 b Fv(for)451 1046 y(all)33 b Ft(\036)h Fq(2)f Fv(\()p Ft(C)840 1016 y Fi(1)834 1067 y Fp(0)911 1046 y Fv(\()p Fo(R)997 1016 y Fp(3)1040 1046 y Fv(\))23 b Fq(\012)f Fo(C)1236 1016 y Fp(2)1279 1046 y Fv(\))1311 1016 y Fn(l)1337 1046 y Ft(;)67 b Fv(w)n(e)33 b(note)g(that)h(the)g(basic)f(di\013erence)g(to)h (the)g(resp)r(ectiv)n(e)451 1146 y(assertion)27 b(for)h Ft(N)34 b Fv(=)24 b(2)k(lies)h(in)g(the)g(p)r(ossible)f(m)n (ultiparticle)g(nature)g(of)h Ft(\036)g Fv(and)f Ft(')p Fv(.)41 b(Ho)n(w-)451 1245 y(ev)n(er,)f(the)f(prop)r(ert)n(y)e(of)i (the)g(domain)f(\012)g(of)g Ft(')h Fv(allo)n(ws)e(for)h(the)h(in)n(tro) r(duction)f(of)h(the)451 1345 y(\(single-particle\))27 b(smo)r(oth)g(auxiliary)f(function)j(\(mapping)e(to)h([0)p Ft(;)14 b Fv(1]\),)1334 1582 y Ft(\037)p Fv(\()1428 1526 y Fk(x)1478 1538 y Fn(k)p 1428 1563 92 4 v 1442 1639 a Ft(R)1529 1582 y Fv(\))23 b(:=)1718 1465 y Fm(\032)1822 1531 y Fv(0)p Ft(;)82 b(x)2016 1543 y Fn(k)2081 1531 y Ft(<)22 b(R)q(=)p Fv(2)1822 1631 y(1)p Ft(;)124 b(x)2058 1643 y Fn(k)2122 1631 y Fq(\025)23 b Ft(R)2380 1582 y(;)671 b Fv(\(1.31\))451 1814 y(suc)n(h)27 b(that)h Ft('\037)c Fv(=)e Ft(':)51 b Fv(Then)28 b(the)g(pro)r(of)f(can)g(b)r(e)h(copied)g (from)f(the)h(t)n(w)n(o-electron)e(case.)451 1916 y(F)-7 b(or)27 b(the)h(t)n(w)n(o-particle)e(in)n(teraction)h(con)n(tained)g (in)g Ft(r)2127 1928 y Fn(j)2163 1916 y Ft(;)h Fv(one)f(has)451 2108 y Fs(Lemma)40 b Fv(6)p Fs(.)45 b Fh(L)l(et)37 b Ft( )1091 2065 y Fp(\()p Fn(a)p Fp(\))1088 2118 y Fn(n)1233 2108 y Fv(=)e Ft(T)1382 2120 y Fd(a)1423 2108 y Ft(')1477 2120 y Fn(n)1572 2108 y Fv(=)h Ft(T)1722 2120 y Fd(a)1776 2108 y Ft(')1830 2065 y Fp(\()p Fn(n)p Fp(\))1830 2130 y(1)1927 2108 y Ft(')1981 2065 y Fp(\()p Fn(n)p Fp(\))1981 2130 y(2)2152 2108 y Fh(as)h(de\014ne)l(d)h(ab)l(ove.)61 b(Then)38 b(for)g(al)t(l)451 2208 y Ft(')24 b Fq(2)f Fv(\()p Ft(C)704 2178 y Fi(1)698 2228 y Fp(0)775 2208 y Fv(\()p Fo(R)861 2178 y Fp(3)904 2208 y Fv(\))c Fq(\012)f Fo(C)1092 2178 y Fp(2)1135 2208 y Fv(\))1167 2178 y Fn(N)1260 2208 y Fh(and)31 b Ft(a)22 b(>)h Fv(4)p Ft(R)q(;)1174 2416 y Fq(j)p Fv(\()p Ft(';)14 b(v)1363 2382 y Fp(\()p Fn(k)q(k)1461 2357 y Fg(0)1486 2382 y Fp(\))1516 2416 y Ft( )1573 2382 y Fp(\()p Fn(a)p Fp(\))1570 2437 y Fn(n)1665 2416 y Fv(\))p Fq(j)46 b(\024)1976 2360 y Ft(c)2012 2372 y Fp(0)p 1887 2397 251 4 v 1887 2473 a Ft(a)18 b Fq(\000)g Fv(2)p Ft(R)2170 2416 y Fq(k)p Ft(')p Fq(k)23 b(k)p Ft( )2430 2382 y Fp(\()p Fn(a)p Fp(\))2427 2437 y Fn(n)2521 2416 y Fq(k)511 b Fv(\(1.32\))451 2639 y Fh(with)37 b(some)f(p)l(ositive)h (c)l(onstants)e Ft(c)1568 2651 y Fp(0)1641 2639 y Fh(and)i Ft(R)q Fh(,)g(pr)l(ovide)l(d)h(p)l(articles)f Ft(k)i Fh(and)d Ft(k)2900 2608 y Fi(0)2959 2639 y Fh(b)l(elong)h(to)451 2738 y(two)30 b(di\013er)l(ent)g(clusters.)451 2911 y Fv(F)-7 b(or)41 b(the)g(pro)r(of)g(of)g(Lemma)g(6,)j(w)n(e)d(need)g (again)f(a)h(suitable)g(auxiliary)f(function)i Ft(\037:)451 3022 y Fv(Let)e Ft(k)658 2992 y Fi(0)723 3022 y Fq(2)j Ft(C)880 3034 y Fp(1)p Fn(j)949 3022 y Ft(;)56 b(k)45 b Fq(2)e Ft(C)1273 3034 y Fp(2)p Fn(j)1342 3022 y Ft(:)82 b Fv(W)-7 b(e)39 b(ha)n(v)n(e)f(supp)14 b Ft(')2043 2979 y Fp(\()p Fn(n)p Fp(\))2043 3044 y(1)2141 3022 y Ft(')2195 2979 y Fp(\()p Fn(n)p Fp(\))2195 3044 y(2)2335 3022 y Fq(\032)42 b Ft(B)2505 3034 y Fn(R)2555 3042 y Ff(1)2591 3022 y Fv(\(0\))27 b Fq(\002)f Ft(B)2878 3034 y Fn(R)2928 3042 y Ff(2)2964 3022 y Fv(\(0\))82 b(and)451 3141 y(supp)14 b Ft(T)685 3153 y Fd(a)725 3141 y Ft(')779 3098 y Fp(\()p Fn(n)p Fp(\))779 3163 y(1)877 3141 y Ft(')931 3098 y Fp(\()p Fn(n)p Fp(\))931 3163 y(2)1051 3141 y Fq(\032)23 b Ft(B)1202 3153 y Fn(R)1252 3161 y Ff(1)1288 3141 y Fv(\(0\))8 b Fq(\002)g Ft(B)1538 3153 y Fn(R)1588 3161 y Ff(2)1624 3141 y Fv(\()p Fk(a)1702 3153 y Fn(l)1728 3141 y Fv(\))p Ft(:)45 b Fv(Hence)23 b Ft(x)2117 3153 y Fn(k)2153 3137 y Fg(0)2204 3141 y Ft(<)f(R)2354 3153 y Fp(1)2414 3141 y Fv(and)g Ft(x)2617 3153 y Fn(k)2681 3141 y Ft(>)h(a)8 b Fq(\000)g Ft(R)2957 3153 y Fp(2)2992 3141 y Ft(:)46 b Fv(So)22 b(the)451 3241 y(in)n(ter-electron)17 b(separation)h(can)g(b)r(e)h(estimated)g(b)n(y)f Fq(j)p Fk(x)2142 3253 y Fn(k)2184 3241 y Fq(\000)q Fk(x)2300 3253 y Fn(k)2336 3236 y Fg(0)2363 3241 y Fq(j)37 b(\025)23 b Ft(x)2558 3253 y Fn(k)2600 3241 y Fq(\000)q Ft(x)2713 3253 y Fn(k)2749 3236 y Fg(0)2799 3241 y Ft(>)f(a)q Fq(\000)q Ft(R)3060 3253 y Fp(2)3097 3241 y Fq(\000)q Ft(R)3226 3253 y Fp(1)3263 3241 y Ft(:)451 3342 y Fv(Let)28 b Ft(R)c Fv(:=)e(max)p Fq(f)p Ft(R)1057 3354 y Fp(1)1094 3342 y Ft(;)14 b(R)1194 3354 y Fp(2)1231 3342 y Fq(g)27 b Fv(and)i(~)-44 b Ft(a)23 b Fv(:=)g Ft(a)18 b Fq(\000)g Fv(2)p Ft(R)q(:)50 b Fv(De\014ne)1047 3579 y Ft(\037)1099 3591 y Fn(k)q(k)1171 3575 y Fg(0)1199 3579 y Fv(\()1241 3523 y Fk(x)1291 3535 y Fn(k)1351 3523 y Fq(\000)18 b Fk(x)1484 3535 y Fn(k)1520 3519 y Fg(0)p 1241 3560 307 4 v 1373 3636 a Fv(~)-43 b Ft(a)1557 3579 y Fv(\))24 b(:=)1746 3462 y Fm(\032)1850 3529 y Fv(0)p Ft(;)83 b Fq(j)p Fk(x)2071 3541 y Fn(k)2131 3529 y Fq(\000)18 b Fk(x)2264 3541 y Fn(k)2300 3525 y Fg(0)2327 3529 y Fq(j)37 b Ft(<)24 b Fv(~)-43 b Ft(a=)p Fv(2)1850 3628 y(1)p Ft(;)124 b Fq(j)p Fk(x)2112 3640 y Fn(k)2172 3628 y Fq(\000)18 b Fk(x)2305 3640 y Fn(k)2341 3624 y Fg(0)2369 3628 y Fq(j)37 b(\025)24 b Fv(~)-44 b Ft(a)2667 3579 y(:)384 b Fv(\(1.33\))451 3841 y(Then)33 b Ft(\037)725 3853 y Fn(k)q(k)797 3837 y Fg(0)858 3841 y Fv(is)g(unit)n(y)g(on)f(the)h(supp) r(ort)g(of)g Ft( )1907 3798 y Fp(\()p Fn(a)p Fp(\))1904 3851 y Fn(n)1999 3841 y Fv(,)h(suc)n(h)e(that)h Ft(\037)2485 3853 y Fn(k)q(k)2557 3837 y Fg(0)2585 3841 y Ft( )2642 3798 y Fp(\()p Fn(a)p Fp(\))2639 3851 y Fn(n)2766 3841 y Fv(=)e Ft( )2919 3798 y Fp(\()p Fn(a)p Fp(\))2916 3851 y Fn(n)3011 3841 y Ft(:)65 b Fv(With)451 3941 y(this)25 b(function,)g(the)g(pro)r(of)e(of)i(Lemma)e(6)h(is)g(done)g(exactly)g (as)f(in)i(the)f(t)n(w)n(o-electron)f(case.)451 4042 y(Collecting)k(results,)g(w)n(e)h(obtain)f(for)g Ft(n)c(>)f(N)1865 4054 y Fp(0)1930 4042 y Fv(and)28 b Ft(a)22 b(>)h Fv(4)p Ft(R)28 b Fv(su\016cien)n(tly)g(large)1000 4264 y Fq(k)p Fv(\()p Ft(h)1122 4230 y Fn(B)s(R)1248 4264 y Fq(\000)18 b Ft(\025)p Fv(\))24 b Ft( )1492 4230 y Fp(\()p Fn(a)p Fp(\))1489 4285 y Fn(n)1584 4264 y Fq(k)45 b(\024)h(k)p Fv(\()p Ft(T)29 b Fv(+)18 b Ft(a)2061 4276 y Fn(j)2115 4264 y Fq(\000)g Ft(\025)p Fv(\))23 b Ft(')2355 4276 y Fn(n)2401 4264 y Fq(k)41 b Fv(+)g Ft(l)2649 4208 y Fv(2)p Ft(c)p 2649 4245 78 4 v 2666 4321 a(a)1485 4533 y Fv(+)1597 4512 y(~)1573 4533 y Ft(N)1682 4477 y Fv(2)p Ft(c)1760 4489 y Fp(0)p 1682 4514 115 4 v 1717 4590 a Ft(a)1829 4533 y Fq(k)p Ft( )1928 4499 y Fp(\()p Fn(a)p Fp(\))1925 4554 y Fn(n)2020 4533 y Fq(k)k Ft(<)h(\017)822 b Fv(\(1.34\))451 4732 y(where)725 4711 y(~)701 4732 y Ft(N)46 b Fv(is)38 b(the)f(total)g(n)n(um)n(b)r(er)h(of)f(t)n(w)n (o-electron)e(in)n(tercluster)i(in)n(teractions.)65 b(This)451 4831 y(pro)n(v)n(es)29 b(that)j Ft(\025)d Fq(2)g Ft(\033)s Fv(\()p Ft(h)1186 4801 y Fn(B)s(R)1294 4831 y Fv(\))p Ft(:)61 b Fv(Since)31 b Ft(\025)e Fq(2)h Fv([\006)1875 4843 y Fp(0)1912 4831 y Ft(;)14 b Fq(1)p Fv(\))31 b(w)n(as)f(c)n(hosen) h(arbitrarily)-7 b(,)30 b(w)n(e)g(there-)451 4931 y(fore)i(ha)n(v)n(e)f ([\006)899 4943 y Fp(0)936 4931 y Ft(;)14 b Fq(1)p Fv(\))31 b Fq(\032)f Ft(\033)s Fv(\()p Ft(h)1344 4901 y Fn(B)s(R)1452 4931 y Fv(\),)k(indicating)e(that)h Ft(\033)s Fv(\()p Ft(h)2248 4901 y Fn(B)s(R)2356 4931 y Fv(\))f(has)g(to)g(b)r(e)g(con)n (tin)n(uous)g(in)451 5031 y([\006)534 5043 y Fp(0)571 5031 y Ft(;)14 b Fq(1)p Fv(\))p Ft(:)80 b Fv(Consequen)n(tly)-7 b(,)41 b([\006)1454 5043 y Fp(0)1491 5031 y Ft(;)14 b Fq(1)p Fv(\))42 b Fq(\032)e Ft(\033)1837 5043 y Fn(ess)1936 5031 y Fv(\()p Ft(h)2016 5000 y Fn(B)s(R)2124 5031 y Fv(\))f(whic)n(h)f(completes)g(the)h(pro)r(of)f(of)451 5130 y(Theorem)27 b(1.)1108 5338 y Fw(Document)l(a)e(Ma)l(thema)l(tica) h(10)f(\(2005\))g(497{525)p eop %%Page: 507 11 507 10 bop 1301 518 a Ft(N)9 b Fs(-Electr)n(on)31 b(HVZ)f(Theorem)726 b Fv(507)451 725 y(W)-7 b(e)50 b(are)f(left)i(to)f(sho)n(w)f(that)h (the)g(de\014ning)g(sequence)f(for)h Ft(\025)g Fv(can)g(b)r(e)g(c)n (hosen)f(to)451 836 y(b)r(e)d(an)n(tisymmetric.)90 b(W)-7 b(e)46 b(write)f Fq(A)p Ft( )1727 793 y Fp(\()p Fn(a)p Fp(\))1724 846 y Fn(n)1886 836 y Fv(=)53 b Ft(c)2040 848 y Fp(1)2116 774 y Fm(P)2091 911 y Fn(\033)r Fi(2P)2273 836 y Fv(sign\()p Ft(\033)s Fv(\))14 b Ft( )2602 793 y Fp(\()p Fn(a)p Fp(\))2599 846 y Fn(n;\033)2751 836 y Fv(where)45 b Ft( )3066 793 y Fp(\()p Fn(a)p Fp(\))3063 846 y Fn(n;\033)3221 836 y Fv(=)451 1018 y Ft( )508 975 y Fp(\()p Fn(a)p Fp(\))505 1028 y Fn(n)600 1018 y Fv(\()p Fk(x)682 1033 y Fn(\033)r Fp(\(1\))813 1018 y Ft(;)14 b(:::;)g Fk(x)1006 1033 y Fn(\033)r Fp(\()p Fn(N)6 b Fp(\))1161 1018 y Fv(\))37 b(with)f Fq(P)42 b Fv(the)36 b(p)r(erm)n(utation)g(group)e(of)i(the)g(n)n(um)n(b)r(ers)g(1)p Ft(;)14 b(:::;)g(N)9 b Fv(,)451 1118 y(and)40 b Ft(c)661 1130 y Fp(1)738 1118 y Fv(is)f(a)g(normalization)f(constan)n(t.)73 b(Since)40 b Ft(h)2133 1088 y Fn(B)s(R)2280 1118 y Fv(is)f(symmetric)h (up)r(on)f(particle)451 1217 y(exc)n(hange)26 b(w)n(e)i(ha)n(v)n(e)454 1417 y Fq(k)p Fv(\()p Ft(h)576 1383 y Fn(B)s(R)701 1417 y Fq(\000)18 b Ft(\025)p Fv(\))24 b Fq(A)p Ft( )1011 1383 y Fp(\()p Fn(a)p Fp(\))1008 1438 y Fn(n)1103 1417 y Fq(k)46 b(\024)g Ft(c)1338 1429 y Fp(1)1397 1338 y Fm(X)1389 1516 y Fn(\033)r Fi(2P)1540 1417 y Fq(k)p Fv(\()p Ft(h)1662 1383 y Fn(B)s(R)1787 1417 y Fq(\000)18 b Ft(\025)p Fv(\))24 b Ft( )2031 1383 y Fp(\()p Fn(a)p Fp(\))2028 1438 y Fn(n;\033)2134 1417 y Fq(k)45 b Fv(=)h Ft(c)2368 1429 y Fp(1)2428 1417 y Fv(\(#)p Ft(\033)s Fv(\))24 b Fq(k)p Fv(\()p Ft(h)2757 1383 y Fn(B)s(R)2883 1417 y Fq(\000)18 b Ft(\025)p Fv(\))24 b Ft( )3127 1383 y Fp(\()p Fn(a)p Fp(\))3124 1438 y Fn(n)3219 1417 y Fq(k)p Ft(:)3074 1599 y Fv(\(1.35\))451 1699 y(By)d(\(1.34\))f(this)h(can)f(b)r(e)h (made)f(smaller)g(than)h Ft(\017)f Fv(since)h(the)g(n)n(um)n(b)r(er)f (#)p Ft(\033)25 b Fv(of)20 b(p)r(erm)n(utations)451 1799 y(is)28 b(\014nite.)451 1901 y(It)36 b(remains)f(to)g(pro)n(v)n(e)f (that)i Fq(A)p Ft( )1519 1858 y Fp(\()p Fn(a)p Fp(\))1516 1910 y Fn(n)1647 1901 y Fv(is)f(normalizable.)59 b(Without)37 b(restriction)d(w)n(e)h(can)451 2012 y(assume)18 b(in)i(the)f (factorization)e Ft(')1479 2024 y Fn(n)1548 2012 y Fv(=)23 b Ft(')1690 1969 y Fp(\(1\))1690 2022 y Fn(n)1780 2012 y Fq(\001)q Ft(')1858 1969 y Fp(\(2\))1858 2022 y Fn(n)1967 2012 y Fv(that)c Ft(')2192 1969 y Fp(\(1\))2192 2022 y Fn(n)2300 2012 y Fv(and)g Ft(')2507 1969 y Fp(\(2\))2507 2022 y Fn(n)2616 2012 y Fv(are)e(an)n(tisymmetric,)451 2112 y(suc)n(h)37 b(that)h Ft(\033)k Fv(can)37 b(b)r(e)h(restricted)f (to)g(the)h(p)r(erm)n(utation)g(of)f(co)r(ordinates)f(relating)h(to)451 2211 y(di\013eren)n(t)28 b(clusters.)36 b(W)-7 b(e)28 b(claim)g(that)f(scalar)f(pro)r(ducts)i(of)f(the)h(form)493 2410 y(\()p Ft(')579 2367 y Fp(\()p Fn(n)p Fp(\))579 2432 y(1)676 2410 y Fv(\()p Fk(x)758 2422 y Fp(1)796 2410 y Ft(;)14 b(:::;)g Fk(x)989 2422 y Fn(N)6 b Fi(\000)p Fn(l)1126 2410 y Fv(\))14 b Ft(')1226 2367 y Fp(\()p Fn(n)p Fp(\))1226 2432 y(2)1323 2410 y Fv(\()p Fk(x)1405 2422 y Fn(N)6 b Fi(\000)p Fn(l)p Fp(+1)1633 2410 y Fq(\000)h Fk(a)p Ft(;)14 b(:::;)g Fk(x)1944 2422 y Fn(N)2013 2410 y Fq(\000)7 b Fk(a)p Fv(\))p Ft(;)28 b(')2268 2367 y Fp(\()p Fn(n)p Fp(\))2268 2432 y(1)2365 2410 y Fv(\()p Fk(x)2447 2425 y Fn(\033)r Fp(\(1\))2578 2410 y Ft(;)14 b(:::;)g Fk(x)2771 2425 y Fn(\033)r Fp(\()p Fn(N)6 b Fi(\000)p Fn(l)p Fp(\))3000 2410 y Fv(\))42 b(\(1.36\))1215 2630 y Fq(\001)14 b Ft(')1306 2587 y Fp(\()p Fn(n)p Fp(\))1306 2652 y(2)1403 2630 y Fv(\()p Fk(x)1485 2645 y Fn(\033)r Fp(\()p Fn(N)6 b Fi(\000)p Fn(l)p Fp(+1\))1817 2630 y Fq(\000)18 b Fk(a)p Ft(;)c(:::;)g Fk(x)2139 2645 y Fn(\033)r Fp(\()p Fn(N)6 b Fp(\))2314 2630 y Fq(\000)18 b Fk(a)p Fv(\))c(\))451 2787 y(where)30 b Fq(9)14 b Ft(k)30 b Fq(2)d(f)p Fv(1)p Ft(;)14 b(:::;)g(N)28 b Fq(\000)20 b Ft(l)r Fq(g)29 b Fv(and)h Ft(k)1624 2757 y Fi(0)1674 2787 y Fq(2)d(f)p Ft(N)i Fq(\000)19 b Ft(l)j Fv(+)d(1)p Ft(;)14 b(:::;)g(N)9 b Fq(g)29 b Fv(suc)n(h)h(that)g Ft(\033)s Fv(\()p Ft(k)s Fv(\))e Fq(2)g(f)p Ft(N)g Fq(\000)451 2886 y Ft(l)e Fv(+)e(1)p Ft(;)14 b(:::;)g(N)9 b Fq(g)35 b Fv(and)i Ft(\033)s Fv(\()p Ft(k)1228 2856 y Fi(0)1252 2886 y Fv(\))h Fq(2)g(f)p Fv(1)p Ft(;)14 b(:::;)g(N)32 b Fq(\000)24 b Ft(l)r Fq(g)p Fv(,)38 b(can)e(b)r(e)h(made)g (arbitrarily)d(small)i(for)g(a)451 3002 y(suitably)28 b(large)f Ft(a)p Fv(.)38 b(In)28 b(fact,)h(since)f Ft(x)1620 3017 y Fn(\033)r Fp(\()p Fn(k)1722 3000 y Fg(0)1746 3017 y Fp(\))1800 3002 y Ft(<)23 b(R)1951 3014 y Fp(1)2016 3002 y Fv(on)28 b(supp)14 b Ft(')2371 2959 y Fp(\()p Fn(n)p Fp(\))2371 3024 y(1)2497 3002 y Fv(and)28 b Fq(j)p Fk(x)2732 3017 y Fn(\033)r Fp(\()p Fn(k)2834 3000 y Fg(0)2858 3017 y Fp(\))2907 3002 y Fq(\000)18 b Fk(a)p Fq(j)38 b Ft(<)24 b(R)3249 3014 y Fp(2)451 3127 y Fv(on)h(supp)14 b Ft(')803 3083 y Fp(\()p Fn(n)p Fp(\))803 3149 y(2)900 3127 y Ft(;)25 b Fv(w)n(e)g(ha)n(v)n(e)1266 3060 y Fm(R)1249 3209 y Fe(R)1296 3193 y Ff(3)1345 3127 y Ft(d)p Fk(x)1438 3142 y Fn(\033)r Fp(\()p Fn(k)1540 3125 y Fg(0)1564 3142 y Fp(\))p 1594 3081 55 4 v 1594 3127 a Ft(')1649 3083 y Fp(\()p Fn(n)p Fp(\))1649 3149 y(1)1746 3127 y Fv(\()p Ft(:::;)14 b Fk(x)1934 3142 y Fn(\033)r Fp(\()p Fn(k)2036 3125 y Fg(0)2060 3142 y Fp(\))2090 3127 y Ft(;)g(:::)p Fv(\))24 b Ft(')2306 3083 y Fp(\()p Fn(n)p Fp(\))2306 3149 y(2)2403 3127 y Fv(\()p Ft(:::;)14 b Fk(x)2591 3142 y Fn(\033)r Fp(\()p Fn(k)2693 3125 y Fg(0)2717 3142 y Fp(\))2761 3127 y Fq(\000)f Fk(a)p Ft(;)h(:::)p Fv(\))37 b(=)23 b(0)47 b(if)451 3283 y Ft(a)23 b(>)g(R)669 3295 y Fp(1)724 3283 y Fv(+)c Ft(R)871 3295 y Fp(2)908 3283 y Ft(:)51 b Fv(Th)n(us)27 b(w)n(e)g(get)1295 3483 y Fq(k)p Ft(A )1456 3449 y Fp(\()p Fn(a)p Fp(\))1453 3503 y Fn(n)1548 3483 y Fq(k)1590 3449 y Fp(2)1673 3483 y Fv(=)45 b Ft(c)1819 3449 y Fp(2)1819 3503 y(1)1879 3404 y Fm(X)1870 3582 y Fn(\033)r Fi(2P)2008 3483 y Fv(\()p Ft( )2097 3449 y Fp(\()p Fn(a)p Fp(\))2094 3503 y Fn(n;\033)2199 3483 y Ft(;)14 b( )2293 3449 y Fp(\()p Fn(a)p Fp(\))2290 3503 y Fn(n;\033)2410 3483 y Fv(\))632 b(\(1.37\))451 3749 y(since)33 b(all)g(cross)f(terms)h(v)-5 b(anish)34 b(for)e(su\016cien)n (tly)i(large)e Ft(a)p Fv(.)54 b(This)33 b(guaran)n(tees)e(the)j(nor-) 451 3860 y(malizabilit)n(y)27 b(of)h Fq(A)p Ft( )1121 3817 y Fp(\()p Fn(a)p Fp(\))1118 3870 y Fn(n)1213 3860 y Ft(:)451 4097 y Fs(2)92 b(The)32 b(tw)n(o-electr)n(on)g(Jansen-Hess)g (opera)-6 b(tor)451 4284 y Fv(The)33 b(Jansen-Hess)e(op)r(erator)f (includes)j(the)g(terms)f(whic)n(h)g(are)g(quadratic)f(in)i(the)g (\014ne)451 4383 y(structure)27 b(constan)n(t)h Ft(e)1182 4353 y Fp(2)1218 4383 y Fv(.)38 b(W)-7 b(e)28 b(restrict)f(ourselv)n (es)f(in)i(this)g(section)g(to)g(the)g(t)n(w)n(o-electron)451 4483 y(ion)g(and)f(write)g(the)h(Jansen-Hess)e(op)r(erator)g Ft(H)1983 4453 y Fp(\(2\))2100 4483 y Fv(in)i(the)g(follo)n(wing)e (form)h([11])980 4750 y Ft(H)1056 4715 y Fp(\(2\))1191 4750 y Fv(=)46 b Ft(H)1378 4715 y Fn(B)s(R)1371 4770 y Fp(2)1526 4750 y Fv(+)c(\003)1691 4762 y Fp(+)p Fn(;)p Fp(2)1812 4608 y Fm( )1922 4646 y Fp(2)1878 4671 y Fm(X)1878 4849 y Fn(k)q Fp(=1)2012 4750 y Ft(B)2079 4706 y Fp(\()p Fn(k)q Fp(\))2075 4772 y(2)p Fn(m)2204 4750 y Fv(+)32 b Ft(C)2366 4715 y Fp(\(12\))2489 4608 y Fm(!)2591 4750 y Fv(\003)2649 4762 y Fp(+)p Fn(;)p Fp(2)3115 4750 y Fv(\(2.1\))458 5091 y Ft(B)525 5048 y Fp(\()p Fn(k)q Fp(\))521 5113 y(2)p Fn(m)627 5091 y Fv(:=)756 5035 y Ft(\015)804 5005 y Fp(2)p 734 5072 130 4 v 734 5148 a Fv(8)p Ft(\031)826 5124 y Fp(2)873 4974 y Fm(\032)955 5035 y Fv(1)p 932 5072 89 4 v 932 5148 a Ft(x)979 5160 y Fn(k)1030 4974 y Fm(\022)1077 5091 y Fv(1)18 b Fq(\000)1230 5035 y Fl(\013)1293 5005 y Fp(\()p Fn(k)q Fp(\))1386 5035 y Fk(p)1439 5047 y Fn(k)1471 5035 y Fv(+)5 b Ft(\014)1592 5005 y Fp(\()p Fn(k)q Fp(\))1684 5035 y Ft(m)p 1230 5072 527 4 v 1425 5148 a(E)1486 5160 y Fn(p)1520 5169 y Fj(k)1767 4974 y Fm(\023)1828 5091 y Ft(V)1895 5048 y Fp(\()p Fn(k)q Fp(\))1876 5113 y(10)p Fn(;m)2044 5091 y Fv(+)18 b Ft(V)2194 5048 y Fp(\()p Fn(k)q Fp(\))2175 5113 y(10)p Fn(;m)2324 4974 y Fm(\022)2371 5091 y Fv(1)g Fq(\000)2524 5035 y Fl(\013)2587 5005 y Fp(\()p Fn(k)q Fp(\))2680 5035 y Fk(p)2733 5047 y Fn(k)2765 5035 y Fv(+)5 b Ft(\014)2886 5005 y Fp(\()p Fn(k)q Fp(\))2978 5035 y Ft(m)p 2524 5072 V 2720 5148 a(E)2781 5160 y Fn(p)2815 5169 y Fj(k)3061 4974 y Fm(\023)3155 5035 y Fv(1)p 3132 5072 89 4 v 3132 5148 a Ft(x)3179 5160 y Fn(k)3217 4974 y Fm(\033)1108 5338 y Fw(Document)l(a)25 b(Ma)l(thema)l(tica)h(10)f(\(2005\))g (497{525)p eop %%Page: 508 12 508 11 bop 451 518 a Fv(508)727 b Fs(D.)30 b(H.)h(Jakubassa-Amundsen) 1171 760 y Ft(V)1238 716 y Fp(\()p Fn(k)q Fp(\))1219 782 y(10)p Fn(;m)1392 760 y Fv(:=)46 b(2)p Ft(\031)1618 725 y Fp(2)1668 647 y Fm(Z)1752 667 y Fi(1)1715 835 y Fp(0)1836 760 y Ft(dt)23 b(e)1971 725 y Fi(\000)p Fn(tE)2097 733 y Fj(p)2128 748 y(k)2228 703 y Fv(1)p 2205 740 89 4 v 2205 816 a Ft(x)2252 828 y Fn(k)2326 760 y Ft(e)2365 725 y Fi(\000)p Fn(tE)2491 733 y Fj(p)2522 748 y(k)451 959 y Fv(where)h Ft(H)764 929 y Fn(B)s(R)757 980 y Fp(2)896 959 y Fv(is)g(the)h(Bro)n(wn-Ra)n(v)n(enhall)d(op)r(erator)h(from)h (\(1.1\))g(indexed)h(b)n(y)f(2)g(\(for)g Ft(N)32 b Fv(=)451 1075 y(2\))p Ft(;)69 b Fv(\003)675 1087 y Fp(+)p Fn(;)p Fp(2)810 1075 y Fv(=)27 b(\003)960 1032 y Fp(\(1\))960 1095 y(+)1049 1075 y Fv(\003)1107 1032 y Fp(\(2\))1107 1095 y(+)1226 1075 y Fv(and)j Ft(V)1457 1032 y Fp(\()p Fn(k)q Fp(\))1438 1097 y(10)p Fn(;m)1617 1075 y Fv(is)g(a)g(b)r(ounded) h(single-particle)e(in)n(tegral)g(op)r(erator.)451 1190 y(The)f(t)n(w)n(o-particle)e(second-order)f(con)n(tribution)i Ft(C)2102 1160 y Fp(\(12\))2252 1190 y Fv(is)h(giv)n(en)e(b)n(y)1005 1440 y Ft(C)1070 1406 y Fp(\(12\))1216 1440 y Fv(:=)1393 1337 y Fp(2)1350 1361 y Fm(X)1349 1540 y Fn(k)q Fp(=1)1470 1440 y Fv(\()p Ft(V)1569 1406 y Fp(\(12\))1705 1440 y Fv(\003)1763 1397 y Fp(\()p Fn(k)q Fp(\))1763 1461 y Fi(\000)1870 1440 y Ft(F)1935 1397 y Fp(\()p Fn(k)q Fp(\))1923 1462 y(0)2069 1440 y Fv(+)41 b Ft(F)2240 1397 y Fp(\()p Fn(k)q Fp(\))2228 1462 y(0)2346 1440 y Fv(\003)2404 1397 y Fp(\()p Fn(k)q Fp(\))2404 1461 y Fi(\000)2511 1440 y Ft(V)2577 1406 y Fp(\(12\))2700 1440 y Fv(\))383 b(\(2.2\))1009 1750 y Ft(F)1074 1707 y Fp(\()p Fn(k)q Fp(\))1062 1773 y(0)1190 1750 y Fv(:=)45 b Fq(\000)1423 1694 y Fv(1)p 1398 1731 92 4 v 1398 1807 a(2)p Ft(\031)1514 1637 y Fm(Z)1597 1658 y Fi(1)1560 1826 y(\0001)1696 1750 y Ft(d\021)1965 1694 y Fv(1)p 1816 1731 339 4 v 1816 1828 a Ft(D)1887 1785 y Fp(\()p Fn(k)q Fp(\))1885 1850 y(0)1998 1828 y Fv(+)19 b Ft(i\021)2187 1750 y(V)2254 1716 y Fp(\()p Fn(k)q Fp(\))2528 1694 y Fv(1)p 2380 1731 V 2380 1828 a Ft(D)2451 1785 y Fp(\()p Fn(k)q Fp(\))2449 1850 y(0)2562 1828 y Fv(+)f Ft(i\021)451 1991 y Fv(and)28 b(\003)671 1948 y Fp(\()p Fn(k)q Fp(\))671 2011 y Fi(\000)786 1991 y Fv(=)23 b(1)18 b Fq(\000)g Fv(\003)1075 1948 y Fp(\()p Fn(k)q Fp(\))1075 2011 y(+)1167 1991 y Ft(:)51 b Fv(Also)27 b Ft(F)1493 1948 y Fp(\()p Fn(k)q Fp(\))1481 2013 y(0)1613 1991 y Fv(is)h(a)f(b)r(ounded)h(single-particle)e(in)n(tegral)h(op)r (erator.)451 2090 y(In)i(the)g(same)g(w)n(a)n(y)e(as)i(for)f(the)h(Bro) n(wn-Ra)n(v)n(enhall)d(op)r(erator,)h(an)i(equiv)-5 b(alen)n(t)29 b(op)r(erator)451 2190 y Ft(h)499 2160 y Fp(\(2\))616 2190 y Fv(acting)e(on)g(the)h(reduced)f(spinor)g(space)g Fq(A)p Fv(\()p Ft(L)2059 2202 y Fp(2)2096 2190 y Fv(\()p Fo(R)2183 2160 y Fp(3)2226 2190 y Fv(\))19 b Fq(\012)f Fo(C)2414 2160 y Fp(2)2457 2190 y Fv(\))2489 2160 y Fp(2)2526 2190 y Fv(,)28 b(can)f(b)r(e)h(de\014ned,)1284 2445 y Ft(h)1332 2410 y Fp(\(2\))1467 2445 y Fv(=)46 b Ft(h)1626 2410 y Fn(B)s(R)1626 2465 y Fp(2)1775 2445 y Fv(+)1925 2341 y Fp(2)1881 2366 y Fm(X)1881 2545 y Fn(k)q Fp(=1)2015 2445 y Ft(b)2051 2402 y Fp(\()p Fn(k)q Fp(\))2051 2467 y(2)p Fn(m)2189 2445 y Fv(+)41 b Ft(c)2331 2410 y Fp(\(12\))3115 2445 y Fv(\(2.3\))451 2695 y(with)497 2909 y Ft(b)533 2866 y Fp(\()p Fn(k)q Fp(\))533 2931 y(2)p Fn(m)675 2909 y Fv(=)818 2853 y Ft(\015)866 2823 y Fp(2)p 796 2890 130 4 v 796 2966 a Fv(8)p Ft(\031)888 2942 y Fp(2)948 2792 y Fm(\032)1011 2909 y Ft(A)1073 2921 y Fn(k)1147 2853 y Fv(1)p 1124 2890 89 4 v 1124 2966 a Ft(x)1171 2978 y Fn(k)1222 2909 y Ft(V)1289 2866 y Fp(\()p Fn(k)q Fp(\))1270 2931 y(10)p Fn(;m)1419 2909 y Ft(A)1481 2921 y Fn(k)1555 2909 y Fq(\000)32 b Ft(G)1717 2921 y Fn(k)1791 2853 y Fv(1)p 1768 2890 V 1768 2966 a Ft(x)1815 2978 y Fn(k)1876 2853 y Fl(\033)1936 2823 y Fp(\()p Fn(k)q Fp(\))2029 2853 y Fk(p)2082 2865 y Fn(k)p 1876 2890 247 4 v 1931 2966 a Ft(E)1992 2978 y Fn(p)2026 2987 y Fj(k)2133 2909 y Ft(V)2200 2866 y Fp(\()p Fn(k)q Fp(\))2181 2931 y(10)p Fn(;m)2330 2909 y Ft(A)2392 2921 y Fn(k)2465 2909 y Fq(\000)g Ft(A)2624 2921 y Fn(k)2699 2853 y Fv(1)p 2675 2890 89 4 v 2675 2966 a Ft(x)2722 2978 y Fn(k)2815 2853 y Ft(m)p 2784 2890 136 4 v 2784 2966 a(E)2845 2978 y Fn(p)2879 2987 y Fj(k)2930 2909 y Ft(V)2996 2866 y Fp(\()p Fn(k)q Fp(\))2978 2931 y(10)p Fn(;m)3127 2909 y Ft(A)3189 2921 y Fn(k)3115 3061 y Fv(\(2.4\))544 3220 y(+)23 b Ft(G)697 3232 y Fn(k)772 3163 y Fv(1)p 748 3200 89 4 v 748 3276 a Ft(x)795 3288 y Fn(k)846 3220 y Ft(V)913 3176 y Fp(\()p Fn(k)q Fp(\))894 3242 y(10)p Fn(;m)1044 3220 y Ft(G)1109 3232 y Fn(k)1182 3220 y Fq(\000)32 b Ft(A)1341 3232 y Fn(k)1416 3163 y Fv(1)p 1392 3200 V 1392 3276 a Ft(x)1439 3288 y Fn(k)1500 3163 y Fl(\033)1560 3133 y Fp(\()p Fn(k)q Fp(\))1653 3163 y Fk(p)1706 3175 y Fn(k)p 1500 3200 247 4 v 1556 3276 a Ft(E)1617 3288 y Fn(p)1651 3297 y Fj(k)1757 3220 y Ft(V)1824 3176 y Fp(\()p Fn(k)q Fp(\))1805 3242 y(10)p Fn(;m)1954 3220 y Ft(G)2019 3232 y Fn(k)2093 3220 y Fv(+)g Ft(G)2255 3232 y Fn(k)2329 3163 y Fv(1)p 2306 3200 89 4 v 2306 3276 a Ft(x)2353 3288 y Fn(k)2446 3163 y Ft(m)p 2414 3200 136 4 v 2414 3276 a(E)2475 3288 y Fn(p)2509 3297 y Fj(k)2560 3220 y Ft(V)2627 3176 y Fp(\()p Fn(k)q Fp(\))2608 3242 y(10)p Fn(;m)2757 3220 y Ft(G)2822 3232 y Fn(k)2905 3220 y Fv(+)41 b(h.c.)3140 3102 y Fm(\033)451 3416 y Fv(where)d Ft(A)764 3428 y Fn(k)805 3416 y Ft(;)14 b(G)907 3428 y Fn(k)986 3416 y Fv(are)37 b(de\014ned)h(b)r(elo)n(w)g(\(1.2\))f (and)h(h.c.)68 b(means)38 b(Hermitean)g(conjugate)451 3532 y(\(suc)n(h)26 b(that)f Ft(b)882 3489 y Fp(\()p Fn(k)q Fp(\))882 3554 y(2)p Fn(m)1004 3532 y Fv(is)g(a)g(symmetric)g (op)r(erator\).)35 b(Note)25 b(that,)i(due)e(to)h(the)f(presence)g(of)h (the)451 3649 y(pro)5 b(jector)33 b(\003)874 3606 y Fp(\()p Fn(k)q Fp(\))874 3670 y(+)1002 3649 y Fv(in)i(\(2.1\),)h Ft(b)1372 3606 y Fp(\()p Fn(k)q Fp(\))1372 3672 y(2)p Fn(m)1503 3649 y Fv(con)n(tains)e(only)g(ev)n(en)g(p)r(o)n(w)n(ers)g (in)h Fl(\033)2668 3619 y Fp(\()p Fn(k)q Fp(\))2760 3649 y Ft(:)70 b Fv(In)35 b(a)g(similar)451 3759 y(w)n(a)n(y)-7 b(,)25 b Ft(c)670 3729 y Fp(\(12\))817 3759 y Fv(is)g(deriv)n(ed)g (from)g Ft(C)1446 3729 y Fp(\(12\))1568 3759 y Ft(:)h Fv(The)f(particle)g(mass)f Ft(m)i Fv(is)f(assumed)f(to)i(b)r(e)f (nonzero)451 3859 y(throughout)i(\(for)g Ft(m)c Fv(=)f(0,)27 b(the)h(sp)r(ectrum)f(of)g(the)h(single-particle)e(Jansen-Hess)f(op)r (era-)451 3958 y(tor)i(is)h(absolutely)e(con)n(tin)n(uous)h(with)h (in\014m)n(um)g(zero)f([11)o(]\).)451 4058 y(F)-7 b(or)35 b(p)r(oten)n(tial)g(strength)f Ft(\015)40 b(<)35 b Fv(0)p Ft(:)p Fv(89)69 b(\(sligh)n(tly)35 b(smaller)f(than)h Ft(\015)2571 4070 y Fn(B)s(R)2678 4058 y Fv(\))p Ft(;)71 b Fv(it)36 b(w)n(as)e(sho)n(wn)451 4157 y([13)o(])41 b(that)h(the)f(total)g(p)r(oten)n(tial)f(of)h Ft(H)1730 4127 y Fp(\(2\))1860 4157 y Fv(\(and)g(hence)g(also)f(of)h Ft(h)2647 4127 y Fp(\(2\))2736 4157 y Fv(\))86 b(is)41 b(relativ)n(ely)451 4257 y(form)34 b(b)r(ounded)h(\(with)h(form)e(b)r (ound)h(smaller)f(than)g(1\))h(with)g(resp)r(ect)f(to)h(the)g(kinetic) 451 4357 y(energy)26 b(op)r(erator.)35 b(Therefore,)26 b Ft(h)1530 4327 y Fp(\(2\))1646 4357 y Fv(is)g(w)n(ell-de\014ned)h(in) g(the)g(form)g(sense)f(and)h(is)g(a)f(self-)451 4456 y(adjoin)n(t)h(op)r(erator)f(b)n(y)g(means)h(of)g(the)h(F)-7 b(riedric)n(hs)26 b(extension)h(of)g(the)h(restriction)e(of)h Ft(h)3197 4426 y Fp(\(2\))451 4556 y Fv(to)j Fq(A)p Fv(\()p Ft(C)718 4526 y Fi(1)712 4577 y Fp(0)789 4556 y Fv(\()p Fo(R)875 4526 y Fp(3)918 4556 y Fv(\))21 b Fq(\012)e Fo(C)1109 4526 y Fp(2)1152 4556 y Fv(\))1184 4526 y Fp(2)1222 4556 y Ft(:)56 b Fv(The)30 b(ab)r(o)n(v)n(e)e(form)i(b)r(oundedness)f (guaran)n(tees)f(the)i(existence)451 4656 y(of)k(a)g Ft(\026)g(>)g Fv(0)f(suc)n(h)h(that)h Ft(h)1315 4625 y Fp(\(2\))1426 4656 y Fv(+)23 b Ft(\026)34 b(>)f Fv(0)h(for)g Ft(\015)k(<)c Fv(0)p Ft(:)p Fv(89)p Ft(:)f Fv(If)h Ft(\015)39 b(<)33 b Fv(0)p Ft(:)p Fv(825)p Ft(;)g Fv(one)h(can)f(ev)n(en)451 4755 y(c)n(ho)r(ose)27 b Ft(\026)c Fv(=)f(0)27 b([13].)451 4855 y(Let)j(us)g(in)n(tro)r(duce)f(the)i(op)r(erator)1566 4833 y(~)1565 4855 y Ft(h)1613 4825 y Fp(\(2\))1732 4855 y Fv(b)n(y)e(means)h(of)f Ft(h)2250 4825 y Fp(\(2\))2366 4855 y Fv(=:)2481 4833 y(~)2481 4855 y Ft(h)2529 4825 y Fp(\(2\))2637 4855 y Fv(+)20 b Ft(c)2758 4825 y Fp(\(12\))2910 4855 y Fv(and)30 b(de\014ne)451 4954 y(in)e(analogy)e(to)h(\(1.4\))h (the)g(t)n(w)n(o-cluster)e(decomp)r(ositions)g(of)2398 4933 y(~)2397 4954 y Ft(h)2445 4924 y Fp(\(2\))2562 4954 y Fv(for)h(j=0,1,2,)1488 5108 y(~)1487 5130 y Ft(h)1535 5096 y Fp(\(2\))1670 5130 y Fv(=)46 b Ft(T)d Fv(+)32 b Ft(a)2014 5142 y Fn(j)2081 5130 y Fv(+)g Ft(r)2215 5142 y Fn(j)3115 5130 y Fv(\(2.5\))1108 5338 y Fw(Document)l(a)25 b(Ma)l(thema)l(tica)h(10)f(\(2005\))g(497{525)p eop %%Page: 509 13 509 12 bop 1301 518 a Ft(N)9 b Fs(-Electr)n(on)31 b(HVZ)f(Theorem)726 b Fv(509)451 725 y(as)27 b(w)n(ell)g(as)1412 825 y(\006)1472 837 y Fp(0)1532 825 y Fv(:=)46 b(min)1720 877 y Fn(j)1818 825 y Fv(inf)35 b Ft(\033)s Fv(\()p Ft(T)30 b Fv(+)18 b Ft(a)2235 837 y Fn(j)2270 825 y Fv(\))p Ft(:)790 b Fv(\(2.6\))451 1009 y(The)28 b(aim)f(of)h(this)g(section)f(is)g(to)h (pro)n(v)n(e)451 1170 y Fs(Theorem)h Fv(2)f Fs(\(HVZ)f(theorem)h(f)n (or)h(the)f(tw)n(o-electr)n(on)i(Jansen-Hess)e(oper-)451 1270 y(a)-6 b(tor\).)451 1423 y Fh(L)l(et)24 b Ft(h)637 1393 y Fp(\(2\))749 1423 y Fv(=)880 1344 y Fp(2)853 1361 y Fm(P)836 1498 y Fn(k)q Fp(=1)957 1423 y Fv(\()p Ft(T)1050 1393 y Fp(\()p Fn(k)q Fp(\))1148 1423 y Fv(+)6 b Ft(b)1255 1380 y Fp(\()p Fn(k)q Fp(\))1255 1445 y(1)p Fn(m)1356 1423 y Fv(+)g Ft(b)1463 1380 y Fp(\()p Fn(k)q Fp(\))1463 1445 y(2)p Fn(m)1558 1423 y Fv(\))20 b(+)6 b Ft(v)1724 1393 y Fp(\(12\))1852 1423 y Fv(+)g Ft(c)1959 1393 y Fp(\(12\))2118 1423 y Fv(=)2206 1401 y(~)2205 1423 y Ft(h)2253 1393 y Fp(\(2\))2348 1423 y Fv(+)g Ft(c)2455 1393 y Fp(\(12\))2624 1423 y Fh(b)l(e)24 b(the)g(two-ele)l(ctr)l(on)451 1577 y(Jansen-Hess)30 b(op)l(er)l(ator)i(with)f(p)l(otential)h(str)l (ength)e Ft(\015)f(<)c Fv(0)p Ft(:)p Fv(66)49 b(\()p Ft(Z)31 b Fq(\024)24 b Fv(90\))p Ft(:)55 b Fh(L)l(et)31 b(\(2.5\))h(b)l(e)451 1677 y(the)i(two-cluster)g(de)l(c)l(omp)l (ositions)h(of)1694 1655 y Fv(~)1693 1677 y Ft(h)1741 1647 y Fp(\(2\))1864 1677 y Fh(and)g Fv(\006)2090 1689 y Fp(0)2161 1677 y Fh(fr)l(om)f(\(2.6\).)52 b(Then)35 b(the)f(essential)451 1776 y(sp)l(e)l(ctrum)29 b(of)i Ft(h)946 1746 y Fp(\(2\))1064 1776 y Fh(is)g(given)f(by)1469 1953 y Ft(\033)1516 1965 y Fn(ess)1614 1953 y Fv(\()p Ft(h)1694 1919 y Fp(\(2\))1784 1953 y Fv(\))46 b(=)g([\006)2056 1965 y Fp(0)2093 1953 y Ft(;)14 b Fq(1)p Fv(\))p Ft(:)847 b Fv(\(2.7\))451 2129 y(W)-7 b(e)29 b(start)f(b)n(y)g(noting)h(that)f (the)h(t)n(w)n(o-particle)e(second-order)f(p)r(oten)n(tial)j Ft(c)2827 2099 y Fp(\(12\))2978 2129 y Fv(do)r(es)f(not)451 2229 y(c)n(hange)f(the)h(essen)n(tial)e(sp)r(ectrum)i(of)g Ft(h)1705 2199 y Fp(\(2\))1817 2229 y Fv(:)451 2390 y Fs(Pr)n(oposition)21 b Fv(1)p Fs(.)33 b Fh(L)l(et)21 b Ft(h)1260 2360 y Fp(\(2\))1372 2390 y Fv(=)1460 2368 y(~)1459 2390 y Ft(h)1507 2360 y Fp(\(2\))1596 2390 y Fv(+)p Ft(c)1697 2360 y Fp(\(12\))1840 2390 y Fh(b)l(e)h(the)f(two-ele) l(ctr)l(on)h(Jansen-Hess)e(op)l(er)l(ator)451 2490 y(with)31 b(p)l(otential)f(str)l(ength)f Ft(\015)f(<)22 b Fv(0)p Ft(:)p Fv(66)p Ft(:)52 b Fh(Then)30 b(one)g(has)1431 2667 y Ft(\033)1478 2679 y Fn(ess)1577 2667 y Fv(\()p Ft(h)1657 2632 y Fp(\(2\))1746 2667 y Fv(\))47 b(=)e Ft(\033)1982 2679 y Fn(ess)2081 2667 y Fv(\()2114 2645 y(~)2113 2667 y Ft(h)2161 2632 y Fp(\(2\))2250 2667 y Fv(\))p Ft(:)810 b Fv(\(2.8\))451 2956 y Fh(Pr)l(o)l(of.)451 3055 y Fv(The)63 b(pro)r(of)f(is)g(p)r(erformed)h(for)f(the)h(equiv)-5 b(alen)n(t)62 b(op)r(erator)f Ft(H)2675 3025 y Fp(\(2\))2845 3055 y Fv(=:)3036 3034 y(~)3015 3055 y Ft(H)3091 3025 y Fp(\(2\))3221 3055 y Fv(+)451 3155 y(\003)509 3167 y Fp(+)p Fn(;)p Fp(2)617 3155 y Ft(C)682 3125 y Fp(\(12\))804 3155 y Fv(\003)862 3167 y Fp(+)p Fn(;)p Fp(2)970 3155 y Ft(:)451 3254 y Fv(The)28 b(resolv)n(en)n(t)e(di\013erence)1192 3431 y Ft(R)1255 3443 y Fn(\026)1323 3431 y Fv(:=)46 b(\()p Ft(H)1565 3397 y Fp(\(2\))1672 3431 y Fv(+)18 b Ft(\026)p Fv(\))1837 3397 y Fi(\000)p Fp(1)1968 3431 y Fq(\000)41 b Fv(\()2129 3410 y(~)2106 3431 y Ft(H)2182 3397 y Fp(\(2\))2290 3431 y Fv(+)18 b Ft(\026)p Fv(\))2455 3397 y Fi(\000)p Fp(1)3115 3431 y Fv(\(2.9\))451 3617 y(is)23 b(b)r(ounded)h(for)e Ft(\026)h Fq(\025)g Fv(0)g(since)f Ft(H)1487 3586 y Fp(\(2\))1599 3617 y Fv(as)h(w)n(ell)g(as)1980 3596 y(~)1958 3617 y Ft(H)2034 3586 y Fp(\(2\))2146 3617 y Fv(are)f(p)r(ositiv)n(e)h(for)f Ft(\015)28 b(<)23 b Fv(0)p Ft(:)p Fv(825)e(whic)n(h)451 3716 y(exceeds)38 b(the)h(critical)f Ft(\015)44 b Fv(of)39 b(Prop)r(osition)e(1.)69 b(W)-7 b(e)40 b(will)f(sho)n(w)e(that)i Ft(R)2780 3728 y Fn(\026)2864 3716 y Fv(is)f(compact.)451 3816 y(Then,)31 b(follo)n(wing)e(the)h(argumen)n(tation)e(of)i([7)o(],)h(one)e(can)h (use)g(Lemma)f(3)h(of)f([20,)h(p.111])451 3915 y(together)d(with)h(the) g(strong)f(sp)r(ectral)g(mapping)g(theorem)g(\([20,)g(p.109]\))g(to)h (pro)n(v)n(e)e(that)451 4015 y(the)i(essen)n(tial)f(sp)r(ectra)g(of)g Ft(H)1384 3985 y Fp(\(2\))1501 4015 y Fv(and)1684 3994 y(~)1662 4015 y Ft(H)1738 3985 y Fp(\(2\))1855 4015 y Fv(coincide.)451 4164 y(Let)42 b Ft(T)663 4176 y Fp(0)746 4164 y Fv(:=)k(\003)938 4176 y Fp(+)p Fn(;)p Fp(2)1103 4085 y(2)1076 4102 y Fm(P)1059 4239 y Fn(k)q Fp(=1)1194 4164 y Ft(D)1265 4121 y Fp(\()p Fn(k)q Fp(\))1263 4186 y(0)1371 4164 y Fv(\003)1429 4176 y Fp(+)p Fn(;)p Fp(2)1578 4164 y Fv(whic)n(h)c(is)f(a)g(p)r(ositiv)n(e)g(op)r(erator)f(\(for)h Ft(m)46 b Fq(6)p Fv(=)g(0\))41 b(on)451 4323 y(the)32 b(p)r(ositiv)n(e)f(sp)r(ectral)f(subspace)h(\003)1633 4335 y Fp(+)p Fn(;)p Fp(2)1740 4323 y Fq(A)p Fv(\()p Ft(H)1907 4335 y Fp(1)1945 4323 y Fv(\()p Fo(R)2032 4293 y Fp(3)2075 4323 y Fv(\))21 b Fq(\012)f Fo(C)2267 4293 y Fp(4)2311 4323 y Fv(\))2343 4293 y Fp(2)2380 4323 y Ft(:)61 b Fv(\(The)31 b(negativ)n(e)f(sp)r(ectral)451 4423 y(subspace)25 b(is)g(disregarded)f(throughout)g(b)r(ecause)h Ft(H)2131 4393 y Fp(\(2\))2243 4423 y Fv(=)e(0)i(on)g(that)g (subspace.\))36 b(With)451 4522 y(the)28 b(help)g(of)g(the)g(second)f (resolv)n(en)n(t)e(iden)n(tit)n(y)-7 b(,)28 b(one)g(decomp)r(oses)e Ft(R)2617 4534 y Fn(\026)2689 4522 y Fv(in)n(to)938 4709 y Ft(R)1001 4721 y Fn(\026)1091 4709 y Fv(=)46 b Fq(\000)p Fv(\()1321 4688 y(~)1299 4709 y Ft(H)1375 4675 y Fp(\(2\))1482 4709 y Fv(+)18 b Ft(\026)p Fv(\))1647 4675 y Fi(\000)p Fp(1)1760 4709 y Fv(\003)1818 4721 y Fp(+)p Fn(;)p Fp(2)1939 4709 y Ft(C)2004 4675 y Fp(\(12\))2141 4709 y Fv(\003)2199 4721 y Fp(+)p Fn(;)p Fp(2)2329 4709 y Fv(\()p Ft(H)2437 4675 y Fp(\(2\))2545 4709 y Fv(+)g Ft(\026)p Fv(\))2710 4675 y Fi(\000)p Fp(1)3074 4709 y Fv(\(2.10\))597 4914 y(=)23 b Fq(\000)764 4822 y Fm(h)802 4914 y Fv(\()856 4893 y(~)834 4914 y Ft(H)910 4880 y Fp(\(2\))1018 4914 y Fv(+)18 b Ft(\026)p Fv(\))1183 4880 y Fi(\000)p Fp(1)1272 4914 y Fv(\()p Ft(T)1353 4926 y Fp(0)1409 4914 y Fv(+)g Ft(\026)p Fv(\))1574 4822 y Fm(i)1632 4914 y Fq(\001)1673 4822 y Fm(n)1729 4914 y Fv(\()p Ft(T)1810 4926 y Fp(0)1865 4914 y Fv(+)g Ft(\026)p Fv(\))2030 4880 y Fi(\000)p Fp(1)2134 4914 y Fv(\003)2192 4926 y Fp(+)p Fn(;)p Fp(2)2313 4914 y Ft(C)2378 4880 y Fp(\(12\))2514 4914 y Fv(\003)2572 4926 y Fp(+)p Fn(;)p Fp(2)2694 4914 y Fv(\()p Ft(T)2775 4926 y Fp(0)2830 4914 y Fv(+)g Ft(\026)p Fv(\))2995 4880 y Fi(\000)p Fp(1)3085 4822 y Fm(o)1406 5118 y Fq(\001)1443 5026 y Fm(h)1483 5118 y Fv(\()p Ft(T)1564 5130 y Fp(0)1619 5118 y Fv(+)g Ft(\026)p Fv(\)\()p Ft(H)1892 5083 y Fp(\(2\))2000 5118 y Fv(+)g Ft(\026)p Fv(\))2165 5083 y Fi(\000)p Fp(1)2254 5026 y Fm(i)2308 5118 y Ft(:)1108 5338 y Fw(Document)l(a)25 b(Ma)l(thema)l(tica)h(10)f(\(2005\))g(497{525)p eop %%Page: 510 14 510 13 bop 451 518 a Fv(510)727 b Fs(D.)30 b(H.)h(Jakubassa-Amundsen) 451 725 y Fv(One)d(can)h(sho)n(w)e(\(see)i([11)o(,)g(pro)r(of)f(b\))h (of)f(Theorem)g(I)r(I.1)g(with)h Ft(T)40 b Fv(replaced)28 b(b)n(y)g Ft(T)3013 737 y Fp(0)3050 725 y Fv(]\))h(that)451 825 y(for)34 b Ft(\015)39 b(<)c Fv(0)p Ft(:)p Fv(66,)g(the)f(t)n(w)n(o) g(op)r(erators)f(in)i(square)e(brac)n(k)n(ets)g(are)g(b)r(ounded.)58 b(This)35 b(relies)451 924 y(on)f(the)g(relativ)n(e)f(b)r(oundedness)h (of)g(the)h(total)e(p)r(oten)n(tial)h(of)g Ft(H)2507 894 y Fp(\(2\))2664 924 y Fv(\(resp)r(ectiv)n(e)3110 903 y(~)3089 924 y Ft(H)3165 894 y Fp(\(2\))3254 924 y Fv(\))451 1024 y(with)42 b(resp)r(ect)f(to)h Ft(T)1117 1036 y Fp(0)1153 1024 y Fv(,)j(with)d(\(op)r(erator\))e(b)r(ound)i (less)f(than)h(one)f(for)g Ft(m)46 b Fv(=)f(0)c(\([11];)451 1124 y(App)r(endix)30 b(B\).)e(Due)h(to)g(scaling)e(\(for)i Ft(\026)24 b Fv(=)h(0\),)j(the)h(b)r(oundedness)g(of)f(the)h(op)r (erators)e(in)451 1223 y(square)f(brac)n(k)n(ets)g(holds)g(for)h(all)g Ft(m)p Fv(.)37 b(The)27 b(op)r(erator)e(in)j(curly)e(brac)n(k)n(ets)g (is)h(sho)n(wn)f(to)h(b)r(e)451 1323 y(compact.)37 b(T)-7 b(o)27 b(this)h(aim)f(it)h(is)g(written)f(as)1204 1518 y(\()p Ft(T)1285 1530 y Fp(0)1341 1518 y Fv(+)18 b Ft(\026)p Fv(\))1506 1483 y Fi(\000)p Fp(1)1595 1518 y Fv(\003)1653 1530 y Fp(+)p Fn(;)p Fp(2)1775 1518 y Ft(C)1840 1483 y Fp(\(12\))1962 1518 y Fv(\003)2020 1530 y Fp(+)p Fn(;)p Fp(2)2142 1518 y Fv(\()p Ft(T)2223 1530 y Fp(0)2278 1518 y Fv(+)g Ft(\026)p Fv(\))2443 1483 y Fi(\000)p Fp(1)3074 1518 y Fv(\(2.11\))902 1731 y(=)46 b(\()p Ft(T)1094 1743 y Fp(0)1149 1731 y Fv(+)18 b Ft(\026)p Fv(\))1314 1697 y Fi(\000)p Fp(1)1404 1731 y Fv(\()p Ft(T)29 b Fv(+)18 b Ft(\026)p Fv(\))c(\003)1751 1743 y Fp(+)p Fn(;)p Fp(2)1859 1731 y Ft(W)1937 1743 y Fp(2)1989 1731 y Fv(\003)2047 1743 y Fp(+)p Fn(;)p Fp(2)2168 1731 y Fv(\()p Ft(T)30 b Fv(+)18 b Ft(\026)p Fv(\)\()p Ft(T)2525 1743 y Fp(0)2581 1731 y Fv(+)g Ft(\026)p Fv(\))2746 1697 y Fi(\000)p Fp(1)451 1899 y Fv(with)38 b Ft(W)728 1911 y Fp(2)806 1899 y Fv(:=)i(\()p Ft(T)c Fv(+)25 b Ft(\026)p Fv(\))1223 1869 y Fi(\000)p Fp(1)1313 1899 y Ft(C)1378 1869 y Fp(\(12\))1500 1899 y Fv(\()p Ft(T)37 b Fv(+)24 b Ft(\026)p Fv(\))1789 1869 y Fi(\000)p Fp(1)1879 1899 y Ft(:)78 b Fv(According)37 b(to)g(Herbst)h([8)o(],)j Ft(W)3006 1911 y Fp(2)3081 1899 y Fv(is)d(de-)451 1998 y(comp)r(osed)e(in)n(to)h Ft(W)1097 2010 y Fp(2)p Fn(n)1200 1998 y Fv(+)24 b Ft(R)1352 2010 y Fn(n)1435 1998 y Fv(where)36 b(\()p Ft(W)1794 2010 y Fp(2)p Fn(n)1873 1998 y Fv(\))1905 2010 y Fn(n)p Fi(2)p Fe(N)2074 1998 y Fv(is)h(a)f(sequence)g(of)h(Hilb)r(ert-Sc)n (hmidt)451 2098 y(op)r(erators)27 b(satisfying)h Fq(k)p Ft(W)1311 2110 y Fp(2)p Fn(n)1408 2098 y Fq(\000)19 b Ft(W)1570 2110 y Fp(2)1608 2098 y Fq(k)24 b(!)h Fv(0)k(for)f Ft(n)23 b Fq(!)g(1)p Ft(:)29 b Fv(It)g(follo)n(ws)e(that)i Ft(W)2918 2110 y Fp(2)p Fn(n)3026 2098 y Fv(is)g(com-)451 2198 y(pact)e(suc)n(h)g(that)g(also)f Ft(W)1245 2210 y Fp(2)1310 2198 y Fv(is)h(compact)f(\(see)h(e.g.)36 b([15)o(,)28 b(I)r(I)r(I.4.2,V.2.4]\).)36 b Ft(W)2839 2210 y Fp(2)p Fn(n)2945 2198 y Fv(is)27 b(de\014ned)451 2297 y(b)n(y)h(regularizing)e(the)i(Coulom)n(b)g(p)r(oten)n(tial)g(b)n (y)g(means)f(of)2345 2265 y Fp(1)p 2343 2279 38 4 v 2343 2326 a Fn(x)2405 2297 y Ft(e)2444 2267 y Fi(\000)p Fn(\017x)2593 2297 y Fv(and)h(b)n(y)f(in)n(tro)r(ducing)451 2397 y(con)n(v)n(ergence) g(generating)h(functions)i Ft(e)1719 2367 y Fi(\000)p Fn(\017p)1866 2397 y Fv(in)g(momen)n(tum)g(space,)f(where)g Ft(\017)d Fv(:=)3080 2364 y Fp(1)p 3076 2378 42 4 v 3076 2426 a Fn(n)3153 2397 y Ft(>)g Fv(0)451 2497 y(is)f(a)g(small)g(quan)n (tit)n(y)-7 b(.)35 b(Details)26 b(of)f(the)g(pro)r(of)g(are)f(found)h (in)h([11)o(].)36 b(The)25 b(adjacen)n(t)g(factors)451 2596 y(of)32 b Ft(W)628 2608 y Fp(2)698 2596 y Fv(in)h(\(2.11\))e(are)g (easily)g(seen)h(to)g(b)r(e)h(b)r(ounded)f(for)g Ft(\026)f Fv(=)f(0)p Ft(:)62 b Fv(Since)33 b(\003)2887 2608 y Fp(+)p Fn(;)p Fp(2)3025 2596 y Fv(=)d(\003)3178 2566 y Fp(2)3178 2617 y(+)p Fn(;)p Fp(2)451 2709 y Fv(comm)n(utes)e(with)i Ft(T)12 b Fv(,)28 b(one)g(has)g(e.g.)40 b(\003)1670 2721 y Fp(+)p Fn(;)p Fp(2)1777 2709 y Ft(T)12 b(T)1899 2674 y Fi(\000)p Fp(1)1887 2731 y(0)2025 2709 y Fv(=)24 b(\(\003)2204 2721 y Fp(+)p Fn(;)p Fp(2)2312 2709 y Ft(T)12 b Fv(\003)2431 2721 y Fp(+)p Fn(;)p Fp(2)2538 2709 y Fv(\))p Ft(T)2631 2674 y Fi(\000)p Fp(1)2619 2731 y(0)2758 2709 y Fv(=)24 b Ft(T)2896 2721 y Fp(0)2933 2709 y Ft(T)2994 2674 y Fi(\000)p Fp(1)2982 2731 y(0)3107 2709 y Fv(=)g(1)p Ft(:)451 2809 y Fv(Therefore,)e(the)g(op)r(erator)e(in)i(curly)f(brac)n(k)n(ets) f(and)i(hence)g Ft(R)2371 2821 y Fn(\026)2437 2809 y Fv(is)f(pro)n(v)n(en)g(to)g(b)r(e)h(compact)451 2909 y(for)27 b Ft(\026)c Fv(=)g(0)p Ft(:)p 3225 2909 4 57 v 3229 2856 50 4 v 3229 2909 V 3278 2909 4 57 v 451 3124 a Fh(Pr)l(o)l(of)64 b(of)34 b(The)l(or)l(em)f(2)p Fv(.)137 b(With)32 b(Prop)r(osition)e(1)g(at)h(hand,)h(it)g(remains)e(to)h(pro)n (v)n(e)f(the)451 3223 y(HVZ)e(theorem)f(for)g(the)h(op)r(erator)1583 3201 y(~)1582 3223 y Ft(h)1630 3193 y Fp(\(2\))1719 3223 y Fv(,)g(whic)n(h)f(in)h(fact)g(holds)f(for)g(all)h Ft(\015)f(<)c(\015) 2929 3235 y Fn(B)s(R)3036 3223 y Ft(:)451 3329 y Fv(W)-7 b(e)28 b(pro)r(ceed)f(along)g(the)h(same)f(lines)h(as)f(done)h(in)g (the)g(pro)r(of)f(of)h(the)g(HVZ)g(theorem)f(for)451 3429 y(the)33 b(Bro)n(wn-Ra)n(v)n(enhall)c(op)r(erator.)48 b(It)33 b(is)f(th)n(us)g(only)g(necessary)e(to)i(extend)g(Lemmata)451 3528 y(1,3,4)40 b(and)h(5)f(to)h(the)g(op)r(erator)1540 3506 y(~)1539 3528 y Ft(h)1587 3498 y Fp(\(2\))1717 3528 y Fv(whic)n(h)g(is)g(obtained)f(from)h Ft(h)2677 3498 y Fn(B)s(R)2825 3528 y Fv(b)n(y)g(including)451 3639 y(the)33 b(single-particle)e(second-order)f(p)r(oten)n(tials)j Ft(b)2050 3596 y Fp(\()p Fn(k)q Fp(\))2050 3661 y(2)p Fn(m)2145 3639 y Ft(;)77 b(k)34 b Fv(=)d(1)p Ft(;)14 b Fv(2)p Ft(:)63 b Fv(W)-7 b(e)33 b(start)e(with)j(the)451 3739 y(lemmata)27 b(required)g(for)g(the)h('hard)f(part')g(of)h(the)g (pro)r(of.)451 3892 y Fh(a\))108 b Fv(In)24 b(the)h(form)n(ulation)e (of)h(Lemma)g(1)f(w)n(e)h(simply)g(replace)f Ft(h)2475 3862 y Fn(B)s(R)2607 3892 y Fv(b)n(y)2719 3870 y(~)2719 3892 y Ft(h)2767 3862 y Fp(\(2\))2880 3892 y Fv(throughout)451 3992 y(\(and)28 b(tak)n(e)f Ft(N)32 b Fv(=)22 b(2\).)451 4097 y(In)36 b(order)d(to)j(pro)n(v)n(e)d Fq(k)p Fv([)1194 4075 y(~)1193 4097 y Ft(h)1241 4067 y Fp(\(2\))1330 4097 y Ft(;)14 b(\037)1419 4109 y Fp(0)1456 4097 y Fv(])g Ft( )1547 4109 y Fn(n)1592 4097 y Fq(k)49 b(\024)1799 4065 y Fn(c)p 1793 4079 42 4 v 1793 4126 a(n)1858 4097 y Fq(k)p Ft( )1954 4109 y Fn(n)1999 4097 y Fq(k)71 b Fv(with)35 b Ft( )2362 4109 y Fn(n)2443 4097 y Fq(2)i(A)p Fv(\()p Ft(C)2698 4067 y Fi(1)2692 4118 y Fp(0)2769 4097 y Fv(\()p Fo(R)2855 4067 y Fp(3)2898 4097 y Fv(\))24 b Fq(\012)f Fo(C)3096 4067 y Fp(2)3139 4097 y Fv(\))3171 4067 y Fp(2)3244 4097 y Fv(a)451 4212 y(W)-7 b(eyl)35 b(sequence)f(for)h Ft(\025)g Fq(2)g Ft(\033)1374 4224 y Fn(ess)1473 4212 y Fv(\()1506 4190 y(~)1505 4212 y Ft(h)1553 4182 y Fp(\(2\))1642 4212 y Fv(\))g(and)g Ft(\037)1930 4224 y Fp(0)2002 4212 y Fv(from)f(\(1.13\))g(with)i Fk(x)f Fv(:=)g(\()p Fk(x)2939 4224 y Fp(1)2977 4212 y Ft(;)14 b Fk(x)3064 4224 y Fp(2)3101 4212 y Fv(\))p Ft(;)35 b Fv(w)n(e)451 4311 y(ha)n(v)n(e)27 b(to)g(sho)n(w)g(in)h(addition)f(to)h (the)g(Bro)n(wn-Ra)n(v)n(enhall)c(case,)1256 4523 y Fq(j)p Fv(\()p Ft(\036;)29 b Fv([)p Ft(b)1471 4480 y Fp(\(1\))1471 4545 y(2)p Fn(m)1567 4523 y Ft(;)14 b(\037)1656 4535 y Fp(0)1693 4523 y Fv(])23 b Ft( )1793 4535 y Fn(n)1838 4523 y Fv(\))p Fq(j)47 b(\024)2067 4467 y Ft(c)p 2060 4504 50 4 v 2060 4580 a(n)2143 4523 y Fq(k)p Ft(\036)p Fq(k)23 b(k)p Ft( )2395 4535 y Fn(n)2439 4523 y Fq(k)593 b Fv(\(2.12\))451 4751 y(for)36 b(all)g Ft(\036)j Fq(2)f Ft(C)957 4721 y Fi(1)951 4772 y Fp(0)1028 4751 y Fv(\()p Fo(R)1114 4721 y Fp(6)1157 4751 y Fv(\))25 b Fq(\012)f Fo(C)1357 4721 y Fp(4)1400 4751 y Ft(:)75 b Fv(Due)37 b(to)f(the)h(symmetry)f(prop)r(ert)n(y)g(of)g Ft( )2846 4763 y Fn(n)2892 4751 y Fv(,)j(the)d(same)451 4867 y(b)r(ound)31 b(holds)g(also)e(for)h([)p Ft(b)1289 4824 y Fp(\(2\))1289 4889 y(2)p Fn(m)1385 4867 y Ft(;)14 b(\037)1474 4879 y Fp(0)1511 4867 y Fv(])p Ft(:)59 b Fv(The)31 b(op)r(erator)e Ft(b)2164 4824 y Fp(\(1\))2164 4889 y(2)p Fn(m)2291 4867 y Fv(de\014ned)i(in)g(\(2.4\))f(is)h(a)f(sum)h(of)451 4984 y(terms)f(of)g(the)g(structure)g Ft(B)t Fv(\()p Fk(p)1438 4996 y Fp(1)1475 4984 y Fv(\))1536 4951 y Fp(1)p 1518 4965 71 4 v 1518 5013 a Fn(x)1556 5021 y Ff(1)1598 4984 y Ft(B)1661 4996 y Fn(\025)1704 4984 y Fv(\()p Fk(p)1789 4996 y Fp(1)1827 4984 y Fv(\))14 b Ft(V)1940 4941 y Fp(\(1\))1921 5006 y(10)p Fn(;m)2070 4984 y Ft(B)2133 4996 y Fn(\026)2178 4984 y Fv(\()p Fk(p)2263 4996 y Fp(1)2300 4984 y Fv(\))58 b(where)29 b Ft(B)t Fv(\()p Fk(p)2784 4996 y Fp(1)2822 4984 y Fv(\))e Fq(2)h(f)p Ft(A)3068 4996 y Fp(1)3105 4984 y Ft(;)14 b(G)3207 4996 y Fp(1)3244 4984 y Fq(g)451 5122 y Fv(lik)n(e)22 b(for)f Ft(b)755 5079 y Fp(\(1\))755 5144 y(1)p Fn(m)873 5122 y Fv(whereas)g Ft(B)1245 5134 y Fn(\025)1289 5122 y Fv(\()p Fk(p)1374 5134 y Fp(1)1411 5122 y Fv(\))p Ft(;)14 b(B)1543 5134 y Fn(\026)1588 5122 y Fv(\()p Fk(p)1673 5134 y Fp(1)1710 5122 y Fv(\))38 b Fq(2)23 b(f)p Fv(1)p Ft(;)1988 5085 y Fc(\033)2035 5060 y Ff(\(1\))2112 5085 y Fd(p)2154 5093 y Ff(1)p 1988 5103 199 4 v 2029 5151 a Fn(E)2078 5159 y Fj(p)2109 5171 y Ff(1)2196 5122 y Ft(;)2272 5090 y Fn(m)p 2243 5104 117 4 v 2243 5151 a(E)2292 5159 y Fj(p)2323 5171 y Ff(1)2369 5122 y Ft(;)14 b(A)2468 5134 y Fp(1)2506 5122 y Ft(;)g(G)2608 5134 y Fp(1)2645 5122 y Fq(g)45 b Fv(are)21 b(all)g(analytic,)1108 5338 y Fw(Document)l(a)k(Ma)l(thema)l(tica)h(10)f(\(2005\))g(497{525)p eop %%Page: 511 15 511 14 bop 1301 518 a Ft(N)9 b Fs(-Electr)n(on)31 b(HVZ)f(Theorem)726 b Fv(511)451 725 y(b)r(ounded)26 b(m)n(ultiplication)f(op)r(erators)e (in)i(momen)n(tum)g(space.)35 b(W)-7 b(e)26 b(pic)n(k)e(for)h(the)g (sak)n(e)f(of)451 825 y(demonstration)j(the)h(second)f(term)g(of)h (\(2.4\))f(and)h(decomp)r(ose)681 1041 y([)p Ft(G)769 1053 y Fp(1)852 985 y Fv(1)p 830 1022 85 4 v 830 1098 a Ft(x)877 1110 y Fp(1)949 985 y Fl(\033)1009 955 y Fp(\(1\))1098 985 y Fk(p)1151 997 y Fp(1)p 949 1022 240 4 v 1002 1098 a Ft(E)1063 1110 y Fn(p)1097 1118 y Ff(1)1212 1041 y Ft(V)1279 998 y Fp(\(1\))1260 1063 y(10)p Fn(;m)1409 1041 y Ft(A)1471 1053 y Fp(1)1509 1041 y Ft(;)g(\037)1612 1053 y Fp(0)1649 1041 y Fv(])46 b(=)g([)p Ft(G)1917 1053 y Fp(1)1954 1041 y Ft(;)14 b(\037)2043 1053 y Fp(0)2080 1041 y Fv(])23 b Ft(p)2168 1053 y Fp(1)2224 1041 y Fq(\001)2337 985 y Fv(1)p 2275 1022 164 4 v 2275 1098 a Ft(p)2317 1110 y Fp(1)2354 1098 y Ft(x)2401 1110 y Fp(1)2473 985 y Fl(\033)2533 955 y Fp(\(1\))2622 985 y Fk(p)2675 997 y Fp(1)p 2473 1022 240 4 v 2527 1098 a Ft(E)2588 1110 y Fn(p)2622 1118 y Ff(1)2736 1041 y Ft(V)2803 998 y Fp(\(1\))2784 1063 y(10)p Fn(;m)2934 1041 y Ft(A)2996 1053 y Fp(1)560 1317 y Fv(+)g Ft(G)713 1329 y Fp(1)835 1261 y Fv(1)p 774 1298 164 4 v 774 1374 a Ft(x)821 1386 y Fp(1)859 1374 y Ft(p)901 1386 y Fp(1)966 1317 y Fq(\001)c Ft(p)1050 1329 y Fp(1)1101 1317 y Fv([)1134 1261 y Fl(\033)1194 1231 y Fp(\(1\))1283 1261 y Fk(p)1336 1273 y Fp(1)p 1134 1298 240 4 v 1188 1374 a Ft(E)1249 1386 y Fn(p)1283 1394 y Ff(1)1383 1317 y Ft(;)14 b(\037)1472 1329 y Fp(0)1509 1317 y Fv(])g Ft(V)1613 1274 y Fp(\(1\))1594 1339 y(10)p Fn(;m)1744 1317 y Ft(A)1806 1329 y Fp(1)1862 1317 y Fv(+)41 b Ft(G)2033 1329 y Fp(1)2155 1261 y Fv(1)p 2094 1298 164 4 v 2094 1374 a Ft(x)2141 1386 y Fp(1)2179 1374 y Ft(p)2221 1386 y Fp(1)2291 1261 y Fl(\033)2351 1231 y Fp(\(1\))2441 1261 y Fk(p)2494 1273 y Fp(1)p 2291 1298 240 4 v 2345 1374 a Ft(E)2406 1386 y Fn(p)2440 1394 y Ff(1)2559 1317 y Fq(\001)19 b Ft(p)2643 1329 y Fp(1)2694 1317 y Fv([)p Ft(V)2784 1274 y Fp(\(1\))2765 1339 y(10)p Fn(;m)2914 1317 y Ft(;)14 b(\037)3003 1329 y Fp(0)3040 1317 y Fv(])g Ft(A)3139 1329 y Fp(1)1090 1570 y Fv(+)22 b Ft(G)1242 1582 y Fp(1)1365 1514 y Fv(1)p 1304 1551 164 4 v 1304 1627 a Ft(x)1351 1639 y Fp(1)1388 1627 y Ft(p)1430 1639 y Fp(1)1501 1514 y Fl(\033)1561 1484 y Fp(\(1\))1650 1514 y Fk(p)1703 1526 y Fp(1)p 1501 1551 240 4 v 1555 1627 a Ft(E)1616 1639 y Fn(p)1650 1647 y Ff(1)1769 1570 y Fq(\001)d Ft(p)1853 1582 y Fp(1)1903 1570 y Ft(V)1970 1527 y Fp(\(1\))1951 1592 y(10)p Fn(;m)2129 1514 y Fv(1)p 2111 1551 80 4 v 2111 1627 a Ft(p)2153 1639 y Fp(1)2218 1570 y Fq(\001)g Ft(p)2302 1582 y Fp(1)2353 1570 y Fv([)p Ft(A)2438 1582 y Fp(1)2475 1570 y Ft(;)14 b(\037)2564 1582 y Fp(0)2601 1570 y Fv(])p Ft(:)427 b Fv(\(2.13\))451 1764 y(W)-7 b(e)19 b(will)g(sho)n(w)f(that)h(the)g (comm)n(utators)e(\(including)j(the)f(factor)f Ft(p)2516 1776 y Fp(1)2553 1764 y Fv(\))h(are)2747 1731 y Fp(1)p 2743 1745 42 4 v 2743 1792 a Fn(n)2794 1764 y Fv(-b)r(ounded)g(and)451 1863 y(the)27 b(adjacen)n(t)f(factors)f(b)r(ounded.)37 b(The)26 b(latter)g(is)h(trivial)e(\(since)i(also)2748 1830 y Fp(1)p 2696 1844 137 4 v 2696 1892 a Fn(x)2734 1900 y Ff(1)2766 1892 y Fn(p)2800 1900 y Ff(1)2869 1863 y Fv(is)f(b)r(ounded,)451 1998 y Fq(k)554 1965 y Fp(1)p 503 1979 V 503 2027 a Fn(x)541 2035 y Ff(1)573 2027 y Fn(p)607 2035 y Ff(1)649 1998 y Fq(k)d Fv(=)g(2)p Ft(;)k Fv(see)g(e.g.)36 b([8]\))28 b(except)g(for)f(the)h(op)r(erator)d Ft(p)2244 2010 y Fp(1)2282 1998 y Ft(V)2348 1955 y Fp(\(1\))2330 2020 y(10)p Fn(;m)2506 1965 y Fp(1)p 2489 1979 67 4 v 2489 2027 a Fn(p)2523 2035 y Ff(1)2593 1998 y Fv(in)j(the)g(last)f (term.)451 2098 y(The)34 b(b)r(oundedness)h(of)f(this)g(op)r(erator)f (is)h(readily)f(pro)n(v)n(ed)g(b)n(y)h(in)n(v)n(oking)f(its)h(k)n (ernel)g(in)451 2197 y(momen)n(tum)28 b(space.)36 b(F)-7 b(rom)27 b(\(2.1\))h(w)n(e)f(ha)n(v)n(e)871 2401 y Fq(k)14 b Ft(p)969 2413 y Fp(1)1028 2401 y Ft(V)1095 2358 y Fp(\(1\))1076 2423 y(10)p Fn(;m)1277 2345 y Fv(1)p 1259 2382 80 4 v 1259 2458 a Ft(p)1301 2470 y Fp(1)1348 2401 y Fq(k)45 b Fv(=)h(2)p Ft(\031)1638 2367 y Fp(2)1698 2401 y Fq(k)1754 2288 y Fm(Z)1836 2309 y Fi(1)1799 2477 y Fp(0)1921 2401 y Ft(dt)23 b(e)2056 2367 y Fi(\000)p Fn(tE)2182 2375 y Fj(p)2213 2387 y Ff(1)2266 2401 y Ft(p)2308 2413 y Fp(1)2440 2345 y Fv(1)p 2378 2382 164 4 v 2378 2458 a Ft(x)2425 2470 y Fp(1)2463 2458 y Ft(p)2505 2470 y Fp(1)2575 2401 y Ft(e)2614 2367 y Fi(\000)p Fn(tE)2740 2375 y Fj(p)2771 2387 y Ff(1)2825 2401 y Fq(k)890 2660 y(\024)46 b Fv(2)p Ft(\031)1093 2625 y Fp(2)1144 2660 y Fq(k)1200 2547 y Fm(Z)1282 2567 y Fi(1)1245 2735 y Fp(0)1366 2660 y Ft(dt)23 b(e)1501 2625 y Fi(\000)p Fn(tE)1627 2633 y Fj(p)1658 2645 y Ff(1)1721 2660 y Ft(p)1763 2672 y Fp(1)1814 2660 y Fq(k)18 b(\001)h(k)2028 2604 y Fv(1)p 1968 2641 V 1968 2717 a Ft(x)2015 2729 y Fp(1)2052 2717 y Ft(p)2094 2729 y Fp(1)2141 2660 y Fq(k)f(\001)g(k)p Ft(e)2323 2625 y Fi(\000)p Fn(tE)2449 2633 y Fj(p)2480 2645 y Ff(1)2520 2660 y Fq(k)45 b(\024)h Fv(4)p Ft(\031)2810 2625 y Fp(2)3074 2660 y Fv(\(2.14\))451 2895 y(where)699 2811 y Fi(1)697 2828 y Fm(R)700 2971 y Fp(0)771 2895 y Ft(dt)14 b(e)897 2865 y Fi(\000)p Fn(tE)1023 2873 y Fj(p)1054 2885 y Ff(1)1117 2895 y Fv(=)23 b(1)p Ft(=E)1350 2907 y Fn(p)1384 2915 y Ff(1)1471 2895 y Fv(has)k(b)r(een)h(used.)451 3050 y(The)33 b(comm)n(utators)f Ft(p)1176 3062 y Fp(1)1227 3050 y Fv([)p Ft(A)1312 3062 y Fp(1)1349 3050 y Ft(;)14 b(\037)1438 3062 y Fp(0)1475 3050 y Fv(])33 b(and)g Ft(p)1740 3062 y Fp(1)1791 3050 y Fv([)p Ft(G)1879 3062 y Fp(1)1917 3050 y Ft(;)14 b(\037)2006 3062 y Fp(0)2043 3050 y Fv(])47 b(ha)n(v)n(e)31 b(already)h(b)r(een)h(dealt)g(with)h(in)451 3173 y(the)i(con)n(text)f(of)g(the)h(Bro)n(wn-Ra)n(v)n(enhall)c(op)r (erator.)58 b Ft(p)2248 3185 y Fp(1)2299 3173 y Fv([)2332 3136 y Fc(\033)2379 3110 y Ff(\(1\))2457 3136 y Fd(p)2499 3144 y Ff(1)p 2332 3153 199 4 v 2374 3201 a Fn(E)2423 3209 y Fj(p)2454 3221 y Ff(1)2541 3173 y Ft(;)14 b(\037)2630 3185 y Fp(0)2667 3173 y Fv(])71 b(is)35 b(of)h(the)f(same)451 3293 y(t)n(yp)r(e,)i(b)r(ecause)e(for)f(an)n(y)g Ft(B)1346 3305 y Fn(\025)1390 3293 y Fv(,)j(one)e(has)f(the)h(estimate)g Fq(j)p Ft(B)2341 3305 y Fn(\025)2385 3293 y Fv(\()p Fk(p)2470 3305 y Fp(1)2507 3293 y Fv(\))24 b Fq(\000)f Ft(B)2714 3305 y Fn(\025)2757 3293 y Fv(\()p Fk(p)2842 3263 y Fi(0)2842 3313 y Fp(1)2880 3293 y Fv(\))p Fq(j)50 b Fv(=)35 b Fq(j)p Fk(p)3161 3305 y Fp(1)3221 3293 y Fq(\000)451 3392 y Fk(p)504 3362 y Fi(0)504 3413 y Fp(1)541 3392 y Fq(j)14 b(jr)670 3404 y Fd(p)712 3412 y Ff(1)763 3392 y Ft(B)826 3404 y Fn(\025)869 3392 y Fv(\()p Fl(\030)s Fv(\))p Fq(j)48 b(\024)f(j)p Fk(p)1237 3404 y Fp(1)1297 3392 y Fq(\000)23 b Fk(p)1438 3362 y Fi(0)1438 3413 y Fp(1)1475 3392 y Fq(j)1566 3358 y Fn(c)1596 3366 y Ff(0)p 1522 3373 151 4 v 1522 3421 a Fp(1+)p Fn(p)1640 3429 y Ff(1)1750 3392 y Fv(from)34 b(the)g(mean)g(v)-5 b(alue)34 b(theorem,)h(where)e Fl(\030)k Fv(is)451 3527 y(some)27 b(p)r(oin)n(t)h(b)r(et)n(w)n(een)g Fk(p)1250 3539 y Fp(1)1314 3527 y Fv(and)g Fk(p)1529 3497 y Fi(0)1529 3548 y Fp(1)1566 3527 y Fv(.)37 b(F)-7 b(or)27 b(the)h(comm)n(utator)f(with)h Ft(V)2643 3484 y Fp(\(1\))2624 3549 y(10)p Fn(;m)2801 3527 y Fv(w)n(e)f(ha)n(v)n(e)910 3744 y Ft(p)952 3756 y Fp(1)1003 3744 y Fv([)p Ft(V)1092 3701 y Fp(\(1\))1074 3766 y(10)p Fn(;m)1223 3744 y Ft(;)14 b(\037)1312 3756 y Fp(0)1349 3744 y Fv(])46 b(=)g(2)p Ft(\031)1621 3709 y Fp(2)1672 3631 y Fm(Z)1755 3651 y Fi(1)1718 3819 y Fp(0)1839 3744 y Ft(dt)23 b(p)1977 3756 y Fp(1)2028 3744 y Fv([)p Ft(e)2090 3709 y Fi(\000)p Fn(tE)2216 3717 y Fj(p)2247 3729 y Ff(1)2287 3744 y Ft(;)14 b(\037)2376 3756 y Fp(0)2413 3744 y Fv(])2482 3687 y(1)p 2460 3725 85 4 v 2460 3801 a Ft(x)2507 3813 y Fp(1)2568 3744 y Ft(e)2607 3709 y Fi(\000)p Fn(tE)2733 3717 y Fj(p)2764 3729 y Ff(1)1176 4002 y Fv(+)22 b(2)p Ft(\031)1355 3968 y Fp(2)1406 3889 y Fm(Z)1489 3910 y Fi(1)1452 4078 y Fp(0)1573 4002 y Ft(dt)i(p)1712 4014 y Fp(1)1762 4002 y Ft(e)1801 3968 y Fi(\000)p Fn(tE)1927 3976 y Fj(p)1958 3988 y Ff(1)2044 3946 y Fv(1)p 2022 3983 V 2022 4059 a Ft(x)2069 4071 y Fp(1)2130 4002 y Fv([)p Ft(e)2192 3968 y Fi(\000)p Fn(tE)2318 3976 y Fj(p)2349 3988 y Ff(1)2389 4002 y Ft(;)14 b(\037)2478 4014 y Fp(0)2515 4002 y Fv(])p Ft(:)513 b Fv(\(2.15\))451 4191 y(The)34 b(pro)r(of)f(of)h(its)1088 4158 y Fp(1)p 1084 4172 42 4 v 1084 4219 a Fn(n)1135 4191 y Fv(-b)r(oundedness)g(pro)r(ceeds)f(with)h(the)g(help)g(of)g(the) g(Lieb)g(and)g(Y)-7 b(au)451 4290 y(form)n(ula)28 b([17)o(],)h(deriv)n (ed)e(from)i(the)f(Sc)n(h)n(w)n(arz)f(inequalit)n(y)h(\(see)g(also)g ([14)o(,)h(Lemma)f(7]\),)h(in)451 4390 y(momen)n(tum)f(space.)36 b(Explicitly)-7 b(,)28 b(in)g(the)g(estimate)556 4620 y Fq(j)p Fv(\()622 4599 y(^)611 4620 y Ft(\036)q(;)710 4601 y Fo([)698 4620 y Fq(O)16 b Ft( )834 4632 y Fn(n)879 4620 y Fv(\))p Fq(j)47 b(\024)1091 4503 y Fm(\022)1152 4507 y(Z)1199 4696 y Fe(R)1246 4680 y Ff(6)1291 4620 y Ft(d)p Fk(p)23 b Fq(j)1444 4599 y Fv(^)1433 4620 y Ft(\036)q Fv(\()p Fk(p)p Fv(\))p Fq(j)1623 4586 y Fp(2)1684 4620 y Ft(I)7 b Fv(\()p Fk(p)p Fv(\))1844 4503 y Fm(\023)1915 4498 y Ff(1)p 1915 4507 29 3 v 1915 4541 a(2)1972 4503 y Fm(\022)2033 4507 y(Z)2079 4696 y Fe(R)2126 4680 y Ff(6)2171 4620 y Ft(d)p Fk(p)2267 4586 y Fi(0)2314 4620 y Fq(j)2354 4599 y Fv(^)2337 4620 y Ft( )2391 4632 y Fn(n)2436 4620 y Fv(\()p Fk(p)2521 4586 y Fi(0)2545 4620 y Fv(\))p Fq(j)2600 4586 y Fp(2)2660 4620 y Ft(J)h Fv(\()p Fk(p)2799 4586 y Fi(0)2823 4620 y Fv(\))2855 4503 y Fm(\023)2927 4498 y Ff(1)p 2927 4507 V 2927 4541 a(2)3074 4620 y Fv(\(2.16\))451 4852 y(where)28 b Fq(O)d Fv(:=)f Ft(p)937 4864 y Fp(1)974 4852 y Fv([)p Ft(V)1063 4808 y Fp(\(1\))1045 4874 y(10)p Fn(;m)1194 4852 y Ft(;)14 b(\037)1283 4864 y Fp(0)1320 4852 y Fv(])28 b(and)g Ft(k)1576 4864 y Fi(O)1662 4852 y Fv(its)h(k)n(ernel,)e(one)g(has)g(to)h(sho)n(w)f(that)h(the)g(in)n (tegrals)451 4951 y Ft(I)35 b Fv(and)27 b Ft(J)36 b Fv(ob)r(ey)1150 5094 y Ft(I)7 b Fv(\()p Fk(p)p Fv(\))24 b(:=)1467 4981 y Fm(Z)1513 5170 y Fe(R)1560 5153 y Ff(6)1606 5094 y Ft(d)p Fk(p)1702 5060 y Fi(0)1748 5094 y Fq(j)p Ft(k)1814 5106 y Fi(O)1873 5094 y Fv(\()p Fk(p)p Ft(;)14 b Fk(p)2048 5060 y Fi(0)2072 5094 y Fv(\))p Fq(j)2172 5038 y Ft(f)9 b Fv(\()p Fk(p)p Fv(\))p 2160 5075 191 4 v 2160 5151 a Ft(f)g Fv(\()p Fk(p)2295 5127 y Fi(0)2318 5151 y Fv(\))2407 5094 y Fq(\024)2534 5038 y Ft(c)p 2527 5075 50 4 v 2527 5151 a(n)1108 5338 y Fw(Document)l(a)25 b(Ma)l(thema)l(tica)h(10)f (\(2005\))g(497{525)p eop %%Page: 512 16 512 15 bop 451 518 a Fv(512)727 b Fs(D.)30 b(H.)h(Jakubassa-Amundsen) 1144 761 y Ft(J)8 b Fv(\()p Fk(p)1283 726 y Fi(0)1307 761 y Fv(\))23 b(:=)1496 648 y Fm(Z)1542 836 y Fe(R)1589 820 y Ff(6)1635 761 y Ft(d)p Fk(p)g Fq(j)p Ft(k)1820 773 y Fi(O)1879 761 y Fv(\()p Fk(p)p Ft(;)14 b Fk(p)2054 726 y Fi(0)2077 761 y Fv(\))p Fq(j)2166 704 y Ft(f)9 b Fv(\()p Fk(p)2301 674 y Fi(0)2324 704 y Fv(\))p 2166 742 191 4 v 2178 818 a Ft(f)g Fv(\()p Fk(p)p Fv(\))2412 761 y Fq(\024)2540 704 y Ft(c)p 2533 742 50 4 v 2533 818 a(n)3074 761 y Fv(\(2.17\))451 953 y(with)27 b(some)e(constan)n(t)g Ft(c)h Fv(\(indep)r(enden)n(t)h(of)e Fk(p)p Ft(;)14 b Fk(p)1976 923 y Fi(0)2000 953 y Fv(\))49 b(for)25 b(a)h(suitably)f(c)n (hosen)g(nonnegativ)n(e)451 1053 y(con)n(v)n(ergence)g(generating)h (function)j Ft(f)9 b Fv(.)451 1152 y(W)-7 b(e)33 b(use)g(the)g(t)n(w)n (o-dimensional)e(\()p Ft(N)41 b Fv(=)31 b(2\))i(F)-7 b(ourier)32 b(transform)f(\(1.14\))h(of)h Ft(\037)2934 1164 y Fp(0)3004 1152 y Fv(and)g(the)451 1252 y(momen)n(tum)28 b(represen)n(tation)e(of)1553 1219 y Fp(1)p 1534 1233 71 4 v 1534 1281 a Fn(x)1572 1289 y Ff(1)1642 1252 y Fv(to)i(write)f(for)g(the)h(\014rst)f(term)h(in)g(\(2.15\),)508 1510 y(\()540 1397 y Fm(Z)623 1418 y Fi(1)586 1586 y Fp(0)666 1510 y Ft(dt)1083 1439 y Fo(\\)739 1510 y Ft(p)781 1522 y Fp(1)818 1510 y Fv([)p Ft(e)880 1480 y Fi(\000)p Fn(tE)1006 1488 y Fj(p)1037 1500 y Ff(1)1077 1510 y Ft(;)14 b(\037)1166 1522 y Fp(0)1203 1510 y Fv(])1257 1454 y(1)p 1236 1491 85 4 v 1236 1567 a Ft(x)1283 1579 y Fp(1)1331 1510 y Ft(e)1370 1480 y Fi(\000)p Fn(tE)1496 1488 y Fj(p)1527 1500 y Ff(1)1566 1510 y Ft(')q Fv(\)\()p Fk(p)1738 1522 y Fp(1)1775 1510 y Ft(;)g Fk(p)1865 1522 y Fp(2)1903 1510 y Fv(\))23 b(=)2032 1397 y Fm(Z)2078 1586 y Fe(R)2125 1569 y Ff(6)2129 1510 y Ft(d)p Fk(q)p Ft(d)p Fk(p)2318 1476 y Fi(0)2318 1531 y Fp(2)2356 1510 y Ft(k)2399 1522 y Fp(1)2436 1510 y Fv(\()p Fk(p)2521 1522 y Fp(1)2559 1510 y Ft(;)14 b Fk(p)2649 1522 y Fp(2)2686 1510 y Ft(;)g Fk(q)p Ft(;)g Fk(p)2863 1476 y Fi(0)2863 1531 y Fp(2)2901 1510 y Fv(\))f(^)-55 b Ft(')p Fv(\()p Fk(q)p Ft(;)14 b Fk(p)3159 1476 y Fi(0)3159 1531 y Fp(2)3197 1510 y Fv(\))451 1785 y Ft(k)494 1797 y Fp(1)532 1785 y Fv(\()p Fk(p)617 1797 y Fp(1)654 1785 y Ft(;)g Fk(p)744 1797 y Fp(2)781 1785 y Ft(;)g Fk(q)p Ft(;)g Fk(p)958 1751 y Fi(0)958 1805 y Fp(2)996 1785 y Fv(\))23 b(:=)1271 1729 y(1)p 1195 1766 194 4 v 1195 1842 a(\(2)p Ft(\031)s Fv(\))1351 1818 y Fp(3)1475 1729 y Fv(1)p 1432 1766 130 4 v 1432 1842 a(2)p Ft(\031)1524 1818 y Fp(2)1594 1785 y Ft(p)1636 1797 y Fp(1)1686 1785 y Ft(n)1736 1751 y Fp(6)1787 1672 y Fm(Z)1870 1692 y Fi(1)1834 1860 y Fp(0)1955 1785 y Ft(dt)2042 1672 y Fm(Z)2088 1860 y Fe(R)2135 1844 y Ff(3)2180 1785 y Ft(d)p Fk(p)2276 1751 y Fi(0)2276 1805 y Fp(1)2347 1785 y Fv(^)-52 b Ft(\037)2389 1797 y Fp(0)2426 1785 y Fv(\()p Ft(n)p Fv(\()p Fk(p)2593 1797 y Fp(1)2640 1785 y Fq(\000)10 b Fk(p)2768 1751 y Fi(0)2768 1805 y Fp(1)2805 1785 y Fv(\))p Ft(;)k(n)p Fv(\()p Fk(p)3009 1797 y Fp(2)3057 1785 y Fq(\000)c Fk(p)3185 1751 y Fi(0)3185 1805 y Fp(2)3221 1785 y Fv(\)\))3074 1933 y(\(2.18\))1230 2072 y Fq(\001)p Fv(\()p Ft(e)1324 2038 y Fi(\000)p Fn(tE)1450 2046 y Fj(p)1481 2058 y Ff(1)1540 2072 y Fq(\000)18 b Ft(e)1662 2025 y Fi(\000)p Fn(tE)1788 2042 y Fj(p)1819 2028 y Fg(0)1819 2063 y Ff(1)1858 2072 y Fv(\))2066 2016 y(1)p 1924 2053 326 4 v 1924 2129 a Fq(j)p Fk(p)2000 2100 y Fi(0)2000 2151 y Fp(1)2056 2129 y Fq(\000)g Fk(q)p Fq(j)2212 2105 y Fp(2)2282 2072 y Ft(e)2321 2038 y Fi(\000)p Fn(tE)2447 2046 y Fj(q)2484 2072 y Ft(:)451 2261 y Fv(F)-7 b(rom)27 b(the)h(mean)g(v)-5 b(alue)27 b(theorem)g(w)n(e)h(get)613 2472 y Fq(j)p Ft(e)675 2438 y Fi(\000)p Fn(tE)801 2446 y Fj(p)832 2458 y Ff(1)891 2472 y Fq(\000)18 b Ft(e)1013 2426 y Fi(\000)p Fn(tE)1139 2443 y Fj(p)1170 2429 y Fg(0)1170 2463 y Ff(1)1210 2472 y Fq(j)46 b Fv(=)f Fq(j)p Fk(p)1465 2484 y Fp(1)1521 2472 y Fq(\000)18 b Fk(p)1657 2438 y Fi(0)1657 2493 y Fp(1)1695 2472 y Fq(j)23 b(j)p Ft(te)1833 2438 y Fi(\000)p Fn(tE)1959 2447 y Fj(\030)2054 2416 y Fl(\030)p 2028 2453 98 4 v 2028 2529 a Ft(E)2089 2541 y Fn(\030)2135 2472 y Fq(j)47 b(\024)e(j)p Fk(p)2391 2484 y Fp(1)2447 2472 y Fq(\000)18 b Fk(p)2583 2438 y Fi(0)2583 2493 y Fp(1)2620 2472 y Fq(j)23 b Ft(t)14 b(e)2749 2438 y Fi(\000)p Fn(tE)2875 2447 y Fj(\030)3074 2472 y Fv(\(2.19\))451 2697 y(with)22 b Fl(\030)k Fv(=)d Ft(\025)p Fk(p)891 2667 y Fi(0)891 2718 y Fp(1)935 2697 y Fv(+)7 b(\(1)g Fq(\000)g Ft(\025)p Fv(\))p Fk(p)1293 2709 y Fp(1)1374 2697 y Fv(for)22 b(some)f Ft(\025)i Fq(2)h Fv([0)p Ft(;)14 b Fv(1])p Ft(:)44 b Fv(W)-7 b(e)22 b(ha)n(v)n(e)e(to)i (sho)n(w)f(that)h(the)g(in)n(tegral)451 2797 y(o)n(v)n(er)e(the)j(mo)r (dulus)f(of)g(the)g(k)n(ernel)f(of)h(\(2.18\),)h(with)f(a)g(suitable)g (con)n(v)n(ergence)d(generating)451 2896 y(function)39 b Ft(f)9 b Fv(,)41 b(is)1009 2864 y Fp(1)p 1005 2878 42 4 v 1005 2925 a Fn(n)1056 2896 y Fv(-b)r(ounded.)69 b(W)-7 b(e)39 b(c)n(ho)r(ose)e Ft(f)9 b Fv(\()p Ft(p)p Fv(\))41 b(=)g Ft(p)d Fv(and)g(mak)n(e)g(the)g(substitution)451 2996 y Fk(y)501 3008 y Fn(i)552 2996 y Fv(:=)23 b Ft(n)p Fv(\()p Fk(p)798 3008 y Fn(i)844 2996 y Fq(\000)18 b Fk(p)980 2966 y Fi(0)980 3018 y Fn(i)1008 2996 y Fv(\))51 b(for)27 b Fk(p)1271 2966 y Fi(0)1271 3018 y Fn(i)1299 2996 y Ft(;)60 b(i)22 b Fv(=)h(1)p Ft(;)14 b Fv(2)p Ft(:)50 b Fv(Then)997 3218 y Ft(I)7 b Fv(\()p Fk(p)1125 3230 y Fp(1)1162 3218 y Ft(;)14 b Fk(p)1252 3230 y Fp(2)1289 3218 y Fv(\))24 b(:=)1479 3105 y Fm(Z)1525 3293 y Fe(R)1572 3277 y Ff(6)1617 3218 y Ft(d)p Fk(q)14 b Ft(d)p Fk(p)1820 3183 y Fi(0)1820 3238 y Fp(2)1881 3218 y Fq(j)p Ft(k)1947 3230 y Fp(1)1985 3218 y Fv(\()p Fk(p)2070 3230 y Fp(1)2107 3218 y Ft(;)g Fk(p)2197 3230 y Fp(2)2234 3218 y Ft(;)g Fk(q)p Ft(;)g Fk(p)2411 3183 y Fi(0)2411 3238 y Fp(2)2449 3218 y Fv(\))p Fq(j)2537 3161 y Ft(f)9 b Fv(\()p Ft(p)2661 3173 y Fp(1)2698 3161 y Fv(\))p 2537 3198 194 4 v 2557 3274 a Ft(f)g Fv(\()p Ft(q)s Fv(\))937 3494 y Fq(\024)1159 3438 y Fv(1)p 1058 3475 244 4 v 1058 3551 a(\(2)p Ft(\031)s Fv(\))1214 3527 y Fp(4)1251 3551 y Ft(\031)1335 3494 y(p)1377 3506 y Fp(1)1428 3381 y Fm(Z)1511 3402 y Fi(1)1474 3570 y Fp(0)1595 3494 y Ft(dt)1682 3381 y Fm(Z)1728 3570 y Fe(R)1775 3553 y Ff(3)1820 3494 y Ft(d)p Fk(q)1927 3381 y Fm(Z)1974 3570 y Fe(R)2021 3553 y Ff(6)2066 3494 y Ft(d)p Fk(y)2159 3506 y Fp(1)2211 3494 y Ft(d)p Fk(y)2304 3506 y Fp(2)2365 3494 y Fq(j)h Fv(^)-52 b Ft(\037)2440 3506 y Fp(0)2477 3494 y Fv(\()p Fk(y)2559 3506 y Fp(1)2597 3494 y Ft(;)14 b Fk(y)2684 3506 y Fp(2)2721 3494 y Fv(\))p Fq(j)298 b Fv(\(2.20\))1107 3734 y Fq(\001)1163 3678 y Ft(y)1204 3690 y Fp(1)p 1163 3715 78 4 v 1177 3791 a Ft(n)1265 3734 y(t)14 b(e)1348 3700 y Fi(\000)p Fn(tE)1474 3709 y Fj(\030)1857 3678 y Fv(1)p 1543 3715 671 4 v 1543 3791 a Fq(j)p Fk(q)19 b Fq(\000)f Fv(\()p Fk(p)1803 3803 y Fp(1)1859 3791 y Fq(\000)g Fk(y)1992 3803 y Fp(1)2029 3791 y Ft(=n)p Fv(\))p Fq(j)2176 3767 y Fp(2)2246 3734 y Ft(e)2285 3700 y Fi(\000)p Fn(tE)2411 3708 y Fj(q)2466 3734 y Fq(\001)2518 3678 y Ft(p)2560 3690 y Fp(1)p 2518 3715 80 4 v 2537 3791 a Ft(q)2607 3734 y(:)451 3981 y Fv(The)33 b Ft(t)p Fv(-in)n(tegral)e(can)i(b)r(e)g(carried)f(out,)1736 3897 y Fi(1)1733 3914 y Fm(R)1736 4057 y Fp(0)1808 3981 y Ft(dt)14 b(te)1964 3951 y Fi(\000)p Fp(\()p Fn(E)2091 3960 y Fj(\030)2123 3951 y Fp(+)p Fn(E)2223 3959 y Fj(q)2255 3951 y Fp(\))2331 3981 y Fv(=)32 b(\()p Ft(E)2521 3993 y Fn(\030)2580 3981 y Fv(+)21 b Ft(E)2727 3993 y Fn(q)2764 3981 y Fv(\))2796 3951 y Fi(\000)p Fp(2)2950 3981 y Fv(with)34 b Fl(\030)g Fv(=)451 4147 y Fk(p)504 4159 y Fp(1)560 4147 y Fq(\000)654 4114 y Fn(\025)p 653 4128 42 4 v 653 4176 a(n)704 4147 y Fk(y)754 4159 y Fp(1)792 4147 y Ft(:)50 b Fv(De\014ne)28 b Fk(q)1172 4159 y Fp(1)1233 4147 y Fv(:=)23 b Fk(p)1397 4159 y Fp(1)1453 4147 y Fq(\000)18 b Fk(y)1586 4159 y Fp(1)1623 4147 y Ft(=n)50 b Fv(and)28 b(consider)1142 4370 y Ft(S)g Fv(:=)46 b Ft(p)1397 4336 y Fp(2)1397 4391 y(1)1448 4257 y Fm(Z)1494 4446 y Fe(R)1541 4429 y Ff(3)1586 4370 y Ft(d)p Fk(q)1853 4314 y Fv(1)p 1713 4351 323 4 v 1713 4427 a Fq(j)p Fk(q)19 b Fq(\000)f Fk(q)1938 4439 y Fp(1)1975 4427 y Fq(j)1998 4403 y Fp(2)2078 4314 y Fv(1)p 2078 4351 42 4 v 2079 4427 a Ft(q)2342 4314 y Fv(1)p 2163 4351 399 4 v 2163 4427 a(\()p Ft(E)2256 4439 y Fn(\030)2311 4427 y Fv(+)g Ft(E)2455 4439 y Fn(q)2492 4427 y Fv(\))2524 4403 y Fp(2)2572 4370 y Ft(:)479 b Fv(\(2.21\))451 4603 y(Estimating)30 b(the)i(last)e(factor)h(b)n(y)1581 4570 y Fp(1)p 1557 4584 82 4 v 1557 4631 a Fn(E)1606 4640 y Fj(\030)1669 4603 y Fq(\001)1723 4570 y Fp(1)p 1723 4584 34 4 v 1723 4631 a Fn(q)1826 4603 y Fv(and)f(p)r(erforming)g (the)i(angular)d(in)n(tegration,)451 4714 y(one)e(obtains)484 4916 y Ft(S)51 b Fq(\024)45 b Ft(p)738 4882 y Fp(2)738 4937 y(1)808 4860 y Fv(2)p Ft(\031)p 808 4897 92 4 v 817 4973 a(q)854 4985 y Fp(1)971 4860 y Fv(1)p 943 4897 98 4 v 943 4973 a Ft(E)1004 4985 y Fn(\030)1065 4803 y Fm(Z)1148 4824 y Fi(1)1111 4992 y Fp(0)1242 4860 y Ft(dq)p 1242 4897 84 4 v 1263 4973 a(q)1372 4916 y Fv(ln)1455 4796 y Fm(\014)1455 4845 y(\014)1455 4895 y(\014)1455 4945 y(\014)1493 4860 y Ft(q)21 b Fv(+)d Ft(q)1671 4872 y Fp(1)p 1493 4897 216 4 v 1493 4973 a Ft(q)j Fq(\000)d Ft(q)1671 4985 y Fp(1)1718 4796 y Fm(\014)1718 4845 y(\014)1718 4895 y(\014)1718 4945 y(\014)1792 4916 y Fv(=)46 b Ft(\031)1953 4882 y Fp(3)2192 4860 y Ft(p)2234 4872 y Fp(1)p 2023 4897 417 4 v 2023 4973 a Fq(j)p Fk(p)2099 4985 y Fp(1)2155 4973 y Fq(\000)18 b Fk(y)2288 4985 y Fp(1)2326 4973 y Ft(=n)p Fq(j)2812 4860 y Ft(p)2854 4872 y Fp(1)p 2483 4897 737 4 v 2483 4914 a Fm(q)p 2566 4914 654 4 v 97 x Fv(\()p Fk(p)2651 5023 y Fp(1)2707 5011 y Fq(\000)2801 4978 y Fn(\025)p 2800 4992 42 4 v 2800 5040 a(n)2851 5011 y Fk(y)2901 5023 y Fp(1)2939 5011 y Fv(\))2971 4987 y Fp(2)3027 5011 y Fv(+)g Ft(m)3183 4987 y Fp(2)3230 4916 y Ft(:)3074 5130 y Fv(\(2.22\))1108 5338 y Fw(Document)l(a)25 b(Ma)l(thema)l(tica)h(10)f(\(2005\))g(497{525)p eop %%Page: 513 17 513 16 bop 1301 518 a Ft(N)9 b Fs(-Electr)n(on)31 b(HVZ)f(Theorem)726 b Fv(513)451 725 y(Insertion)27 b(in)n(to)g(\(2.20\))g(giv)n(es)992 936 y Ft(I)7 b Fv(\()p Fk(p)1120 948 y Fp(1)1158 936 y Ft(;)14 b Fk(p)1248 948 y Fp(2)1285 936 y Fv(\))47 b Fq(\024)1560 880 y Fv(1)p 1484 917 194 4 v 1484 993 a(\(4)p Ft(\031)s Fv(\))1640 969 y Fp(2)1725 880 y Fv(1)p 1721 917 50 4 v 1721 993 a Ft(n)1794 823 y Fm(Z)1841 1012 y Fe(R)1888 995 y Ff(6)1933 936 y Ft(d)p Fk(y)2026 948 y Fp(1)2078 936 y Ft(d)p Fk(y)2171 948 y Fp(2)2232 936 y Fq(j)10 b Fv(^)-52 b Ft(\037)2307 948 y Fp(0)2344 936 y Fv(\()p Fk(y)2426 948 y Fp(1)2464 936 y Ft(;)14 b Fk(y)2551 948 y Fp(2)2588 936 y Fv(\))p Fq(j)24 b Ft(y)2708 948 y Fp(1)1135 1184 y Fq(\001)1337 1127 y Ft(p)1379 1139 y Fp(1)p 1168 1164 417 4 v 1168 1240 a Fq(j)p Fk(p)1244 1252 y Fp(1)1300 1240 y Fq(\000)18 b Fk(y)1433 1252 y Fp(1)1471 1240 y Ft(=n)p Fq(j)1957 1127 y Ft(p)1999 1139 y Fp(1)p 1628 1164 737 4 v 1628 1181 a Fm(q)p 1711 1181 654 4 v 97 x Fv(\()p Fk(p)1796 1290 y Fp(1)1852 1278 y Fq(\000)1946 1246 y Fn(\025)p 1945 1260 42 4 v 1945 1307 a(n)1996 1278 y Fk(y)2046 1290 y Fp(1)2084 1278 y Fv(\))2116 1254 y Fp(2)2172 1278 y Fv(+)g Ft(m)2328 1254 y Fp(2)2421 1184 y Fq(\024)2549 1127 y Ft(c)p 2542 1164 50 4 v 2542 1240 a(n)3074 1184 y Fv(\(2.23\))451 1435 y(b)r(ecause)39 b(the)g(singularit)n(y)e(at)i Fk(y)1509 1447 y Fp(1)1589 1435 y Fv(=)i Ft(n)p Fk(p)1798 1447 y Fp(1)1874 1435 y Fv(is)e(in)n(tegrable)f(and)h(the)g(in)n(tegral)f (is)g(\014nite)451 1534 y(for)d(all)h Ft(p)752 1546 y Fp(1)826 1534 y Fq(\025)g Fv(0)f(due)i(to)45 b(^)-52 b Ft(\037)1331 1546 y Fp(0)1405 1534 y Fq(2)37 b(S)6 b Fv(\()p Fo(R)1640 1504 y Fp(6)1683 1534 y Fv(\))p Ft(:)73 b Fv(Since)36 b(the)g(k)n(ernel)f Ft(k)2483 1546 y Fp(1)2557 1534 y Fv(is)g(not)h(symmetric)g(in)451 1647 y Fk(p)504 1659 y Fp(1)541 1647 y Ft(;)14 b Fk(q)p Ft(;)31 b Fv(the)f(estimate)g (of)g Ft(J)8 b Fv(\()p Fk(q)p Ft(;)14 b Fk(p)1485 1617 y Fi(0)1485 1668 y Fp(2)1523 1647 y Fv(\))27 b(:=)1706 1580 y Fm(R)1689 1730 y Fe(R)1736 1713 y Ff(6)1785 1647 y Ft(d)p Fk(p)1881 1659 y Fp(1)1932 1647 y Ft(d)p Fk(p)2028 1659 y Fp(2)2080 1647 y Fq(j)p Ft(k)2146 1659 y Fp(1)2183 1647 y Fv(\()p Fk(p)2268 1659 y Fp(1)2306 1647 y Ft(;)14 b Fk(p)2396 1659 y Fp(2)2433 1647 y Ft(;)g Fk(q)p Ft(;)g Fk(p)2610 1617 y Fi(0)2610 1668 y Fp(2)2647 1647 y Fv(\))p Fq(j)2744 1607 y Fn(f)7 b Fp(\()p Fn(q)r Fp(\))p 2727 1628 158 4 v 2727 1676 a Fn(f)g Fp(\()p Fn(p)2826 1684 y Ff(1)2858 1676 y Fp(\))2951 1647 y Fv(is)30 b(needed)451 1816 y(to)r(o.)37 b(The)813 1784 y Fp(1)p 809 1798 42 4 v 809 1845 a Fn(n)860 1816 y Fv(-b)r(oundedness)28 b(of)f Ft(J)8 b Fv(\()p Fk(q)p Ft(;)14 b Fk(p)1696 1786 y Fi(0)1696 1837 y Fp(2)1734 1816 y Fv(\))28 b(can)f(b)r(e)h(sho)n(wn)f (along)g(the)h(same)f(lines,)g(using)451 1932 y(\()p Ft(E)544 1944 y Fn(\030)576 1927 y Fg(0)622 1932 y Fv(+)18 b Ft(E)766 1944 y Fn(q)803 1932 y Fv(\))835 1902 y Fi(\000)p Fp(2)947 1932 y Fq(\024)23 b Ft(\030)1075 1876 y Fg(0)1098 1902 y Fi(\000)p Fp(2)1214 1932 y Fv(with)29 b Fl(\030)1448 1895 y Fi(0)1495 1932 y Fv(:=)22 b Fk(p)1658 1902 y Fi(0)1658 1952 y Fp(1)1714 1932 y Fv(+)c Ft(\025)p Fv(\()p Fk(p)1930 1944 y Fp(1)1987 1932 y Fq(\000)g Fk(p)2123 1902 y Fi(0)2123 1952 y Fp(1)2160 1932 y Fv(\))p Ft(:)451 2031 y Fv(W)-7 b(e)28 b(still)g(ha)n(v)n(e)e(to)i(estimate)f(the)h(second)f(term)h(in) g(\(2.15\).)36 b(Its)28 b(k)n(ernel)e(is)951 2247 y Ft(k)994 2259 y Fp(2)1031 2247 y Fv(\()p Fk(p)1116 2259 y Fp(1)1154 2247 y Ft(;)14 b Fk(p)1244 2259 y Fp(2)1281 2247 y Ft(;)g Fk(q)p Ft(;)g Fk(p)1458 2213 y Fi(0)1458 2268 y Fp(2)1495 2247 y Fv(\))24 b(:=)1771 2191 y(1)p 1695 2228 194 4 v 1695 2304 a(\(2)p Ft(\031)s Fv(\))1851 2280 y Fp(3)1975 2191 y Fv(1)p 1931 2228 130 4 v 1931 2304 a(2)p Ft(\031)2023 2280 y Fp(2)2093 2247 y Ft(p)2135 2259 y Fp(1)2186 2247 y Ft(n)2236 2213 y Fp(6)2287 2134 y Fm(Z)2370 2155 y Fi(1)2333 2323 y Fp(0)2454 2247 y Ft(dt)f(e)2589 2213 y Fi(\000)p Fn(tE)2715 2221 y Fj(p)2746 2233 y Ff(1)600 2402 y Fm(Z)646 2591 y Fe(R)693 2574 y Ff(3)739 2515 y Ft(d)p Fk(p)835 2481 y Fi(0)835 2536 y Fp(1)1067 2459 y Fv(1)p 905 2496 366 4 v 905 2572 a Fq(j)p Fk(p)981 2584 y Fp(1)1037 2572 y Fq(\000)18 b Fk(p)1173 2544 y Fi(0)1173 2594 y Fp(1)1210 2572 y Fq(j)1233 2548 y Fp(2)1314 2515 y Fv(^)-52 b Ft(\037)1356 2527 y Fp(0)1393 2515 y Fv(\()p Ft(n)p Fv(\()p Fk(p)1560 2481 y Fi(0)1560 2536 y Fp(1)1616 2515 y Fq(\000)18 b Fk(q)p Fv(\))p Ft(;)c(n)p Fv(\()p Fk(p)1953 2527 y Fp(2)2010 2515 y Fq(\000)k Fk(p)2146 2481 y Fi(0)2146 2536 y Fp(2)2183 2515 y Fv(\)\))23 b(\()p Ft(e)2341 2469 y Fi(\000)p Fn(tE)2467 2486 y Fj(p)2498 2472 y Fg(0)2498 2506 y Ff(1)2571 2515 y Fq(\000)32 b Ft(e)2707 2481 y Fi(\000)p Fn(tE)2833 2489 y Fj(q)2869 2515 y Fv(\))p Ft(:)150 b Fv(\(2.24\))451 2707 y(With)22 b(\(2.19\))f(the)g Ft(t)p Fv(-in)n(tegral)f(can)g(b)r(e)i(carried)e (out)h(as)f(b)r(efore.)35 b(Making)20 b(the)h(substitution)451 2806 y Fk(y)501 2818 y Fp(1)567 2806 y Fv(:=)28 b Ft(n)p Fv(\()p Fk(p)818 2776 y Fi(0)818 2827 y Fp(1)876 2806 y Fq(\000)20 b Fk(q)p Fv(\))p Ft(;)71 b Fk(y)1187 2818 y Fp(2)1253 2806 y Fv(:=)28 b Ft(n)p Fv(\()p Fk(p)1504 2818 y Fp(2)1562 2806 y Fq(\000)20 b Fk(p)1700 2776 y Fi(0)1700 2827 y Fp(2)1738 2806 y Fv(\))31 b(for)f Fk(q)h Fv(and)g Fk(p)2230 2776 y Fi(0)2230 2827 y Fp(2)2267 2806 y Fv(,)h(resp)r(ectiv)n(ely)-7 b(,)31 b(one)f(gets)g(with)451 2914 y(the)e(c)n(hoice)f Ft(f)9 b Fv(\()p Ft(p)p Fv(\))23 b(=)g Ft(p)1160 2862 y Ff(1)p 1159 2871 29 3 v 1159 2904 a(2)1202 2914 y Ft(;)1007 3110 y Fv(~)997 3131 y Ft(I)7 b Fv(\()p Fk(p)1125 3143 y Fp(1)1162 3131 y Ft(;)14 b Fk(p)1252 3143 y Fp(2)1289 3131 y Fv(\))24 b(:=)1479 3018 y Fm(Z)1525 3207 y Fe(R)1572 3190 y Ff(6)1617 3131 y Ft(d)p Fk(q)14 b Ft(d)p Fk(p)1820 3097 y Fi(0)1820 3152 y Fp(2)1881 3131 y Fq(j)p Ft(k)1947 3143 y Fp(2)1985 3131 y Fv(\()p Fk(p)2070 3143 y Fp(1)2107 3131 y Ft(;)g Fk(p)2197 3143 y Fp(2)2234 3131 y Ft(;)g Fk(q)p Ft(;)g Fk(p)2411 3097 y Fi(0)2411 3152 y Fp(2)2449 3131 y Fv(\))p Fq(j)2537 3075 y Ft(f)9 b Fv(\()p Ft(p)2661 3087 y Fp(1)2698 3075 y Fv(\))p 2537 3112 194 4 v 2557 3188 a Ft(f)g Fv(\()p Ft(q)s Fv(\))3074 3131 y(\(2.25\))516 3440 y Fq(\024)715 3384 y Fv(1)p 613 3421 244 4 v 613 3497 a(\(2)p Ft(\031)s Fv(\))769 3473 y Fp(4)807 3497 y Ft(\031)867 3440 y(p)909 3452 y Fp(1)932 3327 y Fm(Z)979 3516 y Fe(R)1026 3499 y Ff(6)1029 3440 y Ft(d)p Fk(y)1122 3452 y Fp(1)1160 3440 y Ft(d)p Fk(y)1253 3452 y Fp(2)1291 3440 y Fq(j)h Fv(^)-52 b Ft(\037)1366 3452 y Fp(0)1403 3440 y Fv(\()p Fk(y)1485 3452 y Fp(1)1523 3440 y Ft(;)14 b Fk(y)1610 3452 y Fp(2)1648 3440 y Fv(\))p Fq(j)1703 3327 y Fm(Z)1749 3516 y Fe(R)1796 3499 y Ff(3)1800 3440 y Ft(d)p Fk(p)1896 3406 y Fi(0)1896 3461 y Fp(1)2092 3384 y Fv(1)p 1944 3421 338 4 v 1944 3497 a Fq(j)p Fk(p)2020 3509 y Fp(1)2062 3497 y Fq(\000)5 b Fk(p)2185 3469 y Fi(0)2185 3519 y Fp(1)2221 3497 y Fq(j)2244 3473 y Fp(2)2301 3384 y Ft(y)2342 3396 y Fp(1)p 2301 3421 78 4 v 2315 3497 a Ft(n)2574 3384 y Fv(1)p 2399 3421 392 4 v 2399 3497 a(\()p Ft(E)2492 3509 y Fn(p)2526 3517 y Ff(1)2554 3497 y Fv(+)g Ft(E)2692 3507 y Fp(~)2685 3523 y Fn(\030)2721 3497 y Fv(\))2753 3473 y Fp(2)2819 3440 y Fq(\001)2994 3384 y Ft(p)3046 3313 y Ff(1)p 3046 3322 29 3 v 3046 3355 a(2)3036 3406 y Fp(1)p 2871 3421 341 4 v 2871 3509 a Fq(j)p Fk(p)2947 3480 y Fi(0)2947 3531 y Fp(1)2975 3509 y Fq(\000)3054 3472 y Fd(y)3094 3480 y Ff(1)p 3054 3490 73 4 v 3069 3538 a Fn(n)3136 3509 y Fq(j)3169 3458 y Ff(1)p 3169 3467 29 3 v 3169 3500 a(2)451 3685 y Fv(with)639 3663 y(~)638 3685 y Fl(\030)25 b Fv(:=)e Ft(\025)p Fk(q)13 b Fv(+)g(\(1)g Fq(\000)g Ft(\025)p Fv(\))p Fk(p)1303 3655 y Fi(0)1303 3706 y Fp(1)1379 3685 y Fv(=)23 b Fk(p)1520 3655 y Fi(0)1520 3706 y Fp(1)1570 3685 y Fq(\000)1659 3652 y Fn(\025)p 1658 3666 42 4 v 1658 3714 a(n)1709 3685 y Fk(y)1759 3697 y Fp(1)1797 3685 y Ft(:)48 b Fv(W)-7 b(e)25 b(estimate)g(\()p Ft(E)2431 3697 y Fn(p)2465 3705 y Ff(1)2516 3685 y Fv(+)13 b Ft(E)2662 3695 y Fp(~)2655 3711 y Fn(\030)2691 3685 y Fv(\))2723 3655 y Fi(\000)p Fp(2)2836 3685 y Fq(\024)22 b Ft(p)2965 3637 y Fi(\000)3027 3614 y Ff(1)p 3027 3623 29 3 v 3027 3657 a(2)2965 3707 y Fp(1)3069 3685 y Ft(E)3135 3637 y Fi(\000)3197 3614 y Ff(3)p 3197 3623 V 3197 3657 a(2)3137 3709 y Fp(~)3130 3724 y Fn(\030)3240 3685 y Ft(:)451 3806 y Fv(Then)28 b(the)g(in)n(tegral)e(o)n(v)n(er)g Fk(p)1344 3776 y Fi(0)1344 3827 y Fp(1)1409 3806 y Fv(reduces)h(to)662 3996 y(~)648 4017 y Ft(S)h Fv(:=)45 b Ft(p)902 4029 y Fp(1)953 3904 y Fm(Z)999 4093 y Fe(R)1046 4076 y Ff(3)1092 4017 y Ft(d)p Fk(p)1188 3983 y Fi(0)1188 4038 y Fp(1)1420 3961 y Fv(1)p 1258 3998 366 4 v 1258 4074 a Fq(j)p Fk(p)1334 4086 y Fp(1)1390 4074 y Fq(\000)18 b Fk(p)1526 4046 y Fi(0)1526 4097 y Fp(1)1563 4074 y Fq(j)1586 4050 y Fp(2)1837 3961 y Fv(1)p 1667 3998 383 4 v 1667 4086 a Fq(j)p Fk(p)1743 4058 y Fi(0)1743 4108 y Fp(1)1798 4086 y Fq(\000)1891 4049 y Fd(y)1931 4057 y Ff(1)p 1891 4067 73 4 v 1907 4115 a Fn(n)1973 4086 y Fq(j)2006 4035 y Ff(1)p 2006 4044 29 3 v 2006 4077 a(2)2447 3961 y Fv(1)p 2092 3998 753 4 v 2092 4086 a([\()p Fk(p)2200 4058 y Fi(0)2200 4108 y Fp(1)2256 4086 y Fq(\000)2350 4054 y Fn(\025)p 2349 4068 42 4 v 2349 4115 a(n)2400 4086 y Fk(y)2450 4098 y Fp(1)2487 4086 y Fv(\))2519 4062 y Fp(2)2575 4086 y Fv(+)g Ft(m)2731 4062 y Fp(2)2769 4086 y Fv(])2802 4035 y Ff(3)p 2802 4044 29 3 v 2802 4077 a(4)2854 4017 y Ft(:)197 b Fv(\(2.26\))451 4255 y(Ev)n(en)28 b(when)h(the)g(t)n(w)n (o)f(singularities)g(coincide)h(\(for)f Fk(y)2175 4267 y Fp(1)2238 4255 y Fv(=)d Ft(n)p Fk(p)2431 4267 y Fp(1)2468 4255 y Fv(\))p Ft(;)54 b Fv(they)29 b(are)f(in)n(tegrable.)451 4367 y(Since)h(the)g(in)n(tegrand)e(b)r(eha)n(v)n(es)g(lik)n(e)h Ft(p)1690 4307 y Fg(0)1712 4332 y Fi(\000)p Fp(2)1690 4390 y(1)1830 4367 y Fv(for)g Ft(p)2000 4337 y Fi(0)2000 4388 y Fp(1)2061 4367 y Fq(!)d(1)p Ft(;)2352 4346 y Fv(~)2338 4367 y Ft(S)33 b Fv(is)28 b(\014nite)h(for)f(all)g(0)c Fq(\024)g Ft(p)3160 4379 y Fp(1)3221 4367 y Ft(<)451 4467 y Fq(1)p Ft(:)50 b Fv(It)27 b(remains)e(to)h(estimate)1450 4446 y(~)1436 4467 y Ft(S)31 b Fv(for)26 b Ft(p)1686 4479 y Fp(1)1746 4467 y Fq(!)d(1)p Ft(:)49 b Fv(W)-7 b(e)27 b(substitute)g Ft(p)2578 4479 y Fp(1)2615 4467 y Fk(x)d Fv(:=)f Fk(p)2853 4437 y Fi(0)2853 4488 y Fp(1)2906 4467 y Fq(\000)15 b Fk(p)3039 4479 y Fp(1)3077 4467 y Ft(;)26 b Fv(suc)n(h)451 4567 y(that)i(with)g Fk(e)864 4579 y Fn(p)898 4587 y Ff(1)958 4567 y Fv(:=)22 b Fk(p)1121 4579 y Fp(1)1159 4567 y Ft(=p)1243 4579 y Fp(1)1279 4567 y Ft(;)812 4761 y Fv(~)798 4782 y Ft(S)51 b Fv(=)1011 4669 y Fm(Z)1057 4857 y Fe(R)1104 4841 y Ff(3)1159 4726 y Ft(d)p Fk(x)p 1159 4763 94 4 v 1163 4839 a Ft(x)1210 4815 y Fp(2)1572 4726 y Fv(1)p 1296 4763 594 4 v 1296 4851 a Fq(j)p Fk(x)19 b Fv(+)f Fk(e)1515 4863 y Fn(p)1549 4871 y Ff(1)1604 4851 y Fq(\000)1714 4814 y Fd(y)1754 4822 y Ff(1)p 1697 4832 108 4 v 1697 4879 a Fn(np)1772 4887 y Ff(1)1814 4851 y Fq(j)1847 4799 y Ff(1)p 1847 4808 29 3 v 1847 4842 a(2)2410 4726 y Fv(1)p 1933 4763 997 4 v 1933 4851 a([\()p Fk(x)h Fv(+)f Fk(e)2184 4863 y Fn(p)2218 4871 y Ff(1)2273 4851 y Fq(\000)2400 4818 y Fn(\025)p 2366 4832 108 4 v 2366 4879 a(np)2441 4887 y Ff(1)2484 4851 y Fk(y)2534 4863 y Fp(1)2571 4851 y Fv(\))2603 4827 y Fp(2)2659 4851 y Fv(+)2752 4818 y Fn(m)2811 4801 y Ff(2)p 2752 4832 92 4 v 2764 4882 a Fn(p)2798 4862 y Ff(2)2798 4900 y(1)2853 4851 y Fv(])2886 4799 y Ff(3)p 2886 4808 29 3 v 2886 4842 a(4)1043 5091 y Fq(\000)-14 b(!)1223 4978 y Fm(Z)1269 5167 y Fe(R)1316 5150 y Ff(3)1371 5035 y Ft(d)p Fk(x)p 1371 5072 94 4 v 1375 5148 a Ft(x)1422 5124 y Fp(2)1662 5035 y Fv(1)p 1508 5072 350 4 v 1508 5148 a Fq(j)p Fk(x)19 b Fv(+)f Fk(e)1727 5160 y Fn(p)1761 5168 y Ff(1)1797 5148 y Fq(j)1820 5124 y Fp(2)1914 5091 y Fv(=)45 b Ft(\031)2074 5057 y Fp(3)2278 5091 y Fv(as)27 b Ft(p)2422 5103 y Fp(1)2482 5091 y Fq(!)c(1)p Ft(:)380 b Fv(\(2.27\))1108 5338 y Fw(Document)l(a)25 b(Ma)l(thema)l(tica)h(10)f (\(2005\))g(497{525)p eop %%Page: 514 18 514 17 bop 451 518 a Fv(514)727 b Fs(D.)30 b(H.)h(Jakubassa-Amundsen) 451 725 y Fv(Therefore,)882 704 y(~)872 725 y Ft(I)51 b Fv(is)1073 692 y Fp(1)p 1069 706 42 4 v 1069 754 a Fn(n)1120 725 y Fv(-b)r(ounded)45 b(for)e(all)i Ft(p)1822 737 y Fp(1)1910 725 y Fq(\025)50 b Fv(0)p Ft(:)95 b Fv(It)45 b(is)f(easy)f(to)i(pro)n(v)n(e)d(that)j(also)471 849 y(~)451 870 y Ft(J)8 b Fv(\()p Fk(q)p Ft(;)14 b Fk(p)677 840 y Fi(0)677 891 y Fp(2)715 870 y Fv(\))23 b(:=)891 803 y Fm(R)873 953 y Fe(R)920 936 y Ff(6)969 870 y Ft(d)p Fk(p)1065 882 y Fp(1)1117 870 y Ft(d)p Fk(p)1213 882 y Fp(2)1264 870 y Fq(j)p Ft(k)1330 882 y Fp(2)1368 870 y Fv(\()p Fk(p)1453 882 y Fp(1)1490 870 y Ft(;)14 b Fk(p)1580 882 y Fp(2)1617 870 y Ft(;)g Fk(q)p Ft(;)g Fk(p)1794 840 y Fi(0)1794 891 y Fp(2)1832 870 y Fv(\))p Fq(j)1912 833 y Fn(q)1954 789 y Ff(1)p 1954 796 29 3 v 1954 827 a(2)p 1911 851 87 4 v 1911 939 a Fn(p)1955 881 y Ff(1)p 1955 888 29 3 v 1955 919 a(2)1945 957 y(1)2058 870 y Fv(is)2156 838 y Fp(1)p 2152 852 42 4 v 2152 899 a Fn(n)2203 870 y Fv(-b)r(ounded,)27 b(using)h(the)g(estimate)451 1042 y(\()p Ft(E)544 1054 y Fn(p)578 1062 y Ff(1)634 1042 y Fv(+)18 b Ft(E)778 1057 y Fi(j)p Fd(q)p Fp(+)p Fn(\025)p Fp(\()p Fd(p)996 1037 y Fg(0)996 1075 y Ff(1)1028 1057 y Fi(\000)p Fd(q)p Fp(\))p Fi(j)1169 1042 y Fv(\))1201 1012 y Fi(\000)p Fp(2)1328 1042 y Fq(\024)k Ft(p)1457 1007 y Fi(\000)p Fp(2)1457 1064 y(1)1546 1042 y Ft(:)451 1170 y Fv(Collecting)35 b(results,)j(this)e(sho)n(ws)e(the)1731 1138 y Fp(1)p 1727 1152 V 1727 1199 a Fn(n)1778 1170 y Fv(-b)r(oundedness)h(of)h Ft(p)2446 1182 y Fp(1)2483 1170 y Fv([)p Ft(V)2573 1127 y Fp(\(1\))2554 1193 y(10)p Fn(;m)2703 1170 y Ft(;)14 b(\037)2792 1182 y Fp(0)2829 1170 y Fv(])p Ft(:)73 b Fv(With)37 b(the)451 1282 y(same)d(to)r(ols,)h (the)1062 1250 y Fp(1)p 1058 1264 V 1058 1311 a Fn(n)1109 1282 y Fv(-b)r(oundedness)e(of)i(the)f(comm)n(utator)f(of)h Ft(\037)2509 1294 y Fp(0)2581 1282 y Fv(with)g(the)h(remaining)451 1406 y(con)n(tributions)27 b(from)g(\(2.4\))h(to)f Ft(b)1489 1363 y Fp(\(1\))1489 1428 y(2)p Fn(m)1612 1406 y Fv(is)h(established.) 451 1506 y(The)i(second)g(item)g(of)g(Lemma)g(1,)g(the)h (normalizabilit)n(y)d(of)i(the)h(sequence)e Ft(')2940 1518 y Fn(n)3013 1506 y Fv(:=)d(\(1)20 b Fq(\000)451 1605 y Ft(\037)503 1617 y Fp(0)540 1605 y Fv(\))p Ft( )626 1617 y Fn(n)672 1605 y Ft(;)38 b Fv(follo)n(ws)e(immediately)i(from)f (the)h(pro)r(of)g(concerning)e(the)i(Bro)n(wn-Ra)n(v)n(enhall)451 1705 y(op)r(erator,)f(b)r(ecause)f(of)h(the)f(relativ)n(e)g(form)g(b)r (oundedness)g(of)h(the)f(total)h(p)r(oten)n(tial)f(of)452 1782 y(~)451 1804 y Ft(h)499 1774 y Fp(\(2\))616 1804 y Fv(with)28 b(form)f(b)r(ound)h(smaller)f(than)h(one)f(for)g Ft(\015)g(<)c(\015)2218 1816 y Fn(B)s(R)2353 1804 y Fv(\()28 b(see)f([13)o(])h(and)g(Lemma)f(7\).)451 2022 y Fh(b\))f Fv(In)h(the)f(form)n(ulation)f(of)h(Lemma)g(3,)g(the)h(only)e(c)n (hange)g(is)h(again)f(the)i(replacemen)n(t)e(of)451 2122 y Ft(h)499 2092 y Fn(B)s(R)634 2122 y Fv(with)824 2100 y(~)823 2122 y Ft(h)871 2092 y Fp(\(2\))988 2122 y Fv(\(and)j Ft(N)j Fv(=)23 b(2\).)451 2238 y(W)-7 b(e)26 b(consider)f(the)i(case)e Ft(j)j Fv(=)22 b(1)k(where)f Ft(r)1722 2250 y Fp(1)1783 2238 y Fv(=)e Ft(b)1907 2194 y Fp(\(1\))1907 2260 y(1)p Fn(m)2017 2238 y Fv(+)15 b Ft(b)2133 2194 y Fp(\(1\))2133 2260 y(2)p Fn(m)2244 2238 y Fv(+)g Ft(v)2367 2207 y Fp(\(12\))2489 2238 y Ft(;)26 b Fv(and)g(w)n(e)f(ha)n(v)n(e)g(to)h(sho)n(w)451 2337 y(in)i(addition)g(to)f(the)h(Bro)n(wn-Ra)n(v)n(enhall)d(case)h (that)1362 2500 y Fq(j)p Fv(\()p Ft(\036)1466 2512 y Fp(1)1504 2500 y Ft(';)14 b(b)1631 2457 y Fp(\(1\))1631 2522 y(2)p Fn(m)1741 2500 y Ft(\036)1790 2512 y Fp(1)1827 2500 y Ft(')p Fv(\))p Fq(j)47 b(\024)2118 2444 y Ft(c)p 2104 2481 64 4 v 2104 2557 a(R)2201 2500 y Fq(k)p Ft(')p Fq(k)2339 2466 y Fp(2)3074 2500 y Fv(\(2.28\))451 2696 y(pro)n(vided)27 b Ft(')c Fq(2)h(A)p Fv(\()p Ft(C)1112 2666 y Fi(1)1106 2716 y Fp(0)1183 2696 y Fv(\()p Fo(R)1269 2666 y Fp(6)1312 2696 y Fq(n)p Ft(B)1417 2708 y Fn(R)1471 2696 y Fv(\(0\)\))19 b Fq(\012)f Fo(C)1765 2666 y Fp(4)1808 2696 y Fv(\))28 b(and)g Ft(R)23 b(>)g Fv(1)p Ft(:)451 2812 y Fv(W)-7 b(e)23 b(note)f(that)h(ev)n(ery)e(summand)h(of)h Ft(b)1656 2768 y Fp(\(1\))1656 2834 y(2)p Fn(m)1774 2812 y Fv(in)g(\(2.4\))f(is)g(of)g(the)h(form)f Ft(B)2618 2824 y Fp(1)2684 2779 y(1)p 2665 2793 71 4 v 2665 2840 a Fn(x)2703 2848 y Ff(1)2745 2812 y Ft(W)2823 2824 y Fp(1)2883 2812 y Fv(or)g Ft(W)3058 2824 y Fp(1)3124 2779 y(1)p 3106 2793 V 3106 2840 a Fn(x)3144 2848 y Ff(1)3186 2812 y Ft(B)3249 2824 y Fp(1)451 2911 y Fv(where)27 b Ft(B)754 2923 y Fp(1)819 2911 y Fv(is)g(a)g(b)r(ounded)h(m)n (ultiplication)f(op)r(erator)f(in)h(momen)n(tum)h(space,)f(while)g Ft(W)3248 2923 y Fp(1)451 3011 y Fv(is)37 b(a)g(b)r(ounded)h(in)n (tegral)e(op)r(erator.)63 b(F)-7 b(or)37 b(op)r(erators)e(of)i(the)h (\014rst)f(t)n(yp)r(e)g(w)n(e)g(tak)n(e)g(the)451 3110 y(smo)r(oth)27 b(auxiliary)e(function)i Ft(\037)1465 3122 y Fp(1)1503 3110 y Fv(\()1545 3076 y Fd(x)1585 3084 y Ff(1)p 1545 3091 73 4 v 1556 3139 a Fn(R)1627 3110 y Fv(\))g(from)f(\(1.17\))g(whic)n(h)h(is)g(unit)n(y)g(on)f(the)h(supp) r(ort)g(of)451 3210 y Ft(\036)500 3222 y Fp(1)538 3210 y Ft(')h Fv(and)f(decomp)r(ose)451 3407 y(\()p Ft(\037)535 3419 y Fp(1)573 3407 y Ft(\036)622 3419 y Fp(1)659 3407 y Ft(';)14 b(B)813 3419 y Fp(1)882 3351 y Fv(1)p 861 3388 85 4 v 861 3464 a Ft(x)908 3476 y Fp(1)955 3407 y Ft(W)1033 3419 y Fp(1)1085 3407 y Ft(\036)1134 3419 y Fp(1)1172 3407 y Ft(')p Fv(\))46 b(=)g(\()p Ft(\036)1496 3419 y Fp(1)1534 3407 y Ft(';)14 b(B)1688 3419 y Fp(1)1725 3407 y Ft(\037)1777 3419 y Fp(1)1846 3351 y Fv(1)p 1825 3388 V 1825 3464 a Ft(x)1872 3476 y Fp(1)1919 3407 y Ft(W)1997 3419 y Fp(1)2049 3407 y Ft(\036)2098 3419 y Fp(1)2135 3407 y Ft(')p Fv(\))30 b(+)f(\()p Ft(\036)2426 3419 y Fp(1)2464 3407 y Ft(';)14 b Fv([)p Ft(\037)2630 3419 y Fp(1)2667 3407 y Ft(;)g(B)2767 3419 y Fp(1)2805 3407 y Fv(])2873 3351 y(1)p 2851 3388 V 2851 3464 a Ft(x)2898 3476 y Fp(1)2960 3407 y Ft(W)3038 3419 y Fp(1)3089 3407 y Ft(\036)3138 3419 y Fp(1)3176 3407 y Ft(')p Fv(\))p Ft(:)3074 3547 y Fv(\(2.29\))451 3647 y(Since)28 b(supp)14 b Ft(\037)905 3659 y Fp(1)965 3647 y Fq(\032)23 b Fo(R)1107 3617 y Fp(3)1150 3647 y Fq(n)p Ft(B)1255 3662 y Fn(C)t(R=)p Fp(2)1428 3647 y Fv(\(0\))28 b(w)n(e)f(ha)n(v)n(e)461 3861 y Fq(j)p Fv(\()p Ft(B)579 3873 y Fp(1)617 3861 y Ft(\036)666 3873 y Fp(1)703 3861 y Ft(';)14 b(\037)846 3873 y Fp(1)915 3805 y Fv(1)p 894 3842 V 894 3918 a Ft(x)941 3930 y Fp(1)988 3861 y Ft(W)1066 3873 y Fp(1)1104 3861 y Ft(\036)1153 3873 y Fp(1)1191 3861 y Ft(')p Fv(\))p Fq(j)23 b(\024)1465 3805 y Fv(2)p 1421 3842 129 4 v 1421 3918 a Ft(C)6 b(R)1560 3748 y Fm(Z)1606 3936 y Fe(R)1653 3920 y Ff(6)1629 3861 y Ft(d)p Fk(x)1722 3873 y Fp(1)1760 3861 y Ft(d)p Fk(x)1853 3873 y Fp(2)1891 3861 y Fq(j)p Fv(\()p Ft(B)2009 3873 y Fp(1)2046 3861 y Ft(\036)2095 3873 y Fp(1)2133 3861 y Ft(')p Fv(\)\()p Fk(x)2301 3873 y Fp(1)2340 3861 y Ft(;)14 b Fk(x)2427 3873 y Fp(2)2464 3861 y Fv(\))p Fq(j)24 b Ft(\037)2595 3873 y Fp(1)2632 3861 y Fq(j)p Fv(\()p Ft(W)2765 3873 y Fp(1)2803 3861 y Ft(\036)2852 3873 y Fp(1)2890 3861 y Ft(')p Fv(\)\()p Fk(x)3058 3873 y Fp(1)3096 3861 y Ft(;)14 b Fk(x)3183 3873 y Fp(2)3221 3861 y Fv(\))p Fq(j)1129 4118 y(\024)1293 4061 y Fv(2)p 1250 4098 V 1250 4174 a Ft(C)6 b(R)1412 4118 y Fq(k)p Ft(B)1517 4130 y Fp(1)1553 4118 y Fq(k)23 b(k)p Ft(')p Fq(k)f(k)p Ft(W)1898 4130 y Fp(1)1935 4118 y Fq(k)h(k)p Ft(')p Fq(k)46 b(\024)2304 4061 y Ft(c)2340 4073 y Fp(0)p 2304 4098 74 4 v 2309 4174 a Ft(R)2410 4118 y Fq(k)p Ft(')p Fq(k)2548 4083 y Fp(2)2585 4118 y Ft(:)466 b Fv(\(2.30\))451 4283 y(F)-7 b(or)33 b(the)g(second)g(con)n (tribution)g(to)g(\(2.29\),)h(w)n(e)f(ha)n(v)n(e)f(to)h(estimate)g([)p Ft(\037)2729 4295 y Fp(1)p Fn(;)p Fp(0)2819 4283 y Ft(;)14 b(B)2919 4295 y Fp(1)2956 4283 y Fv(])p Ft(p)3021 4295 y Fp(1)3124 4283 y Fv(with)451 4383 y Ft(\037)503 4395 y Fp(1)p Fn(;)p Fp(0)621 4383 y Fv(:=)28 b(1)20 b Fq(\000)g Ft(\037)936 4395 y Fp(1)1004 4383 y Fv(in)31 b(momen)n(tum)g(space.)45 b(Since)31 b Ft(B)2089 4395 y Fp(1)2155 4383 y Fq(2)d(f)p Ft(A)2342 4395 y Fp(1)2379 4383 y Ft(;)14 b(G)2481 4395 y Fp(1)2519 4383 y Fq(g)30 b Fv(w)n(e)g(use)h(the)g(relation)451 4492 y Fq(j)p Fv(\()13 b(~)-55 b Ft(')q(;)14 b Fv([)p Ft(\037)673 4504 y Fp(1)p Fn(;)p Fp(0)763 4492 y Ft(;)g(B)863 4504 y Fp(1)900 4492 y Fv(])p Ft(p)965 4504 y Fp(1)1033 4470 y Fv(~)1016 4492 y Ft( )s Fv(\))p Fq(j)50 b Fv(=)36 b Fq(j)p Fv(\()1351 4470 y(~)1334 4492 y Ft( )t(;)14 b(p)1471 4504 y Fp(1)1507 4492 y Fv([)p Ft(B)1593 4504 y Fp(1)1631 4492 y Ft(;)g(\037)1720 4504 y Fp(1)p Fn(;)p Fp(0)1810 4492 y Fv(])27 b(~)-55 b Ft(')p Fv(\))p Fq(j)36 b Fv(\(for)f(suitable)49 b(~)-56 b Ft(')q(;)2585 4470 y Fv(~)2568 4492 y Ft( )s Fv(\),)38 b(the)d(uniform)3206 4459 y Fp(1)p 3198 4473 51 4 v 3198 4521 a Fn(R)3258 4492 y Fv(-)451 4592 y(b)r(oundedness)f(of)f(whic)n(h)h(has)e(already)h (b)r(een)g(pro)n(v)n(en)f(in)i(the)g(con)n(text)f(of)h(the)g(Bro)n(wn-) 451 4691 y(Ra)n(v)n(enhall)j(case.)67 b(The)37 b(second)h(op)r(erator,) g Ft(W)1994 4703 y Fp(1)2060 4658 y(1)p 2042 4672 71 4 v 2042 4720 a Fn(x)2080 4728 y Ff(1)2122 4691 y Ft(B)2185 4703 y Fp(1)2260 4691 y Fv(is)g(treated)f(in)h(the)h(same)e(w)n(a)n(y) -7 b(,)451 4807 y(using)27 b Ft(W)746 4819 y Fp(1)813 4774 y(1)p 794 4788 V 794 4835 a Fn(x)832 4843 y Ff(1)874 4807 y Ft(B)937 4819 y Fp(1)974 4807 y Ft(\037)1026 4819 y Fp(1)1077 4807 y Ft(\036)1126 4819 y Fp(1)1164 4807 y Ft(')37 b Fv(=)23 b Ft(W)1421 4819 y Fp(1)1487 4774 y(1)p 1468 4788 V 1468 4835 a Fn(x)1506 4843 y Ff(1)1548 4807 y Ft(\037)1600 4819 y Fp(1)1638 4807 y Ft(B)1701 4819 y Fp(1)1752 4807 y Ft(\036)1801 4819 y Fp(1)1838 4807 y Ft(')33 b Fv(+)18 b Ft(W)2086 4819 y Fp(1)2152 4774 y(1)p 2134 4788 V 2134 4835 a Fn(x)2172 4843 y Ff(1)2214 4807 y Fv([)p Ft(B)2300 4819 y Fp(1)2337 4807 y Ft(;)c(\037)2426 4819 y Fp(1)2463 4807 y Fv(])g Ft(\036)2549 4819 y Fp(1)2587 4807 y Ft(':)451 4976 y Fv(In)36 b(the)g(case)f Ft(j)41 b Fv(=)36 b(0)f(w)n(e)h(ha)n(v)n(e)e Ft(r)1518 4988 y Fp(0)1592 4976 y Fv(=)1737 4898 y Fp(2)1710 4914 y Fm(P)1693 5051 y Fn(k)q Fp(=1)1814 4976 y Fv(\()p Ft(b)1882 4933 y Fp(\()p Fn(k)q Fp(\))1882 4999 y(1)p Fn(m)2002 4976 y Fv(+)23 b Ft(b)2126 4933 y Fp(\()p Fn(k)q Fp(\))2126 4999 y(2)p Fn(m)2222 4976 y Fv(\))p Ft(;)36 b Fv(and)f(since)h(supp)14 b Ft(\036)2928 4988 y Fp(0)3001 4976 y Fv(requires)451 5130 y Ft(x)498 5142 y Fp(1)571 5130 y Fq(\025)34 b Ft(C)6 b(x)36 b Fv(as)e(w)n(ell)h(as)f Ft(x)1259 5142 y Fp(2)1331 5130 y Fq(\025)h Ft(C)6 b(x;)85 b Fk(x)35 b Fv(=)g(\()p Fk(x)1918 5142 y Fp(1)1956 5130 y Ft(;)14 b Fk(x)2043 5142 y Fp(2)2080 5130 y Fv(\))p Ft(;)70 b Fv(the)35 b(auxiliary)f (function)h(can)f(b)r(e)1108 5338 y Fw(Document)l(a)25 b(Ma)l(thema)l(tica)h(10)f(\(2005\))g(497{525)p eop %%Page: 515 19 515 18 bop 1301 518 a Ft(N)9 b Fs(-Electr)n(on)31 b(HVZ)f(Theorem)726 b Fv(515)451 725 y(tak)n(en)38 b(from)g(\(1.17\))f(for)h Ft(k)44 b Fv(=)c(1)e(or)g Ft(k)43 b Fv(=)e(2.)69 b(The)38 b(further)g(pro)r(of)g(of)g(the)h(lemma)f(is)451 825 y(iden)n(tical)28 b(to)f(the)h(one)f(for)g Ft(j)h Fv(=)23 b(1)p Ft(:)451 1042 y Fh(c\))117 b Fv(Lemma)33 b(4)g(\(form)n(ulated)h (for)1609 1021 y(~)1609 1042 y Ft(h)1657 1012 y Fp(\(2\))1779 1042 y Fv(in)g(place)f(of)h Ft(h)2249 1012 y Fn(B)s(R)2356 1042 y Fv(\))g(whic)n(h)f(is)h(needed)f(for)h(the)451 1142 y(lo)r(calization)27 b(form)n(ula,)f(has)h(to)h(b)r(e)g(supplemen) n(ted)g(with)g(the)g(follo)n(wing)e(estimate)1015 1325 y(\()p Ft(d)p Fv(\))499 b Fq(j)p Fv(\()p Ft(\036)1725 1337 y Fn(j)1761 1325 y Ft(';)14 b Fv([)p Ft(b)1911 1282 y Fp(\()p Fn(k)q Fp(\))1911 1347 y(2)p Fn(m)2007 1325 y Ft(;)g(\036)2093 1337 y Fn(j)2128 1325 y Fv(])23 b Ft(')p Fv(\))p Fq(j)47 b(\024)2465 1269 y Ft(c)p 2451 1306 64 4 v 2451 1382 a(R)2547 1325 y Fq(k)p Ft(')p Fq(k)2685 1291 y Fp(2)3074 1325 y Fv(\(2.31\))451 1525 y(for)27 b Ft(')d Fq(2)f(A)p Fv(\()p Ft(C)897 1495 y Fi(1)891 1546 y Fp(0)968 1525 y Fv(\()p Fo(R)1054 1495 y Fp(6)1098 1525 y Fq(n)p Ft(B)1203 1537 y Fn(R)1257 1525 y Fv(\(0\)\))18 b Fq(\012)h Fo(C)1550 1495 y Fp(4)1594 1525 y Fv(\))28 b(and)f Ft(R)d(>)e Fv(2)p Ft(:)451 1672 y Fv(The)33 b(pro)r(of)g(is)g (carried)e(out)i(in)h(co)r(ordinate)e(space)g(as)g(are)g(the)i(pro)r (ofs)e(of)h(the)h(Bro)n(wn-)451 1772 y(Ra)n(v)n(enhall)27 b(items)h(of)g(Lemma)g(4.)38 b(W)-7 b(e)28 b(split)h(the)f(comm)n (utator)f(in)h(the)h(same)e(w)n(a)n(y)g(as)h(in)451 1871 y(the)35 b(pro)r(of)f(of)g(Lemma)g(1.)56 b(In)35 b(order)e(to)h(sho)n (w)f(ho)n(w)h(to)g(pro)r(ceed,)i(w)n(e)d(pic)n(k)h(again)g(the)451 1971 y(second)27 b(term)h(of)f(\(2.4\),)h(tak)n(e)f Ft(k)e Fv(=)e(1)k(and)h(decomp)r(ose)781 2197 y([)p Ft(G)869 2209 y Fp(1)952 2141 y Fv(1)p 930 2178 85 4 v 930 2254 a Ft(x)977 2266 y Fp(1)1049 2141 y Fl(\033)1109 2110 y Fp(\(1\))1198 2141 y Fk(p)1251 2153 y Fp(1)p 1049 2178 240 4 v 1102 2254 a Ft(E)1163 2266 y Fn(p)1197 2274 y Ff(1)1312 2197 y Ft(V)1379 2154 y Fp(\(1\))1360 2219 y(10)p Fn(;m)1523 2197 y Ft(A)1585 2209 y Fp(1)1623 2197 y Ft(;)14 b(\036)1709 2209 y Fn(j)1744 2197 y Fv(])46 b(=)g([)p Ft(G)2012 2209 y Fp(1)2049 2197 y Ft(;)14 b(\036)2135 2209 y Fn(j)2171 2197 y Fv(])2239 2141 y(1)p 2218 2178 85 4 v 2218 2254 a Ft(x)2265 2266 y Fp(1)2331 2197 y Fq(\001)2382 2141 y Fl(\033)2442 2110 y Fp(\(1\))2531 2141 y Fk(p)2584 2153 y Fp(1)p 2382 2178 240 4 v 2436 2254 a Ft(E)2497 2266 y Fn(p)2531 2274 y Ff(1)2645 2197 y Ft(V)2712 2154 y Fp(\(1\))2693 2219 y(10)p Fn(;m)2857 2197 y Ft(A)2919 2209 y Fp(1)527 2482 y Fv(+)23 b Ft(G)680 2494 y Fp(1)763 2426 y Fv(1)p 741 2463 85 4 v 741 2539 a Ft(x)788 2551 y Fp(1)849 2482 y Fv([)882 2426 y Fl(\033)943 2396 y Fp(\(1\))1032 2426 y Fk(p)1085 2438 y Fp(1)p 882 2463 240 4 v 936 2539 a Ft(E)997 2551 y Fn(p)1031 2559 y Ff(1)1132 2482 y Ft(;)14 b(\036)1218 2494 y Fn(j)1253 2482 y Fv(])g Ft(V)1357 2439 y Fp(\(1\))1338 2505 y(10)p Fn(;m)1501 2482 y Ft(A)1563 2494 y Fp(1)1642 2482 y Fv(+)41 b Ft(G)1813 2494 y Fp(1)1896 2426 y Fv(1)p 1875 2463 85 4 v 1875 2539 a Ft(x)1922 2551 y Fp(1)1993 2426 y Fl(\033)2053 2396 y Fp(\(1\))2142 2426 y Fk(p)2195 2438 y Fp(1)p 1993 2463 240 4 v 2047 2539 a Ft(E)2108 2551 y Fn(p)2142 2559 y Ff(1)2256 2482 y Ft(x)2303 2494 y Fp(1)2360 2482 y Fq(\001)2433 2426 y Fv(1)p 2411 2463 85 4 v 2411 2539 a Ft(x)2458 2551 y Fp(1)2520 2482 y Fv([)p Ft(V)2610 2439 y Fp(\(1\))2591 2505 y(10)p Fn(;m)2740 2482 y Ft(;)14 b(\036)2826 2494 y Fn(j)2861 2482 y Fv(])g Ft(A)2960 2494 y Fp(1)3074 2482 y Fv(\(2.32\))1188 2742 y(+)23 b Ft(G)1341 2754 y Fp(1)1424 2685 y Fv(1)p 1402 2722 V 1402 2798 a Ft(x)1449 2810 y Fp(1)1521 2685 y Fl(\033)1581 2655 y Fp(\(1\))1670 2685 y Fk(p)1723 2697 y Fp(1)p 1521 2722 240 4 v 1575 2798 a Ft(E)1636 2810 y Fn(p)1670 2818 y Ff(1)1784 2742 y Ft(V)1851 2698 y Fp(\(1\))1832 2764 y(10)p Fn(;m)1995 2742 y Ft(x)2042 2754 y Fp(1)2099 2742 y Fq(\001)2172 2685 y Fv(1)p 2150 2722 85 4 v 2150 2798 a Ft(x)2197 2810 y Fp(1)2258 2742 y Fv([)p Ft(A)2343 2754 y Fp(1)2381 2742 y Ft(;)14 b(\036)2467 2754 y Fn(j)2502 2742 y Fv(])p Ft(:)451 2941 y Fv(W)-7 b(e)25 b(ha)n(v)n(e)e(to)h(pro)n(v)n(e)e(the)1256 2908 y Fp(1)p 1247 2922 51 4 v 1247 2969 a Fn(R)1307 2941 y Fv(-b)r(oundedness)i(of)g(the)h(comm)n(utators)d(\(including)j(the)g (factor)480 3008 y Fp(1)p 461 3022 71 4 v 461 3069 a Fn(x)499 3077 y Ff(1)541 3040 y Fv(\))c(and)g(to)f(assure)f(the)i(b)r (oundedness)g(of)f(the)h(adjacen)n(t)f(op)r(erators.)33 b(The)20 b(comm)n(utators)451 3140 y(with)25 b Ft(G)702 3152 y Fp(1)763 3140 y Fv(and)f Ft(A)983 3152 y Fp(1)1045 3140 y Fv(ha)n(v)n(e)f(already)f(b)r(een)j(dealt)f(with)g(in)h(the)f (Bro)n(wn-Ra)n(v)n(enhall)d(case.)35 b(As)451 3258 y(concerns)27 b([)822 3221 y Fc(\033)869 3196 y Ff(\(1\))946 3221 y Fd(p)988 3229 y Ff(1)p 822 3239 199 4 v 863 3286 a Fn(E)912 3294 y Fj(p)943 3306 y Ff(1)1030 3258 y Ft(;)14 b(\036)1116 3270 y Fn(j)1151 3258 y Fv(])1203 3225 y Fp(1)p 1184 3239 71 4 v 1184 3286 a Fn(x)1222 3294 y Ff(1)1264 3258 y Ft(;)51 b Fv(w)n(e)27 b(ha)n(v)n(e)g(to)g(sho)n(w)g(that)h(its)g(k)n (ernel)e(ob)r(eys)h(the)h(estimate)1251 3474 y Fq(j)1276 3452 y Fv(\024)1274 3474 y Ft(k)1317 3495 y Fc(\033)1364 3478 y Ff(\(1\))1442 3495 y Fd(p)1484 3503 y Ff(1)1566 3472 y(1)p 1526 3481 110 3 v 1526 3515 a Fj(E)1568 3523 y(p)1599 3535 y Ff(1)1649 3474 y Fv(\()p Fk(x)1731 3486 y Fp(1)1769 3474 y Ft(;)14 b Fk(x)1856 3440 y Fi(0)1856 3495 y Fp(1)1894 3474 y Fv(\))p Fq(j)46 b(\024)2278 3418 y Ft(c)p 2116 3455 361 4 v 2116 3531 a Fq(j)p Fk(x)2189 3543 y Fp(1)2245 3531 y Fq(\000)18 b Fk(x)2378 3503 y Fi(0)2378 3553 y Fp(1)2416 3531 y Fq(j)2439 3507 y Fp(3)3074 3474 y Fv(\(2.33\))451 3686 y(with)43 b(some)f(constan)n(t)g Ft(c)p Fv(.)82 b(When)44 b(dealing)e(with)h(the)g(Bro)n(wn-Ra)n(v)n (enhall)d(op)r(erator,)451 3786 y(w)n(e)46 b(ha)n(v)n(e)e(sho)n(wn)h (the)i(corresp)r(onding)c(estimate)j(for)g(the)g(k)n(ernel)f(of)g(the)i (op)r(erator)451 3885 y Fl(\033)511 3855 y Fp(\(1\))600 3885 y Fk(p)653 3897 y Fp(1)691 3885 y Ft(g)s Fv(\()p Ft(p)808 3897 y Fp(1)844 3885 y Fv(\))25 b(with)f Ft(g)s Fv(\()p Ft(p)1203 3897 y Fp(1)1240 3885 y Fv(\))g(=)e([2\()p Ft(p)1522 3855 y Fp(2)1522 3906 y(1)1570 3885 y Fv(+)11 b Ft(m)1719 3855 y Fp(2)1768 3885 y Fv(+)g Ft(m)1917 3813 y Fm(p)p 1999 3813 291 4 v 1999 3885 a Ft(p)2041 3857 y Fp(2)2041 3908 y(1)2097 3885 y Fv(+)18 b Ft(m)2253 3861 y Fp(2)2304 3885 y Fv(\)])2359 3855 y Fi(\000)2421 3833 y Ff(1)p 2421 3842 29 3 v 2421 3875 a(2)2464 3885 y Ft(:)47 b Fv(Replacing)23 b Ft(g)s Fv(\()p Ft(p)3031 3897 y Fp(1)3068 3885 y Fv(\))h(with)451 3997 y(\()p Ft(p)525 3967 y Fp(2)525 4018 y(1)580 3997 y Fv(+)17 b Ft(m)735 3967 y Fp(2)772 3997 y Fv(\))804 3967 y Fi(\000)866 3945 y Ff(1)p 866 3954 V 866 3987 a(2)935 3997 y Fv(do)r(es)27 b(neither)g(c)n(hange)f(the)h(analyticit)n(y)f(prop)r(ert)n(y)g(of)h (the)g(k)n(ernel)g(nor)f(its)451 4097 y(b)r(eha)n(viour)k(as)g Fq(j)p Fk(x)1018 4109 y Fp(1)1077 4097 y Fq(\000)20 b Fk(x)1212 4067 y Fi(0)1212 4117 y Fp(1)1250 4097 y Fq(j)31 b Fv(tends)g(to)g(0)f(or)g(in\014nit)n(y)-7 b(,)33 b(from)d(whic)n(h)h (\(2.33\))f(is)h(established)451 4196 y([14)o(].)451 4296 y(F)-7 b(or)33 b(the)g(further)g(pro)r(of)g(of)g(the)1529 4263 y Fp(1)p 1520 4277 51 4 v 1520 4325 a Fn(R)1580 4296 y Fv(-b)r(oundedness)g(of)g(the)g(comm)n(utator,)h(w)n(e)e(can)h (sub-)451 4396 y(stitute)j Ft(\036)771 4408 y Fn(j)842 4396 y Fv(with)g Ft(\036)1088 4408 y Fn(j)1123 4396 y Ft(\037)f Fv(where)g Ft(\037)p Fv(\()1557 4363 y Fd(x)p 1552 4377 V 1552 4424 a Fn(R)1612 4396 y Fv(\))h(is)f(de\014ned)g(in)h (\(1.20\))e(with)i Fk(x)g Fv(=)f(\()p Fk(x)2881 4408 y Fp(1)2919 4396 y Ft(;)14 b Fk(x)3006 4408 y Fp(2)3044 4396 y Fv(\))71 b(\(see)451 4495 y(the)32 b(discussion)e(b)r(elo)n(w)h (\(1.20\)\).)47 b(Th)n(us)31 b(w)n(e)g(can)g(use)g(the)g(estimate)g (\(1.21\))g(\(for)g Ft(k)h Fv(=)c(1)451 4595 y(and)h Ft(N)k Fv(=)24 b(2\))29 b(deriv)n(ed)f(from)g(the)h(mean)f(v)-5 b(alue)29 b(theorem)f(and)g(mimic)h(the)g(pro)r(of)f(of)h(the)451 4694 y(t)n(w)n(o-electron)d(Bro)n(wn-Ra)n(v)n(enhall)e(case.)451 4794 y(F)-7 b(or)30 b(the)g(treatmen)n(t)g(of)h(the)f(remaining)g(comm) n(utator,)f([)p Ft(V)2354 4751 y Fp(\(1\))2335 4816 y(10)p Fn(;m)2485 4794 y Ft(;)14 b(\036)2571 4806 y Fn(j)2606 4794 y Ft(\037)p Fv(])2710 4761 y Fp(1)p 2691 4775 71 4 v 2691 4823 a Fn(x)2729 4831 y Ff(1)2771 4794 y Ft(;)31 b Fv(w)n(e)e(set)i Ft( )3136 4806 y Fn(j)3198 4794 y Fv(:=)451 4894 y Ft(\036)500 4906 y Fn(j)536 4894 y Ft(\037)c Fv(and)h(decomp)r(ose)1302 5102 y([)p Ft(V)1392 5059 y Fp(\(1\))1373 5124 y(10)p Fn(;m)1523 5102 y Ft(;)14 b( )1614 5114 y Fn(j)1649 5102 y Fv(])1717 5046 y(1)p 1695 5083 85 4 v 1695 5159 a Ft(x)1742 5171 y Fp(1)1836 5102 y Fv(=)46 b([)p Ft(V)2037 5059 y Fp(\(1\))2018 5124 y(10)p Fn(;m)2213 5046 y Fv(1)p 2191 5083 V 2191 5159 a Ft(x)2238 5171 y Fp(1)2286 5102 y Ft(;)14 b( )2377 5114 y Fn(j)2412 5102 y Fv(])639 b(\(2.34\))1108 5338 y Fw(Document)l(a)25 b(Ma)l(thema)l(tica)h(10)f(\(2005\))g(497{525)p eop %%Page: 516 20 516 19 bop 451 518 a Fv(516)727 b Fs(D.)30 b(H.)h(Jakubassa-Amundsen) 451 760 y Fv(=)46 b(2)p Ft(\031)654 725 y Fp(2)705 647 y Fm(Z)788 667 y Fi(1)751 835 y Fp(0)872 760 y Ft(dt)14 b Fv([)p Ft(e)1021 725 y Fi(\000)p Fn(tE)1147 733 y Fj(p)1178 745 y Ff(1)1218 760 y Ft(;)g( )1309 772 y Fn(j)1344 760 y Fv(])1412 703 y(1)p 1391 740 85 4 v 1391 816 a Ft(x)1438 828 y Fp(1)1499 760 y Ft(e)1538 725 y Fi(\000)p Fn(tE)1664 733 y Fj(p)1695 745 y Ff(1)1780 703 y Fv(1)p 1759 740 V 1759 816 a Ft(x)1806 828 y Fp(1)1880 760 y Fv(+)26 b(2)p Ft(\031)2063 725 y Fp(2)2114 647 y Fm(Z)2197 667 y Fi(1)2160 835 y Fp(0)2281 760 y Ft(dt)14 b(e)2407 725 y Fi(\000)p Fn(tE)2533 733 y Fj(p)2564 745 y Ff(1)2650 703 y Fv(1)p 2628 740 V 2628 816 a Ft(x)2675 828 y Fp(1)2736 760 y Fv([)p Ft(e)2798 725 y Fi(\000)p Fn(tE)2924 733 y Fj(p)2955 745 y Ff(1)2995 760 y Ft(;)g( )3086 772 y Fn(j)3121 760 y Fv(])3190 703 y(1)p 3168 740 V 3168 816 a Ft(x)3215 828 y Fp(1)3263 760 y Ft(:)451 963 y Fv(The)28 b(k)n(ernel)f(of)g Ft(e)1000 933 y Fi(\000)p Fn(tE)1126 941 y Fj(p)1157 953 y Ff(1)1225 963 y Fv(in)g(co)r(ordinate)g(space)g (is)g(giv)n(en)g(b)n(y)g([17)o(])553 1177 y(\024)550 1198 y Ft(k)593 1225 y Fn(e)624 1198 y Fg(\000)p Fj(tE)734 1206 y(p)765 1218 y Ff(1)811 1198 y Fv(\()p Fk(x)893 1210 y Fp(1)931 1198 y Ft(;)14 b Fk(x)1018 1164 y Fi(0)1018 1219 y Fp(1)1055 1198 y Ft(;)g(t)p Fv(\))47 b(=)1314 1177 y(\024)1311 1198 y Ft(k)1354 1225 y Fn(e)1385 1198 y Fg(\000)p Fj(tE)1495 1206 y(p)1526 1218 y Ff(1)1572 1198 y Fv(\()1608 1197 y(~)1604 1198 y Fk(x)p Ft(;)14 b(t)p Fv(\))47 b(=)1970 1142 y Ft(t)p 1920 1179 130 4 v 1920 1255 a Fv(2)p Ft(\031)2012 1231 y Fp(2)2164 1142 y Ft(m)2237 1112 y Fp(2)p 2092 1179 254 4 v 2097 1255 a Fv(~)-47 b Ft(x)2139 1231 y Fp(2)2196 1255 y Fv(+)18 b Ft(t)2309 1231 y Fp(2)2379 1198 y Ft(K)2450 1210 y Fp(2)2487 1198 y Fv(\()p Ft(m)2592 1117 y Fm(p)p 2675 1117 V 2680 1198 a Fv(~)-47 b Ft(x)2722 1174 y Fp(2)2778 1198 y Fv(+)18 b Ft(t)2891 1174 y Fp(2)2942 1198 y Fv(\))100 b(\(2.35\))451 1416 y(where)29 b Ft(K)764 1428 y Fp(2)830 1416 y Fv(is)h(a)e(mo)r(di\014ed)i(Bessel)f(function)h(of)f(the)h (second)f(kind)g(and)2772 1415 y(~)2768 1416 y Fk(x)d Fv(:=)g Fk(x)3008 1428 y Fp(1)3065 1416 y Fq(\000)19 b Fk(x)3199 1386 y Fi(0)3199 1436 y Fp(1)3237 1416 y Ft(:)451 1515 y Fv(Making)k(use)h(of)g(the)h(analyticit)n(y)e(of)h Ft(K)1689 1527 y Fp(2)1726 1515 y Fv(\()p Ft(z)t Fv(\))g(for)f Ft(z)k(>)22 b Fv(0)i(and)g(its)g(b)r(eha)n(viour)f Ft(K)2922 1527 y Fp(2)2959 1515 y Fv(\()p Ft(z)t Fv(\))g Fq(\030)3203 1483 y Fp(2)p 3186 1497 67 4 v 3186 1544 a Fn(z)3220 1527 y Ff(2)451 1624 y Fv(for)k Ft(z)g Fq(!)c Fv(0)k(and)g Ft(K)1051 1636 y Fp(2)1088 1624 y Fv(\()p Ft(z)t Fv(\))c Fq(\030)1306 1559 y Fm(p)p 1389 1559 88 4 v 1412 1591 a Fn(\031)p 1399 1605 68 4 v 1399 1652 a Fp(2)p Fn(z)1490 1624 y Ft(e)1529 1594 y Fi(\000)p Fn(z)1669 1624 y Fv(for)k Ft(z)f Fq(!)e(1)50 b Fv([1,)28 b(p.377])e(w)n(e)h(ha)n(v)n(e)1592 1856 y Fq(j)p Ft(K)1686 1868 y Fp(2)1723 1856 y Fv(\()p Ft(z)t Fv(\))p Fq(j)46 b(\024)2020 1800 y Fv(2)p Ft(c)2098 1812 y Fp(1)p 2020 1837 115 4 v 2038 1913 a Ft(z)2081 1889 y Fp(2)3074 1856 y Fv(\(2.36\))451 2078 y(and)28 b(therefore)e(w)n(e)i(can)f(estimate)1570 2056 y(\024)1568 2078 y Ft(k)1611 2105 y Fn(e)1642 2078 y Fg(\000)p Fj(tE)1752 2086 y(p)1783 2098 y Ff(1)1856 2078 y Fv(b)n(y)h(the)g(corresp)r (onding)d(k)n(ernel)i(for)g Ft(m)c Fv(=)g(0)p Ft(;)957 2303 y Fq(j)982 2281 y Fv(\024)980 2303 y Ft(k)1023 2330 y Fn(e)1054 2303 y Fg(\000)p Fj(tE)1164 2311 y(p)1195 2323 y Ff(1)1240 2303 y Fv(\()1276 2302 y(~)1272 2303 y Fk(x)q Ft(;)14 b(t)p Fv(\))p Fq(j)46 b(\024)1641 2247 y Ft(t)p 1612 2284 88 4 v 1612 2360 a(\031)1662 2336 y Fp(2)1884 2247 y Ft(c)1920 2259 y Fp(1)p 1743 2284 356 4 v 1743 2360 a Fv(\()5 b(~)-47 b Ft(x)1822 2336 y Fp(2)1878 2360 y Fv(+)18 b Ft(t)1991 2336 y Fp(2)2028 2360 y Fv(\))2060 2336 y Fp(2)2154 2303 y Fv(=)46 b Ft(c)2301 2315 y Fp(1)2363 2281 y Fv(\024)2361 2303 y Ft(k)2404 2321 y Fn(e)2435 2302 y Fg(\000)p Fj(tp)2534 2314 y Ff(1)2575 2303 y Fv(\()2611 2302 y(~)2607 2303 y Fk(x)q Ft(;)14 b(t)p Fv(\))p Ft(:)294 b Fv(\(2.37\))451 2534 y(Th)n(us)24 b(w)n(e)g(obtain)g(for)g(the)g(k)n(ernel)f(of)i(the)f(second)g(con)n (tribution)f(to)i(\(2.34\),)f(using)g(\(2.37\))451 2633 y(and)k(\(1.21\),)998 2866 y Ft(S)1049 2878 y Fp(0)1109 2866 y Fv(:=)1243 2745 y Fm(\014)1243 2795 y(\014)1243 2845 y(\014)1243 2895 y(\014)1271 2753 y(Z)1354 2773 y Fi(1)1317 2941 y Fp(0)1438 2866 y Ft(dt)1536 2844 y Fv(\024)1534 2866 y Ft(k)1577 2892 y Fn(e)1608 2865 y Fg(\000)p Fj(tE)1718 2873 y(p)1749 2885 y Ff(1)1819 2870 y(1)p 1800 2879 66 3 v 1800 2912 a Fj(x)1833 2924 y Ff(1)1875 2892 y Fp([)p Fn(e)1925 2865 y Fg(\000)p Fj(tE)2035 2873 y(p)2066 2885 y Ff(1)2107 2892 y Fn(; )2171 2900 y Fj(j)2202 2892 y Fp(])2249 2870 y Ff(1)p 2231 2879 V 2231 2912 a Fj(x)2264 2924 y Ff(1)2310 2866 y Fv(\()p Fk(x)2392 2878 y Fp(1)2430 2866 y Ft(;)14 b Fk(y)2517 2878 y Fp(1)2555 2866 y Ft(;)g Fk(x)2642 2878 y Fp(2)2679 2866 y Fv(\))2711 2745 y Fm(\014)2711 2795 y(\014)2711 2845 y(\014)2711 2895 y(\014)3074 2866 y Fv(\(2.38\))650 3159 y(=)761 3039 y Fm(\014)761 3089 y(\014)761 3138 y(\014)761 3188 y(\014)788 3046 y(Z)871 3067 y Fi(1)834 3235 y Fp(0)955 3159 y Ft(dt)1042 3046 y Fm(Z)1089 3235 y Fe(R)1136 3218 y Ff(3)1181 3159 y Ft(d)p Fk(x)1274 3125 y Fi(0)1274 3180 y Fp(1)1385 3103 y Ft(t)p 1336 3140 130 4 v 1336 3216 a Fv(2)p Ft(\031)1428 3192 y Fp(2)1717 3103 y Ft(m)1790 3073 y Fp(2)p 1498 3140 548 4 v 1498 3216 a Fv(\()p Fk(x)1580 3228 y Fp(1)1637 3216 y Fq(\000)k Fk(x)1770 3188 y Fi(0)1770 3238 y Fp(1)1807 3216 y Fv(\))1839 3192 y Fp(2)1895 3216 y Fv(+)g Ft(t)2008 3192 y Fp(2)2069 3159 y Ft(K)2140 3171 y Fp(2)2177 3159 y Fv(\()p Ft(m)2282 3060 y Fm(q)p 2365 3060 V 99 x Fv(\()p Fk(x)2447 3171 y Fp(1)2504 3159 y Fq(\000)g Fk(x)2637 3131 y Fi(0)2637 3181 y Fp(1)2674 3159 y Fv(\))2706 3135 y Fp(2)2762 3159 y Fv(+)g Ft(t)2875 3135 y Fp(2)2926 3159 y Fv(\))3004 3103 y(1)p 2983 3140 85 4 v 2983 3216 a Ft(x)3030 3188 y Fi(0)3030 3238 y Fp(1)489 3420 y Fq(\001)572 3364 y Ft(t)p 522 3401 130 4 v 522 3477 a Fv(2)p Ft(\031)614 3453 y Fp(2)904 3364 y Ft(m)977 3334 y Fp(2)p 685 3401 548 4 v 685 3477 a Fv(\()p Fk(x)767 3448 y Fi(0)767 3499 y Fp(1)823 3477 y Fq(\000)g Fk(y)956 3489 y Fp(1)994 3477 y Fv(\))1026 3453 y Fp(2)1082 3477 y Fv(+)g Ft(t)1195 3453 y Fp(2)1294 3420 y Ft(K)1365 3432 y Fp(2)1402 3420 y Fv(\()p Ft(m)1507 3321 y Fm(q)p 1590 3321 V 99 x Fv(\()p Fk(x)1672 3391 y Fi(0)1672 3442 y Fp(1)1728 3420 y Fq(\000)g Fk(y)1861 3432 y Fp(1)1899 3420 y Fv(\))1931 3396 y Fp(2)1987 3420 y Fv(+)g Ft(t)2100 3396 y Fp(2)2151 3420 y Fv(\))2225 3364 y(1)p 2207 3401 78 4 v 2207 3477 a Ft(y)2248 3489 y Fp(1)2322 3420 y Fv(\()q Ft( )2409 3432 y Fn(j)2444 3420 y Fv(\()p Fk(y)2526 3432 y Fp(1)2564 3420 y Ft(;)c Fk(x)2651 3432 y Fp(2)2688 3420 y Fv(\))19 b Fq(\000)f Ft( )2876 3432 y Fn(j)2911 3420 y Fv(\()p Fk(x)2993 3386 y Fi(0)2993 3441 y Fp(1)3031 3420 y Ft(;)c Fk(x)3118 3432 y Fp(2)3156 3420 y Fv(\)\))3220 3300 y Fm(\014)3220 3349 y(\014)3220 3399 y(\014)3220 3449 y(\014)451 3681 y Fq(\024)579 3625 y Ft(c)615 3594 y Fp(2)615 3645 y(1)p 572 3662 88 4 v 572 3738 a Ft(\031)622 3714 y Fp(4)683 3568 y Fm(Z)766 3588 y Fi(1)729 3756 y Fp(0)850 3681 y Ft(t)880 3646 y Fp(2)931 3681 y Ft(dt)1018 3568 y Fm(Z)1065 3756 y Fe(R)1112 3740 y Ff(3)1157 3681 y Ft(d)p Fk(x)1250 3646 y Fi(0)1250 3701 y Fp(1)1606 3625 y Fv(1)p 1312 3662 631 4 v 1312 3738 a([\()p Fk(x)1417 3750 y Fp(1)1473 3738 y Fq(\000)k Fk(x)1606 3709 y Fi(0)1606 3760 y Fp(1)1644 3738 y Fv(\))1676 3714 y Fp(2)1732 3738 y Fv(+)g Ft(t)1845 3714 y Fp(2)1882 3738 y Fv(])1905 3714 y Fp(2)1998 3625 y Fv(1)p 1976 3662 85 4 v 1976 3738 a Ft(x)2023 3709 y Fi(0)2023 3760 y Fp(1)2389 3625 y Fv(1)p 2094 3662 631 4 v 2094 3738 a([\()p Fk(x)2199 3709 y Fi(0)2199 3760 y Fp(1)2256 3738 y Fq(\000)g Fk(y)2389 3750 y Fp(1)2427 3738 y Fv(\))2459 3714 y Fp(2)2515 3738 y Fv(+)g Ft(t)2628 3714 y Fp(2)2665 3738 y Fv(])2688 3714 y Fp(2)2777 3625 y Fv(1)p 2759 3662 78 4 v 2759 3738 a Ft(y)2800 3750 y Fp(1)2847 3681 y Fq(\001j)p Fk(x)2943 3646 y Fi(0)2943 3701 y Fp(1)2981 3681 y Fq(\000)p Fk(y)3096 3693 y Fp(1)3133 3681 y Fq(j)3180 3625 y Ft(c)3216 3637 y Fp(0)p 3180 3662 74 4 v 3185 3738 a Ft(R)3263 3681 y(:)451 3888 y Fv(With)32 b(the)g(help)g(of)f(the)h(estimate)1804 3855 y Fp(1)p 1591 3869 459 4 v 1591 3917 a([\()p Fd(x)1676 3896 y Fg(0)1676 3935 y Ff(1)1708 3917 y Fi(\000)p Fd(y)1800 3925 y Ff(1)1832 3917 y Fp(\))1858 3900 y Ff(2)1890 3917 y Fp(+)p Fn(t)1966 3900 y Ff(2)1999 3917 y Fp(])2018 3900 y Ff(2)2089 3888 y Fq(\024)2222 3855 y Fp(1)p 2222 3869 34 4 v 2226 3917 a Fn(t)2407 3855 y Fp(1)p 2289 3869 268 4 v 2289 3917 a Fi(j)p Fd(x)2349 3896 y Fg(0)2349 3935 y Ff(1)2381 3917 y Fi(\000)p Fd(y)2473 3925 y Ff(1)2505 3917 y Fi(j)2525 3900 y Ff(3)2567 3888 y Ft(;)61 b Fv(the)32 b Ft(t)p Fv(-in)n(tegral)d(can)451 4000 y(b)r(e)f(carried)e(out,)1104 4112 y Fm(Z)1187 4133 y Fi(1)1150 4301 y Fp(0)1271 4225 y Ft(dt)1678 4169 y(t)p 1377 4206 631 4 v 1377 4282 a Fv([\()p Fk(x)1482 4294 y Fp(1)1539 4282 y Fq(\000)18 b Fk(x)1672 4253 y Fi(0)1672 4304 y Fp(1)1709 4282 y Fv(\))1741 4258 y Fp(2)1797 4282 y Fv(+)g Ft(t)1910 4258 y Fp(2)1948 4282 y Fv(])1971 4258 y Fp(2)2064 4225 y Fv(=)2372 4169 y(1)p 2185 4206 416 4 v 2185 4282 a(2)c Fq(j)p Fk(x)2314 4294 y Fp(1)2369 4282 y Fq(\000)k Fk(x)2502 4253 y Fi(0)2502 4304 y Fp(1)2540 4282 y Fq(j)2563 4258 y Fp(2)2610 4225 y Ft(:)441 b Fv(\(2.39\))451 4465 y(According)38 b(to)h(the)h(Lieb)f(and)g(Y)-7 b(au)40 b(form)n(ula)e(\(2.16\))g(in)i (co)r(ordinate)e(space,)j(the)3206 4433 y Fp(1)p 3198 4447 51 4 v 3198 4494 a Fn(R)3258 4465 y Fv(-)451 4565 y(b)r(oundedness)c(of)g Ft(S)1103 4577 y Fp(0)1178 4565 y Fv(in)n(tegrated)f(o)n(v)n(er)f Fk(y)1819 4577 y Fp(1)1857 4565 y Fv(,)40 b(resp)r(ectiv)n(ely)c(o)n(v)n(er)f Fk(x)2619 4577 y Fp(1)2657 4565 y Fv(,)40 b(with)d(a)g(suitably)451 4665 y(c)n(hosen)k(con)n(v)n(ergence)d(generating)i(function)i Ft(f)9 b Fv(,)45 b(has)40 b(to)i(b)r(e)f(sho)n(wn)g(\(in)h(analogy)d (to)451 4764 y(\(2.17\)\).)451 4864 y(With)29 b(the)f(c)n(hoice)e Ft(f)9 b Fv(\()p Ft(x)p Fv(\))24 b(=)f Ft(x)1375 4834 y Fn(\013)1450 4864 y Fv(and)28 b(\(2.39\))e(w)n(e)i(ha)n(v)n(e)1386 5094 y Ft(I)7 b Fv(\()p Fk(x)1511 5106 y Fp(1)1549 5094 y Fv(\))23 b(:=)1738 4981 y Fm(Z)1784 5170 y Fe(R)1831 5153 y Ff(3)1876 5094 y Ft(d)p Fk(y)1969 5106 y Fp(1)2021 5094 y Ft(S)2072 5106 y Fp(0)2142 5038 y Ft(f)9 b Fv(\()p Ft(x)2271 5050 y Fp(1)2309 5038 y Fv(\))p 2142 5075 199 4 v 2145 5151 a Ft(f)g Fv(\()p Ft(y)2268 5163 y Fp(1)2305 5151 y Fv(\))1108 5338 y Fw(Document)l(a)25 b(Ma)l(thema)l(tica)h(10)f (\(2005\))g(497{525)p eop %%Page: 517 21 517 20 bop 1301 518 a Ft(N)9 b Fs(-Electr)n(on)31 b(HVZ)f(Theorem)726 b Fv(517)756 755 y Fq(\024)892 699 y Fv(~)-44 b Ft(c)p 877 736 64 4 v 877 812 a(R)964 642 y Fm(Z)1010 831 y Fe(R)1057 814 y Ff(3)1102 755 y Ft(d)p Fk(x)1195 721 y Fi(0)1195 776 y Fp(1)1426 699 y Fv(1)p 1266 736 361 4 v 1266 812 a Fq(j)p Fk(x)1339 824 y Fp(1)1395 812 y Fq(\000)19 b Fk(x)1529 783 y Fi(0)1529 834 y Fp(1)1566 812 y Fq(j)1589 788 y Fp(2)1691 699 y Fv(1)p 1669 736 85 4 v 1669 812 a Ft(x)1716 783 y Fi(0)1716 834 y Fp(1)1778 642 y Fm(Z)1824 831 y Fe(R)1871 814 y Ff(3)1916 755 y Ft(d)p Fk(y)2009 767 y Fp(1)2098 699 y Fv(1)p 2080 736 78 4 v 2080 812 a Ft(y)2121 824 y Fp(1)2361 699 y Fv(1)p 2201 736 361 4 v 2201 812 a Fq(j)p Fk(x)2274 783 y Fi(0)2274 834 y Fp(1)2330 812 y Fq(\000)f Fk(y)2463 824 y Fp(1)2501 812 y Fq(j)2524 788 y Fp(2)2590 755 y Fq(\001)2641 699 y Ft(x)2688 669 y Fn(\013)2688 719 y Fp(1)p 2641 736 95 4 v 2643 812 a Ft(y)2687 783 y Fn(\013)2684 834 y Fp(1)2746 755 y Ft(:)305 b Fv(\(2.40\))451 961 y(With)23 b(the)f(substitutions)g Fk(y)1336 973 y Fp(1)1397 961 y Fv(=:)g Ft(x)1554 930 y Fi(0)1554 981 y Fp(1)1592 961 y Fk(z)g Fv(and)g(then)g Fk(x)2045 930 y Fi(0)2045 981 y Fp(1)2106 961 y Fv(=:)h Ft(x)2264 973 y Fp(1)2301 961 y Fl(\030)i Fv(the)d(t)n(w)n(o)f(in)n(tegrals)f(separate)451 1060 y(suc)n(h)27 b(that)h(\(with)h Fk(e)1084 1072 y Fn(x)1148 1060 y Fv(:=)23 b Fk(x)p Ft(=x)p Fv(\))666 1290 y Ft(I)7 b Fv(\()p Fk(x)791 1302 y Fp(1)829 1290 y Fv(\))47 b Fq(\024)1044 1234 y Fv(~)-44 b Ft(c)p 1028 1271 64 4 v 1028 1347 a(R)1116 1177 y Fm(Z)1162 1366 y Fe(R)1209 1349 y Ff(3)1306 1234 y Ft(d)p Fl(\030)p 1264 1271 172 4 v 1264 1347 a Ft(\030)1304 1323 y Fp(1+)p Fn(\013)1632 1234 y Fv(1)p 1479 1271 348 4 v 1479 1347 a Fq(j)p Fk(e)1546 1359 y Fn(x)1584 1367 y Ff(1)1638 1347 y Fq(\000)18 b Fl(\030)s Fq(j)1789 1323 y Fp(2)1855 1290 y Fq(\001)1896 1177 y Fm(Z)1942 1366 y Fe(R)1989 1349 y Ff(3)2089 1234 y Ft(d)p Fk(z)p 2045 1271 174 4 v 2045 1347 a Ft(z)2088 1323 y Fp(1+)p Fn(\013)2413 1234 y Fv(1)p 2261 1271 346 4 v 2261 1347 a Fq(j)p Fk(e)2328 1361 y Fn(x)2366 1341 y Fg(0)2366 1379 y Ff(1)2421 1347 y Fq(\000)g Fk(z)p Fq(j)2569 1323 y Fp(2)2663 1290 y Fq(\024)2783 1234 y Ft(C)p 2783 1271 66 4 v 2784 1347 a(R)3074 1290 y Fv(\(2.41\))451 1560 y(if)29 b(0)24 b Ft(<)g(\013)h(<)f Fv(2)k([3].)39 b(In)29 b(the)g(same)f(w)n(a)n(y)f(it) i(is)f(sho)n(wn)g(that)h Ft(J)8 b Fv(\()p Fk(y)2435 1572 y Fp(1)2473 1560 y Fv(\))24 b(:=)2651 1493 y Fm(R)2634 1643 y Fe(R)2681 1626 y Ff(3)2730 1560 y Ft(d)p Fk(x)2823 1572 y Fp(1)2875 1560 y Ft(S)2926 1572 y Fp(0)2987 1518 y Fn(y)3023 1493 y Fj(\013)3021 1534 y Ff(1)p 2986 1541 80 4 v 2986 1589 a Fn(x)3024 1569 y Fj(\013)3024 1607 y Ff(1)3101 1560 y Fq(\024)3200 1527 y Fn(C)p 3200 1541 52 4 v 3201 1589 a(R)451 1721 y Fv(for)30 b(1)e Ft(<)g(\013)h(<)f Fv(3)p Ft(:)58 b Fv(Th)n(us)31 b Ft(\013)e Fv(=)f(3)p Ft(=)p Fv(2)h(assures)g(the)i(1)p Ft(=R)q Fv(-b)r(oundedness)e(of)i Ft(I)38 b Fv(and)30 b Ft(J)8 b Fv(.)47 b(The)451 1821 y(\014rst)36 b(con)n(tribution)g(to)g(\(2.34\))g(is)g(treated)g(along)g (the)g(same)g(lines.)64 b(This)36 b(pro)n(v)n(es)f(the)451 1937 y(1)p Ft(=R)q Fv(-b)r(oundedness)26 b(of)i([)p Ft(V)1298 1894 y Fp(\(1\))1279 1959 y(10)p Fn(;m)1428 1937 y Ft(;)14 b( )1519 1949 y Fn(j)1554 1937 y Fv(])1606 1904 y Fp(1)p 1587 1918 71 4 v 1587 1965 a Fn(x)1625 1973 y Ff(1)1667 1937 y Ft(:)451 2077 y Fv(Finally)30 b(the)h(b)r(oundedness)f(of)g(the) g(t)n(w)n(o)g(op)r(erators)e(o)r(ccurring)g(in)j(\(2.32\),)2907 2045 y Fp(1)p 2889 2059 V 2889 2106 a Fn(x)2927 2114 y Ff(1)2993 2040 y Fc(\033)3040 2015 y Ff(\(1\))3117 2040 y Fd(p)3159 2048 y Ff(1)p 2993 2058 199 4 v 3034 2106 a Fn(E)3083 2114 y Fj(p)3114 2126 y Ff(1)3201 2077 y Ft(x)3248 2089 y Fp(1)451 2222 y Fv(and)646 2189 y Fp(1)p 627 2203 71 4 v 627 2250 a Fn(x)665 2258 y Ff(1)721 2222 y Ft(V)788 2179 y Fp(\(1\))769 2244 y(10)p Fn(;m)919 2222 y Ft(x)966 2234 y Fp(1)1003 2222 y Ft(;)i Fv(has)f(to)g(b)r(e)h (sho)n(wn.)51 b(W)-7 b(e)33 b(use)g(the)f(fact)h(that)g(for)f(an)n(y)g (b)r(ounded)h(op-)451 2337 y(erator)i Fq(O)r Ft(;)913 2304 y Fp(1)p 894 2318 V 894 2366 a Fn(x)932 2374 y Ff(1)988 2337 y Fq(O)r Ft(x)1103 2349 y Fp(1)1192 2337 y Fv(=)1323 2304 y Fp(1)p 1304 2318 V 1304 2366 a Fn(x)1342 2374 y Ff(1)1398 2337 y Fv([)p Fq(O)r Ft(;)14 b(x)1573 2349 y Fp(1)1611 2337 y Fv(])24 b(+)g Fq(O)r Ft(;)74 b Fv(suc)n(h)35 b(that)i(for)e(the)i(\014rst)f(op)r(erator,)g(only)451 2475 y(the)29 b(b)r(oundedness)g(of)1208 2443 y Fp(1)p 1189 2457 V 1189 2504 a Fn(x)1227 2512 y Ff(1)1283 2475 y Fv([)1316 2438 y Fc(\033)1363 2413 y Ff(\(1\))1440 2438 y Fd(p)1482 2446 y Ff(1)p 1316 2456 199 4 v 1357 2504 a Fn(E)1406 2512 y Fj(p)1437 2524 y Ff(1)1525 2475 y Ft(;)14 b(x)1609 2487 y Fp(1)1646 2475 y Fv(])54 b(has)28 b(to)g(b)r(e)h(established.)40 b(W)-7 b(e)29 b(use)f(the)h(estimate)451 2595 y(\(2.33\))e(to)g(write)1471 2701 y Fq(j)1496 2679 y Fv(\024)1494 2701 y Ft(k)1566 2727 y Ff(1)p 1548 2736 66 3 v 1548 2770 a Fj(x)1581 2782 y Ff(1)1623 2750 y Fp([)1652 2718 y Fc(\033)1699 2703 y Ff(\(1\))1776 2718 y Fb(p)1811 2730 y Ff(1)p 1652 2736 192 3 v 1693 2770 a Fj(E)1735 2778 y(p)1766 2790 y Ff(1)1853 2750 y Fn(;x)1911 2758 y Ff(1)1943 2750 y Fp(])1966 2701 y Fv(\()p Fk(x)2048 2713 y Fp(1)2086 2701 y Ft(;)14 b Fk(x)2173 2667 y Fi(0)2173 2721 y Fp(1)2210 2701 y Fv(\))p Fq(j)924 2981 y Fv(=)1035 2860 y Fm(\014)1035 2910 y(\014)1035 2960 y(\014)1035 3010 y(\014)1094 2924 y Fv(1)p 1072 2961 85 4 v 1072 3038 a Ft(x)1119 3050 y Fp(1)1192 2959 y Fv(\024)1190 2981 y Ft(k)1243 2998 y Fc(\033)1290 2983 y Ff(\(1\))1367 2998 y Fb(p)1402 3010 y Ff(1)p 1243 3016 192 3 v 1284 3049 a Fj(E)1326 3057 y(p)1357 3069 y Ff(1)1449 2981 y Fv(\()p Fk(x)1531 2993 y Fp(1)1569 2981 y Ft(;)g Fk(x)1656 2946 y Fi(0)1656 3001 y Fp(1)1693 2981 y Fv(\))19 b Fq(\001)g Fv(\()p Ft(x)1865 2993 y Fp(1)1921 2981 y Fq(\000)f Ft(x)2051 2946 y Fi(0)2051 3001 y Fp(1)2089 2981 y Fv(\))2121 2860 y Fm(\014)2121 2910 y(\014)2121 2960 y(\014)2121 3010 y(\014)2195 2981 y Fq(\024)2342 2924 y Fv(~)-44 b Ft(c)p 2315 2961 85 4 v 2315 3038 a(x)2362 3050 y Fp(1)2602 2924 y Fv(1)p 2443 2961 361 4 v 2443 3038 a Fq(j)p Fk(x)2516 3050 y Fp(1)2572 3038 y Fq(\000)18 b Fk(x)2705 3009 y Fi(0)2705 3060 y Fp(1)2743 3038 y Fq(j)2766 3014 y Fp(2)3074 2981 y Fv(\(2.42\))451 3208 y(and)32 b(with)h(the)g(c)n(hoice)f Ft(f)9 b Fv(\()p Ft(x)p Fv(\))31 b(=)g Ft(x)1546 3178 y Fp(3)p Fn(=)p Fp(2)1651 3208 y Ft(;)46 b Fv(\(2.42\))32 b(m)n(ultiplied)h(b)n(y)f Ft(f)9 b Fv(\()p Ft(x)2613 3220 y Fp(1)2651 3208 y Fv(\))p Ft(=f)g Fv(\()p Ft(x)2854 3178 y Fi(0)2854 3228 y Fp(1)2891 3208 y Fv(\))33 b(and)f(in)n(te-)451 3307 y(grated)23 b(o)n(v)n(er)g Ft(d)p Fk(x)974 3277 y Fi(0)974 3328 y Fp(1)1012 3307 y Fv(,)i(resp)r(ectiv)n(e)e(m)n (ultiplied)i(b)n(y)f Ft(f)9 b Fv(\()p Ft(x)2074 3277 y Fi(0)2074 3328 y Fp(1)2111 3307 y Fv(\))p Ft(=f)g Fv(\()p Ft(x)2314 3319 y Fp(1)2352 3307 y Fv(\))24 b(and)g(in)n(tegrated)g(o)n (v)n(er)e Ft(d)p Fk(x)3225 3319 y Fp(1)3263 3307 y Fv(,)451 3407 y(is)28 b(\014nite.)37 b(This)28 b(pro)n(v)n(es)d(the)j(desired)f (b)r(oundedness.)451 3520 y(Concerning)g(the)h(op)r(erator)1396 3487 y Fp(1)p 1377 3501 71 4 v 1377 3549 a Fn(x)1415 3557 y Ff(1)1457 3520 y Ft(V)1524 3477 y Fp(\(1\))1505 3542 y(10)p Fn(;m)1655 3520 y Ft(x)1702 3532 y Fp(1)1767 3520 y Fv(w)n(e)f(decomp)r(ose)578 3714 y(1)p 556 3751 85 4 v 556 3827 a Ft(x)603 3839 y Fp(1)665 3770 y Ft(V)732 3727 y Fp(\(1\))713 3792 y(10)p Fn(;m)876 3770 y Ft(x)923 3782 y Fp(1)1007 3770 y Fv(=)45 b(2)p Ft(\031)1209 3735 y Fp(2)1260 3657 y Fm(Z)1343 3677 y Fi(1)1306 3845 y Fp(0)1427 3770 y Ft(dt)1555 3714 y Fv(1)p 1534 3751 V 1534 3827 a Ft(x)1581 3839 y Fp(1)1651 3770 y Ft(e)1690 3735 y Fi(\000)p Fn(tE)1816 3743 y Fj(p)1847 3755 y Ff(1)1933 3714 y Fv(1)p 1911 3751 V 1911 3827 a Ft(x)1958 3839 y Fp(1)2019 3702 y Fm(\010)2068 3770 y Fv([)p Ft(e)2130 3735 y Fi(\000)p Fn(tE)2256 3743 y Fj(p)2287 3755 y Ff(1)2327 3770 y Ft(;)14 b(x)2411 3782 y Fp(1)2448 3770 y Fv(])19 b(+)f Ft(x)2620 3782 y Fp(1)2658 3770 y Ft(e)2697 3735 y Fi(\000)p Fn(tE)2823 3743 y Fj(p)2854 3755 y Ff(1)2893 3702 y Fm(\011)2956 3770 y Ft(:)95 b Fv(\(2.43\))451 4057 y(In)28 b(the)h(second)e(con)n(tribution)g(the)h Ft(t)p Fv(-in)n(tegral)f(can)g(b)r(e)h(carried)f(out,)2666 3974 y Fi(1)2663 3991 y Fm(R)2666 4134 y Fp(0)2738 4057 y Ft(dt)2853 4025 y Fp(1)p 2835 4039 71 4 v 2835 4086 a Fn(x)2873 4094 y Ff(1)2929 4057 y Ft(e)2968 4027 y Fi(\000)p Fp(2)p Fn(tE)3127 4035 y Fj(p)3158 4047 y Ff(1)3221 4057 y Fv(=)554 4188 y Fp(1)p 461 4202 220 4 v 461 4249 a(2)p Fn(x)532 4257 y Ff(1)564 4249 y Fn(E)613 4257 y Fj(p)644 4269 y Ff(1)744 4221 y Fv(whic)n(h)i(is)g(a)g(b)r(ounded)g(op) r(erator.)39 b(F)-7 b(or)28 b(the)i(\014rst)e(con)n(tribution,)h(w)n(e) g(can)f(again)451 4341 y(use)j(the)g(estimate)g(\(2.36\))f(for)h(the)g (Bessel)f(function)i(together)e(with)h(the)h(estimate)e(for)451 4440 y(the)e Ft(t)p Fv(-dep)r(endence,)g(resulting)f(in)h(\(2.39\),)f (suc)n(h)g(that)1081 4656 y(~)1067 4677 y Ft(S)1118 4689 y Fp(0)1178 4677 y Fv(:=)1303 4556 y Fm(\014)1303 4606 y(\014)1303 4656 y(\014)1303 4706 y(\014)1331 4564 y(Z)1414 4584 y Fi(1)1377 4752 y Fp(0)1498 4677 y Ft(dt)1596 4655 y Fv(\024)1594 4677 y Ft(k)1666 4681 y Ff(1)p 1647 4690 66 3 v 1647 4724 a Fj(x)1680 4736 y Ff(1)1723 4704 y Fn(e)1754 4677 y Fg(\000)p Fj(tE)1864 4685 y(p)1895 4697 y Ff(1)1964 4681 y(1)p 1946 4690 V 1946 4724 a Fj(x)1979 4736 y Ff(1)2021 4704 y Fp([)p Fn(e)2071 4677 y Fg(\000)p Fj(tE)2181 4685 y(p)2212 4697 y Ff(1)2253 4704 y Fn(;x)2311 4712 y Ff(1)2342 4704 y Fp(])2365 4677 y Fv(\()p Fk(x)2447 4689 y Fp(1)2485 4677 y Ft(;)14 b Fk(y)2572 4689 y Fp(1)2610 4677 y Fv(\))2642 4556 y Fm(\014)2642 4606 y(\014)2642 4656 y(\014)2642 4706 y(\014)595 4981 y Fv(=)706 4860 y Fm(\014)706 4910 y(\014)706 4960 y(\014)706 5010 y(\014)734 4868 y(Z)817 4888 y Fi(1)780 5056 y Fp(0)901 4981 y Ft(dt)1019 4924 y Fv(1)p 998 4961 85 4 v 998 5038 a Ft(x)1045 5050 y Fp(1)1106 4868 y Fm(Z)1152 5056 y Fe(R)1199 5040 y Ff(3)1245 4981 y Ft(d)p Fk(x)1338 4946 y Fi(0)1338 5001 y Fp(1)1449 4924 y Ft(t)p 1399 4961 130 4 v 1399 5038 a Fv(2)p Ft(\031)1491 5014 y Fp(2)1772 4924 y Ft(m)1845 4894 y Fp(2)p 1562 4961 529 4 v 1562 5038 a Fq(j)p Fk(x)1635 5050 y Fp(1)1691 5038 y Fq(\000)k Fk(x)1824 5009 y Fi(0)1824 5060 y Fp(1)1862 5038 y Fq(j)1885 5014 y Fp(2)1941 5038 y Fv(+)g Ft(t)2054 5014 y Fp(2)2124 4981 y Ft(K)2195 4993 y Fp(2)2232 4981 y Fv(\()p Ft(m)2337 4881 y Fm(q)p 2420 4881 548 4 v 100 x Fv(\()p Fk(x)2502 4993 y Fp(1)2558 4981 y Fq(\000)g Fk(x)2691 4952 y Fi(0)2691 5003 y Fp(1)2729 4981 y Fv(\))2761 4957 y Fp(2)2817 4981 y Fv(+)g Ft(t)2930 4957 y Fp(2)2981 4981 y Fv(\))3059 4924 y(1)p 3037 4961 85 4 v 3037 5038 a Ft(x)3084 5009 y Fi(0)3084 5060 y Fp(1)3074 5130 y Fv(\(2.44\))1108 5338 y Fw(Document)l(a)25 b(Ma)l(thema)l(tica)h(10)f(\(2005\))g(497{525)p eop %%Page: 518 22 518 21 bop 451 518 a Fv(518)727 b Fs(D.)30 b(H.)h(Jakubassa-Amundsen) 839 766 y Fq(\001)945 710 y Ft(t)p 896 747 130 4 v 896 823 a Fv(2)p Ft(\031)988 799 y Fp(2)1277 710 y Ft(m)1350 679 y Fp(2)p 1058 747 548 4 v 1058 823 a Fv(\()p Fk(x)1140 794 y Fi(0)1140 845 y Fp(1)1197 823 y Fq(\000)18 b Fk(y)1330 835 y Fp(1)1367 823 y Fv(\))1399 799 y Fp(2)1455 823 y Fv(+)g Ft(t)1568 799 y Fp(2)1639 766 y Ft(K)1710 778 y Fp(2)1746 766 y Fv(\()p Ft(m)1851 667 y Fm(q)p 1935 667 V 1935 766 a Fv(\()p Fk(x)2017 737 y Fi(0)2017 788 y Fp(1)2073 766 y Fq(\000)g Fk(y)2206 778 y Fp(1)2244 766 y Fv(\))2276 742 y Fp(2)2332 766 y Fv(+)g Ft(t)2445 742 y Fp(2)2496 766 y Fv(\))c(\()p Ft(y)2615 778 y Fp(1)2671 766 y Fq(\000)k Ft(x)2801 732 y Fi(0)2801 786 y Fp(1)2838 766 y Fv(\))2870 645 y Fm(\014)2870 695 y(\014)2870 745 y(\014)2870 795 y(\014)1109 1010 y Fq(\024)24 b Fv(~)-44 b Ft(c)1232 1022 y Fp(0)1315 954 y Fv(1)p 1293 991 85 4 v 1293 1067 a Ft(x)1340 1079 y Fp(1)1402 897 y Fm(Z)1448 1086 y Fe(R)1495 1069 y Ff(3)1540 1010 y Ft(d)p Fk(x)1633 976 y Fi(0)1633 1031 y Fp(1)1864 954 y Fv(1)p 1704 991 361 4 v 1704 1067 a Fq(j)p Fk(x)1777 1079 y Fp(1)1833 1067 y Fq(\000)18 b Fk(x)1966 1039 y Fi(0)1966 1089 y Fp(1)2004 1067 y Fq(j)2027 1043 y Fp(2)2129 954 y Fv(1)p 2107 991 85 4 v 2107 1067 a Ft(x)2154 1039 y Fi(0)2154 1089 y Fp(1)2394 954 y Fv(1)p 2235 991 361 4 v 2235 1067 a Fq(j)p Fk(x)2308 1039 y Fi(0)2308 1089 y Fp(1)2364 1067 y Fq(\000)g Fk(y)2497 1079 y Fp(1)2535 1067 y Fq(j)2558 1043 y Fp(2)2605 1010 y Ft(:)451 1204 y Fv(With)27 b Ft(\013)c Fv(=)g(3)p Ft(=)p Fv(2)p Ft(;)h Fv(in)i(the)g(same)f(w)n(a)n (y)f(as)h(sho)n(wn)g(in)h(the)g(step)f(from)h(\(2.40\))f(to)g (\(2.41\),)g(one)451 1318 y(obtains)757 1297 y(~)748 1318 y Ft(I)7 b Fv(\()p Fk(x)873 1330 y Fp(1)910 1318 y Fv(\))33 b(:=)1104 1251 y Fm(R)1086 1401 y Fe(R)1133 1384 y Ff(3)1182 1318 y Ft(d)p Fk(y)1275 1330 y Fp(1)1341 1297 y Fv(~)1327 1318 y Ft(S)1378 1330 y Fp(0)1425 1276 y Fn(x)1463 1251 y Fj(\013)1463 1293 y Ff(1)p 1425 1299 80 4 v 1426 1347 a Fn(y)1462 1327 y Fj(\013)1460 1365 y Ff(1)1561 1318 y Fq(\024)e Ft(c)65 b Fv(and)1945 1297 y(~)1924 1318 y Ft(J)8 b Fv(\()p Fk(y)2060 1330 y Fp(1)2098 1318 y Fv(\))33 b(:=)2292 1251 y Fm(R)2274 1401 y Fe(R)2321 1384 y Ff(3)2370 1318 y Ft(d)p Fk(x)2463 1330 y Fp(1)2529 1297 y Fv(~)2515 1318 y Ft(S)2566 1330 y Fp(0)2614 1276 y Fn(y)2650 1251 y Fj(\013)2648 1293 y Ff(1)p 2613 1299 V 2613 1347 a Fn(x)2651 1327 y Fj(\013)2651 1365 y Ff(1)2735 1318 y Fq(\024)e Ft(c:)65 b Fv(Th)n(us)33 b(the)451 1504 y(b)r(oundedness)28 b(of)1062 1472 y Fp(1)p 1043 1486 71 4 v 1043 1533 a Fn(x)1081 1541 y Ff(1)1137 1504 y Ft(V)1204 1461 y Fp(\(1\))1185 1526 y(10)p Fn(;m)1334 1504 y Ft(x)1381 1516 y Fp(1)1447 1504 y Fv(is)f(sho)n(wn.)451 1636 y(In)47 b(the)f(remaining)f(con)n(tributions)h(to)g([)p Ft(b)1845 1593 y Fp(\(1\))1845 1658 y(2)p Fn(m)1941 1636 y Ft(;)14 b(\036)2027 1648 y Fn(j)2062 1636 y Ft(\037)p Fv(])46 b(the)h(terms)f(not)g(treated)g(so)f(far)451 1736 y(are)50 b([)675 1703 y Fn(m)p 646 1717 117 4 v 646 1764 a(E)695 1772 y Fj(p)726 1784 y Ff(1)772 1736 y Ft(;)14 b(\036)858 1748 y Fn(j)893 1736 y Ft(\037)p Fv(])997 1703 y Fp(1)p 978 1717 71 4 v 978 1764 a Fn(x)1016 1772 y Ff(1)1058 1736 y Ft(;)65 b Fv(the)1331 1703 y Fp(1)p 1322 1717 51 4 v 1322 1764 a Fn(R)1383 1736 y Fv(-b)r(oundedness)50 b(of)h(whic)n(h)f(follo)n(ws)g(from)h(the)g (estimate)451 1868 y Fq(j)476 1846 y Fv(\024)474 1868 y Ft(k)556 1858 y Fj(m)p 527 1867 110 3 v 527 1900 a(E)569 1908 y(p)600 1920 y Ff(1)651 1868 y Fv(\()p Fk(x)733 1880 y Fp(1)771 1868 y Ft(;)14 b Fk(x)858 1837 y Fi(0)858 1888 y Fp(1)895 1868 y Fv(\))p Fq(j)40 b(\024)26 b Ft(c=)p Fq(j)p Fk(x)1232 1880 y Fp(1)1289 1868 y Fq(\000)19 b Fk(x)1423 1837 y Fi(0)1423 1888 y Fp(1)1461 1868 y Fq(j)1484 1837 y Fp(3)1577 1868 y Fv(\(whic)n(h)29 b(is)h(pro)n(v)n(en)e(in)h (the)h(same)f(w)n(a)n(y)f(as)h(the)h(corre-)451 2026 y(sp)r(onding)e(Bro)n(wn-Ra)n(v)n(enhall)e(estimate)i(for)j(~)-45 b Ft(g)s Fv(\()p Ft(p)2035 2038 y Fp(1)2072 2026 y Fv(\))25 b(:=)2265 1993 y Fn(m)p 2251 2007 88 4 v 2251 2016 a Fi(p)p 2305 2016 34 3 v 2305 2064 a Fp(2)2362 2026 y Fv(\()p Ft(E)2455 2038 y Fn(p)2489 2046 y Ff(1)2545 2026 y Fv(+)2629 1936 y Fm(q)p 2712 1936 439 4 v 90 x Ft(E)2778 2002 y Fp(2)2773 2046 y Fn(p)2807 2054 y Ff(1)2863 2026 y Fv(+)18 b Ft(mE)3080 2038 y Fn(p)3114 2046 y Ff(1)3164 2026 y Fv(\))3196 1996 y Fi(\000)p Fp(1)451 2160 y Fv(in)35 b(place)f(of)h Ft(m=E)1052 2172 y Fn(p)1086 2180 y Ff(1)1157 2160 y Fv([14)o(]\).)58 b(The)34 b(b)r(oundedness)h(of)f(the)h (additional)f(term)2955 2128 y Fp(1)p 2937 2142 71 4 v 2937 2189 a Fn(x)2975 2197 y Ff(1)3069 2128 y Fn(m)p 3041 2142 117 4 v 3041 2189 a(E)3090 2197 y Fj(p)3121 2209 y Ff(1)3167 2160 y Ft(x)3214 2172 y Fp(1)451 2292 y Fv(\(resp)r(ectiv)n(e)898 2259 y Fp(1)p 879 2273 71 4 v 879 2321 a Fn(x)917 2329 y Ff(1)959 2292 y Fv([)1021 2259 y Fn(m)p 992 2273 117 4 v 992 2321 a(E)1041 2329 y Fj(p)1072 2341 y Ff(1)1118 2292 y Ft(;)14 b(x)1202 2304 y Fp(1)1240 2292 y Fv(]\))51 b(follo)n(ws)27 b(from)g(\(2.42\))g (form)n(ulated)g(for)2604 2270 y(\024)2602 2292 y Ft(k)2684 2282 y Fj(m)p 2655 2291 110 3 v 2655 2325 a(E)2697 2333 y(p)2728 2345 y Ff(1)2778 2292 y Ft(:)451 2411 y Fv(This)h(completes)f (the)h(pro)r(of)f(of)h(Lemma)f(4.)451 2629 y(W)-7 b(e)29 b(no)n(w)f(turn)h(to)g(the)g('easy)e(part')i(of)f(the)h(HVZ)g(theorem,) g(where)f(w)n(e)g(ha)n(v)n(e)g(to)g(assure)451 2729 y(that)j([\006)717 2741 y Fp(0)755 2729 y Ft(;)14 b Fq(1)p Fv(\))28 b Fq(\032)h Ft(\033)1076 2741 y Fn(ess)1174 2729 y Fv(\()1207 2707 y(~)1206 2729 y Ft(h)1254 2698 y Fp(\(2\))1344 2729 y Fv(\))p Ft(:)60 b Fv(W)-7 b(e)31 b(use)g(the)g(metho)r(d)g(of)g(pro)r (of)g(applied)g(to)f(the)i(m)n(ulti-)451 2828 y(particle)26 b(Bro)n(wn-Ra)n(v)n(enhall)d(op)r(erator)h(\(see)i(section)g(1)g (\(b\)\).)37 b(The)27 b(pro)r(of)e(of)h(con)n(tin)n(uit)n(y)451 2928 y(of)d Ft(\033)s Fv(\()p Ft(T)f Fv(+)10 b Ft(a)813 2940 y Fn(j)848 2928 y Fv(\))23 b(for)g Ft(j)28 b Fq(2)c(f)p Fv(0)p Ft(;)14 b(:::;)g(N)9 b Fq(g)21 b Fv(with)j Ft(a)1762 2940 y Fn(j)1820 2928 y Fv(from)f(\(2.5\))h(do)r(es)f(not)g(dep)r(end)h (on)f(the)h(c)n(hoice)451 3027 y(of)33 b(the)g(single-particle)e(p)r (oten)n(tial)i(and)f(hence)h(also)e(holds)i(true)f(for)g(the)h (Jansen-Hess)451 3127 y(op)r(erator.)59 b(With)37 b Ft(T)1114 3139 y Fd(a)1189 3127 y Fv(from)f(\(1.25\))e(for)h Ft(N)46 b Fv(=)35 b(2)h(and)f Ft(')2290 3139 y Fn(n)2372 3127 y Fq(2)h Ft(C)2528 3097 y Fi(1)2522 3148 y Fp(0)2599 3127 y Fv(\()p Fo(R)2685 3097 y Fp(6)2729 3127 y Fv(\))24 b Fq(\012)f Fo(C)2927 3097 y Fp(4)3006 3127 y Fv(a)35 b(de\014n-)451 3227 y(ing)h(sequence)g(for)g Ft(\025)j Fq(2)f Ft(\033)s Fv(\()p Ft(T)e Fv(+)24 b Ft(a)1567 3239 y Fn(j)1602 3227 y Fv(\))37 b(w)n(e)f(ha)n(v)n(e)f(\(according)g(to)i (\(1.26\)\))f(to)g(sho)n(w)g(that)451 3326 y Fq(k)p Ft(r)530 3338 y Fn(j)579 3326 y Ft(T)628 3338 y Fd(a)668 3326 y Ft(')722 3338 y Fn(n)768 3326 y Fq(k)25 b Ft(<)f(\017)55 b Fv(for)28 b Ft(n)h Fv(and)g Ft(a)g Fv(su\016cien)n(tly)g(large,)f (where)g Ft(r)2379 3338 y Fn(j)2443 3326 y Fv(no)n(w)h(includes)g(the)g (terms)451 3445 y Ft(b)487 3402 y Fp(\()p Fn(k)q Fp(\))487 3467 y(2)p Fn(m)611 3445 y Fv(with)f Ft(k)35 b(=)-51 b Fq(2)23 b Ft(C)1006 3457 y Fp(1)p Fn(j)1074 3445 y Ft(:)451 3592 y Fh(\(d\))28 b Fv(Lemma)g(5)f(has)g(therefore)f(to)i(b)r (e)g(supplemen)n(ted)g(with)g(the)g(conjecture)1527 3786 y Fq(k)p Ft(b)1605 3743 y Fp(\()p Fn(k)q Fp(\))1605 3809 y(2)p Fn(m)1714 3786 y Ft(')p Fq(k)46 b(\024)1990 3730 y Ft(c)p 1976 3767 64 4 v 1976 3843 a(R)2073 3786 y Fq(k)p Ft(')p Fq(k)863 b Fv(\(2.45\))451 3996 y(where)34 b Ft(')h Fq(2)g Ft(C)942 3966 y Fi(1)936 4016 y Fp(0)1012 3996 y Fv(\(\012\))24 b Fq(\012)e Fo(C)1301 3966 y Fp(2)p Fn(l)1435 3996 y Fv(with)35 b(\012)f(:=)g Fq(f)p Fk(x)g Fv(=)g(\()p Fk(x)2154 4008 y Fp(1)2192 3996 y Ft(;)14 b(:::;)g Fk(x)2385 4008 y Fn(l)2411 3996 y Fv(\))35 b Fq(2)f Fo(R)2621 3966 y Fp(3)q Fn(l)2720 3996 y Fv(:)49 b Ft(x)2839 4008 y Fn(i)2901 3996 y Ft(>)34 b(R)h Fq(8)14 b Ft(i)33 b Fv(=)451 4095 y(1)p Ft(;)14 b(:::;)g(l)r Fq(g)p Ft(;)52 b(R)27 b(>)e Fv(1)k(and)g Ft(k)g Fq(2)d(f)p Fv(1)p Ft(;)14 b(:::;)g(l)r Fq(g)28 b Fv(where)g Ft(l)j Fv(is)e(the)h(n)n(um)n(b)r(er)f(of)g(electrons)g(in)g(cluster)451 4195 y Ft(C)510 4207 y Fp(2)p Fn(j)579 4195 y Ft(:)24 b Fv(The)g(domain)f(\012)h(allo)n(ws)f(for)h(the)g(in)n(tro)r(duction)g (of)g(the)g(auxiliary)f(function)h Ft(\037)g Fv(from)451 4295 y(\(1.31\))j(whic)n(h)h(is)f(unit)n(y)h(on)f(the)h(supp)r(ort)g (of)f Ft(':)451 4410 y Fv(As)32 b(discussed)g(in)g(the)h(pro)r(of)e(of) h(Lemma)g(3,)h Ft(b)1948 4367 y Fp(\()p Fn(k)q Fp(\))1948 4432 y(2)p Fn(m)2075 4410 y Fv(consists)f(\(for)f Ft(k)j Fv(=)c(1\))i(of)g(terms)f(lik)n(e)451 4510 y Ft(W)529 4522 y Fp(1)595 4477 y(1)p 577 4491 71 4 v 577 4539 a Fn(x)615 4547 y Ff(1)657 4510 y Ft(B)720 4522 y Fp(1)821 4510 y Fv(\(and)i(its)g(Hermitean)g(conjugate\),)h(suc)n(h)e(that)h (the)g(idea)f(of)h(\(2.29\))f(can)g(b)r(e)451 4610 y(used,)592 4817 y Fq(j)p Fv(\()p Ft(\036;)14 b(W)811 4829 y Fp(1)895 4761 y Fv(1)p 873 4798 85 4 v 873 4874 a Ft(x)920 4886 y Fp(1)982 4817 y Ft(B)1045 4829 y Fp(1)1096 4817 y Ft(')p Fv(\))p Fq(j)47 b(\024)e(j)p Fv(\()p Ft(W)1495 4829 y Fp(1)1533 4817 y Ft(\036;)1651 4761 y Fv(1)p 1630 4798 V 1630 4874 a Ft(x)1677 4886 y Fp(1)1738 4817 y Ft(\037)14 b(B)1867 4829 y Fp(1)1918 4817 y Ft(')p Fv(\))p Fq(j)42 b Fv(+)f Fq(j)p Fv(\()p Ft(W)2308 4829 y Fp(1)2346 4817 y Ft(\036;)2464 4761 y Fv(1)p 2443 4798 V 2443 4874 a Ft(x)2490 4886 y Fp(1)2551 4817 y Fv([)p Ft(\037;)14 b(B)2726 4829 y Fp(1)2763 4817 y Fv(])g Ft(')p Fv(\))p Fq(j)p Ft(:)142 b Fv(\(2.46\))451 5031 y(Therefore,)27 b(the)h(pro)r(of)f(of)g(Lemma)h(3)f(establishes)g(the)h(v)-5 b(alidit)n(y)27 b(of)h(\(2.45\),)f(to)r(o.)451 5130 y(Th)n(us)h(the)f (pro)r(of)g(of)h(Theorem)f(2)g(is)g(complete.)1256 b Fa(\003)1108 5338 y Fw(Document)l(a)25 b(Ma)l(thema)l(tica)h(10)f (\(2005\))g(497{525)p eop %%Page: 519 23 519 22 bop 1301 518 a Ft(N)9 b Fs(-Electr)n(on)31 b(HVZ)f(Theorem)726 b Fv(519)451 725 y(W)-7 b(e)29 b(remark)e(that)i(the)g(t)n(w)n (o-particle)e(p)r(oten)n(tials)h(of)2143 703 y(~)2142 725 y Ft(h)2190 695 y Fp(\(2\))2308 725 y Fv(coincide)g(with)h(those)f (of)h Ft(h)3179 695 y Fn(B)s(R)451 825 y Fv(and)36 b(hence)g(are)f (nonnegativ)n(e.)61 b(Therefore,)37 b(as)f(demonstrated)f(in)i(section) e(1)h(\(b)r(elo)n(w)451 924 y(\(1.9\)\),)28 b Ft(j)h Fv(=)23 b(0)k(\(corresp)r(onding)g(to)g(the)i(cluster)e(decomp)r (osition)h(where)f(the)h(n)n(ucleus)g(is)451 1024 y(separated)e(from)h (all)g(electrons\))f(can)h(b)r(e)h(omitted)f(in)h(the)g(determination)e (of)i(\006)3016 1036 y Fp(0)3053 1024 y Ft(:)f Fv(Th)n(us)451 1124 y(the)35 b(in\014m)n(um)g(of)g(the)g(essen)n(tial)f(sp)r(ectrum)g (of)h Ft(h)2042 1093 y Fp(\(2\))2166 1124 y Fv(is)f(giv)n(en)g(b)n(y)g (the)h(\014rst)g(ionization)451 1223 y(threshold)30 b(\(i.e.)44 b(the)31 b(in\014m)n(um)g(of)f(the)g(sp)r(ectrum)g(of)g(the)h(op)r (erator)d(describing)h(an)h(ion)451 1323 y(with)e(one)f(electron)g (less\))h(increased)e(b)n(y)i(the)g(electron's)e(rest)h(energy)g Ft(m)p Fv(.)451 1546 y Fs(3)92 b(The)32 b(mul)-6 b(tip)g(ar)g(ticle)33 b(Jansen-Hess)e(opera)-6 b(tor)451 1728 y Fv(Let)899 1888 y Ft(H)975 1845 y Fp(\(2\))968 1912 y Fn(N)1087 1888 y Fv(:=)46 b Ft(H)1297 1854 y Fn(B)s(R)1437 1888 y Fv(+)31 b(\003)1591 1900 y Fp(+)p Fn(;N)1748 1888 y Fv(\()1811 1784 y Fn(N)1780 1809 y Fm(X)1780 1988 y Fn(k)q Fp(=1)1915 1888 y Ft(B)1982 1845 y Fp(\()p Fn(k)q Fp(\))1978 1910 y(2)p Fn(m)2107 1888 y Fv(+)2271 1784 y Fn(N)2241 1809 y Fm(X)2204 1988 y Fn(k)q(>l)p Fp(=1)2412 1888 y Ft(C)2477 1854 y Fp(\()p Fn(k)q(l)p Fp(\))2591 1888 y Fv(\))23 b(\003)2704 1900 y Fp(+)p Fn(;N)3115 1888 y Fv(\(3.1\))1258 2205 y(=:)1391 2184 y(~)1369 2205 y Ft(H)1445 2162 y Fp(\(2\))1438 2230 y Fn(N)1575 2205 y Fv(+)41 b(\003)1739 2217 y Fp(+)p Fn(;N)1954 2101 y(N)1924 2126 y Fm(X)1887 2305 y Fn(k)q(>l)p Fp(=1)2094 2205 y Ft(C)2159 2171 y Fp(\()p Fn(k)q(l)p Fp(\))2288 2205 y Fv(\003)2346 2217 y Fp(+)p Fn(;N)451 2441 y Fv(with)28 b Ft(H)716 2410 y Fn(B)s(R)851 2441 y Fv(from)f(\(1.1\))h(and)f(the)h (second-order)d(p)r(oten)n(tials)j(from)f(\(2.1\))g(and)h(\(2.2\).)451 2540 y(According)f(to)h(section)f(1,)g(the)h(pro)r(ofs)f(of)h(the)g (required)f(lemmata)g(to)h(assure)e(the)j(HVZ)451 2651 y(theorem)34 b(for)937 2630 y(~)916 2651 y Ft(H)992 2608 y Fp(\(2\))985 2676 y Fn(N)1115 2651 y Fv(are)g(easily)g(generalized)f (to)i(the)g Ft(N)9 b Fv(-electron)33 b(case)h(\(with)h(the)g(ex-)451 2751 y(ception)h(of)f(Lemma)g(1\).)60 b(F)-7 b(or)35 b(Lemma)g(1)g(to)h(hold,)h(w)n(e)e(ha)n(v)n(e)f(to)h(establish)g(the)h (form)451 2867 y(b)r(oundedness)23 b(of)h(the)f(total)g(p)r(oten)n (tial)1728 2846 y(~)1704 2867 y Ft(W)1782 2879 y Fp(0)1843 2867 y Fv(of)1955 2846 y(~)1933 2867 y Ft(H)2009 2824 y Fp(\(2\))2002 2891 y Fn(N)2121 2867 y Fv(with)h(resp)r(ect)f(to)g (the)h(m)n(ultiparticle)451 2966 y(kinetic)k(energy)e Ft(T)1035 2978 y Fp(0)1072 2966 y Fv(.)37 b(W)-7 b(e)28 b(can)f(pro)n(v)n(e)f(\(see)i(App)r(endix)g(A\))451 3142 y Fs(Lemma)61 b Fv(7)p Fs(.)d Fh(L)l(et)1108 3121 y Fv(~)1086 3142 y Ft(H)1162 3098 y Fp(\(2\))1155 3166 y Fn(N)1321 3142 y Fv(=:)69 b Ft(T)1527 3154 y Fp(0)1601 3142 y Fv(+)1728 3121 y(~)1703 3142 y Ft(W)1781 3154 y Fp(0)1875 3142 y Fh(b)l(e)55 b(\(as)h(de\014ne)l(d)g(in)g(\(3.1\))h(with)f Ft(T)3091 3154 y Fp(0)3198 3142 y Fv(:=)451 3301 y(\003)509 3313 y Fp(+)p Fn(;N)687 3222 y(N)673 3239 y Fm(P)656 3376 y Fn(k)q Fp(=1)791 3301 y Ft(D)862 3258 y Fp(\()p Fn(k)q Fp(\))860 3323 y(0)969 3301 y Fv(\003)1027 3313 y Fp(+)p Fn(;N)1160 3301 y Fh(\))31 b(the)g Ft(N)9 b Fh(-ele)l(ctr)l(on)30 b(Jansen-Hess)g(op)l(er)l(ator)i(without)g(the)f (se)l(c)l(ond-)451 3469 y(or)l(der)e(two-ele)l(ctr)l(on)e(inter)l (action)h(terms,)g(acting)g(on)g Fq(A)p Fv(\()p Ft(H)2334 3481 y Fp(1)2372 3469 y Fv(\()p Fo(R)2458 3439 y Fp(3)2501 3469 y Fv(\))14 b Fq(\012)g Fo(C)2680 3439 y Fp(4)2723 3469 y Fv(\))2755 3439 y Fn(N)2818 3469 y Ft(:)28 b Fh(Then)3107 3448 y Fv(~)3083 3469 y Ft(W)3161 3481 y Fp(0)3226 3469 y Fh(is)451 3569 y(r)l(elatively)j(form)g(b)l(ounde)l(d)f(with)g(r)l (esp)l(e)l(ct)g(to)g(the)g(kinetic)g(ener)l(gy)g(op)l(er)l(ator)h Ft(T)2917 3581 y Fp(0)2954 3569 y Fh(,)1154 3743 y Fq(j)p Fv(\()p Ft( )s(;)1328 3722 y Fv(~)1303 3743 y Ft(W)1381 3755 y Fp(0)1419 3743 y Ft( )s Fv(\))p Fq(j)47 b(\024)e Ft(c)1724 3755 y Fp(1)1785 3743 y Fv(\()p Ft( )s(;)14 b(T)1960 3755 y Fp(0)2011 3743 y Ft( )s Fv(\))41 b(+)g Ft(C)2306 3755 y Fp(1)2367 3743 y Fv(\()p Ft( )s(;)14 b( )s Fv(\))533 b(\(3.2\))451 3917 y Fh(with)31 b Ft(c)668 3929 y Fp(1)728 3917 y Ft(<)22 b Fv(1)30 b Fh(for)g Ft(\015)e(<)22 b(\015)1220 3929 y Fn(B)s(R)1358 3917 y Fh(irr)l(esp)l(e)l(ctive)30 b(of)h(the)f(ele)l(ctr)l(on)g(numb)l(er)f Ft(N)38 b Fh(\(for)31 b Ft(N)g Fq(\024)23 b Ft(Z)6 b Fh(\).)451 4076 y Fv(W)-7 b(e)63 b(remark)e(that)h(the)h(relativ)n(e)e(form)h(b)r(oundedness)g (of)g(the)h(total)f(p)r(oten)n(tial)451 4187 y Ft(W)529 4199 y Fp(0)616 4187 y Fv(:=)48 b Ft(H)828 4144 y Fp(\(2\))821 4211 y Fn(N)946 4187 y Fq(\000)28 b Ft(T)1088 4199 y Fp(0)1168 4187 y Fv(holds)43 b(only)f(for)h(a)f(smaller)g(critical)h Ft(\015)5 b Fv(.)83 b(Using)43 b(the)g(estimate)451 4347 y Fq(j)p Fv(\()p Ft( )560 4359 y Fp(+)616 4347 y Ft(;)720 4268 y Fn(N)706 4284 y Fm(P)653 4422 y Fn(k)q(>l)p Fp(=1)860 4347 y Ft(C)925 4316 y Fp(\()p Fn(k)q(l)p Fp(\))1040 4347 y Ft( )1094 4359 y Fp(+)1149 4347 y Fv(\))p Fq(j)24 b(\024)g Ft(\015)1374 4314 y Fn(e)1405 4289 y Ff(2)1438 4314 y Fn(\031)1479 4289 y Ff(2)p 1374 4328 138 4 v 1426 4375 a Fp(2)1545 4314 y Fn(N)6 b Fi(\000)p Fp(1)p 1545 4328 144 4 v 1601 4375 a(2)1713 4347 y Fv(\()p Ft( )s(;)14 b(T)1888 4359 y Fp(0)1925 4347 y Ft( )s Fv(\))52 b(with)29 b Ft( )2310 4359 y Fp(+)2389 4347 y Fv(:=)24 b(\003)2559 4359 y Fp(+)p Fn(;N)2692 4347 y Ft( )31 b Fv([13)o(],)e(w)n(e)f(found) 451 4505 y Ft(\015)g(<)22 b Fv(0)p Ft(:)p Fv(454)45 b(\()p Ft(Z)29 b Fq(\024)22 b Fv(62\))27 b(for)g Ft(N)32 b Fv(=)23 b Ft(Z)6 b Fv(.)451 4621 y(The)34 b(pro)r(of)g(of)f(Lemma)h(1)g(for)f (the)i Ft(N)9 b Fv(-electron)32 b(op)r(erator)2400 4600 y(~)2378 4621 y Ft(H)2454 4577 y Fp(\(2\))2447 4645 y Fn(N)2577 4621 y Fv(is)i(then)h(done)e(in)i(the)451 4720 y(same)21 b(w)n(a)n(y)f(as)h(for)g(the)h(Bro)n(wn-Ra)n(v)n(enhall)d(op) r(erator)h(in)h(section)h(1)f(\(using)g(the)h(estimates)451 4820 y(for)27 b(the)h(second-order)d(single-particle)i(in)n(teraction)f (from)h(section)h(2)f(\(a\)\).)451 4919 y(F)-7 b(or)40 b(the)h(pro)r(of)e(of)i(Prop)r(osition)d(1)i(form)n(ulated)g(for)g(the) h Ft(N)9 b Fv(-electron)39 b(case)g(w)n(e)h(note)451 5031 y(that)32 b(the)g(resolv)n(en)n(t)e Ft(R)1198 5043 y Fn(N)s(;\026)1348 5031 y Fv(:=)g(\()p Ft(H)1574 4987 y Fp(\(2\))1567 5055 y Fn(N)1684 5031 y Fv(+)21 b Ft(\026)p Fv(\))1852 5000 y Fi(\000)p Fp(1)1976 5031 y Fq(\000)g Fv(\()2116 5010 y(~)2094 5031 y Ft(H)2170 4987 y Fp(\(2\))2163 5055 y Fn(N)2281 5031 y Fv(+)f Ft(\026)p Fv(\))2448 5000 y Fi(\000)p Fp(1)2570 5031 y Fv(can)31 b(b)r(e)h(written)g(as)f(a)451 5130 y(\014nite)j(sum)g(of)f(compact)g(op)r(erators)e(of)i(the)h(t)n (yp)r(e)g(\(2.10\).)53 b(In)33 b(place)g(of)h Ft(W)2899 5142 y Fp(2)2936 5130 y Fv(,)h(w)n(e)e(ha)n(v)n(e)1108 5338 y Fw(Document)l(a)25 b(Ma)l(thema)l(tica)h(10)f(\(2005\))g (497{525)p eop %%Page: 520 24 520 23 bop 451 518 a Fv(520)727 b Fs(D.)30 b(H.)h(Jakubassa-Amundsen) 451 725 y Ft(W)529 737 y Fn(k)q(l)615 725 y Fv(:=)24 b(\()p Ft(T)30 b Fv(+)18 b Ft(\026)p Fv(\))1003 695 y Fi(\000)p Fp(1)1093 725 y Ft(C)1158 695 y Fp(\()p Fn(k)q(l)p Fp(\))1272 725 y Fv(\()p Ft(T)30 b Fv(+)18 b Ft(\026)p Fv(\))1548 695 y Fi(\000)p Fp(1)1680 725 y Fv(with)28 b(the)h Ft(N)9 b Fv(-particle)26 b(kinetic)j(energy)d Ft(T)12 b Fv(.)38 b(Since,)451 825 y(ho)n(w)n(ev)n(er,)25 b(\()p Ft(T)j Fv(+)17 b Ft(\026)p Fv(\))1065 795 y Fi(\000)p Fp(1)1177 825 y Fq(\024)23 b Fv(\()p Ft(T)1358 795 y Fp(\()p Fn(k)q Fp(\))1467 825 y Fv(+)17 b Ft(T)1610 795 y Fp(\()p Fn(l)p Fp(\))1703 825 y Fv(+)g Ft(\026)p Fv(\))1867 795 y Fi(\000)p Fp(1)1956 825 y Ft(;)50 b Fv(the)27 b(compactness)f (pro)r(of)g(for)h Ft(W)3072 837 y Fn(k)q(l)3161 825 y Fv(can)451 924 y(b)r(e)35 b(copied)f(from)h(the)g Ft(N)43 b Fv(=)34 b(2)h(case.)57 b(In)34 b(addition,)j(w)n(e)d(ha)n(v)n(e)f(to) i(assure)e(the)i(relativ)n(e)451 1035 y(op)r(erator)26 b(b)r(oundedness)i(of)f(the)h(total)f(p)r(oten)n(tial)h(of)g Ft(H)2231 992 y Fp(\(2\))2224 1060 y Fn(N)2319 1035 y Fv(:)451 1214 y Fs(Lemma)33 b Fv(8)p Fs(.)42 b Fh(L)l(et)30 b Ft(H)1093 1171 y Fp(\(2\))1086 1239 y Fn(N)1208 1214 y Fv(=:)25 b Ft(T)1370 1226 y Fp(0)1426 1214 y Fv(+)19 b Ft(W)1588 1226 y Fp(0)1657 1214 y Fh(b)l(e)32 b(the)f Ft(N)9 b Fh(-ele)l(ctr)l(on)30 b(Jansen-Hess)h(op)l(er)l(ator.)44 b(F)-6 b(or)451 1314 y Ft(\015)28 b(<)22 b(\015)652 1326 y Fp(1)719 1314 y Fh(the)30 b(total)g(p)l(otential)h Ft(W)1466 1326 y Fp(0)1533 1314 y Fh(is)f(b)l(ounde)l(d)g(by)h(the)e (kinetic)i(ener)l(gy)f(op)l(er)l(ator,)1487 1488 y Fq(k)p Ft(W)1607 1500 y Fp(0)1658 1488 y Ft( )s Fq(k)46 b(\024)g Ft(c)1950 1500 y Fp(0)2010 1488 y Fq(k)p Ft(T)2101 1500 y Fp(0)2151 1488 y Ft( )s Fq(k)865 b Fv(\(3.3\))451 1661 y Fh(with)31 b Ft(c)668 1673 y Fp(0)728 1661 y Ft(<)22 b Fv(1)p Ft(:)53 b Fh(F)-6 b(or)30 b Ft(N)i Fv(=)22 b Ft(Z)59 b Fh(\(and)30 b Ft(m)23 b Fv(=)f(0\))p Ft(;)60 b(\015)1968 1673 y Fp(1)2028 1661 y Fv(=)23 b(0)p Ft(:)p Fv(285)44 b(\()p Ft(Z)29 b Fq(\024)23 b Fv(39\))p Ft(:)451 1820 y Fv(The)30 b(pro)r(of)g(is)g(giv)n(en)f(in)h(App)r(endix)h(B.)f (A)g(consequence)f(of)h(this)g(pro)r(of)g(is)g(the)g(relativ)n(e)451 1932 y(b)r(oundedness)i(of)g(the)h(total)e(p)r(oten)n(tial)h(of)1868 1911 y(~)1846 1932 y Ft(H)1922 1888 y Fp(\(2\))1915 1956 y Fn(N)2043 1932 y Fv(\(with)h(b)r(ound)g Ft(<)d Fv(1\))i(for)f Ft(\015)k(<)30 b(\015)3078 1944 y Fp(1)3115 1932 y Ft(:)j Fv(W)-7 b(e)451 2031 y(note)31 b(that)f(the)h(critical)f(p)r(oten)n (tial)h(strength)f(ma)n(y)g(w)n(ell)g(b)r(e)h(impro)n(v)n(ed)e(b)n(y)i (using)f(more)451 2131 y(re\014ned)e(tec)n(hniques)f(for)g(the)h (estimate)f(of)h Ft(W)1905 2143 y Fp(0)1943 2131 y Ft( )i Fv(in)e(the)g(case)f(of)h(large)e Ft(N)9 b Fv(.)451 2230 y(Collecting)26 b(results,)g(w)n(e)g(ha)n(v)n(e)f(sho)n(wn)h(that)g (the)h(HVZ)g(theorem)f(holds)g(also)f(for)h(the)g Ft(N)9 b Fv(-)451 2330 y(electron)23 b(Jansen-Hess)g(op)r(erator,)g(pro)n (vided)g Ft(\015)28 b Fv(is)c(b)r(elo)n(w)g(a)f(critical)g(p)r(oten)n (tial)h(strength)451 2430 y(\()p Ft(\015)k(<)23 b Fv(0)p Ft(:)p Fv(285)j(if)i Ft(N)j Fv(=)23 b Ft(Z)6 b Fv(\).)451 2653 y Fs(Appendix)32 b(A)123 b(\(Pr)n(oof)31 b(of)g(Lemma)h(7\))451 2835 y Fv(When)c(sho)n(wing)e(the)i(relativ)n(e)e(form)g(b)r (oundedness)i(of)f(the)g(p)r(oten)n(tial)2741 2814 y(~)2717 2835 y Ft(W)2795 2847 y Fp(0)2832 2835 y Ft(;)h Fv(w)n(e)e(can)h(dis-) 451 2934 y(regard)36 b(the)i(pro)5 b(jectors)35 b(\003)1331 2946 y Fp(+)p Fn(;N)1502 2934 y Fv(in)i(\(1.1\))h(and)f(\(3.1\).)66 b(In)37 b(fact,)k(de\014ne)c(the)h(p)r(oten)n(tial)475 3072 y(~)451 3093 y Ft(W)46 b Fv(b)n(y)717 3072 y(~)696 3093 y Ft(H)772 3050 y Fp(\(2\))765 3118 y Fn(N)893 3093 y Fv(=)32 b Ft(T)1039 3105 y Fp(0)1098 3093 y Fv(+)1210 3072 y(~)1185 3093 y Ft(W)1263 3105 y Fp(0)1334 3093 y Fv(=:)46 b(\003)1526 3105 y Fp(+)p Fn(;N)1659 3093 y Fv(\()1722 3014 y Fn(N)1708 3031 y Fm(P)1691 3168 y Fn(k)q Fp(=1)1826 3093 y Ft(D)1897 3050 y Fp(\()p Fn(k)q Fp(\))1895 3115 y(0)2012 3093 y Fv(+)2123 3072 y(~)2099 3093 y Ft(W)12 b Fv(\))i(\003)2293 3105 y Fp(+)p Fn(;N)2426 3093 y Ft(:)66 b Fv(Assume)34 b(w)n(e)f(pro)n(v)n(e)e(for)451 3255 y Ft( )505 3267 y Fp(+)585 3255 y Fv(:=)24 b(\003)755 3267 y Fp(+)p Fn(;N)902 3255 y Ft( )42 b Fq(2)25 b Fv(\003)1136 3267 y Fp(+)p Fn(;N)1269 3255 y Fv(\()p Fq(A)p Fv(\()p Ft(H)1468 3267 y Fp(1)1506 3255 y Fv(\()p Fo(R)1592 3225 y Fp(3)1636 3255 y Fv(\))19 b Fq(\012)g Fo(C)1825 3225 y Fp(4)1868 3255 y Fv(\))1900 3225 y Fn(N)1963 3255 y Fv(\))29 b(an)f Ft(N)9 b Fv(-particle)28 b(function)h(in)g(the)f(p)r (osi-)451 3354 y(tiv)n(e)g(sp)r(ectral)f(subspace)f(and)i Ft(T)34 b Fv(=)23 b Ft(E)1665 3366 y Fn(p)1699 3374 y Ff(1)1754 3354 y Fv(+)18 b Ft(:::)h Fv(+)f Ft(E)2069 3366 y Fn(p)2103 3374 y Fj(N)2161 3354 y Ft(;)1031 3537 y Fq(j)p Fv(\()p Ft( )1140 3549 y Fp(+)1195 3537 y Ft(;)1256 3516 y Fv(~)1232 3537 y Ft(W)12 b( )1376 3549 y Fp(+)1431 3537 y Fv(\))p Fq(j)47 b(\024)e Ft(c)1679 3549 y Fp(1)1739 3537 y Fv(\()p Ft( )1825 3549 y Fp(+)1881 3537 y Ft(;)14 b(T)e( )2033 3549 y Fp(+)2087 3537 y Fv(\))42 b(+)f Ft(C)2326 3549 y Fp(1)2387 3537 y Fv(\()p Ft( )2473 3549 y Fp(+)2528 3537 y Ft(;)14 b( )2619 3549 y Fp(+)2674 3537 y Fv(\))388 b(\(A.1\))451 3711 y(with)28 b(constan)n(ts)f Ft(c)1044 3723 y Fp(1)1104 3711 y Ft(<)c Fv(1)k(and)g Ft(C)1481 3723 y Fp(1)1542 3711 y Fq(\025)c Fv(0)p Ft(:)50 b Fv(Then)28 b(w)n(e)f(get)972 3885 y(\()p Ft( )s(;)1122 3864 y Fv(~)1098 3885 y Ft(W)1176 3897 y Fp(0)1214 3885 y Ft( )s Fv(\))46 b(=)g(\()p Ft( )s(;)14 b Fv(\003)1644 3897 y Fp(+)p Fn(;N)1802 3864 y Fv(~)1777 3885 y Ft(W)e Fv(\003)1925 3897 y Fp(+)p Fn(;N)2072 3885 y Ft( )s Fv(\))47 b(=)f(\()p Ft( )2405 3897 y Fp(+)2460 3885 y Ft(;)2521 3864 y Fv(~)2497 3885 y Ft(W)26 b( )2655 3897 y Fp(+)2710 3885 y Fv(\))p Ft(:)329 b Fv(\(A.2\))451 4118 y(Noting)35 b(that)g(\()p Ft( )1006 4130 y Fp(+)1062 4118 y Ft(;)14 b(T)e( )1214 4130 y Fp(+)1268 4118 y Fv(\))49 b(=)35 b(\()p Ft( )1535 4130 y Fp(+)1590 4118 y Ft(;)1658 4039 y Fn(N)1644 4055 y Fm(P)1627 4193 y Fn(k)q Fp(=1)1762 4118 y Ft(D)1833 4074 y Fp(\()p Fn(k)q Fp(\))1831 4140 y(0)1926 4118 y Ft( )1980 4130 y Fp(+)2035 4118 y Fv(\))71 b(=)f(\()p Ft( )s(;)14 b(T)2448 4130 y Fp(0)2499 4118 y Ft( )s Fv(\))70 b(and)35 b Fq(k)p Fv(\003)2927 4130 y Fp(+)p Fn(;N)3074 4118 y Ft( )s Fq(k)48 b(\024)451 4296 y(k)p Fv(\003)551 4308 y Fp(+)p Fn(;N)684 4296 y Fq(k)14 b(k)p Ft( )s Fq(k)46 b(\024)h(k)p Ft( )s Fq(k)67 b Fv(b)r(ecause)34 b Fq(k)p Fv(\003)1661 4308 y Fp(+)p Fn(;N)1794 4296 y Fq(k)47 b Fv(=)33 b Fq(k)p Fv(\003)2081 4253 y Fp(\(1\))2081 4317 y(+)2169 4296 y Fq(k)14 b(\001)g(\001)g(\001)f(k)p Fv(\003)2435 4253 y Fp(\()p Fn(n)p Fp(\))2435 4317 y(+)2532 4296 y Fq(k)47 b Fv(=)33 b(1)p Ft(;)68 b Fv(Lemma)33 b(7)h(is)451 4396 y(v)n(eri\014ed)27 b(with)h(the)g(help)g(of)g(\(A.1\).)451 4495 y(In)36 b(order)d(to)i(sho)n(w)g(\(A.1\))g(w)n(e)g(start)g(b)n(y)f (estimating)h(from)g(b)r(elo)n(w.)59 b(W)-7 b(e)36 b(use)f Ft(V)3072 4465 y Fp(\()p Fn(k)q(l)p Fp(\))3221 4495 y Fq(\025)451 4595 y Fv(0)p Ft(;)60 b Fq(j)p Fv(\()p Ft( )685 4607 y Fp(+)740 4595 y Ft(;)14 b(V)844 4565 y Fp(\()p Fn(k)q Fp(\))937 4595 y Ft( )991 4607 y Fp(+)1046 4595 y Fv(\))p Fq(j)37 b(\024)1280 4558 y Fn(\015)p 1236 4576 127 4 v 1236 4623 a(\015)1271 4631 y Fj(B)r(R)1386 4595 y Fv(\()p Ft( )1472 4607 y Fp(+)1528 4595 y Ft(;)14 b(E)1626 4607 y Fn(p)1660 4615 y Ff(1)1697 4595 y Ft( )1751 4607 y Fp(+)1806 4595 y Fv(\))28 b(\(for)f Ft(\015)h Fq(\024)23 b Ft(\015)2227 4607 y Fn(B)s(R)2334 4595 y Fv(;)28 b([4)o(,)g(13)o(]\)) g(as)f(w)n(ell)h(as)451 4730 y(\()p Ft( )537 4742 y Fp(+)593 4730 y Ft(;)14 b(B)697 4687 y Fp(\()p Fn(k)q Fp(\))693 4752 y(2)p Fn(m)789 4730 y Ft( )843 4742 y Fp(+)899 4730 y Fv(\))39 b Fq(\025)24 b(\000)p Ft(md)1240 4742 y Fp(0)1277 4730 y Ft(\015)1325 4700 y Fp(2)1376 4730 y Fv(\()p Ft( )1462 4742 y Fp(+)1517 4730 y Ft(;)14 b( )1608 4742 y Fp(+)1663 4730 y Fv(\))54 b(\(for)28 b Ft(\015)i Fq(\024)24 b Fv(4)p Ft(=\031)s Fv(\))29 b(with)g Ft(d)2499 4742 y Fp(0)2561 4730 y Fv(:=)24 b(8)19 b(+)g(12)2902 4661 y Fq(p)p 2970 4661 42 4 v 2970 4730 a Fv(2)28 b([3,)h(13)o(].)451 4829 y(Then)752 5064 y(\()p Ft( )838 5076 y Fp(+)894 5064 y Ft(;)955 5043 y Fv(~)931 5064 y Ft(W)11 b( )1074 5076 y Fp(+)1130 5064 y Fv(\))37 b Fq(\025)f(\000)1440 5007 y Ft(\015)p 1389 5044 151 4 v 1389 5121 a(\015)1432 5133 y Fn(B)s(R)1594 4960 y(N)1563 4985 y Fm(X)1563 5163 y Fn(k)q Fp(=1)1684 5064 y Fv(\()p Ft( )1770 5076 y Fp(+)1825 5064 y Ft(;)14 b(E)1923 5076 y Fn(p)1957 5084 y Ff(1)2008 5064 y Ft( )2062 5076 y Fp(+)2117 5064 y Fv(\))33 b Fq(\000)e Ft(md)2394 5076 y Fp(0)2432 5064 y Ft(\015)2480 5029 y Fp(2)2575 4960 y Fn(N)2545 4985 y Fm(X)2544 5163 y Fn(k)q Fp(=1)2665 5064 y Fv(\()p Ft( )2751 5076 y Fp(+)2807 5064 y Ft(;)14 b( )2898 5076 y Fp(+)2953 5064 y Fv(\))1108 5338 y Fw(Document)l(a)25 b(Ma)l(thema)l(tica)h(10)f(\(2005\))g (497{525)p eop %%Page: 521 25 521 24 bop 1301 518 a Ft(N)9 b Fs(-Electr)n(on)31 b(HVZ)f(Theorem)726 b Fv(521)1083 734 y(=)45 b Fq(\000)1333 678 y Ft(\015)p 1282 715 151 4 v 1282 791 a(\015)1325 803 y Fn(B)s(R)1465 734 y Fv(\()p Ft( )1551 746 y Fp(+)1607 734 y Ft(;)14 b(T)e( )1759 746 y Fp(+)1813 734 y Fv(\))32 b Fq(\000)g Ft(md)2090 746 y Fp(0)2128 734 y Ft(N)9 b(\015)2252 700 y Fp(2)2311 734 y Fv(\()p Ft( )2397 746 y Fp(+)2453 734 y Ft(;)14 b( )2544 746 y Fp(+)2599 734 y Fv(\))p Ft(:)440 b Fv(\(A.3\))451 944 y(F)-7 b(or)45 b(the)g(estimate)g(from)g(ab)r(o)n (v)n(e)f(w)n(e)g(use)h(\()p Ft( )1981 956 y Fp(+)2037 944 y Ft(;)14 b Fv(\()p Ft(V)2173 914 y Fp(\()p Fn(k)q Fp(\))2296 944 y Fv(+)29 b Ft(B)2457 901 y Fp(\()p Fn(k)q Fp(\))2453 966 y(2)p Fn(m)2550 944 y Fv(\))14 b Ft( )2650 956 y Fp(+)2706 944 y Fv(\))66 b Fq(\024)52 b Ft(m)p Fv(\()p Ft(d)3069 956 y Fp(0)3106 944 y Ft(\015)3154 914 y Fp(2)3221 944 y Fv(+)461 1011 y Fp(3)p 461 1025 34 4 v 461 1072 a(2)504 1044 y Ft(\015)5 b Fv(\))14 b(\()p Ft( )684 1056 y Fp(+)739 1044 y Ft(;)g( )830 1056 y Fp(+)885 1044 y Fv(\))71 b(for)35 b Ft(\015)40 b Fq(\024)35 b Fv(4)p Ft(=\031)i Fv([3],)g([11)o(,)g(Lemma)e(I)r(I.8])g(as)f(w)n(ell)h (as)f(\()p Ft( )2757 1056 y Fp(+)2813 1044 y Ft(;)14 b(V)2916 1014 y Fp(\()p Fn(k)q(l)p Fp(\))3031 1044 y Ft( )3085 1056 y Fp(+)3140 1044 y Fv(\))49 b Fq(\024)493 1133 y Fn(e)524 1108 y Ff(2)p 461 1147 127 4 v 461 1194 a Fn(\015)496 1202 y Fj(B)r(R)612 1165 y Fv(\()p Ft( )698 1177 y Fp(+)753 1165 y Ft(;)14 b(E)851 1177 y Fn(p)885 1185 y Ff(1)922 1165 y Ft( )976 1177 y Fp(+)1031 1165 y Fv(\))75 b(\(for)36 b Ft(\015)42 b Fq(\024)37 b Ft(\015)1536 1177 y Fn(B)s(R)1644 1165 y Fv(\))g(whic)n(h)f(is)g(an)g(immediate)h (consequence)e(of)i(the)451 1287 y(estimate)28 b(of)f Ft(V)945 1257 y Fp(\()p Fn(k)q Fp(\))1038 1287 y Ft(:)h Fv(Then)523 1489 y(\()p Ft( )609 1501 y Fp(+)664 1489 y Ft(;)726 1468 y Fv(~)701 1489 y Ft(W)e( )859 1501 y Fp(+)914 1489 y Fv(\))47 b Fq(\024)e Ft(m)p Fv(\()p Ft(d)1251 1501 y Fp(0)1289 1489 y Ft(\015)1337 1455 y Fp(2)1392 1489 y Fv(+)1485 1433 y(3)p 1485 1470 42 4 v 1485 1546 a(2)1537 1489 y Ft(\015)5 b Fv(\))14 b Ft(N)22 b Fv(\()p Ft( )1806 1501 y Fp(+)1862 1489 y Ft(;)14 b( )1953 1501 y Fp(+)2008 1489 y Fv(\))41 b(+)2198 1433 y Ft(N)27 b Fq(\000)18 b Fv(1)p 2198 1470 219 4 v 2286 1546 a(2)2497 1433 y Ft(e)2536 1403 y Fp(2)p 2459 1470 151 4 v 2459 1546 a Ft(\015)2502 1558 y Fn(B)s(R)2643 1489 y Fv(\()p Ft( )2729 1501 y Fp(+)2784 1489 y Ft(;)c(T)e( )2936 1501 y Fp(+)2990 1489 y Fv(\))72 b(\(A.4\))451 1726 y(suc)n(h)33 b(that)h(\(A.1\))g(holds)f(with)g Ft(c)1508 1738 y Fp(1)1578 1726 y Fv(:=)f(max)p Fq(f)1948 1689 y Fn(\015)p 1904 1707 127 4 v 1904 1754 a(\015)1939 1762 y Fj(B)r(R)2041 1726 y Ft(;)2088 1693 y Fn(N)6 b Fi(\000)p Fp(1)p 2088 1707 144 4 v 2143 1754 a(2)2297 1693 y Fn(e)2328 1668 y Ff(2)p 2266 1707 127 4 v 2266 1754 a Fn(\015)2301 1762 y Fj(B)r(R)2402 1726 y Fq(g)p Ft(:)66 b Fv(F)-7 b(or)33 b Ft(N)41 b Fq(\024)32 b Ft(Z)q(;)i Fv(one)e(has)451 1836 y Ft(c)487 1848 y Fp(1)547 1836 y Fv(=)689 1799 y Fn(\015)p 645 1817 V 645 1865 a(\015)680 1873 y Fj(B)r(R)809 1836 y Fv(whic)n(h)c(is)g(smaller)e(than)i(one)f(if)h Ft(\015)g(<)22 b(\015)2040 1848 y Fn(B)s(R)2148 1836 y Ft(:)451 2069 y Fs(Appendix)32 b(B)123 b(\(Pr)n(oof)31 b(of)h(Lemma)f(8\))451 2267 y Fv(F)-7 b(or)26 b(the)g(pro)r(of)f(of)h (the)h(relativ)n(e)e(b)r(oundedness)h(of)g(the)g(total)g(p)r(oten)n (tial)g Ft(W)2828 2279 y Fp(0)2865 2267 y Fv(,)h(let)f Ft(H)3109 2224 y Fp(\(2\))3102 2292 y Fn(N)3221 2267 y Fv(=)451 2427 y Ft(T)500 2439 y Fp(0)558 2427 y Fv(+)21 b Ft(W)722 2439 y Fp(0)804 2427 y Fv(=:)30 b(\003)980 2439 y Fp(+)p Fn(;N)1114 2427 y Fv(\()1177 2348 y Fn(N)1162 2365 y Fm(P)1146 2502 y Fn(k)q Fp(=1)1281 2427 y Ft(D)1352 2384 y Fp(\()p Fn(k)q Fp(\))1350 2449 y(0)1480 2427 y Fv(+)20 b Ft(W)12 b Fv(\)\003)1745 2439 y Fp(+)p Fn(;N)1942 2427 y Fv(where)31 b Ft(W)44 b Fv(denotes)32 b(the)g(total)g(p)r(oten)n (tial)451 2581 y(from)27 b(\(3.1\).)37 b(Assume)28 b(that)1096 2832 y Fq(k)p Ft(W)12 b( )1282 2844 y Fp(+)1337 2832 y Fq(k)45 b(\024)h Ft(c)1571 2844 y Fp(0)1631 2832 y Fq(k)1718 2728 y Fn(N)1687 2753 y Fm(X)1687 2932 y Fn(k)q Fp(=1)1821 2832 y Ft(D)1892 2789 y Fp(\()p Fn(k)q Fp(\))1890 2854 y(0)1985 2832 y Ft( )2039 2844 y Fp(+)2094 2832 y Fq(k)g Fv(=)f Ft(c)2328 2844 y Fp(0)2389 2832 y Fq(k)p Ft(T)12 b( )2546 2844 y Fp(+)2599 2832 y Fq(k)457 b Fv(\(B.1\))451 3076 y(with)28 b Ft( )694 3088 y Fp(+)773 3076 y Fv(=)22 b(\003)918 3088 y Fp(+)p Fn(;N)1065 3076 y Ft( )s(:)51 b Fv(Then)637 3330 y Fq(k)p Ft(W)757 3342 y Fp(0)794 3330 y Ft( )s Fq(k)36 b Fv(=)h Fq(k)p Fv(\003)1131 3342 y Fp(+)p Fn(;N)1264 3330 y Ft(W)12 b Fv(\003)1412 3342 y Fp(+)p Fn(;N)1545 3330 y Ft( )s Fq(k)36 b(\024)h(k)p Fv(\003)1882 3342 y Fp(+)p Fn(;N)2015 3330 y Fq(k)22 b(k)p Ft(W)12 b( )2265 3342 y Fp(+)2320 3330 y Fq(k)36 b(\024)h Ft(c)2536 3342 y Fp(0)2596 3330 y Fq(k)2682 3226 y Fn(N)2652 3251 y Fm(X)2652 3430 y Fn(k)q Fp(=1)2786 3330 y Ft(D)2857 3287 y Fp(\()p Fn(k)q Fp(\))2855 3352 y(0)2950 3330 y Ft( )3004 3342 y Fp(+)3059 3330 y Fq(k)1108 3669 y Fv(=)46 b Ft(c)1255 3681 y Fp(0)1315 3669 y Fq(k)p Fv(\003)1415 3681 y Fp(+)p Fn(;N)1593 3565 y(N)1562 3590 y Fm(X)1562 3769 y Fn(k)q Fp(=1)1696 3669 y Ft(D)1767 3626 y Fp(\()p Fn(k)q Fp(\))1765 3691 y(0)1860 3669 y Fv(\003)1918 3681 y Fp(+)p Fn(;N)2051 3669 y Ft( )s Fq(k)g Fv(=)g Ft(c)2343 3681 y Fp(0)2403 3669 y Fq(k)p Ft(T)2494 3681 y Fp(0)2530 3669 y Ft( )s Fq(k)469 b Fv(\(B.2\))451 3914 y(since)28 b(\003)713 3926 y Fp(+)p Fn(;N)869 3914 y Fv(=)23 b(\003)1015 3884 y Fp(2)1015 3937 y(+)p Fn(;N)1176 3914 y Fv(comm)n(utes)k(with)h Ft(D)1826 3871 y Fp(\()p Fn(k)q Fp(\))1824 3936 y(0)1919 3914 y Ft(:)451 4043 y Fv(In)g(order)e(to)i(v)n(erify)f(\(B.1\))g(w)n(e)g(set)h Ft(W)1662 4013 y Fp(\()p Fn(k)q Fp(\))1778 4043 y Fv(:=)22 b Ft(V)1955 4013 y Fp(\()p Fn(k)q Fp(\))2066 4043 y Fv(+)d Ft(B)2217 4000 y Fp(\()p Fn(k)q Fp(\))2213 4065 y(2)p Fn(m)2337 4043 y Fv(and)27 b(estimate)458 4296 y Fq(k)p Ft(W)12 b( )644 4308 y Fp(+)698 4296 y Fq(k)23 b(\024)f(k)937 4192 y Fn(N)906 4217 y Fm(X)906 4396 y Fn(k)q Fp(=1)1026 4296 y Ft(W)1116 4261 y Fp(\()p Fn(k)q Fp(\))1209 4296 y Ft( )1263 4308 y Fp(+)1318 4296 y Fq(k)c Fv(+)g Fq(k)1543 4192 y Fn(N)1512 4217 y Fm(X)1475 4396 y Fn(k)q(>l)p Fp(=1)1641 4296 y Ft(V)1708 4261 y Fp(\()p Fn(k)q(l)p Fp(\))1822 4296 y Ft( )1876 4308 y Fp(+)1932 4296 y Fq(k)g Fv(+)g(2)p Fq(k)2198 4192 y Fn(N)2168 4217 y Fm(X)2131 4396 y Fn(k)q(>l)p Fp(=1)2296 4296 y Ft(C)2361 4261 y Fp(\()p Fn(k)q(l)p Fp(\))2355 4316 y Fn(a)2476 4296 y Ft( )2530 4308 y Fp(+)2585 4296 y Fq(k)g Fv(+)g(2)p Fq(k)2851 4192 y Fn(N)2821 4217 y Fm(X)2784 4396 y Fn(k)q(>l)p Fp(=1)2949 4296 y Ft(C)3014 4253 y Fp(\()p Fn(k)q(l)p Fp(\))3008 4321 y Fn(b)3129 4296 y Ft( )3183 4308 y Fp(+)3238 4296 y Fq(k)3098 4479 y Fv(\(B.3\))451 4595 y(where)32 b(according)e(to)i(\(2.2\),)h Ft(C)1472 4551 y Fp(\()p Fn(k)q(l)p Fp(\))1466 4604 y Fn(a)1617 4595 y Fv(:=)d Ft(V)1802 4564 y Fp(\()p Fn(k)q(l)p Fp(\))1916 4595 y Fv(\003)1974 4551 y Fp(\()p Fn(l)p Fp(\))1974 4615 y Fi(\000)2051 4595 y Ft(F)2116 4551 y Fp(\()p Fn(l)p Fp(\))2104 4617 y(0)2225 4595 y Fv(and)i Ft(C)2456 4551 y Fp(\()p Fn(k)q(l)p Fp(\))2450 4620 y Fn(b)2601 4595 y Fv(:=)e Ft(F)2784 4551 y Fp(\()p Fn(l)p Fp(\))2772 4617 y(0)2861 4595 y Fv(\003)2919 4551 y Fp(\()p Fn(l)p Fp(\))2919 4615 y Fi(\000)2996 4595 y Ft(V)3063 4564 y Fp(\()p Fn(k)q(l)p Fp(\))3221 4595 y Fv(=)451 4717 y Ft(C)516 4674 y Fp(\()p Fn(k)q(l)p Fp(\))p Fi(\003)510 4727 y Fn(a)665 4717 y Ft(;)45 b Fv(and)21 b(the)i(an)n(tisymmetry)e(of)g Ft( )1691 4729 y Fp(+)1769 4717 y Fv(with)h(resp)r(ect)g(to)f(particle)h(exc)n (hange)e(w)n(as)h(used)451 4817 y(to)28 b(reduce)f(the)h(four)f(con)n (tributions)g(to)g Ft(C)1804 4787 y Fp(\()p Fn(k)q(l)p Fp(\))1946 4817 y Fv(to)h(t)n(w)n(o.)451 4952 y(F)-7 b(rom)24 b([11)o(])g(it)g(follo)n(ws)f(that)i Fq(k)1430 4873 y Fn(N)1415 4890 y Fm(P)1400 5027 y Fn(k)q Fp(=1)1533 4952 y Ft(W)1623 4922 y Fp(\()p Fn(k)q Fp(\))1716 4952 y Ft( )1770 4964 y Fp(+)1825 4952 y Fq(k)37 b(\024)1991 4898 y(p)p 2061 4898 90 4 v 2061 4952 a Ft(c)2097 4964 y Fn(w)2173 4952 y Fq(k)p Ft(T)12 b( )2330 4964 y Fp(+)2384 4952 y Fq(k)24 b Fv(with)g Ft(c)2671 4964 y Fn(w)2748 4952 y Fv(:=)f(\()2901 4919 y Fp(4)p 2901 4933 34 4 v 2901 4981 a(3)2944 4952 y Ft(\015)16 b Fv(+)3088 4919 y Fp(2)p 3088 4933 V 3088 4981 a(9)3131 4952 y Ft(\015)3179 4922 y Fp(2)3216 4952 y Fv(\))3248 4922 y Fp(2)451 5130 y Fv(and)34 b Fq(k)p Ft(V)728 5100 y Fp(\()p Fn(k)q(l)p Fp(\))842 5130 y Ft( )896 5142 y Fp(+)951 5130 y Fq(k)47 b(\024)1139 5077 y(p)p 1208 5077 76 4 v 53 x Ft(c)1244 5142 y Fn(v)1318 5130 y Fq(k)p Ft(E)1421 5142 y Fn(p)1455 5151 y Fj(k)1495 5130 y Ft( )1549 5142 y Fp(+)1604 5130 y Fq(k)34 b Fv(with)h Ft(c)1912 5142 y Fn(v)1985 5130 y Fv(:=)f(4)p Ft(e)2188 5100 y Fp(4)2225 5130 y Fv(.)57 b(Lik)n(ewise,)35 b(using)e Fq(k)p Fv(\003)2993 5087 y Fp(\()p Fn(l)p Fp(\))2993 5151 y Fi(\000)3070 5130 y Fq(k)h Fv(=)f(1)1108 5338 y Fw(Document)l(a)25 b(Ma)l(thema)l(tica)h (10)f(\(2005\))g(497{525)p eop %%Page: 522 26 522 25 bop 451 518 a Fv(522)727 b Fs(D.)30 b(H.)h(Jakubassa-Amundsen) 451 729 y Fv(and)f Fq(k)p Ft(F)722 686 y Fp(\()p Fn(l)p Fp(\))710 751 y(0)799 729 y Fq(k)d(\024)972 692 y Fn(\015)p 971 710 41 4 v 971 757 a(\031)1022 729 y Fv(\()1064 696 y Fn(\031)1105 671 y Ff(2)p 1064 710 74 4 v 1084 757 a Fp(4)1167 729 y Fq(\000)20 b Fv(1\))31 b([11)o(],)g(one)f(has)g Fq(k)p Ft(C)1953 686 y Fp(\()p Fn(k)q(l)p Fp(\))1947 738 y Fn(a)2067 729 y Ft( )2121 741 y Fp(+)2176 729 y Fq(k)41 b(\024)2351 675 y(p)p 2420 675 76 4 v 54 x Ft(c)2456 741 y Fn(v)2510 729 y Fq(k)p Ft(E)2613 741 y Fn(p)2647 750 y Fj(k)2687 729 y Fv(\(\003)2777 686 y Fp(\()p Fn(l)p Fp(\))2777 749 y Fi(\000)2854 729 y Ft(F)2919 686 y Fp(\()p Fn(l)p Fp(\))2907 751 y(0)2997 729 y Ft( )3051 741 y Fp(+)3106 729 y Fv(\))p Fq(k)g(\024)451 799 y(p)p 520 799 V 53 x Ft(c)556 864 y Fn(v)610 852 y Fq(k)p Ft(F)717 809 y Fp(\()p Fn(l)p Fp(\))705 875 y(0)793 852 y Fq(k)14 b(k)p Ft(E)952 864 y Fn(p)986 873 y Fj(k)1026 852 y Ft( )1080 864 y Fp(+)1135 852 y Fq(k)52 b(\024)1331 789 y(p)p 1400 789 72 4 v 1402 852 a Fv(~)-44 b Ft(c)1436 864 y Fn(s)1510 852 y Fq(k)p Ft(E)1613 864 y Fn(p)1647 873 y Fj(k)1687 852 y Ft( )1741 864 y Fp(+)1796 852 y Fq(k)37 b Fv(and)f(the)h(same)f (estimate)g(for)g Fq(k)p Ft(C)2998 809 y Fp(\()p Fn(k)q(l)p Fp(\))2992 877 y Fn(b)3112 852 y Ft( )3166 864 y Fp(+)3221 852 y Fq(k)p Ft(;)451 971 y Fv(with)25 b(~)-44 b Ft(c)671 983 y Fn(s)730 971 y Fv(:=)22 b(\()883 934 y Fn(\015)p 883 952 41 4 v 883 1000 a(\031)933 971 y Fv(\()975 939 y Fn(\031)1016 914 y Ff(2)p 976 953 74 4 v 996 1000 a Fp(4)1067 971 y Fq(\000)8 b Fv(1\)\))1246 941 y Fp(2)1283 971 y Ft(c)1319 983 y Fn(v)1404 971 y Fv(\(for)22 b Ft(m)h Fv(=)g(0\).)35 b(F)-7 b(or)22 b(the)h(cross)e(terms)h Ft(V)2648 941 y Fp(\()p Fn(k)q(l)p Fp(\))2762 971 y Ft(V)2829 941 y Fp(\()p Fn(k)q(l)2912 916 y Fg(0)2935 941 y Fp(\))3011 971 y Fv(\()p Ft(l)j Fq(6)p Fv(=)e Ft(l)3208 941 y Fi(0)3230 971 y Fv(\))451 1071 y(w)n(e)i(substitute)h Fk(y)1007 1083 y Fn(l)1056 1071 y Fv(:=)d Fk(x)1217 1083 y Fn(l)1257 1071 y Fq(\000)14 b Fk(x)1386 1083 y Fn(k)1453 1071 y Fv(and)25 b Fk(y)1662 1083 y Fn(l)1683 1067 y Fg(0)1733 1071 y Fv(:=)e Fk(x)1894 1083 y Fn(l)1915 1067 y Fg(0)1956 1071 y Fq(\000)14 b Fk(x)2085 1083 y Fn(k)2152 1071 y Fv(for)25 b Fk(x)2327 1083 y Fn(l)2378 1071 y Fv(and)h Fk(x)2588 1083 y Fn(l)2609 1067 y Fg(0)2636 1071 y Fv(,)g(resp)r(ectiv) n(ely)-7 b(,)25 b(and)451 1171 y(get)472 1421 y(\()p Ft( )558 1433 y Fp(+)614 1421 y Ft(;)14 b(V)718 1387 y Fp(\()p Fn(k)q(l)p Fp(\))832 1421 y Ft(V)899 1387 y Fp(\()p Fn(k)q(l)982 1362 y Fg(0)1005 1387 y Fp(\))1035 1421 y Ft( )1089 1433 y Fp(+)1144 1421 y Fv(\))38 b(=)1315 1308 y Fm(Z)1361 1497 y Fe(R)1408 1480 y Ff(3)p Fj(N)1489 1421 y Fv(\()1563 1317 y Fn(N)1540 1342 y Fm(Y)1530 1516 y Fj(k)1562 1504 y Fg(0)1585 1516 y Ff(=1)1503 1563 y Fj(k)1535 1551 y Fg(0)1558 1563 y(6)p Ff(=)p Fj(l;l)1660 1551 y Fg(0)1678 1421 y Ft(d)p Fk(x)1771 1433 y Fn(k)1807 1417 y Fg(0)1835 1421 y Fv(\))14 b Ft(d)p Fk(y)1974 1433 y Fn(l)2014 1421 y Ft(d)p Fk(y)2107 1433 y Fn(l)2128 1417 y Fg(0)2179 1365 y Ft(e)2218 1335 y Fp(2)p 2179 1402 76 4 v 2184 1478 a Ft(y)2225 1490 y Fn(l)p 2279 1354 58 4 v 2279 1421 a Ft( )2336 1442 y Fp(+)2391 1421 y Fv(\()p Ft(:::;)g Fk(y)2579 1433 y Fn(l)2624 1421 y Fv(+)k Fk(x)2757 1433 y Fn(k)2798 1421 y Ft(;)c Fk(y)2885 1433 y Fn(l)2906 1417 y Fg(0)2952 1421 y Fv(+)k Fk(x)3085 1433 y Fn(k)3126 1421 y Ft(;)c(:::)p Fv(\))1286 1786 y Fq(\001)1339 1730 y Ft(e)1378 1700 y Fp(2)p 1333 1767 89 4 v 1333 1843 a Ft(y)1374 1855 y Fn(l)1395 1839 y Fg(0)1445 1786 y Ft( )1499 1798 y Fp(+)1555 1786 y Fv(\()p Ft(:::;)g Fk(y)1743 1798 y Fn(l)1787 1786 y Fv(+)k Fk(x)1920 1798 y Fn(k)1962 1786 y Ft(;)c Fk(y)2049 1798 y Fn(l)2070 1782 y Fg(0)2115 1786 y Fv(+)k Fk(x)2248 1798 y Fn(k)2289 1786 y Ft(;)c(:::)p Fv(\))p Ft(:)648 b Fv(\(B.4\))451 1970 y(Keeping)33 b(for)g(the)h(momen)n(t)g Fk(x)1439 1982 y Fn(k)1475 1966 y Fg(0)1536 1970 y Fv(\014xed)f(and)h(using)f (the)h(F)-7 b(ourier)33 b(represen)n(tation)e(with)451 2070 y(resp)r(ect)d(to)f Fk(y)887 2082 y Fn(l)941 2070 y Fv(and)g Fk(y)1152 2082 y Fn(l)1173 2065 y Fg(0)1228 2070 y Fv(\(setting)h Ft(')1587 2082 y Fp(+)1642 2070 y Fv(\()p Fk(y)1724 2082 y Fn(l)1750 2070 y Ft(;)14 b Fk(y)1837 2082 y Fn(l)1858 2065 y Fg(0)1886 2070 y Fv(\))23 b(:=)g Ft( )2106 2082 y Fp(+)2161 2070 y Fv(\()p Ft(:::;)14 b Fk(y)2349 2082 y Fn(l)2394 2070 y Fv(+)k Fk(x)2527 2082 y Fn(k)2568 2070 y Ft(;)c Fk(y)2655 2082 y Fn(l)2676 2065 y Fg(0)2722 2070 y Fv(+)k Fk(x)2855 2082 y Fn(k)2896 2070 y Ft(;)c(:::)p Fv(\)\),)894 2313 y(\()938 2242 y Fo(\\)960 2257 y Fv(1)p 936 2294 V 936 2370 a Ft(y)977 2382 y Fn(l)998 2366 y Fg(0)1035 2313 y Ft(')1089 2325 y Fp(+)1144 2313 y Fv(\)\()p Fk(p)1261 2325 y Fn(l)1287 2313 y Ft(;)g Fk(p)1377 2325 y Fn(l)1398 2309 y Fg(0)1425 2313 y Fv(\))47 b(=)1668 2257 y(1)p 1624 2294 130 4 v 1624 2370 a(2)p Ft(\031)1716 2346 y Fp(2)1777 2200 y Fm(Z)1823 2388 y Fe(R)1870 2372 y Ff(3)1916 2313 y Ft(d)p Fk(p)2012 2279 y Fi(0)2229 2257 y Fv(1)p 2068 2294 363 4 v 2068 2370 a Fq(j)p Fk(p)2144 2382 y Fn(l)2165 2366 y Fg(0)2211 2370 y Fq(\000)18 b Fk(p)2347 2346 y Fi(0)2370 2370 y Fq(j)2393 2346 y Fp(2)2468 2313 y Fv(^)-56 b Ft(')2508 2325 y Fp(+)2564 2313 y Fv(\()p Fk(p)2649 2325 y Fn(l)2674 2313 y Ft(;)14 b Fk(p)2764 2279 y Fi(0)2788 2313 y Fv(\))p Ft(;)255 b Fv(\(B.5\))451 2536 y(the)42 b(Lieb)f(and)g(Y)-7 b(au)41 b(form)n(ula)f(\(2.16\))g(with)i(the)f(con)n(v)n(ergence)e (generating)g(function)451 2635 y Ft(f)9 b Fv(\()p Ft(p)p Fv(\))23 b(=)g Ft(p)760 2605 y Fp(3)p Fn(=)p Fp(2)892 2635 y Fv(giv)n(es)600 2742 y Fm(\014)600 2792 y(\014)600 2842 y(\014)600 2891 y(\014)628 2749 y(Z)674 2938 y Fe(R)721 2921 y Ff(6)766 2862 y Ft(d)p Fk(y)859 2874 y Fn(l)899 2862 y Ft(d)p Fk(y)992 2874 y Fn(l)1013 2858 y Fg(0)1074 2806 y Ft(e)1113 2776 y Fp(2)p 1074 2843 76 4 v 1079 2919 a Ft(y)1120 2931 y Fn(l)p 1174 2817 55 4 v 1174 2862 a Ft(')1228 2883 y Fp(+)1322 2806 y Ft(e)1361 2776 y Fp(2)p 1316 2843 89 4 v 1316 2919 a Ft(y)1357 2931 y Fn(l)1378 2915 y Fg(0)1429 2862 y Ft(')1483 2874 y Fp(+)1538 2742 y Fm(\014)1538 2792 y(\014)1538 2842 y(\014)1538 2891 y(\014)1612 2862 y Fq(\024)45 b Fv(4)p Ft(e)1803 2828 y Fp(4)1854 2749 y Fm(Z)1900 2938 y Fe(R)1947 2921 y Ff(6)1992 2862 y Ft(d)p Fk(p)2088 2874 y Fn(l)2128 2862 y Ft(d)p Fk(p)2224 2874 y Fn(l)2245 2858 y Fg(0)2295 2862 y Fq(j)13 b Fv(^)-55 b Ft(')2372 2874 y Fp(+)2427 2862 y Fv(\()p Fk(p)2512 2874 y Fn(l)2538 2862 y Ft(;)14 b Fk(p)2628 2874 y Fn(l)2649 2858 y Fg(0)2676 2862 y Fv(\))p Fq(j)2731 2828 y Fp(2)2792 2862 y Ft(p)2834 2874 y Fn(l)2859 2862 y Ft(p)2901 2874 y Fn(l)2922 2858 y Fg(0)3098 2862 y Fv(\(B.6\))451 3082 y(suc)n(h)27 b(that,)h(using)g Ft(p)22 b Fq(\024)h Ft(E)1272 3094 y Fn(p)1311 3082 y Ft(;)451 3192 y Fq(j)p Fv(\()p Ft( )560 3204 y Fp(+)616 3192 y Ft(;)14 b(V)720 3162 y Fp(\()p Fn(k)q(l)p Fp(\))834 3192 y Ft(V)900 3162 y Fp(\()p Fn(k)q(l)983 3137 y Fg(0)1007 3162 y Fp(\))1037 3192 y Ft( )1091 3204 y Fp(+)1146 3192 y Fv(\))p Fq(j)43 b(\024)29 b Ft(c)1374 3204 y Fn(v)1427 3192 y Fv(\()p Ft( )1513 3204 y Fp(+)1569 3192 y Ft(;)14 b(p)1648 3204 y Fn(l)1673 3192 y Ft(p)1715 3204 y Fn(l)1736 3188 y Fg(0)1762 3192 y Ft( )1816 3204 y Fp(+)1872 3192 y Fv(\))43 b Fq(\024)28 b Ft(c)2076 3204 y Fn(v)2130 3192 y Fv(\()p Ft( )2216 3204 y Fp(+)2271 3192 y Ft(;)14 b(E)2369 3204 y Fn(p)2403 3213 y Fj(l)2432 3192 y Ft(E)2493 3204 y Fn(p)2527 3220 y Fj(l)2547 3208 y Fg(0)2578 3192 y Ft( )2632 3204 y Fp(+)2687 3192 y Fv(\))p Ft(:)61 b Fv(The)31 b(same)g(es-)451 3306 y(timate)h(holds)f(for)f Ft(V)1136 3276 y Fp(\()p Fn(k)q(l)p Fp(\))1250 3306 y Ft(V)1317 3276 y Fp(\()p Fn(k)1379 3251 y Fg(0)1402 3276 y Fn(l)1423 3251 y Fg(0)1446 3276 y Fp(\))1507 3306 y Fv(with)i(distinct)g(indices.)48 b(The)31 b(symmetry)g(of)g Ft( )3038 3318 y Fp(+)3124 3306 y Fv(with)451 3461 y(resp)r(ect)36 b(to)g(particle)f(exc)n(hange)f(and)1763 3382 y Fn(N)1748 3399 y Fm(P)1695 3536 y Fn(k)q(>l)p Fp(=1)1903 3461 y Fv(1)50 b(=)2107 3421 y Fn(N)6 b Fp(\()p Fn(N)g Fi(\000)p Fp(1\))p 2107 3442 255 4 v 2218 3489 a(2)2407 3461 y Fv(then)37 b(leads)e(to)h(the)g(result)451 3684 y Fq(k)574 3605 y Fn(N)560 3621 y Fm(P)507 3759 y Fn(k)q(>l)p Fp(=1)714 3684 y Ft(V)781 3654 y Fp(\()p Fn(k)q(l)p Fp(\))895 3684 y Ft( )949 3696 y Fp(+)1004 3684 y Fq(k)1046 3654 y Fp(2)1120 3684 y Fq(\024)23 b Ft(c)1244 3696 y Fn(v)1302 3684 y Fq(\001)18 b Fv(max)p Fq(f)1550 3651 y Fn(N)6 b Fi(\000)p Fp(1)p 1549 3665 144 4 v 1604 3712 a(2)1703 3684 y Ft(;)1750 3651 y Fp(1)p 1750 3665 34 4 v 1750 3712 a(2)1793 3684 y Fv([)1826 3643 y Fn(N)g Fp(\()p Fn(N)g Fi(\000)p Fp(1\))p 1826 3665 255 4 v 1937 3712 a(2)2109 3684 y Fq(\000)18 b Fv(1])p Fq(g)c(k)p Ft(T)e( )2470 3696 y Fp(+)2522 3684 y Fq(k)2564 3654 y Fp(2)2601 3684 y Ft(:)451 3842 y Fv(The)30 b(remaining)e(con)n(tribution)h(to)g(\(B.3\))g(can)g(partly)g(b)r(e)h (reduced)f(to)g(the)h(estimate)f(of)451 3958 y Ft(V)518 3928 y Fp(\()p Fn(k)q(l)p Fp(\))632 3958 y Ft(:)21 b Fv(Let)g Ft(k)s(;)14 b(l)r(;)g(k)1011 3928 y Fi(0)1034 3958 y Ft(;)g(l)1098 3928 y Fi(0)1141 3958 y Fv(b)r(e)22 b(distinct)f(indices)g(and)g(set)g Ft(')2139 3970 y Fn(l)2188 3958 y Fv(:=)i(\003)2357 3915 y Fp(\()p Fn(l)p Fp(\))2357 3978 y Fi(\000)2434 3958 y Ft(F)2499 3915 y Fp(\()p Fn(l)p Fp(\))2487 3980 y(0)2576 3958 y Ft( )2630 3970 y Fp(+)2685 3958 y Ft(:)e Fv(Then)h(w)n(e)e(obtain)451 4120 y(for)27 b(the)h(cross)e(terms)i(of)f(\()1351 4042 y Fn(N)1337 4058 y Fm(P)1283 4195 y Fn(k)q(>l)p Fp(=1)1491 4120 y Ft(C)1556 4077 y Fp(\()p Fn(k)q(l)p Fp(\))1550 4130 y Fn(a)1671 4120 y Fv(\))1703 4090 y Fp(2)1740 4120 y Ft(;)719 4382 y Fq(j)p Fv(\()p Ft(C)839 4348 y Fp(\()p Fn(k)q(l)p Fp(\))833 4403 y Fn(a)954 4382 y Ft( )1008 4394 y Fp(+)1063 4382 y Ft(;)14 b(C)1165 4348 y Fp(\()p Fn(k)1227 4323 y Fg(0)1250 4348 y Fn(l)1271 4323 y Fg(0)1294 4348 y Fp(\))1159 4403 y Fn(a)1324 4382 y Ft( )1378 4394 y Fp(+)1433 4382 y Fv(\))p Fq(j)47 b Fv(=)f Fq(j)p Fv(\(\003)1759 4339 y Fp(\()p Fn(l)p Fp(\))1759 4403 y Fi(\000)1836 4382 y Ft(F)1901 4339 y Fp(\()p Fn(l)p Fp(\))1889 4404 y(0)1978 4382 y Ft( )2032 4394 y Fp(+)2087 4382 y Ft(;)14 b(V)2191 4348 y Fp(\()p Fn(k)q(l)p Fp(\))2305 4382 y Ft(V)2372 4348 y Fp(\()p Fn(k)2434 4323 y Fg(0)2457 4348 y Fn(l)2478 4323 y Fg(0)2501 4348 y Fp(\))2531 4382 y Fv(\003)2589 4339 y Fp(\()p Fn(l)2636 4314 y Fg(0)2658 4339 y Fp(\))2589 4403 y Fi(\000)2689 4382 y Ft(F)2754 4339 y Fp(\()p Fn(l)2801 4314 y Fg(0)2823 4339 y Fp(\))2742 4404 y(0)2853 4382 y Ft( )2907 4394 y Fp(+)2963 4382 y Fv(\))p Fq(j)693 4576 y Fv(=)46 b Fq(j)p Fv(\()p Ft(')913 4588 y Fn(l)939 4576 y Ft(;)14 b(V)1042 4541 y Fp(\()p Fn(k)q(l)p Fp(\))1157 4576 y Ft(V)1223 4541 y Fp(\()p Fn(k)1285 4516 y Fg(0)1309 4541 y Fn(l)1330 4516 y Fg(0)1352 4541 y Fp(\))1382 4576 y Ft(')1436 4588 y Fn(l)1457 4572 y Fg(0)1485 4576 y Fv(\))p Fq(j)46 b(\024)g Ft(c)1733 4588 y Fn(v)1786 4576 y Fv(\()p Ft(')1872 4588 y Fn(l)1898 4576 y Ft(;)14 b(p)1977 4588 y Fn(k)2018 4576 y Ft(p)2060 4588 y Fn(k)2096 4572 y Fg(0)2123 4576 y Ft(')2177 4588 y Fn(l)2203 4576 y Fv(\))2245 4519 y Ff(1)p 2245 4528 29 3 v 2245 4561 a(2)2287 4576 y Fv(\()p Ft(')2373 4588 y Fn(l)2394 4572 y Fg(0)2422 4576 y Ft(;)g(p)2501 4588 y Fn(k)2541 4576 y Ft(p)2583 4588 y Fn(k)2619 4572 y Fg(0)2646 4576 y Ft(')2700 4588 y Fn(l)2721 4572 y Fg(0)2749 4576 y Fv(\))2791 4519 y Ff(1)p 2791 4528 V 2791 4561 a(2)2833 4576 y Ft(:)242 b Fv(\(B.7\))451 4736 y(Since)28 b Ft(l)c Fq(6)p Fv(=)f Ft(k)851 4706 y Fi(0)874 4736 y Ft(;)60 b(p)999 4748 y Fn(k)1035 4732 y Fg(0)1090 4736 y Fv(comm)n(utes)27 b(with)h(\003)1727 4693 y Fp(\()p Fn(l)p Fp(\))1727 4757 y Fi(\000)1804 4736 y Ft(F)1869 4693 y Fp(\()p Fn(l)p Fp(\))1857 4758 y(0)1974 4736 y Fv(suc)n(h)g(that)827 4933 y(\()p Ft(')913 4945 y Fn(l)939 4933 y Ft(;)14 b(p)1018 4945 y Fn(k)1058 4933 y Ft(p)1100 4945 y Fn(k)1136 4929 y Fg(0)1164 4933 y Ft(')1218 4945 y Fn(l)1243 4933 y Fv(\))38 b(=)e Fq(k)p Fv(\()p Ft(p)1530 4945 y Fn(k)1570 4933 y Ft(p)1612 4945 y Fn(k)1648 4929 y Fg(0)1675 4933 y Fv(\))1717 4877 y Ff(1)p 1718 4886 V 1718 4919 a(2)1760 4933 y Ft(')1814 4945 y Fn(l)1840 4933 y Fq(k)1882 4899 y Fp(2)1965 4933 y Fv(=)45 b Fq(k)p Fv(\003)2175 4890 y Fp(\()p Fn(l)p Fp(\))2175 4954 y Fi(\000)2252 4933 y Ft(F)2317 4890 y Fp(\()p Fn(l)p Fp(\))2305 4955 y(0)2394 4933 y Fv(\()p Ft(p)2468 4945 y Fn(k)2509 4933 y Ft(p)2551 4945 y Fn(k)2587 4929 y Fg(0)2614 4933 y Fv(\))2656 4877 y Ff(1)p 2657 4886 V 2657 4919 a(2)2699 4933 y Ft(')2753 4945 y Fp(+)2808 4933 y Fq(k)2850 4899 y Fp(2)1405 5130 y Fq(\024)h(k)p Ft(F)1623 5087 y Fp(\()p Fn(l)p Fp(\))1611 5152 y(0)1700 5130 y Fq(k)1742 5096 y Fp(2)1801 5130 y Fv(\()p Ft( )1887 5142 y Fp(+)1943 5130 y Ft(;)14 b(p)2022 5142 y Fn(k)2062 5130 y Ft(p)2104 5142 y Fn(k)2140 5126 y Fg(0)2167 5130 y Ft( )2221 5142 y Fp(+)2277 5130 y Fv(\))p Ft(:)766 b Fv(\(B.8\))1108 5338 y Fw(Document)l(a)25 b(Ma)l(thema)l(tica)h(10)f(\(2005\))g (497{525)p eop %%Page: 523 27 523 26 bop 1301 518 a Ft(N)9 b Fs(-Electr)n(on)31 b(HVZ)f(Theorem)726 b Fv(523)451 769 y(The)28 b(cross)e(terms)h(of)h(\()1252 690 y Fn(N)1237 707 y Fm(P)1184 844 y Fn(k)q(>l)p Fp(=1)1392 769 y Ft(C)1457 726 y Fp(\()p Fn(k)q(l)p Fp(\))1451 794 y Fn(b)1571 769 y Fv(\))1603 739 y Fp(2)1668 769 y Fv(ha)n(v)n(e)f(the) h(same)f(estimate.)37 b(In)27 b(fact,)712 1050 y Fq(j)p Fv(\()p Ft(C)832 1007 y Fp(\()p Fn(k)q(l)p Fp(\))826 1075 y Fn(b)947 1050 y Ft( )1001 1062 y Fp(+)1056 1050 y Ft(;)14 b(C)1158 1007 y Fp(\()p Fn(k)1220 982 y Fg(0)1243 1007 y Fn(l)1264 982 y Fg(0)1287 1007 y Fp(\))1152 1075 y Fn(b)1317 1050 y Ft( )1371 1062 y Fp(+)1426 1050 y Fv(\))p Fq(j)47 b Fv(=)f Fq(j)p Fv(\()p Ft( )1748 1062 y Fp(+)1803 1050 y Ft(;)14 b(V)1907 1016 y Fp(\()p Fn(k)q(l)p Fp(\))2021 1050 y Fv(\003)2079 1007 y Fp(\()p Fn(l)p Fp(\))2079 1071 y Fi(\000)2156 1050 y Ft(F)2221 1007 y Fp(\()p Fn(l)p Fp(\))2209 1072 y(0)2312 1050 y Ft(F)2377 1007 y Fp(\()p Fn(l)2424 982 y Fg(0)2447 1007 y Fp(\))2365 1072 y(0)2477 1050 y Fv(\003)2535 1007 y Fp(\()p Fn(l)2582 982 y Fg(0)2604 1007 y Fp(\))2535 1071 y Fi(\000)2634 1050 y Ft(V)2701 1016 y Fp(\()p Fn(k)2763 991 y Fg(0)2786 1016 y Fn(l)2807 991 y Fg(0)2830 1016 y Fp(\))2860 1050 y Ft( )2914 1062 y Fp(+)2969 1050 y Fv(\))p Fq(j)923 1283 y Fv(=)46 b Fq(j)p Fv(\()p Ft(')1143 1295 y Fn(l)1164 1279 y Fg(0)1191 1283 y Ft(;)14 b(V)1295 1248 y Fp(\()p Fn(k)q(l)p Fp(\))1409 1283 y Ft(V)1476 1248 y Fp(\()p Fn(k)1538 1223 y Fg(0)1561 1248 y Fn(l)1582 1223 y Fg(0)1605 1248 y Fp(\))1635 1283 y Ft(')1689 1295 y Fn(l)1715 1283 y Fv(\))p Fq(j)37 b(\024)g Ft(c)1945 1295 y Fn(v)1998 1283 y Fq(k)p Ft(F)2105 1240 y Fp(\()p Fn(l)p Fp(\))2093 1305 y(0)2182 1283 y Fq(k)2224 1248 y Fp(2)2283 1283 y Fv(\()p Ft( )2369 1295 y Fp(+)2425 1283 y Ft(;)14 b(p)2504 1295 y Fn(k)2544 1283 y Ft(p)2586 1295 y Fn(k)2622 1279 y Fg(0)2649 1283 y Ft( )2703 1295 y Fp(+)2759 1283 y Fv(\))p Ft(:)284 b Fv(\(B.9\))451 1449 y(If)28 b(an)n(y)f(t)n(w)n(o)g (indices)g(coincide,)h(w)n(e)f(use)g(for)g(simplicit)n(y)h(a)f(w)n(eak) n(er)f(estimate,)i(e.g.)499 1677 y Fq(j)p Fv(\()p Ft(C)619 1633 y Fp(\()p Fn(k)q(l)p Fp(\))613 1702 y Fn(b)734 1677 y Ft( )788 1689 y Fp(+)843 1677 y Ft(;)14 b(C)945 1633 y Fp(\()p Fn(k)1007 1608 y Fg(0)1031 1633 y Fn(l)p Fp(\))939 1702 y Fn(b)1082 1677 y Ft( )1136 1689 y Fp(+)1191 1677 y Fv(\))p Fq(j)24 b(\024)e(k)p Ft(C)1464 1633 y Fp(\()p Fn(k)q(l)p Fp(\))1458 1702 y Fn(b)1578 1677 y Ft( )1632 1689 y Fp(+)1687 1677 y Fq(kk)p Ft(C)1836 1633 y Fp(\()p Fn(k)1898 1608 y Fg(0)1921 1633 y Fn(l)p Fp(\))1830 1702 y Fn(b)1972 1677 y Ft( )2026 1689 y Fp(+)2081 1677 y Fq(k)h(\024)h Fv(~)-44 b Ft(c)2269 1689 y Fn(s)2305 1677 y Fq(k)p Ft(E)2408 1689 y Fn(p)2442 1698 y Fj(k)2482 1677 y Ft( )2536 1689 y Fp(+)2592 1677 y Fq(k)2634 1642 y Fp(2)2693 1677 y Fq(\024)25 b Fv(~)-44 b Ft(c)2817 1689 y Fn(s)2880 1620 y Fv(1)p 2862 1657 76 4 v 2862 1733 a Ft(N)2948 1677 y Fq(k)p Ft(T)12 b( )3105 1689 y Fp(+)3159 1677 y Fq(k)3201 1642 y Fp(2)3056 1804 y Fv(\(B.10\))451 1920 y(and)28 b(similarly)e(for)h Ft(C)1144 1877 y Fp(\()p Fn(k)q(l)p Fp(\))1138 1929 y Fn(a)1259 1920 y Fv(.)451 2077 y(Coun)n(ting)35 b(terms)g(in)h(the)g(sum)1567 1998 y Fn(N)1553 2014 y Fm(P)1499 2152 y Fn(k)q(>l)p Fp(=1)1707 2077 y Ft(C)1772 2033 y Fp(\()p Fn(k)q(l)p Fp(\))1766 2086 y Fn(a)1990 1998 y(N)1976 2014 y Fm(P)1900 2152 y Fn(k)1936 2135 y Fg(0)1960 2152 y Fn(>l)2033 2135 y Fg(0)2055 2152 y Fp(=1)2153 2077 y Ft(C)2218 2033 y Fp(\()p Fn(k)2280 2008 y Fg(0)2303 2033 y Fn(l)2324 2008 y Fg(0)2347 2033 y Fp(\))2212 2086 y Fn(a)2413 2077 y Fv(w)n(e)f(ha)n(v)n(e)2752 2036 y Fn(N)6 b Fp(\()p Fn(N)g Fi(\000)p Fp(1\))p 2752 2057 255 4 v 2863 2105 a(2)3052 2077 y Fv(square)451 2243 y(terms,)715 2210 y Fp(1)p 715 2224 34 4 v 715 2271 a(4)758 2243 y Ft(N)j Fv(\()p Ft(N)25 b Fq(\000)16 b Fv(1\)\()p Ft(N)26 b Fq(\000)16 b Fv(2\)\()p Ft(N)25 b Fq(\000)16 b Fv(3\))27 b(terms)f(with)h(four)f (distinct)i(indices)e(and)h Ft(N)9 b Fv(\()p Ft(N)25 b Fq(\000)451 2342 y Fv(1\)\()p Ft(N)30 b Fq(\000)20 b Fv(2\))30 b(terms)h(where)f(t)n(w)n(o)g(of)g(the)h(four)g(indices)f (agree)g(\(while)h(the)g(other)f(t)n(w)n(o)g(are)451 2442 y(distinct\).)53 b(F)-7 b(or)32 b(all)h(terms)f(of)h(the)g(last)f (t)n(yp)r(e,)i(the)f(estimate)g(\(B.10\))f(is)h(used)f(whereas)451 2598 y(for)27 b(the)h(other)f(terms)h(w)n(e)f(pro)r(ceed)g(as)g(in)h (the)g(case)e(of)i(\()2311 2519 y Fn(N)2296 2536 y Fm(P)2243 2673 y Fn(k)q(>l)p Fp(=1)2451 2598 y Ft(V)2518 2568 y Fp(\()p Fn(k)q(l)p Fp(\))2632 2598 y Fv(\))2664 2568 y Fp(2)2701 2598 y Ft(:)g Fv(This)g(leads)f(to)703 2939 y Fq(k)826 2836 y Fn(N)795 2861 y Fm(X)759 3039 y Fn(k)q(>l)p Fp(=1)966 2939 y Ft(C)1031 2905 y Fp(\()p Fn(k)q(l)p Fp(\))1025 2960 y Fn(a)1146 2939 y Ft( )1200 2951 y Fp(+)1255 2939 y Fq(k)1297 2905 y Fp(2)1380 2939 y Fq(\024)47 b Fv(~)-44 b Ft(c)1526 2951 y Fn(s)1580 2939 y Fq(\001)19 b Fv(max)o Fq(f)1828 2883 y Ft(N)27 b Fq(\000)18 b Fv(1)p 1828 2920 219 4 v 1916 2996 a(2)2056 2939 y Ft(;)2103 2883 y Fv(\()p Ft(N)28 b Fq(\000)18 b Fv(2\)\()p Ft(N)27 b Fq(\000)18 b Fv(3\))p 2103 2920 567 4 v 2366 2996 a(4)2680 2939 y Fq(g)k(k)p Ft(T)12 b( )2901 2951 y Fp(+)2955 2939 y Fq(k)2997 2905 y Fp(2)1326 3242 y Fv(+)25 b(~)-44 b Ft(c)1450 3254 y Fn(s)1508 3242 y Fv(\()p Ft(N)28 b Fq(\000)18 b Fv(1\)\()p Ft(N)27 b Fq(\000)18 b Fv(2\))23 b Fq(k)p Ft(T)12 b( )2255 3254 y Fp(+)2309 3242 y Fq(k)2351 3208 y Fp(2)2388 3242 y Ft(:)645 b Fv(\(B.11\))451 3408 y(Inserting)27 b(our)g(results)g(in)n(to)g(\(B.3\))h(w)n(e)f(\014nd)h Fq(k)p Ft(W)12 b( )2070 3420 y Fp(+)2125 3408 y Fq(k)22 b(\024)h Ft(c)2313 3420 y Fp(0)2350 3408 y Fq(k)p Ft(T)12 b( )2507 3420 y Fp(+)2561 3408 y Fq(k)27 b Fv(with)913 3672 y Ft(c)949 3684 y Fp(0)1009 3672 y Fv(:=)1143 3615 y Fq(p)p 1212 3615 90 4 v 57 x Ft(c)1248 3684 y Fn(w)1343 3672 y Fv(+)1449 3538 y Fm(r)p 1532 3538 1292 4 v 134 x Ft(c)1568 3684 y Fn(v)1626 3672 y Fq(\001)19 b Fv(max)o Fq(f)1874 3616 y Ft(N)27 b Fq(\000)18 b Fv(1)p 1874 3653 219 4 v 1962 3729 a(2)2102 3672 y Ft(;)2149 3616 y Fv(1)p 2149 3653 42 4 v 2149 3729 a(2)2215 3672 y([)2248 3616 y Ft(N)9 b Fv(\()p Ft(N)27 b Fq(\000)18 b Fv(1\))p 2248 3653 360 4 v 2406 3729 a(2)2635 3672 y Fq(\000)g Fv(1])p Fq(g)231 b Fv(\(B.12\))767 3993 y(+)22 b(4)919 3918 y Fm(p)p 1002 3918 72 4 v 1004 3993 a Fv(~)-44 b Ft(c)1038 4005 y Fn(s)1096 3859 y Fm(r)p 1179 3859 1768 4 v 134 x Fv(max)p Fq(f)1386 3937 y Ft(N)27 b Fq(\000)18 b Fv(1)p 1386 3974 219 4 v 1474 4050 a(2)1614 3993 y Ft(;)1661 3937 y Fv(\()p Ft(N)28 b Fq(\000)18 b Fv(2\)\()p Ft(N)27 b Fq(\000)18 b Fv(3\))p 1661 3974 567 4 v 1924 4050 a(4)2238 3993 y Fq(g)g Fv(+)g(\()p Ft(N)27 b Fq(\000)18 b Fv(1\)\()p Ft(N)27 b Fq(\000)18 b Fv(2\))p Ft(:)451 4187 y Fv(F)-7 b(or)33 b Ft(N)41 b Fv(=)32 b Ft(Z)39 b Fv(w)n(e)33 b(get)g Ft(c)1215 4199 y Fp(0)1285 4187 y Ft(<)f Fv(1)h(for)f Ft(\015)37 b(<)32 b Fv(0)p Ft(:)p Fv(285)g(whic)n(h)h(corresp)r(onds)e (to)i Ft(Z)39 b Fq(\024)32 b Fv(39)p Ft(:)65 b Fv(F)-7 b(or)451 4286 y Ft(N)45 b Fv(=)35 b(2)p Ft(;)g Fv(w)n(e)g(need)h Ft(\015)k(<)c Fv(0)p Ft(:)p Fv(66)70 b(\()p Ft(Z)42 b Fq(\024)35 b Fv(90\))g(whic)n(h)g(sligh)n(tly)g(impro)n(v)n(es)f(on)h (our)f(earlier)451 4386 y(estimate)g(\()p Ft(Z)41 b Fq(\024)33 b Fv(89)h([11)o(]\),)i(obtained)e(b)n(y)h(using)e(\(B.10\)-t)n(yp)r(e)h (estimates)g(for)g(all)g(t)n(w)n(o-)451 4485 y(particle)27 b(in)n(teraction)g(cross)f(terms.)451 4739 y Fs(A)n(ckno)n(wledgment) 451 4931 y Fv(I)g(w)n(ould)f(lik)n(e)g(to)g(thank)g(A.)h(Sob)r(olev,)f (H.)h(Sieden)n(top)f(and)h(S.)f(Morozo)n(v)e(for)i(stim)n(ulating)451 5031 y(discussions)c(and)g(critical)g(commen)n(ts.)34 b(P)n(artial)20 b(supp)r(ort)h(b)n(y)g(the)h(EU)f(net)n(w)n(ork)f (Analysis)451 5130 y(and)28 b(Quan)n(tum)f(\(con)n(tract)g (HPRN-CT-2002-00277\))22 b(is)28 b(gratefully)f(ac)n(kno)n(wledged.) 1108 5338 y Fw(Document)l(a)e(Ma)l(thema)l(tica)h(10)f(\(2005\))g (497{525)p eop %%Page: 524 28 524 27 bop 451 518 a Fv(524)727 b Fs(D.)30 b(H.)h(Jakubassa-Amundsen) 451 725 y(References)493 913 y Fv([1])41 b(Abramo)n(witz)33 b(M.)h(and)f(Stegun)h(I.)g(A.:)49 b Fh(Handb)l(o)l(ok)37 b(of)f(Mathematic)l(al)h(F)-6 b(unctions)622 1012 y(with)33 b(F)-6 b(ormulas,)33 b(Gr)l(aphs)h(and)e(Mathematic)l(al)i(T)-6 b(ables)p Fv(.)32 b(New)e(Y)-7 b(ork,)31 b(Do)n(v)n(er)d(Pub-)622 1112 y(lications,)f(1965)493 1290 y([2])41 b(Bro)n(wn)32 b(G.)h(E.)g(and)g(Ra)n(v)n(enhall)f(D.)i(G.:)49 b(On)33 b(the)h(in)n(teraction)e(of)h(t)n(w)n(o)g(electrons.)622 1390 y Fh(Pr)l(o)l(c.)d(R)l(oy.)h(So)l(c.)f(L)l(ondon)e Fs(A208)p Fv(,)f(552-559)d(\(1951\))493 1568 y([3])41 b(Brummelh)n(uis)28 b(R.,)i(Sieden)n(top)f(H.)g(and)g(Sto)r(c)n(kmey)n (er)f(E.:)39 b(The)29 b(ground-state)e(en-)622 1667 y(ergy)d(of)h (relativistic)g(one-electron)e(atoms)i(according)f(to)h(Jansen)f(and)h (Hess.)g Fh(Do)l(c.)622 1767 y(Math.)k Fs(7)p Fv(,)e(167-182)e (\(2002\))493 1945 y([4])41 b(Burenk)n(o)n(v)32 b(V.)i(I.)g(and)f(Ev)-5 b(ans)33 b(W.)i(D.:)49 b(On)34 b(the)g(ev)-5 b(aluation)33 b(of)h(the)g(norm)f(of)h(an)622 2045 y(in)n(tegral)22 b(op)r(erator)f(asso)r(ciated)h(with)h(the)g(stabilit)n(y)g(of)g (one-electron)f(atoms.)g Fh(Pr)l(o)l(c.)622 2144 y(R)l(oy.)30 b(So)l(c.)g(\(Edinbur)l(gh\))f(128A)p Fv(,)g(993-1005)24 b(\(1998\))493 2323 y([5])41 b(Cycon)27 b(H.)h(L.,)g(F)-7 b(ro)r(ese)27 b(R.)h(G.,)h(Kirsc)n(h)d(W.)i(and)g(Simon)g(B.:)37 b Fh(Schr\177)-42 b(odinger)32 b(Op)l(er)l(a-)622 2422 y(tors)g(with)g(Applic)l(ation)h(to)f(Quantum)e(Me)l(chanics)k(and)e (Glob)l(al)h(Ge)l(ometry)p Fv(.)e(T)-7 b(ext)622 2522 y(and)27 b(Monographs)f(in)i(Ph)n(ysics,)e(1st)h(Edition.)h(Berlin,)f (Springer-V)-7 b(erlag,)25 b(1987)493 2700 y([6])41 b(Douglas)33 b(M.)i(and)f(Kroll)f(N.)h(M.:)51 b(Quan)n(tum)34 b(electro)r(dynamical) f(corrections)f(to)622 2800 y(the)c(\014ne)g(structure)f(of)g(helium.)h Fh(A)n(nn.)i(Phys.)h(\(N.)f(Y.\))d Fs(82)p Fv(,)h(89-155)d(\(1974\))493 2978 y([7])41 b(Ev)-5 b(ans)22 b(W.)h(D.,)h(P)n(erry)c(P)-7 b(.)22 b(and)h(Sieden)n(top)f(H.:)35 b(The)23 b(sp)r(ectrum)f(of)h (relativistic)f(one-)622 3077 y(electron)33 b(atoms)g(according)g(to)h (Bethe)g(and)g(Salp)r(eter.)f Fh(Commun.)j(Math.)h(Phys.)622 3177 y Fs(178)p Fv(,)27 b(733-746)e(\(1996\))493 3364 y([8])41 b(I.)19 b(W.)h(Herbst,)h(Sp)r(ectral)e(theory)g(of)g(the)h(op) r(erator)d(\()p Ft(p)2300 3334 y Fp(2)2340 3364 y Fv(+)r Ft(m)2480 3334 y Fp(2)2516 3364 y Fv(\))2558 3311 y Ff(1)p 2558 3320 29 3 v 2558 3354 a(2)2603 3364 y Fq(\000)r Ft(Z)6 b(e)2772 3334 y Fp(2)2808 3364 y Ft(=r)r Fv(.)20 b Fh(Commun.)622 3463 y(Math.)31 b(Phys.)e Fs(53)p Fv(,)f(285-294)c (\(1977\).)493 3642 y([9])41 b(Ho)r(ev)n(er)30 b(G.)i(and)g(Sieden)n (top)f(S.:)46 b(Stabilit)n(y)31 b(of)h(the)g(Bro)n(wn-Ra)n(v)n(enhall)d (op)r(erator.)622 3741 y Fh(Math.)i(Phys.)g(Ele)l(ctr)l(on.)f(J.)e Fs(5)p Fv(\(6\),)g(1-11)e(\(1999\))451 3919 y([10])41 b(Hunzik)n(er)30 b(W.:)43 b(On)30 b(the)h(sp)r(ectra)f(of)g(Sc)n (hr\177)-42 b(odinger)29 b(m)n(ultiparticle)h(Hamiltonians.)622 4019 y Fh(Helv.)g(Phys.)h(A)l(cta)d Fs(39)p Fv(,)f(451-462)e(\(1966\)) 451 4197 y([11])41 b(Jakuba\031a-Am)n(undsen)24 b(D.)k(H.:)37 b(Sp)r(ectral)26 b(theory)g(of)h(the)g(atomic)f(Dirac)h(op)r(erator)622 4297 y(in)h(the)g(no-pair)e(formalism.)h(Ph.)g(D.)h(thesis,)g(Univ)n (ersit)n(y)f(of)g(Munic)n(h)h(\(2004\))451 4475 y([12])41 b(Jakuba\031a-Am)n(undsen)28 b(D.)i(H.:)43 b(The)30 b(pro)5 b(jected)29 b(single-particle)g(Dirac)h(op)r(erator)622 4575 y(for)d(Coulom)n(bic)g(p)r(oten)n(tials.)g Fh(Do)l(c.)j(Math.)f Fs(10)p Fv(,)f(331-356)c(\(2005\))451 4753 y([13])41 b(Jakuba\031a-Am)n(undsen)22 b(D.)j(H.:)35 b(Pseudorelativistic)23 b(op)r(erator)f(for)i(a)g(t)n(w)n(o-electron)622 4852 y(ion.)j Fh(Phys.)k(R)l(ev.)d Fs(A71)p Fv(,)f(032105,)e(1-8)i(\(2005\)) 451 5031 y([14])41 b(Jakuba\031a-Am)n(undsen)33 b(D.)j(H.:)53 b(The)35 b(HVZ)h(theorem)f(for)f(a)h(pseudo-relativistic)622 5130 y(op)r(erator.)26 b(Submitted)j(to)e Fh(A)n(nn.)i(Henri)h(Poinc)l (ar)n(\023)-40 b(e)29 b Fv(\(2005\))1108 5338 y Fw(Document)l(a)c(Ma)l (thema)l(tica)h(10)f(\(2005\))g(497{525)p eop %%Page: 525 29 525 28 bop 1301 518 a Ft(N)9 b Fs(-Electr)n(on)31 b(HVZ)f(Theorem)726 b Fv(525)451 725 y([15])41 b(Kato)h(T.:)69 b Fh(Perturb)l(ation)44 b(The)l(ory)i(for)f(Line)l(ar)g(Op)l(er)l(ators)p Fv(.)e(Berlin,)k (Springer-)622 825 y(V)-7 b(erlag,)26 b(1980)451 991 y([16])41 b(Lewis)d(R.)h(T.,)i(Sieden)n(top)e(H.)g(and)f(V)-7 b(ugalter)38 b(S.:)59 b(The)39 b(essen)n(tial)e(sp)r(ectrum)i(of)622 1090 y(relativistic)26 b(m)n(ulti-particle)h(op)r(erators.)e Fh(A)n(nn.)j(Inst.)h(Henri)h(Poinc)l(ar)n(\023)-40 b(e)28 b Fs(67)p Fv(,)f(No.)g(1,)622 1190 y(1-28)f(\(1997\))451 1356 y([17])41 b(Lieb)f(E.)f(H.)h(and)g(Y)-7 b(au)40 b(H.-T.:)61 b(The)40 b(stabilit)n(y)g(and)f(instabilit)n(y)h(of)g (relativistic)622 1456 y(matter.)27 b Fh(Commun.)j(Math.)h(Phys.)e Fs(118)p Fv(,)f(177-213)c(\(1988\))451 1622 y([18])41 b(Morozo)n(v)31 b(S.)i(and)g(V)-7 b(ugalter)33 b(S.:)48 b(Stabilit)n(y)33 b(of)g(atoms)g(in)g(the)h(Bro)n(wn-Ra)n(v)n(enhall) 622 1721 y(mo)r(del.)28 b(arXiv:math-ph/0511033)23 b(\(2005\))451 1887 y([19])41 b(Murra)n(y)26 b(J.)h(D.:)37 b Fh(Asymptotic)30 b(A)n(nalysis)p Fv(.)f(Oxford,)d(Clarendon)h(Press,)f(1974,)f Fq(x)p Fv(2,)i(5)451 2053 y([20])41 b(Reed)e(M.)g(and)f(Simon)h(B.:)60 b Fh(A)n(nalysis)40 b(of)h(Op)l(er)l(ators)p Fv(.)e(V)-7 b(ol.)39 b(IV)g(of)g(Metho)r(ds)g(of)622 2153 y(Mo)r(dern)27 b(Mathematical)g(Ph)n(ysics.)g(New)g(Y)-7 b(ork,)27 b(Academic)h (Press,)e(1978)451 2319 y([21])41 b(Sieden)n(top)21 b(H.)h(and)f(Sto)r (c)n(kmey)n(er)f(E.:)33 b(An)22 b(analytic)e(Douglas-Kroll-Hess)e (metho)r(d.)622 2419 y Fh(Phys.)31 b(L)l(ett.)c Fs(A341)g Fv(473-478)e(\(2005\))451 2585 y([22])41 b(Simon)34 b(B.:)51 b(Geometric)34 b(metho)r(ds)h(in)g(m)n(ultiparticle)f(quan)n(tum)g (systems.)g Fh(Com-)622 2684 y(mun.)29 b(Math.)i(Phys.)e Fs(55)p Fv(,)f(259-274)c(\(1977\))451 2850 y([23])41 b(Suc)n(her)28 b(J.:)40 b(F)-7 b(oundations)28 b(of)h(the)h (relativistic)e(theory)g(of)h(man)n(y-electron)f(atoms.)622 2950 y Fh(Phys.)j(R)l(ev.)d Fs(A22)p Fv(,)f(348-362)d(\(1980\))451 3116 y([24])41 b(T)-7 b(esc)n(hl)27 b(G.:)37 b(Lecture)27 b(Notes)h(on)f Fh(Schr\177)-42 b(odinger)31 b(Op)l(er)l(ators)p Fv(.)d(Section)g(9.4,)f(2004.)622 3249 y(h)n (ttp://www.mat.univie.ac.at/~gerald/ftp/index.h)n(tml)451 3415 y([25])41 b(Tix)32 b(C.:)47 b(Strict)33 b(p)r(ositivit)n(y)g(of)f (a)g(relativistic)g(Hamiltonian)h(due)f(to)h(Bro)n(wn)e(and)622 3515 y(Ra)n(v)n(enhall.)26 b Fh(Bul)t(l.)31 b(L)l(ondon)f(Math.)h(So)l (c.)d Fs(30)p Fv(,)g(283-290)c(\(1998\))451 3681 y([26])41 b(v)-5 b(an)22 b(Win)n(ter)g(C.:)34 b(Theory)21 b(of)h(\014nite)h (systems)f(of)g(particles)f(I.)h(The)g(Green)g(function.)622 3780 y Fh(Mat.)30 b(Fys.)h(Dan.)f(Vid.)h(Selsk.)d Fs(2)g Fv(No.)f(8,)g(1-60)f(\(1964\))451 3946 y([27])41 b(W)-7 b(olf)27 b(A.,)g(Reiher)f(M.)h(and)g(Hess)f(B.)g(A.:)37 b(The)27 b(generalized)e(Douglas-Kroll)f(trans-)622 4046 y(formation.)j Fh(J.)i(Chem.)i(Phys.)f Fs(117)p Fv(,)d(9215-9226)c (\(2002\))451 4212 y([28])41 b(Zhislin)28 b(G.)g(M.:)37 b(A)28 b(study)g(of)g(the)g(sp)r(ectrum)f(of)h(the)g(Sc)n(hr\177)-42 b(odinger)26 b(op)r(erator)g(for)h(a)622 4312 y(system)g(of)h(sev)n (eral)e(particles.)g Fh(T)-6 b(rudy)30 b(Moskov.)i(Mat.)f(Obsc.)d Fs(9)p Fv(,)g(81-120)d(\(1960\))1243 4502 y(D.)j(H.)g(Jakubassa-Am)n (undsen)1243 4601 y(Mathematics)f(Institute)1243 4701 y(Univ)n(ersit)n(y)f(of)i(Munic)n(h)1243 4800 y(Theresienstr.)35 b(39)1243 4900 y(80333)25 b(Munic)n(h)1243 5000 y(German)n(y)1243 5099 y(dj@mathematik.uni-m)n(uenc)n(hen.de)1108 5338 y Fw(Document)l(a)g(Ma)l(thema)l(tica)h(10)f(\(2005\))g(497{525)p eop %%Page: 526 30 526 29 bop 451 518 a Fv(526)1255 5338 y Fw(Document)l(a)26 b(Ma)l(thema)l(tica)g(10)f(\(2005\))p eop %%Trailer end userdict /end-hook known{end-hook}if %%EOF